From beb7c6ec357e77eb71930fb213a6c90e5b992231 Mon Sep 17 00:00:00 2001 From: csxiaoyao <1724338257@qq.com> Date: Wed, 21 Jun 2017 03:21:52 +0800 Subject: [PATCH] nodejs init --- 8 node/.idea/8 node.iml | 12 + 8 node/.idea/misc.xml | 20 + 8 node/.idea/modules.xml | 8 + 8 node/.idea/workspace.xml | 272 + ...36\350\260\203\345\207\275\346\225\260.js" | 28 + ...13\344\273\266\345\276\252\347\216\257.js" | 137 + 8 node/03-buffer.js | 174 + 8 node/04-stream.js | 91 + 8 node/05-hello.js | 21 + ...41\345\235\227\347\263\273\347\273\237.js" | 74 + "8 node/06-\345\207\275\346\225\260.js" | 29 + "8 node/07-\350\267\257\347\224\261.js" | 0 8 node/README.md | 0 8 node/input.txt | 1 + 8 node/node_modules/.bin/mime | 1 + 8 node/node_modules/accepts/HISTORY.md | 212 + 8 node/node_modules/accepts/LICENSE | 23 + 8 node/node_modules/accepts/README.md | 135 + 8 node/node_modules/accepts/index.js | 231 + 8 node/node_modules/accepts/package.json | 77 + 8 node/node_modules/array-flatten/LICENSE | 21 + 8 node/node_modules/array-flatten/README.md | 43 + .../array-flatten/array-flatten.js | 64 + .../node_modules/array-flatten/package.json | 64 + .../content-disposition/HISTORY.md | 50 + .../node_modules/content-disposition/LICENSE | 22 + .../content-disposition/README.md | 141 + .../node_modules/content-disposition/index.js | 445 ++ .../content-disposition/package.json | 74 + 8 node/node_modules/content-type/HISTORY.md | 14 + 8 node/node_modules/content-type/LICENSE | 22 + 8 node/node_modules/content-type/README.md | 92 + 8 node/node_modules/content-type/index.js | 216 + 8 node/node_modules/content-type/package.json | 68 + .../node_modules/cookie-signature/.npmignore | 4 + .../node_modules/cookie-signature/History.md | 38 + .../node_modules/cookie-signature/Readme.md | 42 + 8 node/node_modules/cookie-signature/index.js | 51 + .../cookie-signature/package.json | 57 + 8 node/node_modules/cookie/HISTORY.md | 118 + 8 node/node_modules/cookie/LICENSE | 24 + 8 node/node_modules/cookie/README.md | 220 + 8 node/node_modules/cookie/index.js | 195 + 8 node/node_modules/cookie/package.json | 71 + 8 node/node_modules/debug/.coveralls.yml | 1 + 8 node/node_modules/debug/.eslintrc | 11 + 8 node/node_modules/debug/.npmignore | 9 + 8 node/node_modules/debug/.travis.yml | 14 + 8 node/node_modules/debug/CHANGELOG.md | 352 + 8 node/node_modules/debug/LICENSE | 19 + 8 node/node_modules/debug/Makefile | 50 + 8 node/node_modules/debug/README.md | 312 + 8 node/node_modules/debug/component.json | 19 + 8 node/node_modules/debug/karma.conf.js | 70 + 8 node/node_modules/debug/node.js | 1 + 8 node/node_modules/debug/package.json | 90 + 8 node/node_modules/debug/src/browser.js | 185 + 8 node/node_modules/debug/src/debug.js | 202 + 8 node/node_modules/debug/src/index.js | 10 + 8 node/node_modules/debug/src/node.js | 246 + 8 node/node_modules/depd/History.md | 84 + 8 node/node_modules/depd/LICENSE | 22 + 8 node/node_modules/depd/Readme.md | 281 + 8 node/node_modules/depd/index.js | 521 ++ 8 node/node_modules/depd/lib/browser/index.js | 79 + .../depd/lib/compat/buffer-concat.js | 35 + .../depd/lib/compat/callsite-tostring.js | 103 + .../depd/lib/compat/event-listener-count.js | 22 + 8 node/node_modules/depd/lib/compat/index.js | 84 + 8 node/node_modules/depd/package.json | 72 + 8 node/node_modules/destroy/LICENSE | 22 + 8 node/node_modules/destroy/README.md | 60 + 8 node/node_modules/destroy/index.js | 75 + 8 node/node_modules/destroy/package.json | 71 + 8 node/node_modules/ee-first/LICENSE | 22 + 8 node/node_modules/ee-first/README.md | 80 + 8 node/node_modules/ee-first/index.js | 95 + 8 node/node_modules/ee-first/package.json | 63 + 8 node/node_modules/encodeurl/HISTORY.md | 9 + 8 node/node_modules/encodeurl/LICENSE | 22 + 8 node/node_modules/encodeurl/README.md | 124 + 8 node/node_modules/encodeurl/index.js | 60 + 8 node/node_modules/encodeurl/package.json | 76 + 8 node/node_modules/escape-html/LICENSE | 24 + 8 node/node_modules/escape-html/Readme.md | 43 + 8 node/node_modules/escape-html/index.js | 78 + 8 node/node_modules/escape-html/package.json | 59 + 8 node/node_modules/etag/HISTORY.md | 78 + 8 node/node_modules/etag/LICENSE | 22 + 8 node/node_modules/etag/README.md | 159 + 8 node/node_modules/etag/index.js | 132 + 8 node/node_modules/etag/package.json | 83 + 8 node/node_modules/express/History.md | 3270 ++++++++ 8 node/node_modules/express/LICENSE | 24 + 8 node/node_modules/express/Readme.md | 141 + 8 node/node_modules/express/index.js | 11 + .../node_modules/express/lib/application.js | 644 ++ 8 node/node_modules/express/lib/express.js | 111 + .../express/lib/middleware/init.js | 43 + .../express/lib/middleware/query.js | 46 + 8 node/node_modules/express/lib/request.js | 517 ++ 8 node/node_modules/express/lib/response.js | 1076 +++ .../node_modules/express/lib/router/index.js | 662 ++ .../node_modules/express/lib/router/layer.js | 181 + .../node_modules/express/lib/router/route.js | 216 + 8 node/node_modules/express/lib/utils.js | 299 + 8 node/node_modules/express/lib/view.js | 175 + 8 node/node_modules/express/package.json | 151 + 8 node/node_modules/finalhandler/HISTORY.md | 150 + 8 node/node_modules/finalhandler/LICENSE | 22 + 8 node/node_modules/finalhandler/README.md | 146 + 8 node/node_modules/finalhandler/index.js | 300 + 8 node/node_modules/finalhandler/package.json | 80 + 8 node/node_modules/forwarded/HISTORY.md | 4 + 8 node/node_modules/forwarded/LICENSE | 22 + 8 node/node_modules/forwarded/README.md | 53 + 8 node/node_modules/forwarded/index.js | 35 + 8 node/node_modules/forwarded/package.json | 68 + 8 node/node_modules/fresh/HISTORY.md | 58 + 8 node/node_modules/fresh/LICENSE | 23 + 8 node/node_modules/fresh/README.md | 113 + 8 node/node_modules/fresh/index.js | 81 + 8 node/node_modules/fresh/package.json | 84 + 8 node/node_modules/http-errors/HISTORY.md | 118 + 8 node/node_modules/http-errors/LICENSE | 23 + 8 node/node_modules/http-errors/README.md | 135 + 8 node/node_modules/http-errors/index.js | 260 + 8 node/node_modules/http-errors/package.json | 88 + 8 node/node_modules/inherits/LICENSE | 16 + 8 node/node_modules/inherits/README.md | 42 + 8 node/node_modules/inherits/inherits.js | 7 + .../node_modules/inherits/inherits_browser.js | 23 + 8 node/node_modules/inherits/package.json | 61 + 8 node/node_modules/ipaddr.js/.npmignore | 2 + 8 node/node_modules/ipaddr.js/.travis.yml | 10 + 8 node/node_modules/ipaddr.js/Cakefile | 18 + 8 node/node_modules/ipaddr.js/LICENSE | 19 + 8 node/node_modules/ipaddr.js/README.md | 211 + 8 node/node_modules/ipaddr.js/bower.json | 29 + 8 node/node_modules/ipaddr.js/ipaddr.min.js | 1 + 8 node/node_modules/ipaddr.js/lib/ipaddr.js | 535 ++ 8 node/node_modules/ipaddr.js/package.json | 64 + .../node_modules/ipaddr.js/src/ipaddr.coffee | 460 ++ .../ipaddr.js/test/ipaddr.test.coffee | 346 + 8 node/node_modules/media-typer/HISTORY.md | 22 + 8 node/node_modules/media-typer/LICENSE | 22 + 8 node/node_modules/media-typer/README.md | 81 + 8 node/node_modules/media-typer/index.js | 270 + 8 node/node_modules/media-typer/package.json | 61 + .../node_modules/merge-descriptors/HISTORY.md | 21 + 8 node/node_modules/merge-descriptors/LICENSE | 23 + .../node_modules/merge-descriptors/README.md | 48 + .../node_modules/merge-descriptors/index.js | 60 + .../merge-descriptors/package.json | 69 + 8 node/node_modules/methods/HISTORY.md | 29 + 8 node/node_modules/methods/LICENSE | 24 + 8 node/node_modules/methods/README.md | 51 + 8 node/node_modules/methods/index.js | 69 + 8 node/node_modules/methods/package.json | 79 + 8 node/node_modules/mime-db/HISTORY.md | 412 + 8 node/node_modules/mime-db/LICENSE | 22 + 8 node/node_modules/mime-db/README.md | 82 + 8 node/node_modules/mime-db/db.json | 6805 +++++++++++++++++ 8 node/node_modules/mime-db/index.js | 11 + 8 node/node_modules/mime-db/package.json | 98 + 8 node/node_modules/mime-types/HISTORY.md | 223 + 8 node/node_modules/mime-types/LICENSE | 23 + 8 node/node_modules/mime-types/README.md | 108 + 8 node/node_modules/mime-types/index.js | 188 + 8 node/node_modules/mime-types/package.json | 85 + 8 node/node_modules/mime/.npmignore | 0 8 node/node_modules/mime/LICENSE | 19 + 8 node/node_modules/mime/README.md | 90 + 8 node/node_modules/mime/build/build.js | 11 + 8 node/node_modules/mime/build/test.js | 57 + 8 node/node_modules/mime/cli.js | 8 + 8 node/node_modules/mime/mime.js | 108 + 8 node/node_modules/mime/package.json | 72 + 8 node/node_modules/mime/types.json | 1 + 8 node/node_modules/ms/index.js | 152 + 8 node/node_modules/ms/license.md | 21 + 8 node/node_modules/ms/package.json | 70 + 8 node/node_modules/ms/readme.md | 51 + 8 node/node_modules/negotiator/HISTORY.md | 98 + 8 node/node_modules/negotiator/LICENSE | 24 + 8 node/node_modules/negotiator/README.md | 203 + 8 node/node_modules/negotiator/index.js | 124 + 8 node/node_modules/negotiator/lib/charset.js | 169 + .../node_modules/negotiator/lib/encoding.js | 184 + .../node_modules/negotiator/lib/language.js | 179 + .../node_modules/negotiator/lib/mediaType.js | 294 + 8 node/node_modules/negotiator/package.json | 81 + 8 node/node_modules/on-finished/HISTORY.md | 88 + 8 node/node_modules/on-finished/LICENSE | 23 + 8 node/node_modules/on-finished/README.md | 154 + 8 node/node_modules/on-finished/index.js | 196 + 8 node/node_modules/on-finished/package.json | 72 + 8 node/node_modules/parseurl/HISTORY.md | 47 + 8 node/node_modules/parseurl/LICENSE | 24 + 8 node/node_modules/parseurl/README.md | 120 + 8 node/node_modules/parseurl/index.js | 138 + 8 node/node_modules/parseurl/package.json | 74 + 8 node/node_modules/path-to-regexp/History.md | 36 + 8 node/node_modules/path-to-regexp/LICENSE | 21 + 8 node/node_modules/path-to-regexp/Readme.md | 35 + 8 node/node_modules/path-to-regexp/index.js | 129 + .../node_modules/path-to-regexp/package.json | 59 + 8 node/node_modules/proxy-addr/HISTORY.md | 109 + 8 node/node_modules/proxy-addr/LICENSE | 22 + 8 node/node_modules/proxy-addr/README.md | 140 + 8 node/node_modules/proxy-addr/index.js | 325 + 8 node/node_modules/proxy-addr/package.json | 73 + 8 node/node_modules/qs/.eslintignore | 1 + 8 node/node_modules/qs/.eslintrc | 18 + 8 node/node_modules/qs/.jscs.json | 176 + 8 node/node_modules/qs/CHANGELOG.md | 175 + 8 node/node_modules/qs/LICENSE | 28 + 8 node/node_modules/qs/README.md | 440 ++ 8 node/node_modules/qs/dist/qs.js | 597 ++ 8 node/node_modules/qs/lib/formats.js | 18 + 8 node/node_modules/qs/lib/index.js | 11 + 8 node/node_modules/qs/lib/parse.js | 167 + 8 node/node_modules/qs/lib/stringify.js | 207 + 8 node/node_modules/qs/lib/utils.js | 182 + 8 node/node_modules/qs/package.json | 78 + 8 node/node_modules/qs/test/.eslintrc | 11 + 8 node/node_modules/qs/test/index.js | 7 + 8 node/node_modules/qs/test/parse.js | 519 ++ 8 node/node_modules/qs/test/stringify.js | 567 ++ 8 node/node_modules/qs/test/utils.js | 22 + 8 node/node_modules/range-parser/HISTORY.md | 51 + 8 node/node_modules/range-parser/LICENSE | 23 + 8 node/node_modules/range-parser/README.md | 75 + 8 node/node_modules/range-parser/index.js | 158 + 8 node/node_modules/range-parser/package.json | 87 + 8 node/node_modules/send/HISTORY.md | 411 + 8 node/node_modules/send/LICENSE | 23 + 8 node/node_modules/send/README.md | 301 + 8 node/node_modules/send/index.js | 1074 +++ 8 node/node_modules/send/package.json | 104 + 8 node/node_modules/serve-static/HISTORY.md | 377 + 8 node/node_modules/serve-static/LICENSE | 25 + 8 node/node_modules/serve-static/README.md | 253 + 8 node/node_modules/serve-static/index.js | 209 + 8 node/node_modules/serve-static/package.json | 75 + 8 node/node_modules/setprototypeof/LICENSE | 13 + 8 node/node_modules/setprototypeof/README.md | 21 + 8 node/node_modules/setprototypeof/index.js | 15 + .../node_modules/setprototypeof/package.json | 52 + 8 node/node_modules/statuses/HISTORY.md | 55 + 8 node/node_modules/statuses/LICENSE | 23 + 8 node/node_modules/statuses/README.md | 103 + 8 node/node_modules/statuses/codes.json | 65 + 8 node/node_modules/statuses/index.js | 110 + 8 node/node_modules/statuses/package.json | 86 + 8 node/node_modules/type-is/HISTORY.md | 218 + 8 node/node_modules/type-is/LICENSE | 23 + 8 node/node_modules/type-is/README.md | 146 + 8 node/node_modules/type-is/index.js | 262 + 8 node/node_modules/type-is/package.json | 82 + 8 node/node_modules/unpipe/HISTORY.md | 4 + 8 node/node_modules/unpipe/LICENSE | 22 + 8 node/node_modules/unpipe/README.md | 43 + 8 node/node_modules/unpipe/index.js | 69 + 8 node/node_modules/unpipe/package.json | 62 + 8 node/node_modules/utils-merge/.travis.yml | 6 + 8 node/node_modules/utils-merge/LICENSE | 20 + 8 node/node_modules/utils-merge/README.md | 34 + 8 node/node_modules/utils-merge/index.js | 23 + 8 node/node_modules/utils-merge/package.json | 64 + 8 node/node_modules/vary/HISTORY.md | 34 + 8 node/node_modules/vary/LICENSE | 22 + 8 node/node_modules/vary/README.md | 101 + 8 node/node_modules/vary/index.js | 131 + 8 node/node_modules/vary/package.json | 73 + 8 node/output.txt | 1 + 8 node/package-lock.json | 215 + 277 files changed, 40882 insertions(+) create mode 100644 8 node/.idea/8 node.iml create mode 100644 8 node/.idea/misc.xml create mode 100644 8 node/.idea/modules.xml create mode 100644 8 node/.idea/workspace.xml create mode 100644 "8 node/01-\345\233\236\350\260\203\345\207\275\346\225\260.js" create mode 100644 "8 node/02-\344\272\213\344\273\266\345\276\252\347\216\257.js" create mode 100644 8 node/03-buffer.js create mode 100644 8 node/04-stream.js create mode 100644 8 node/05-hello.js create mode 100644 "8 node/05-\346\250\241\345\235\227\347\263\273\347\273\237.js" create mode 100644 "8 node/06-\345\207\275\346\225\260.js" create mode 100644 "8 node/07-\350\267\257\347\224\261.js" create mode 100644 8 node/README.md create mode 100644 8 node/input.txt create mode 120000 8 node/node_modules/.bin/mime create mode 100644 8 node/node_modules/accepts/HISTORY.md create mode 100644 8 node/node_modules/accepts/LICENSE create mode 100644 8 node/node_modules/accepts/README.md create mode 100644 8 node/node_modules/accepts/index.js create mode 100644 8 node/node_modules/accepts/package.json create mode 100644 8 node/node_modules/array-flatten/LICENSE create mode 100644 8 node/node_modules/array-flatten/README.md create mode 100644 8 node/node_modules/array-flatten/array-flatten.js create mode 100644 8 node/node_modules/array-flatten/package.json create mode 100644 8 node/node_modules/content-disposition/HISTORY.md create mode 100644 8 node/node_modules/content-disposition/LICENSE create mode 100644 8 node/node_modules/content-disposition/README.md create mode 100644 8 node/node_modules/content-disposition/index.js create mode 100644 8 node/node_modules/content-disposition/package.json create mode 100644 8 node/node_modules/content-type/HISTORY.md create mode 100644 8 node/node_modules/content-type/LICENSE create mode 100644 8 node/node_modules/content-type/README.md create mode 100644 8 node/node_modules/content-type/index.js create mode 100644 8 node/node_modules/content-type/package.json create mode 100644 8 node/node_modules/cookie-signature/.npmignore create mode 100644 8 node/node_modules/cookie-signature/History.md create mode 100644 8 node/node_modules/cookie-signature/Readme.md create mode 100644 8 node/node_modules/cookie-signature/index.js create mode 100644 8 node/node_modules/cookie-signature/package.json create mode 100644 8 node/node_modules/cookie/HISTORY.md create mode 100644 8 node/node_modules/cookie/LICENSE create mode 100644 8 node/node_modules/cookie/README.md create mode 100644 8 node/node_modules/cookie/index.js create mode 100644 8 node/node_modules/cookie/package.json create mode 100644 8 node/node_modules/debug/.coveralls.yml create mode 100644 8 node/node_modules/debug/.eslintrc create mode 100644 8 node/node_modules/debug/.npmignore create mode 100644 8 node/node_modules/debug/.travis.yml create mode 100644 8 node/node_modules/debug/CHANGELOG.md create mode 100644 8 node/node_modules/debug/LICENSE create mode 100644 8 node/node_modules/debug/Makefile create mode 100644 8 node/node_modules/debug/README.md create mode 100644 8 node/node_modules/debug/component.json create mode 100644 8 node/node_modules/debug/karma.conf.js create mode 100644 8 node/node_modules/debug/node.js create mode 100644 8 node/node_modules/debug/package.json create mode 100644 8 node/node_modules/debug/src/browser.js create mode 100644 8 node/node_modules/debug/src/debug.js create mode 100644 8 node/node_modules/debug/src/index.js create mode 100644 8 node/node_modules/debug/src/node.js create mode 100644 8 node/node_modules/depd/History.md create mode 100644 8 node/node_modules/depd/LICENSE create mode 100644 8 node/node_modules/depd/Readme.md create mode 100644 8 node/node_modules/depd/index.js create mode 100644 8 node/node_modules/depd/lib/browser/index.js create mode 100644 8 node/node_modules/depd/lib/compat/buffer-concat.js create mode 100644 8 node/node_modules/depd/lib/compat/callsite-tostring.js create mode 100644 8 node/node_modules/depd/lib/compat/event-listener-count.js create mode 100644 8 node/node_modules/depd/lib/compat/index.js create mode 100644 8 node/node_modules/depd/package.json create mode 100644 8 node/node_modules/destroy/LICENSE create mode 100644 8 node/node_modules/destroy/README.md create mode 100644 8 node/node_modules/destroy/index.js create mode 100644 8 node/node_modules/destroy/package.json create mode 100644 8 node/node_modules/ee-first/LICENSE create mode 100644 8 node/node_modules/ee-first/README.md create mode 100644 8 node/node_modules/ee-first/index.js create mode 100644 8 node/node_modules/ee-first/package.json create mode 100644 8 node/node_modules/encodeurl/HISTORY.md create mode 100644 8 node/node_modules/encodeurl/LICENSE create mode 100644 8 node/node_modules/encodeurl/README.md create mode 100644 8 node/node_modules/encodeurl/index.js create mode 100644 8 node/node_modules/encodeurl/package.json create mode 100644 8 node/node_modules/escape-html/LICENSE create mode 100644 8 node/node_modules/escape-html/Readme.md create mode 100644 8 node/node_modules/escape-html/index.js create mode 100644 8 node/node_modules/escape-html/package.json create mode 100644 8 node/node_modules/etag/HISTORY.md create mode 100644 8 node/node_modules/etag/LICENSE create mode 100644 8 node/node_modules/etag/README.md create mode 100644 8 node/node_modules/etag/index.js create mode 100644 8 node/node_modules/etag/package.json create mode 100644 8 node/node_modules/express/History.md create mode 100644 8 node/node_modules/express/LICENSE create mode 100644 8 node/node_modules/express/Readme.md create mode 100644 8 node/node_modules/express/index.js create mode 100644 8 node/node_modules/express/lib/application.js create mode 100644 8 node/node_modules/express/lib/express.js create mode 100644 8 node/node_modules/express/lib/middleware/init.js create mode 100644 8 node/node_modules/express/lib/middleware/query.js create mode 100644 8 node/node_modules/express/lib/request.js create mode 100644 8 node/node_modules/express/lib/response.js create mode 100644 8 node/node_modules/express/lib/router/index.js create mode 100644 8 node/node_modules/express/lib/router/layer.js create mode 100644 8 node/node_modules/express/lib/router/route.js create mode 100644 8 node/node_modules/express/lib/utils.js create mode 100644 8 node/node_modules/express/lib/view.js create mode 100644 8 node/node_modules/express/package.json create mode 100644 8 node/node_modules/finalhandler/HISTORY.md create mode 100644 8 node/node_modules/finalhandler/LICENSE create mode 100644 8 node/node_modules/finalhandler/README.md create mode 100644 8 node/node_modules/finalhandler/index.js create mode 100644 8 node/node_modules/finalhandler/package.json create mode 100644 8 node/node_modules/forwarded/HISTORY.md create mode 100644 8 node/node_modules/forwarded/LICENSE create mode 100644 8 node/node_modules/forwarded/README.md create mode 100644 8 node/node_modules/forwarded/index.js create mode 100644 8 node/node_modules/forwarded/package.json create mode 100644 8 node/node_modules/fresh/HISTORY.md create mode 100644 8 node/node_modules/fresh/LICENSE create mode 100644 8 node/node_modules/fresh/README.md create mode 100644 8 node/node_modules/fresh/index.js create mode 100644 8 node/node_modules/fresh/package.json create mode 100644 8 node/node_modules/http-errors/HISTORY.md create mode 100644 8 node/node_modules/http-errors/LICENSE create mode 100644 8 node/node_modules/http-errors/README.md create mode 100644 8 node/node_modules/http-errors/index.js create mode 100644 8 node/node_modules/http-errors/package.json create mode 100644 8 node/node_modules/inherits/LICENSE create mode 100644 8 node/node_modules/inherits/README.md create mode 100644 8 node/node_modules/inherits/inherits.js create mode 100644 8 node/node_modules/inherits/inherits_browser.js create mode 100644 8 node/node_modules/inherits/package.json create mode 100644 8 node/node_modules/ipaddr.js/.npmignore create mode 100644 8 node/node_modules/ipaddr.js/.travis.yml create mode 100644 8 node/node_modules/ipaddr.js/Cakefile create mode 100644 8 node/node_modules/ipaddr.js/LICENSE create mode 100644 8 node/node_modules/ipaddr.js/README.md create mode 100644 8 node/node_modules/ipaddr.js/bower.json create mode 100644 8 node/node_modules/ipaddr.js/ipaddr.min.js create mode 100644 8 node/node_modules/ipaddr.js/lib/ipaddr.js create mode 100644 8 node/node_modules/ipaddr.js/package.json create mode 100644 8 node/node_modules/ipaddr.js/src/ipaddr.coffee create mode 100644 8 node/node_modules/ipaddr.js/test/ipaddr.test.coffee create mode 100644 8 node/node_modules/media-typer/HISTORY.md create mode 100644 8 node/node_modules/media-typer/LICENSE create mode 100644 8 node/node_modules/media-typer/README.md create mode 100644 8 node/node_modules/media-typer/index.js create mode 100644 8 node/node_modules/media-typer/package.json create mode 100644 8 node/node_modules/merge-descriptors/HISTORY.md create mode 100644 8 node/node_modules/merge-descriptors/LICENSE create mode 100644 8 node/node_modules/merge-descriptors/README.md create mode 100644 8 node/node_modules/merge-descriptors/index.js create mode 100644 8 node/node_modules/merge-descriptors/package.json create mode 100644 8 node/node_modules/methods/HISTORY.md create mode 100644 8 node/node_modules/methods/LICENSE create mode 100644 8 node/node_modules/methods/README.md create mode 100644 8 node/node_modules/methods/index.js create mode 100644 8 node/node_modules/methods/package.json create mode 100644 8 node/node_modules/mime-db/HISTORY.md create mode 100644 8 node/node_modules/mime-db/LICENSE create mode 100644 8 node/node_modules/mime-db/README.md create mode 100644 8 node/node_modules/mime-db/db.json create mode 100644 8 node/node_modules/mime-db/index.js create mode 100644 8 node/node_modules/mime-db/package.json create mode 100644 8 node/node_modules/mime-types/HISTORY.md create mode 100644 8 node/node_modules/mime-types/LICENSE create mode 100644 8 node/node_modules/mime-types/README.md create mode 100644 8 node/node_modules/mime-types/index.js create mode 100644 8 node/node_modules/mime-types/package.json create mode 100644 8 node/node_modules/mime/.npmignore create mode 100644 8 node/node_modules/mime/LICENSE create mode 100644 8 node/node_modules/mime/README.md create mode 100644 8 node/node_modules/mime/build/build.js create mode 100644 8 node/node_modules/mime/build/test.js create mode 100755 8 node/node_modules/mime/cli.js create mode 100644 8 node/node_modules/mime/mime.js create mode 100644 8 node/node_modules/mime/package.json create mode 100644 8 node/node_modules/mime/types.json create mode 100644 8 node/node_modules/ms/index.js create mode 100644 8 node/node_modules/ms/license.md create mode 100644 8 node/node_modules/ms/package.json create mode 100644 8 node/node_modules/ms/readme.md create mode 100644 8 node/node_modules/negotiator/HISTORY.md create mode 100644 8 node/node_modules/negotiator/LICENSE create mode 100644 8 node/node_modules/negotiator/README.md create mode 100644 8 node/node_modules/negotiator/index.js create mode 100644 8 node/node_modules/negotiator/lib/charset.js create mode 100644 8 node/node_modules/negotiator/lib/encoding.js create mode 100644 8 node/node_modules/negotiator/lib/language.js create mode 100644 8 node/node_modules/negotiator/lib/mediaType.js create mode 100644 8 node/node_modules/negotiator/package.json create mode 100644 8 node/node_modules/on-finished/HISTORY.md create mode 100644 8 node/node_modules/on-finished/LICENSE create mode 100644 8 node/node_modules/on-finished/README.md create mode 100644 8 node/node_modules/on-finished/index.js create mode 100644 8 node/node_modules/on-finished/package.json create mode 100644 8 node/node_modules/parseurl/HISTORY.md create mode 100644 8 node/node_modules/parseurl/LICENSE create mode 100644 8 node/node_modules/parseurl/README.md create mode 100644 8 node/node_modules/parseurl/index.js create mode 100644 8 node/node_modules/parseurl/package.json create mode 100644 8 node/node_modules/path-to-regexp/History.md create mode 100644 8 node/node_modules/path-to-regexp/LICENSE create mode 100644 8 node/node_modules/path-to-regexp/Readme.md create mode 100644 8 node/node_modules/path-to-regexp/index.js create mode 100644 8 node/node_modules/path-to-regexp/package.json create mode 100644 8 node/node_modules/proxy-addr/HISTORY.md create mode 100644 8 node/node_modules/proxy-addr/LICENSE create mode 100644 8 node/node_modules/proxy-addr/README.md create mode 100644 8 node/node_modules/proxy-addr/index.js create mode 100644 8 node/node_modules/proxy-addr/package.json create mode 100644 8 node/node_modules/qs/.eslintignore create mode 100644 8 node/node_modules/qs/.eslintrc create mode 100644 8 node/node_modules/qs/.jscs.json create mode 100644 8 node/node_modules/qs/CHANGELOG.md create mode 100644 8 node/node_modules/qs/LICENSE create mode 100644 8 node/node_modules/qs/README.md create mode 100644 8 node/node_modules/qs/dist/qs.js create mode 100644 8 node/node_modules/qs/lib/formats.js create mode 100644 8 node/node_modules/qs/lib/index.js create mode 100644 8 node/node_modules/qs/lib/parse.js create mode 100644 8 node/node_modules/qs/lib/stringify.js create mode 100644 8 node/node_modules/qs/lib/utils.js create mode 100644 8 node/node_modules/qs/package.json create mode 100644 8 node/node_modules/qs/test/.eslintrc create mode 100644 8 node/node_modules/qs/test/index.js create mode 100644 8 node/node_modules/qs/test/parse.js create mode 100644 8 node/node_modules/qs/test/stringify.js create mode 100644 8 node/node_modules/qs/test/utils.js create mode 100644 8 node/node_modules/range-parser/HISTORY.md create mode 100644 8 node/node_modules/range-parser/LICENSE create mode 100644 8 node/node_modules/range-parser/README.md create mode 100644 8 node/node_modules/range-parser/index.js create mode 100644 8 node/node_modules/range-parser/package.json create mode 100644 8 node/node_modules/send/HISTORY.md create mode 100644 8 node/node_modules/send/LICENSE create mode 100644 8 node/node_modules/send/README.md create mode 100644 8 node/node_modules/send/index.js create mode 100644 8 node/node_modules/send/package.json create mode 100644 8 node/node_modules/serve-static/HISTORY.md create mode 100644 8 node/node_modules/serve-static/LICENSE create mode 100644 8 node/node_modules/serve-static/README.md create mode 100644 8 node/node_modules/serve-static/index.js create mode 100644 8 node/node_modules/serve-static/package.json create mode 100644 8 node/node_modules/setprototypeof/LICENSE create mode 100644 8 node/node_modules/setprototypeof/README.md create mode 100644 8 node/node_modules/setprototypeof/index.js create mode 100644 8 node/node_modules/setprototypeof/package.json create mode 100644 8 node/node_modules/statuses/HISTORY.md create mode 100644 8 node/node_modules/statuses/LICENSE create mode 100644 8 node/node_modules/statuses/README.md create mode 100644 8 node/node_modules/statuses/codes.json create mode 100644 8 node/node_modules/statuses/index.js create mode 100644 8 node/node_modules/statuses/package.json create mode 100644 8 node/node_modules/type-is/HISTORY.md create mode 100644 8 node/node_modules/type-is/LICENSE create mode 100644 8 node/node_modules/type-is/README.md create mode 100644 8 node/node_modules/type-is/index.js create mode 100644 8 node/node_modules/type-is/package.json create mode 100644 8 node/node_modules/unpipe/HISTORY.md create mode 100644 8 node/node_modules/unpipe/LICENSE create mode 100644 8 node/node_modules/unpipe/README.md create mode 100644 8 node/node_modules/unpipe/index.js create mode 100644 8 node/node_modules/unpipe/package.json create mode 100644 8 node/node_modules/utils-merge/.travis.yml create mode 100644 8 node/node_modules/utils-merge/LICENSE create mode 100644 8 node/node_modules/utils-merge/README.md create mode 100644 8 node/node_modules/utils-merge/index.js create mode 100644 8 node/node_modules/utils-merge/package.json create mode 100644 8 node/node_modules/vary/HISTORY.md create mode 100644 8 node/node_modules/vary/LICENSE create mode 100644 8 node/node_modules/vary/README.md create mode 100644 8 node/node_modules/vary/index.js create mode 100644 8 node/node_modules/vary/package.json create mode 100644 8 node/output.txt create mode 100644 8 node/package-lock.json diff --git a/8 node/.idea/8 node.iml b/8 node/.idea/8 node.iml new file mode 100644 index 000000000..24643cc37 --- /dev/null +++ b/8 node/.idea/8 node.iml @@ -0,0 +1,12 @@ + + + + + + + + + + + + \ No newline at end of file diff --git a/8 node/.idea/misc.xml b/8 node/.idea/misc.xml new file mode 100644 index 000000000..dd6656d15 --- /dev/null +++ b/8 node/.idea/misc.xml @@ -0,0 +1,20 @@ + + + + + + + + + + + General + + + XPath + + + + + + \ No newline at end of file diff --git a/8 node/.idea/modules.xml b/8 node/.idea/modules.xml new file mode 100644 index 000000000..8240d7d1e --- /dev/null +++ b/8 node/.idea/modules.xml @@ -0,0 +1,8 @@ + + + + + + + + \ No newline at end of file diff --git a/8 node/.idea/workspace.xml b/8 node/.idea/workspace.xml new file mode 100644 index 000000000..ca9f302b0 --- /dev/null +++ b/8 node/.idea/workspace.xml @@ -0,0 +1,272 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + true + DEFINITION_ORDER + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + project + + + true + + + + DIRECTORY + + false + + + + + + + + + 1497976202495 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git "a/8 node/01-\345\233\236\350\260\203\345\207\275\346\225\260.js" "b/8 node/01-\345\233\236\350\260\203\345\207\275\346\225\260.js" new file mode 100644 index 000000000..c4d09c6e9 --- /dev/null +++ "b/8 node/01-\345\233\236\350\260\203\345\207\275\346\225\260.js" @@ -0,0 +1,28 @@ +/** + * @Author csxiaoyao + * @DateTime 2017-06-20 + * @copyright [copyright] + * @license [license] + * @version [version] + */ + +// 【普通阻塞方式】 +// sunshine studio +// 程序执行结束! +var fs = require("fs"); +var data = fs.readFileSync('input.txt'); +console.log(data.toString()); +console.log("程序执行结束!"); + +// 【回调函数方式】 +// 程序执行结束! +// sunshine studio +var fs = require("fs"); +fs.readFile('input.txt', function (err, data) { + if (err) { + console.log(err.stack); + return; + } + console.log(data.toString()); +}); +console.log("程序执行结束!"); \ No newline at end of file diff --git "a/8 node/02-\344\272\213\344\273\266\345\276\252\347\216\257.js" "b/8 node/02-\344\272\213\344\273\266\345\276\252\347\216\257.js" new file mode 100644 index 000000000..b697772be --- /dev/null +++ "b/8 node/02-\344\272\213\344\273\266\345\276\252\347\216\257.js" @@ -0,0 +1,137 @@ +/** + * @Author csxiaoyao + * @DateTime 2017-06-20 + * @copyright [copyright] + * @license [license] + * @version [version] + */ + +/* +Node.js 是单进程单线程应用程序,但是通过事件和回调支持并发,所以性能非常高 +Node.js 的每一个 API 都是异步的,并作为一个独立线程运行,使用异步函数调用,并处理并发 +Node.js 基本上所有的事件机制都是用设计模式中观察者模式实现 +Node.js 单线程类似进入一个while(true)的事件循环,直到没有事件观察者退出,每个异步事件都生成一个事件观察者,如果有事件发生就调用该回调函数. + +【EventEmitter 类】 + events.EventEmitter 处理事件触发与事件监听 + +【EventEmitter 方法】 +---addListener(event, listener) + 为指定事件添加一个监听器到监听器数组的尾部 +---on(event, listener) + 为指定事件注册一个监听器,接受一个字符串 event 和一个回调函数 +---once(event, listener) + 为指定事件注册一个单次监听器,即 监听器最多只会触发一次,触发后立刻解除该监听器 + server.once('connection', function (stream) { + console.log('Ah, we have our first user!'); + }); +---removeListener(event, listener) + 移除指定事件的某个监听器,监听器必须是该事件已经注册过的监听器 + 它接受两个参数,第一个是事件名称,第二个是回调函数名称 + var callback = function(stream) { + console.log('someone connected!'); + }; + server.on('connection', callback); + // ... + server.removeListener('connection', callback); +---removeAllListeners([event]) + 移除所有事件的所有监听器, 如果指定事件,则移除指定事件的所有监听器 +---setMaxListeners(n) + 默认情况下, EventEmitters 如果你添加的监听器超过 10 个就会输出警告信息。 setMaxListeners 函数用于提高监听器的默认限制的数量 +---listeners(event) + 返回指定事件的监听器数组 +---emit(event, [arg1], [arg2], [...]) + 按参数的顺序执行每个监听器,如果事件有注册监听返回 true,否则返回 false + +【EventEmitter 类方法】 +---listenerCount(emitter, event) + 返回指定事件的监听器数量 + +【EventEmitter 事件】 +---newListener + event - 字符串,事件名称 + listener - 处理事件函数 + 该事件在添加新监听器时被触发 +---removeListener + event - 字符串,事件名称 + listener - 处理事件函数 + 从指定监听器数组中删除一个监听器。需要注意的是,此操作将会改变处于被删监听器之后的那些监听器的索引 + */ + +// 【case1】:多个事件 +// 引入 events 模块 +var events = require('events'); +// 创建 eventEmitter 对象 +var eventEmitter = new events.EventEmitter(); +// 创建事件处理程序 +var connectHandler = function connected() { + console.log('连接成功'); + // 触发 data_received 事件 + eventEmitter.emit('data_received'); +} +// 绑定 connection 事件处理程序 +eventEmitter.on('connection', connectHandler); +// 使用匿名函数绑定 data_received 事件 +eventEmitter.on('data_received', function(){ + console.log('数据接收成功'); +}); +// 触发 connection 事件 +eventEmitter.emit('connection'); +console.log("程序执行完毕"); +// 【执行结果】 +// 连接成功 +// 数据接收成功 +// 程序执行完毕 + + +//【case2】:绑定多个回调函数 +//EventEmitter 支持若干个事件监听器。当事件触发时,注册到这个事件的事件监听器被依次调用,事件参数作为回调函数参数传递 +var events = require('events'); +var emitter = new events.EventEmitter(); +emitter.on('someEvent', function(arg1, arg2) { + console.log('listener1', arg1, arg2); +}); +emitter.on('someEvent', function(arg1, arg2) { + console.log('listener2', arg1, arg2); +}); +emitter.emit('someEvent', 'arg1 参数', 'arg2 参数'); +// 【执行结果】 +// listener1 arg1 参数 arg2 参数 +// listener2 arg1 参数 arg2 参数 + + +//【case3】:绑定多个回调函数 +var events = require('events'); +var eventEmitter = new events.EventEmitter(); +// 监听器 #1 +var listener1 = function listener1() { + console.log('监听器 listener1 执行'); +} +// 监听器 #2 +var listener2 = function listener2() { + console.log('监听器 listener2 执行'); +} +// 绑定 connection 事件,处理函数为 listener1 +eventEmitter.addListener('connection', listener1); +// 绑定 connection 事件,处理函数为 listener2 +eventEmitter.on('connection', listener2); +var eventListeners = require('events').EventEmitter.listenerCount(eventEmitter,'connection'); +console.log(eventListeners + " 个监听器监听连接事件"); +// 处理 connection 事件 +eventEmitter.emit('connection'); +// 移除监绑定的 listener1 函数 +eventEmitter.removeListener('connection', listener1); +console.log("listener1 不再受监听"); +// 触发连接事件 +eventEmitter.emit('connection'); +eventListeners = require('events').EventEmitter.listenerCount(eventEmitter,'connection'); +console.log(eventListeners + " 个监听器监听连接事件"); +console.log("程序执行完毕。"); +// 【执行结果】 +// 2 个监听器监听连接事件 +// 监听器 listener1 执行 +// 监听器 listener2 执行 +// listener1 不再受监听 +// 监听器 listener2 执行 +// 1 个监听器监听连接事件 +// 程序执行完毕 \ No newline at end of file diff --git a/8 node/03-buffer.js b/8 node/03-buffer.js new file mode 100644 index 000000000..0f52868ff --- /dev/null +++ b/8 node/03-buffer.js @@ -0,0 +1,174 @@ +/** + * @Author csxiaoyao + * @DateTime 2017-06-20 + * @copyright [copyright] + * @license [license] + * @version [version] + */ + +/** + * Node.js Buffer(缓冲区) + */ + +// 处理I/O操作中移动的二进制数据时,可能使用 Buffer 库 +// 原始数据存储在 Buffer 类的实例中,类似于一个整数数组,但对应于 V8 堆内存之外的一块原始内存 + +//【创建 Buffer 类】 +// 方法 1 +// 创建长度为 10 字节的 Buffer 实例: +var buf = new Buffer(10); +// 方法 2 +// 通过给定的数组创建 Buffer 实例: +var buf = new Buffer([10, 20, 30, 40, 50]); +// 方法 3 +// 通过一个字符串来创建 Buffer 实例: +// utf-8 是默认的编码方式,此外它同样支持以下编码:"ascii", "utf8", "utf16le", "ucs2", "base64" 和 "hex" +var buf = new Buffer("www.csxiaoyao.com", "utf-8"); + +//【写入缓冲区】 +// buf.write(string[, offset[, length]][, encoding]) +// string - 写入缓冲区的字符串 +// offset - 缓冲区开始写入的索引值,默认为 0 +// length - 写入的字节数,默认为 buffer.length +// encoding - 使用的编码。默认为 'utf8' +// 返回实际写入的大小。如果 buffer 空间不足, 则只会写入部分字符串。 +buf = new Buffer(256); +len = buf.write("www.csxiaoyao.com"); +console.log("写入字节数 : "+ len); // 写入字节数 : 14 + +//【从缓冲区读取数据】 +// buf.toString([encoding[, start[, end]]]) +// encoding - 使用的编码。默认为 'utf8' +// start - 指定开始读取的索引位置,默认为 0 +// end - 结束位置,默认为缓冲区的末尾 +// 解码缓冲区数据并使用指定的编码返回字符串 +buf = new Buffer(26); +for (var i = 0 ; i < 26 ; i++) { + buf[i] = i + 97; +} +console.log( buf.toString('ascii')); // 输出: abcdefghijklmnopqrstuvwxyz +console.log( buf.toString('ascii',0,5)); // 输出: abcde +console.log( buf.toString('utf8',0,5)); // 输出: abcde +console.log( buf.toString(undefined,0,5)); // 使用 'utf8' 编码, 并输出: abcde + +//【 Buffer ---> JSON 对象 】 +// buf.toJSON() +var buf = new Buffer('www.runoob.com'); +var json = buf.toJSON(buf); +console.log(json);// [ 119, 119, 119, 46, 114, 117, 110, 111, 111, 98, 46, 99, 111, 109 ] + +//【缓冲区合并】 +// Buffer.concat(list[, totalLength]) +// list - 用于合并的 Buffer 对象数组列表 +// totalLength - 指定合并后Buffer对象的总长度 +// 返回一个多个成员合并的新 Buffer 对象 +var buffer1 = new Buffer('sunshine '); +var buffer2 = new Buffer('www.csxiaoyao.com'); +var buffer3 = Buffer.concat([buffer1,buffer2]); +console.log("buffer3 内容: " + buffer3.toString());// buffer3 内容: sunshine www.runoob.com + +//【缓冲区比较】 +// buf.compare(otherBuffer); +// otherBuffer - 与 buf 对象比较的另外一个 Buffer 对象 +// 返回一个数字,表示 buf 在 otherBuffer 之前,之后或相同 +var buffer1 = new Buffer('ABC'); +var buffer2 = new Buffer('ABCD'); +var result = buffer1.compare(buffer2); +if(result < 0) { + console.log(buffer1 + " 在 " + buffer2 + "之前"); +}else if(result == 0){ + console.log(buffer1 + " 与 " + buffer2 + "相同"); +}else { + console.log(buffer1 + " 在 " + buffer2 + "之后"); +} +// ABC在ABCD之前 + +//【拷贝缓冲区】 +// buf.copy(targetBuffer[, targetStart[, sourceStart[, sourceEnd]]]) +// targetBuffer - 要拷贝的 Buffer 对象 +// targetStart - 数字, 可选, 默认: 0 +// sourceStart - 数字, 可选, 默认: 0 +// sourceEnd - 数字, 可选, 默认: buffer.length +// 没有返回值 +var buffer1 = new Buffer('ABC'); +// 拷贝一个缓冲区 +var buffer2 = new Buffer(3); +buffer1.copy(buffer2); +console.log("buffer2 content: " + buffer2.toString()); // buffer2 content: ABC + +//【缓冲区裁剪】 +// buf.slice([start[, end]]) +// start - 数字, 可选, 默认: 0 +// end - 数字, 可选, 默认: buffer.length +// 返回一个新的缓冲区,它和旧缓冲区指向同一块内存,但是从索引 start 到 end 的位置剪切。 +var buffer1 = new Buffer('csxiaoyao'); +// 剪切缓冲区 +var buffer2 = buffer1.slice(0,2); +console.log("buffer2 content: " + buffer2.toString()); +// buffer2 content: cs + +//【缓冲区长度】 +// buf.length; +// 返回 Buffer 对象所占据的内存长度 +var buffer = new Buffer('www.csxiaoyao.com'); +// 缓冲区长度 +console.log("buffer length: " + buffer.length); +// buffer length: 14 + +//【API】 +// 【1 创建】 +// -- new Buffer(size) 分配一个新的 size 大小单位为8位字节的 buffer, size 必须小于 kMaxLength,否则,将会抛出异常 RangeError +// -- new Buffer(buffer) 拷贝参数 buffer 的数据到 Buffer 实例 +// -- new Buffer(str[, encoding]) 分配一个新的 buffer,其中包含传入的 str 字符串,encoding 编码方式默认为 'utf8' +// 【2 常用】 +// -- buf.length 返回 buffer 对象所分配的内存数 +// -- buf.toString([encoding[, start[, end]]]) 解码,默认'utf8',start默认0,end默认buffer.length +// -- buf.toJSON() 将 Buffer 实例转换为 JSON 对象 +// -- buf[index] 获取或设置指定的字节,返回值代表一个字节,所以返回值的合法范围是十六进制0x00到0xFF,或者十进制0至255 +// -- buf.equals(otherBuffer) 比较两个缓冲区是否相等,如果是返回 true,否则返回 false +// -- buf.compare(otherBuffer) 比较两个 Buffer 对象,返回一个数字,表示 buf 在 otherBuffer 之前,之后或相同 +// -- buf.copy(targetBuffer[, targetStart[, sourceStart[, sourceEnd]]]) buffer 拷贝,源和目标可以相同 +// -- buf.slice([start[, end]]) 剪切 Buffer 对象,负的索引从 buffer 尾部开始计算 +// 【3 读写】 +// -- buf.write(string[, offset[, length]][, encoding]) 根据参数 offset 偏移量和指定的 encoding 编码方式,将参数 string 数据写入buffer。 offset 偏移量默认值是 0, encoding 编码方式默认是 utf8。 length 长度是将要写入的字符串的 bytes 大小。 返回 number 类型,表示写入了多少 8 位字节流。如果 buffer 没有足够的空间来放整个 string,它将只会只写入部分字符串。 length 默认是 buffer.length - offset。 这个方法不会出现写入部分字符。 +// -- buf.fill(value[, offset][, end]) 使用指定的 value 来填充 buffer,如果没有指定 offset (默认是 0) 并且 end (默认是 buffer.length) ,将会填充整个buffer +// 【4 其他读写】 +// -- buf.writeUIntLE(value, offset, byteLength[, noAssert]) 将 value 写入 buffer,最高支持 48 位无符号整数,小端对齐,noAssert 默认 false,值为 true 时,不再验证 value 和 offset 的有效性 +// -- buf.writeUIntBE(value, offset, byteLength[, noAssert]) 最高支持48位无符号整数,大端对齐 +// -- buf.writeIntLE(value, offset, byteLength[, noAssert]) 最高支持48位有符号整数,小端对齐 +// -- buf.writeIntBE(value, offset, byteLength[, noAssert]) 最高支持48位有符号整数,大端对齐 +var b = new Buffer(6); +b.writeUIntBE(0x1234567890ab, 0, 6); +console.log(b); // +// -- buf.readUIntLE(offset, byteLength[, noAssert]) 支持读取 48 位以下的无符号数字,小端对齐,noAssert 默认 false,值为 true 时,不再验证 value 和 offset 的有效性 +// -- buf.readUIntBE(offset, byteLength[, noAssert]) 支持读取 48 位以下的无符号数字,大端对齐 +// -- buf.readIntLE(offset, byteLength[, noAssert]) 支持读取 48 位以下的有符号数字,小端对齐 +// -- buf.readIntBE(offset, byteLength[, noAssert]) 支持读取 48 位以下的有符号数字,大端对齐 +// -- buf.readUInt8(offset[, noAssert]) 根据指定的偏移量,读取一个无符号 8 位整数,noAssert 默认 false,值为 true 时,不再验证 offset 的有效性 +// -- buf.readUInt16LE(offset[, noAssert]) 读取一个无符号 16 位整数 +// -- buf.readUInt16BE(offset[, noAssert]) 读取一个无符号 16 位整数,大端对齐 +// -- buf.readUInt32LE(offset[, noAssert]) 读取一个无符号 32 位整数,小端对齐 +// -- buf.readUInt32BE(offset[, noAssert]) 读取一个无符号 32 位整数,大端对齐 +// -- buf.readInt8(offset[, noAssert]) 根据指定的偏移量,读取一个有符号 8 位整数,noAssert 默认 false,值为 true 时,不再验证 offset 的有效性 +// -- buf.readInt16LE(offset[, noAssert]) 读取一个 有符号 16 位整数,小端对齐 +// -- buf.readInt16BE(offset[, noAssert]) 读取一个 有符号 16 位整数,大端对齐 +// -- buf.readInt32LE(offset[, noAssert]) 读取一个有符号 32 位整数,小端对齐 +// -- buf.readInt32BE(offset[, noAssert]) 读取一个有符号 32 位整数,大端对齐 +// -- buf.readFloatLE(offset[, noAssert]) 读取一个 32 位双浮点数,小端对齐 +// -- buf.readFloatBE(offset[, noAssert]) 读取一个 32 位双浮点数,大端对齐 +// -- buf.readDoubleLE(offset[, noAssert]) 读取一个 64 位双精度数,小端对齐 +// -- buf.readDoubleBE(offset[, noAssert]) 读取一个 64 位双精度数,大端对齐 +// -- buf.writeUInt8(value, offset[, noAssert]) 根据传入的 offset 偏移量将 value 写入 buffer,value 必须是一个合法的无符号 8 位整数,noAssert 默认 false,值为 true 时,不再验证 offset 的有效性 +// -- buf.writeUInt16LE(value, offset[, noAssert]) value 是一个合法的无符号 16 位整数,小端对齐 +// -- buf.writeUInt16BE(value, offset[, noAssert]) value 是一个合法的无符号 16 位整数,大端对齐 +// -- buf.writeUInt32LE(value, offset[, noAssert]) value 是一个合法的无符号 32 位整数,小端对齐 +// -- buf.writeUInt32BE(value, offset[, noAssert]) value 是一个合法的有符号 32 位整数 +// -- buf.writeInt8(value, offset[, noAssert]) +// -- buf.writeInt16LE(value, offset[, noAssert]) value 是一个合法的 signed 16 位整数 +// -- buf.writeInt16BE(value, offset[, noAssert]) value 是一个合法的 signed 16 位整数 +// -- buf.writeInt32LE(value, offset[, noAssert]) value 是一个合法的 signed 32 位整数 +// -- buf.writeInt32BE(value, offset[, noAssert]) value 是一个合法的 signed 32 位整数 +// -- buf.writeFloatLE(value, offset[, noAssert]) 当 value 不是一个 32 位浮点数类型的值时,结果将是不确定的 +// -- buf.writeFloatBE(value, offset[, noAssert]) 当 value 不是一个 32 位浮点数类型的值时,结果将是不确定的 +// -- buf.writeDoubleLE(value, offset[, noAssert]) value 是一个有效的 64 位double 类型的值 +// -- buf.writeDoubleBE(value, offset[, noAssert]) value 是一个有效的 64 位double 类型的值 \ No newline at end of file diff --git a/8 node/04-stream.js b/8 node/04-stream.js new file mode 100644 index 000000000..a5ada7049 --- /dev/null +++ b/8 node/04-stream.js @@ -0,0 +1,91 @@ +/** + * @Author csxiaoyao + * @DateTime 2017-06-20 + * @copyright [copyright] + * @license [license] + * @version [version] + */ + +/** + * Node.js Stream(流) + */ +// Stream 是一个抽象接口,Node 中有很多对象实现了这个接口 +// 例如,对http 服务器发起请求的request 对象就是一个 Stream,还有stdout(标准输出) + +// 【四种流类型】 +// Readable - 可读操作 +// Writable - 可写操作 +// Duplex - 可读可写操作 +// Transform - 操作被写入数据,然后读出结果 + +// 【常用事件】 +// 所有的 Stream 对象都是 EventEmitter 的实例,常用事件: +// data - 当有数据可读时触发 +// end - 没有更多的数据可读时触发 +// error - 在接收和写入过程中发生错误时触发 +// finish - 所有数据已被写入到底层系统时触发 + +// 【1 从流中读取数据】 +var fs = require("fs"); +var data = ''; +var readerStream = fs.createReadStream('input.txt'); //创建可读流 +readerStream.setEncoding('UTF8'); //设置编码为 utf8 +// 处理流事件 --> data, end, error +readerStream.on('data', function(chunk) { + data += chunk; +}); +readerStream.on('end',function(){ + console.log(data); +}); +readerStream.on('error', function(err){ + console.log(err.stack); +}); +console.log("程序执行完毕"); +// 程序执行完毕 +// sunshine studio --CS逍遥剑仙 + +// 【2 写入流】 +var fs2 = require("fs"); +var data2 = 'www.csxiaoyo.com --CS逍遥剑仙'; +var writerStream2 = fs2.createWriteStream('output.txt'); // 创建一个可以写入的流,写入到文件 output.txt 中 +writerStream2.write(data,'UTF8'); // 使用 utf8 编码写入数据 +writerStream2.end(); // 标记文件末尾 +// 处理流事件 --> finish, error +writerStream2.on('finish', function() { + console.log("写入完成"); +}); +writerStream2.on('error', function(err){ + console.log(err.stack); +}); +console.log("程序执行完毕"); +// 程序执行完毕 +// 写入完成 + +// 【3 管道流】 +// 管道提供了一个输出流到输入流的机制 +var fs3 = require("fs"); +// 创建一个可读流 +var readerStream3 = fs3.createReadStream('input.txt'); +// 创建一个可写流 +var writerStream3 = fs3.createWriteStream('output.txt'); +// 管道读写操作,读取 input.txt 文件内容,并将内容写入到 output.txt 文件中 +readerStream3.pipe(writerStream3); +console.log("程序执行完毕"); + +// 【4 链式流】 +// 链式是通过连接输出流到另外一个流并创建多个对个流操作链的机制,链式流一般用于管道操作 +// 用管道和链式流压缩和解压文件 +var fs4 = require("fs"); +var zlib = require('zlib'); +// 压缩 input.txt 文件为 input.txt.gz +fs4.createReadStream('input.txt') + .pipe(zlib.createGzip()) + .pipe(fs4.createWriteStream('input.txt.gz')); +console.log("文件压缩完成"); +// 解压 input.txt.gz 文件为 input.txt +var fs5 = require("fs"); +var zlib2 = require('zlib'); +fs5.createReadStream('input.txt.gz') + .pipe(zlib2.createGunzip()) + .pipe(fs5.createWriteStream('input.txt')); +console.log("文件解压完成"); \ No newline at end of file diff --git a/8 node/05-hello.js b/8 node/05-hello.js new file mode 100644 index 000000000..c7c9d6ca0 --- /dev/null +++ b/8 node/05-hello.js @@ -0,0 +1,21 @@ +// exports 方式1 +// 导出 exports 对象 +exports.world = function() { + console.log('Hello World'); +} + +// exports 方式2 +// 导出目的对象( 如 Hello ) +module.exports = function() { + // ... +} +function Hello() { + var name; + this.setName = function(thyName) { + name = thyName; + }; + this.sayHello = function() { + console.log('Hello ' + name); + }; +}; +module.exports = Hello; \ No newline at end of file diff --git "a/8 node/05-\346\250\241\345\235\227\347\263\273\347\273\237.js" "b/8 node/05-\346\250\241\345\235\227\347\263\273\347\273\237.js" new file mode 100644 index 000000000..9821275c9 --- /dev/null +++ "b/8 node/05-\346\250\241\345\235\227\347\263\273\347\273\237.js" @@ -0,0 +1,74 @@ +/** + * Created by sunshine on 2017/6/21. + */ +// 一个 Node.js 文件就是一个模块,这个文件可能是JavaScript 代码、JSON 或者编译过的 C/C++ 扩展 + +// 【创建模块】 +// exports 对象,公开模块接口 +// require 对象,获取模块接口,即获取 exports 对象 +// 【方式1】导出 exports 对象 +// 获取 exports 对象 +var hello = require('./05-hello'); +hello.world(); // hello world +// 【方式2】导出目的对象 +var Hello = require('./05-hello'); +hello2 = new Hello(); +hello2.setName('Sunshine'); +hello2.sayHello(); // Hello Sunshine + +// 【require方法接受4种模块】 +// 1、http、fs、path等,原生模块 +// 2、./mod或../mod,相对路径的文件模块 +// 3、/pathtomodule/mod,绝对路径的文件模块 +// 4、mod,非原生模块的文件模块 + +// 【require文件查找策略】 +// 文件模块缓存 --> 原生模块缓存 --> (原生模块) --> 文件加载 + +// 在路径 Y 下执行 require(X) 语句执行顺序: +// 1. 如果 X 是内置模块 +// a. 返回内置模块 +// b. 停止执行 +// 2. 如果 X 以 '/' 开头 +// a. 设置 Y 为文件根路径 +// 3. 如果 X 以 './' 或 '/' or '../' 开头 +// a. LOAD_AS_FILE(Y + X) +// b. LOAD_AS_DIRECTORY(Y + X) +// 4. LOAD_NODE_MODULES(X, dirname(Y)) +// 5. 抛出异常 "not found" + +// LOAD_AS_FILE(X) +// 1. 如果 X 是一个文件, 将 X 作为 JavaScript 文本载入并停止执行。 +// 2. 如果 X.js 是一个文件, 将 X.js 作为 JavaScript 文本载入并停止执行。 +// 3. 如果 X.json 是一个文件, 解析 X.json 为 JavaScript 对象并停止执行。 +// 4. 如果 X.node 是一个文件, 将 X.node 作为二进制插件载入并停止执行。 + +// LOAD_INDEX(X) +// 1. 如果 X/index.js 是一个文件, 将 X/index.js 作为 JavaScript 文本载入并停止执行。 +// 2. 如果 X/index.json 是一个文件, 解析 X/index.json 为 JavaScript 对象并停止执行。 +// 3. 如果 X/index.node 是一个文件, 将 X/index.node 作为二进制插件载入并停止执行。 + +// LOAD_AS_DIRECTORY(X) +// 1. 如果 X/package.json 是一个文件, +// a. 解析 X/package.json, 并查找 "main" 字段。 +// b. let M = X + (json main 字段) +// c. LOAD_AS_FILE(M) +// d. LOAD_INDEX(M) +// 2. LOAD_INDEX(X) + +// LOAD_NODE_MODULES(X, START) +// 1. let DIRS=NODE_MODULES_PATHS(START) +// 2. for each DIR in DIRS: +// a. LOAD_AS_FILE(DIR/X) +// b. LOAD_AS_DIRECTORY(DIR/X) + +// NODE_MODULES_PATHS(START) +// 1. let PARTS = path split(START) +// 2. let I = count of PARTS - 1 +// 3. let DIRS = [] +// 4. while I >= 0, +// a. if PARTS[I] = "node_modules" CONTINUE +// b. DIR = path join(PARTS[0 .. I] + "node_modules") +// c. DIRS = DIRS + DIR +// d. let I = I - 1 +// 5. return DIRS \ No newline at end of file diff --git "a/8 node/06-\345\207\275\346\225\260.js" "b/8 node/06-\345\207\275\346\225\260.js" new file mode 100644 index 000000000..3541e902b --- /dev/null +++ "b/8 node/06-\345\207\275\346\225\260.js" @@ -0,0 +1,29 @@ +// 【函数作为参数】 +function say(word) { + console.log(word); +} +function execute(someFunction, value) { + someFunction(value); +} +execute(say, "Hello"); + +// 【匿名函数】 +function execute2(someFunction, value) { + someFunction(value); +} +execute2(function(word){ console.log(word) }, "Hello"); + +// 【以 http 为例】 +// var http = require("http"); +// function onRequest(request, response) { +// response.writeHead(200, {"Content-Type": "text/plain"}); +// response.write("Hello World"); +// response.end(); +// } +// http.createServer(onRequest).listen(8888); +var http = require("http"); +http.createServer(function(request, response) { + response.writeHead(200, {"Content-Type": "text/plain"}); + response.write("Hello World"); + response.end(); +}).listen(8888); \ No newline at end of file diff --git "a/8 node/07-\350\267\257\347\224\261.js" "b/8 node/07-\350\267\257\347\224\261.js" new file mode 100644 index 000000000..e69de29bb diff --git a/8 node/README.md b/8 node/README.md new file mode 100644 index 000000000..e69de29bb diff --git a/8 node/input.txt b/8 node/input.txt new file mode 100644 index 000000000..e54d4ee88 --- /dev/null +++ b/8 node/input.txt @@ -0,0 +1 @@ +sunshine studio --CS逍遥剑仙 \ No newline at end of file diff --git a/8 node/node_modules/.bin/mime b/8 node/node_modules/.bin/mime new file mode 120000 index 000000000..fbb7ee0ee --- /dev/null +++ b/8 node/node_modules/.bin/mime @@ -0,0 +1 @@ +../mime/cli.js \ No newline at end of file diff --git a/8 node/node_modules/accepts/HISTORY.md b/8 node/node_modules/accepts/HISTORY.md new file mode 100644 index 000000000..0477ed71c --- /dev/null +++ b/8 node/node_modules/accepts/HISTORY.md @@ -0,0 +1,212 @@ +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/8 node/node_modules/accepts/LICENSE b/8 node/node_modules/accepts/LICENSE new file mode 100644 index 000000000..06166077b --- /dev/null +++ b/8 node/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/accepts/README.md b/8 node/node_modules/accepts/README.md new file mode 100644 index 000000000..ae36676f2 --- /dev/null +++ b/8 node/node_modules/accepts/README.md @@ -0,0 +1,135 @@ +# accepts + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +```sh +npm install accepts +``` + +## API + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app(req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch(accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('hello, world!') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/accepts.svg +[npm-url]: https://npmjs.org/package/accepts +[node-version-image]: https://img.shields.io/node/v/accepts.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/accepts/master.svg +[travis-url]: https://travis-ci.org/jshttp/accepts +[coveralls-image]: https://img.shields.io/coveralls/jshttp/accepts/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/accepts +[downloads-image]: https://img.shields.io/npm/dm/accepts.svg +[downloads-url]: https://npmjs.org/package/accepts diff --git a/8 node/node_modules/accepts/index.js b/8 node/node_modules/accepts/index.js new file mode 100644 index 000000000..e80192abf --- /dev/null +++ b/8 node/node_modules/accepts/index.js @@ -0,0 +1,231 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts(req) { + if (!(this instanceof Accepts)) + return new Accepts(req) + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + if (!this.headers.accept) return types[0]; + var mimes = types.map(extToMime); + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)); + var first = accepts[0]; + if (!first) return false; + return types[mimes.indexOf(first)]; +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime(type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime(type) { + return typeof type === 'string'; +} diff --git a/8 node/node_modules/accepts/package.json b/8 node/node_modules/accepts/package.json new file mode 100644 index 000000000..cb4435835 --- /dev/null +++ b/8 node/node_modules/accepts/package.json @@ -0,0 +1,77 @@ +{ + "_from": "accepts@~1.3.3", + "_id": "accepts@1.3.3", + "_inBundle": false, + "_integrity": "sha1-w8p0NJOGSMPg2cHjKN1otiLChMo=", + "_location": "/accepts", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "accepts@~1.3.3", + "name": "accepts", + "escapedName": "accepts", + "rawSpec": "~1.3.3", + "saveSpec": null, + "fetchSpec": "~1.3.3" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.3.tgz", + "_shasum": "c3ca7434938648c3e0d9c1e328dd68b622c284ca", + "_spec": "accepts@~1.3.3", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/accepts/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "mime-types": "~2.1.11", + "negotiator": "0.6.1" + }, + "deprecated": false, + "description": "Higher-level content negotiation", + "devDependencies": { + "istanbul": "0.4.3", + "mocha": "~1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/accepts#readme", + "keywords": [ + "content", + "negotiation", + "accept", + "accepts" + ], + "license": "MIT", + "name": "accepts", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/accepts.git" + }, + "scripts": { + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.3.3" +} diff --git a/8 node/node_modules/array-flatten/LICENSE b/8 node/node_modules/array-flatten/LICENSE new file mode 100644 index 000000000..983fbe8ae --- /dev/null +++ b/8 node/node_modules/array-flatten/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/8 node/node_modules/array-flatten/README.md b/8 node/node_modules/array-flatten/README.md new file mode 100644 index 000000000..91fa5b637 --- /dev/null +++ b/8 node/node_modules/array-flatten/README.md @@ -0,0 +1,43 @@ +# Array Flatten + +[![NPM version][npm-image]][npm-url] +[![NPM downloads][downloads-image]][downloads-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] + +> Flatten an array of nested arrays into a single flat array. Accepts an optional depth. + +## Installation + +``` +npm install array-flatten --save +``` + +## Usage + +```javascript +var flatten = require('array-flatten') + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9]) +//=> [1, 2, 3, 4, 5, 6, 7, 8, 9] + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2) +//=> [1, 2, 3, [4, [5], 6], 7, 8, 9] + +(function () { + flatten(arguments) //=> [1, 2, 3] +})(1, [2, 3]) +``` + +## License + +MIT + +[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat +[npm-url]: https://npmjs.org/package/array-flatten +[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat +[downloads-url]: https://npmjs.org/package/array-flatten +[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat +[travis-url]: https://travis-ci.org/blakeembrey/array-flatten +[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat +[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master diff --git a/8 node/node_modules/array-flatten/array-flatten.js b/8 node/node_modules/array-flatten/array-flatten.js new file mode 100644 index 000000000..089117b32 --- /dev/null +++ b/8 node/node_modules/array-flatten/array-flatten.js @@ -0,0 +1,64 @@ +'use strict' + +/** + * Expose `arrayFlatten`. + */ +module.exports = arrayFlatten + +/** + * Recursive flatten function with depth. + * + * @param {Array} array + * @param {Array} result + * @param {Number} depth + * @return {Array} + */ +function flattenWithDepth (array, result, depth) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (depth > 0 && Array.isArray(value)) { + flattenWithDepth(value, result, depth - 1) + } else { + result.push(value) + } + } + + return result +} + +/** + * Recursive flatten function. Omitting depth is slightly faster. + * + * @param {Array} array + * @param {Array} result + * @return {Array} + */ +function flattenForever (array, result) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (Array.isArray(value)) { + flattenForever(value, result) + } else { + result.push(value) + } + } + + return result +} + +/** + * Flatten an array, with the ability to define a depth. + * + * @param {Array} array + * @param {Number} depth + * @return {Array} + */ +function arrayFlatten (array, depth) { + if (depth == null) { + return flattenForever(array, []) + } + + return flattenWithDepth(array, [], depth) +} diff --git a/8 node/node_modules/array-flatten/package.json b/8 node/node_modules/array-flatten/package.json new file mode 100644 index 000000000..f043f2c0a --- /dev/null +++ b/8 node/node_modules/array-flatten/package.json @@ -0,0 +1,64 @@ +{ + "_from": "array-flatten@1.1.1", + "_id": "array-flatten@1.1.1", + "_inBundle": false, + "_integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=", + "_location": "/array-flatten", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "array-flatten@1.1.1", + "name": "array-flatten", + "escapedName": "array-flatten", + "rawSpec": "1.1.1", + "saveSpec": null, + "fetchSpec": "1.1.1" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "_shasum": "9a5f699051b1e7073328f2a008968b64ea2955d2", + "_spec": "array-flatten@1.1.1", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Blake Embrey", + "email": "hello@blakeembrey.com", + "url": "http://blakeembrey.me" + }, + "bugs": { + "url": "https://github.com/blakeembrey/array-flatten/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Flatten an array of nested arrays into a single flat array", + "devDependencies": { + "istanbul": "^0.3.13", + "mocha": "^2.2.4", + "pre-commit": "^1.0.7", + "standard": "^3.7.3" + }, + "files": [ + "array-flatten.js", + "LICENSE" + ], + "homepage": "https://github.com/blakeembrey/array-flatten", + "keywords": [ + "array", + "flatten", + "arguments", + "depth" + ], + "license": "MIT", + "main": "array-flatten.js", + "name": "array-flatten", + "repository": { + "type": "git", + "url": "git://github.com/blakeembrey/array-flatten.git" + }, + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "version": "1.1.1" +} diff --git a/8 node/node_modules/content-disposition/HISTORY.md b/8 node/node_modules/content-disposition/HISTORY.md new file mode 100644 index 000000000..53849b618 --- /dev/null +++ b/8 node/node_modules/content-disposition/HISTORY.md @@ -0,0 +1,50 @@ +0.5.2 / 2016-12-08 +================== + + * Fix `parse` to accept any linear whitespace character + +0.5.1 / 2016-01-17 +================== + + * perf: enable strict mode + +0.5.0 / 2014-10-11 +================== + + * Add `parse` function + +0.4.0 / 2014-09-21 +================== + + * Expand non-Unicode `filename` to the full ISO-8859-1 charset + +0.3.0 / 2014-09-20 +================== + + * Add `fallback` option + * Add `type` option + +0.2.0 / 2014-09-19 +================== + + * Reduce ambiguity of file names with hex escape in buggy browsers + +0.1.2 / 2014-09-19 +================== + + * Fix periodic invalid Unicode filename header + +0.1.1 / 2014-09-19 +================== + + * Fix invalid characters appearing in `filename*` parameter + +0.1.0 / 2014-09-18 +================== + + * Make the `filename` argument optional + +0.0.0 / 2014-09-18 +================== + + * Initial release diff --git a/8 node/node_modules/content-disposition/LICENSE b/8 node/node_modules/content-disposition/LICENSE new file mode 100644 index 000000000..b7dce6cf9 --- /dev/null +++ b/8 node/node_modules/content-disposition/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/content-disposition/README.md b/8 node/node_modules/content-disposition/README.md new file mode 100644 index 000000000..992d19a62 --- /dev/null +++ b/8 node/node_modules/content-disposition/README.md @@ -0,0 +1,141 @@ +# content-disposition + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create and parse HTTP `Content-Disposition` header + +## Installation + +```sh +$ npm install content-disposition +``` + +## API + +```js +var contentDisposition = require('content-disposition') +``` + +### contentDisposition(filename, options) + +Create an attachment `Content-Disposition` header value using the given file name, +if supplied. The `filename` is optional and if no file name is desired, but you +want to specify `options`, set `filename` to `undefined`. + +```js +res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf')) +``` + +**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this +header through a means different from `setHeader` in Node.js, you'll want to specify +the `'binary'` encoding in Node.js. + +#### Options + +`contentDisposition` accepts these properties in the options object. + +##### fallback + +If the `filename` option is outside ISO-8859-1, then the file name is actually +stored in a supplemental field for clients that support Unicode file names and +a ISO-8859-1 version of the file name is automatically generated. + +This specifies the ISO-8859-1 file name to override the automatic generation or +disables the generation all together, defaults to `true`. + + - A string will specify the ISO-8859-1 file name to use in place of automatic + generation. + - `false` will disable including a ISO-8859-1 file name and only include the + Unicode version (unless the file name is already ISO-8859-1). + - `true` will enable automatic generation if the file name is outside ISO-8859-1. + +If the `filename` option is ISO-8859-1 and this option is specified and has a +different value, then the `filename` option is encoded in the extended field +and this set as the fallback field, even though they are both ISO-8859-1. + +##### type + +Specifies the disposition type, defaults to `"attachment"`. This can also be +`"inline"`, or any other value (all values except inline are treated like +`attachment`, but can convey additional information if both parties agree to +it). The type is normalized to lower-case. + +### contentDisposition.parse(string) + +```js +var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'); +``` + +Parse a `Content-Disposition` header string. This automatically handles extended +("Unicode") parameters by decoding them and providing them under the standard +parameter name. This will return an object with the following properties (examples +are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`): + + - `type`: The disposition type (always lower case). Example: `'attachment'` + + - `parameters`: An object of the parameters in the disposition (name of parameter + always lower case and extended versions replace non-extended versions). Example: + `{filename: "€ rates.txt"}` + +## Examples + +### Send a file for download + +```js +var contentDisposition = require('content-disposition') +var destroy = require('destroy') +var http = require('http') +var onFinished = require('on-finished') + +var filePath = '/path/to/public/plans.pdf' + +http.createServer(function onRequest(req, res) { + // set headers + res.setHeader('Content-Type', 'application/pdf') + res.setHeader('Content-Disposition', contentDisposition(filePath)) + + // send file + var stream = fs.createReadStream(filePath) + stream.pipe(res) + onFinished(res, function (err) { + destroy(stream) + }) +}) +``` + +## Testing + +```sh +$ npm test +``` + +## References + +- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616] +- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987] +- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266] +- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231] + +[rfc-2616]: https://tools.ietf.org/html/rfc2616 +[rfc-5987]: https://tools.ietf.org/html/rfc5987 +[rfc-6266]: https://tools.ietf.org/html/rfc6266 +[tc-2231]: http://greenbytes.de/tech/tc2231/ + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/content-disposition.svg?style=flat +[npm-url]: https://npmjs.org/package/content-disposition +[node-version-image]: https://img.shields.io/node/v/content-disposition.svg?style=flat +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/jshttp/content-disposition.svg?style=flat +[travis-url]: https://travis-ci.org/jshttp/content-disposition +[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg?style=flat +[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master +[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg?style=flat +[downloads-url]: https://npmjs.org/package/content-disposition diff --git a/8 node/node_modules/content-disposition/index.js b/8 node/node_modules/content-disposition/index.js new file mode 100644 index 000000000..88a0d0a23 --- /dev/null +++ b/8 node/node_modules/content-disposition/index.js @@ -0,0 +1,445 @@ +/*! + * content-disposition + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = contentDisposition +module.exports.parse = parse + +/** + * Module dependencies. + */ + +var basename = require('path').basename + +/** + * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%") + */ + +var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex + +/** + * RegExp to match percent encoding escape. + */ + +var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/ +var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g + +/** + * RegExp to match non-latin1 characters. + */ + +var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g + +/** + * RegExp to match quoted-pair in RFC 2616 + * + * quoted-pair = "\" CHAR + * CHAR = + */ + +var QESC_REGEXP = /\\([\u0000-\u007f])/g + +/** + * RegExp to match chars that must be quoted-pair in RFC 2616 + */ + +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp for various RFC 2616 grammar + * + * parameter = token "=" ( token | quoted-string ) + * token = 1* + * separators = "(" | ")" | "<" | ">" | "@" + * | "," | ";" | ":" | "\" | <"> + * | "/" | "[" | "]" | "?" | "=" + * | "{" | "}" | SP | HT + * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> ) + * qdtext = > + * quoted-pair = "\" CHAR + * CHAR = + * TEXT = + * LWS = [CRLF] 1*( SP | HT ) + * CRLF = CR LF + * CR = + * LF = + * SP = + * HT = + * CTL = + * OCTET = + */ + +var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex +var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/ +var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/ + +/** + * RegExp for various RFC 5987 grammar + * + * ext-value = charset "'" [ language ] "'" value-chars + * charset = "UTF-8" / "ISO-8859-1" / mime-charset + * mime-charset = 1*mime-charsetc + * mime-charsetc = ALPHA / DIGIT + * / "!" / "#" / "$" / "%" / "&" + * / "+" / "-" / "^" / "_" / "`" + * / "{" / "}" / "~" + * language = ( 2*3ALPHA [ extlang ] ) + * / 4ALPHA + * / 5*8ALPHA + * extlang = *3( "-" 3ALPHA ) + * value-chars = *( pct-encoded / attr-char ) + * pct-encoded = "%" HEXDIG HEXDIG + * attr-char = ALPHA / DIGIT + * / "!" / "#" / "$" / "&" / "+" / "-" / "." + * / "^" / "_" / "`" / "|" / "~" + */ + +var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/ + +/** + * RegExp for various RFC 6266 grammar + * + * disposition-type = "inline" | "attachment" | disp-ext-type + * disp-ext-type = token + * disposition-parm = filename-parm | disp-ext-parm + * filename-parm = "filename" "=" value + * | "filename*" "=" ext-value + * disp-ext-parm = token "=" value + * | ext-token "=" ext-value + * ext-token = + */ + +var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex + +/** + * Create an attachment Content-Disposition header. + * + * @param {string} [filename] + * @param {object} [options] + * @param {string} [options.type=attachment] + * @param {string|boolean} [options.fallback=true] + * @return {string} + * @api public + */ + +function contentDisposition (filename, options) { + var opts = options || {} + + // get type + var type = opts.type || 'attachment' + + // get parameters + var params = createparams(filename, opts.fallback) + + // format into string + return format(new ContentDisposition(type, params)) +} + +/** + * Create parameters object from filename and fallback. + * + * @param {string} [filename] + * @param {string|boolean} [fallback=true] + * @return {object} + * @api private + */ + +function createparams (filename, fallback) { + if (filename === undefined) { + return + } + + var params = {} + + if (typeof filename !== 'string') { + throw new TypeError('filename must be a string') + } + + // fallback defaults to true + if (fallback === undefined) { + fallback = true + } + + if (typeof fallback !== 'string' && typeof fallback !== 'boolean') { + throw new TypeError('fallback must be a string or boolean') + } + + if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) { + throw new TypeError('fallback must be ISO-8859-1 string') + } + + // restrict to file base name + var name = basename(filename) + + // determine if name is suitable for quoted string + var isQuotedString = TEXT_REGEXP.test(name) + + // generate fallback name + var fallbackName = typeof fallback !== 'string' + ? fallback && getlatin1(name) + : basename(fallback) + var hasFallback = typeof fallbackName === 'string' && fallbackName !== name + + // set extended filename parameter + if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) { + params['filename*'] = name + } + + // set filename parameter + if (isQuotedString || hasFallback) { + params.filename = hasFallback + ? fallbackName + : name + } + + return params +} + +/** + * Format object to Content-Disposition header. + * + * @param {object} obj + * @param {string} obj.type + * @param {object} [obj.parameters] + * @return {string} + * @api private + */ + +function format (obj) { + var parameters = obj.parameters + var type = obj.type + + if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + // start with normalized type + var string = String(type).toLowerCase() + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + var val = param.substr(-1) === '*' + ? ustring(parameters[param]) + : qstring(parameters[param]) + + string += '; ' + param + '=' + val + } + } + + return string +} + +/** + * Decode a RFC 6987 field value (gracefully). + * + * @param {string} str + * @return {string} + * @api private + */ + +function decodefield (str) { + var match = EXT_VALUE_REGEXP.exec(str) + + if (!match) { + throw new TypeError('invalid extended field value') + } + + var charset = match[1].toLowerCase() + var encoded = match[2] + var value + + // to binary string + var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode) + + switch (charset) { + case 'iso-8859-1': + value = getlatin1(binary) + break + case 'utf-8': + value = new Buffer(binary, 'binary').toString('utf8') + break + default: + throw new TypeError('unsupported charset in extended field') + } + + return value +} + +/** + * Get ISO-8859-1 version of string. + * + * @param {string} val + * @return {string} + * @api private + */ + +function getlatin1 (val) { + // simple Unicode -> ISO-8859-1 transformation + return String(val).replace(NON_LATIN1_REGEXP, '?') +} + +/** + * Parse Content-Disposition header string. + * + * @param {string} string + * @return {object} + * @api private + */ + +function parse (string) { + if (!string || typeof string !== 'string') { + throw new TypeError('argument string is required') + } + + var match = DISPOSITION_TYPE_REGEXP.exec(string) + + if (!match) { + throw new TypeError('invalid type format') + } + + // normalize type + var index = match[0].length + var type = match[1].toLowerCase() + + var key + var names = [] + var params = {} + var value + + // calculate index to start at + index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';' + ? index - 1 + : index + + // match parameters + while ((match = PARAM_REGEXP.exec(string))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (names.indexOf(key) !== -1) { + throw new TypeError('invalid duplicate parameter') + } + + names.push(key) + + if (key.indexOf('*') + 1 === key.length) { + // decode extended value + key = key.slice(0, -1) + value = decodefield(value) + + // overwrite existing value + params[key] = value + continue + } + + if (typeof params[key] === 'string') { + continue + } + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(QESC_REGEXP, '$1') + } + + params[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + return new ContentDisposition(type, params) +} + +/** + * Percent decode a single character. + * + * @param {string} str + * @param {string} hex + * @return {string} + * @api private + */ + +function pdecode (str, hex) { + return String.fromCharCode(parseInt(hex, 16)) +} + +/** + * Percent encode a single character. + * + * @param {string} char + * @return {string} + * @api private + */ + +function pencode (char) { + var hex = String(char) + .charCodeAt(0) + .toString(16) + .toUpperCase() + return hex.length === 1 + ? '%0' + hex + : '%' + hex +} + +/** + * Quote a string for HTTP. + * + * @param {string} val + * @return {string} + * @api private + */ + +function qstring (val) { + var str = String(val) + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Encode a Unicode string for HTTP (RFC 5987). + * + * @param {string} val + * @return {string} + * @api private + */ + +function ustring (val) { + var str = String(val) + + // percent encode as UTF-8 + var encoded = encodeURIComponent(str) + .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode) + + return 'UTF-8\'\'' + encoded +} + +/** + * Class for parsed Content-Disposition header for v8 optimization + */ + +function ContentDisposition (type, parameters) { + this.type = type + this.parameters = parameters +} diff --git a/8 node/node_modules/content-disposition/package.json b/8 node/node_modules/content-disposition/package.json new file mode 100644 index 000000000..e1e0915fb --- /dev/null +++ b/8 node/node_modules/content-disposition/package.json @@ -0,0 +1,74 @@ +{ + "_from": "content-disposition@0.5.2", + "_id": "content-disposition@0.5.2", + "_inBundle": false, + "_integrity": "sha1-DPaLud318r55YcOoUXjLhdunjLQ=", + "_location": "/content-disposition", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "content-disposition@0.5.2", + "name": "content-disposition", + "escapedName": "content-disposition", + "rawSpec": "0.5.2", + "saveSpec": null, + "fetchSpec": "0.5.2" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.2.tgz", + "_shasum": "0cf68bb9ddf5f2be7961c3a85178cb85dba78cb4", + "_spec": "content-disposition@0.5.2", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/content-disposition/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "Create and parse Content-Disposition header", + "devDependencies": { + "eslint": "3.11.1", + "eslint-config-standard": "6.2.1", + "eslint-plugin-promise": "3.3.0", + "eslint-plugin-standard": "2.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/content-disposition#readme", + "keywords": [ + "content-disposition", + "http", + "rfc6266", + "res" + ], + "license": "MIT", + "name": "content-disposition", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/content-disposition.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.5.2" +} diff --git a/8 node/node_modules/content-type/HISTORY.md b/8 node/node_modules/content-type/HISTORY.md new file mode 100644 index 000000000..01652ff46 --- /dev/null +++ b/8 node/node_modules/content-type/HISTORY.md @@ -0,0 +1,14 @@ +1.0.2 / 2016-05-09 +================== + + * perf: enable strict mode + +1.0.1 / 2015-02-13 +================== + + * Improve missing `Content-Type` header error message + +1.0.0 / 2015-02-01 +================== + + * Initial implementation, derived from `media-typer@0.3.0` diff --git a/8 node/node_modules/content-type/LICENSE b/8 node/node_modules/content-type/LICENSE new file mode 100644 index 000000000..34b1a2de3 --- /dev/null +++ b/8 node/node_modules/content-type/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/content-type/README.md b/8 node/node_modules/content-type/README.md new file mode 100644 index 000000000..3ed67413c --- /dev/null +++ b/8 node/node_modules/content-type/README.md @@ -0,0 +1,92 @@ +# content-type + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create and parse HTTP Content-Type header according to RFC 7231 + +## Installation + +```sh +$ npm install content-type +``` + +## API + +```js +var contentType = require('content-type') +``` + +### contentType.parse(string) + +```js +var obj = contentType.parse('image/svg+xml; charset=utf-8') +``` + +Parse a content type string. This will return an object with the following +properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (the type and subtype, always lower case). + Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of parameter + always lower case). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the string is missing or invalid. + +### contentType.parse(req) + +```js +var obj = contentType.parse(req) +``` + +Parse the `content-type` header from the given `req`. Short-cut for +`contentType.parse(req.headers['content-type'])`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.parse(res) + +```js +var obj = contentType.parse(res) +``` + +Parse the `content-type` header set on the given `res`. Short-cut for +`contentType.parse(res.getHeader('content-type'))`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.format(obj) + +```js +var str = contentType.format({type: 'image/svg+xml'}) +``` + +Format an object into a content type string. This will return a string of the +content type for the given object with the following properties (examples are +shown that produce the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of the + parameter will be lower-cased). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the object contains an invalid type or parameter names. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/content-type.svg +[npm-url]: https://npmjs.org/package/content-type +[node-version-image]: https://img.shields.io/node/v/content-type.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/content-type/master.svg +[travis-url]: https://travis-ci.org/jshttp/content-type +[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-type/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/content-type +[downloads-image]: https://img.shields.io/npm/dm/content-type.svg +[downloads-url]: https://npmjs.org/package/content-type diff --git a/8 node/node_modules/content-type/index.js b/8 node/node_modules/content-type/index.js new file mode 100644 index 000000000..61ba6b5a2 --- /dev/null +++ b/8 node/node_modules/content-type/index.js @@ -0,0 +1,216 @@ +/*! + * content-type + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1 + * + * parameter = token "=" ( token / quoted-string ) + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE + * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text + * obs-text = %x80-FF + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + */ +var paramRegExp = /; *([!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+) */g +var textRegExp = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/ +var tokenRegExp = /^[!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+$/ + +/** + * RegExp to match quoted-pair in RFC 7230 sec 3.2.6 + * + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + * obs-text = %x80-FF + */ +var qescRegExp = /\\([\u000b\u0020-\u00ff])/g + +/** + * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6 + */ +var quoteRegExp = /([\\"])/g + +/** + * RegExp to match type in RFC 6838 + * + * media-type = type "/" subtype + * type = token + * subtype = token + */ +var typeRegExp = /^[!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+\/[!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+$/ + +/** + * Module exports. + * @public + */ + +exports.format = format +exports.parse = parse + +/** + * Format object to media type. + * + * @param {object} obj + * @return {string} + * @public + */ + +function format(obj) { + if (!obj || typeof obj !== 'object') { + throw new TypeError('argument obj is required') + } + + var parameters = obj.parameters + var type = obj.type + + if (!type || !typeRegExp.test(type)) { + throw new TypeError('invalid type') + } + + var string = type + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + if (!tokenRegExp.test(param)) { + throw new TypeError('invalid parameter name') + } + + string += '; ' + param + '=' + qstring(parameters[param]) + } + } + + return string +} + +/** + * Parse media type to object. + * + * @param {string|object} string + * @return {Object} + * @public + */ + +function parse(string) { + if (!string) { + throw new TypeError('argument string is required') + } + + if (typeof string === 'object') { + // support req/res-like objects as argument + string = getcontenttype(string) + + if (typeof string !== 'string') { + throw new TypeError('content-type header is missing from object'); + } + } + + if (typeof string !== 'string') { + throw new TypeError('argument string is required to be a string') + } + + var index = string.indexOf(';') + var type = index !== -1 + ? string.substr(0, index).trim() + : string.trim() + + if (!typeRegExp.test(type)) { + throw new TypeError('invalid media type') + } + + var key + var match + var obj = new ContentType(type.toLowerCase()) + var value + + paramRegExp.lastIndex = index + + while (match = paramRegExp.exec(string)) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(qescRegExp, '$1') + } + + obj.parameters[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + return obj +} + +/** + * Get content-type from req/res objects. + * + * @param {object} + * @return {Object} + * @private + */ + +function getcontenttype(obj) { + if (typeof obj.getHeader === 'function') { + // res-like + return obj.getHeader('content-type') + } + + if (typeof obj.headers === 'object') { + // req-like + return obj.headers && obj.headers['content-type'] + } +} + +/** + * Quote a string if necessary. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring(val) { + var str = String(val) + + // no need to quote tokens + if (tokenRegExp.test(str)) { + return str + } + + if (str.length > 0 && !textRegExp.test(str)) { + throw new TypeError('invalid parameter value') + } + + return '"' + str.replace(quoteRegExp, '\\$1') + '"' +} + +/** + * Class to represent a content type. + * @private + */ +function ContentType(type) { + this.parameters = Object.create(null) + this.type = type +} diff --git a/8 node/node_modules/content-type/package.json b/8 node/node_modules/content-type/package.json new file mode 100644 index 000000000..c49b395a2 --- /dev/null +++ b/8 node/node_modules/content-type/package.json @@ -0,0 +1,68 @@ +{ + "_from": "content-type@~1.0.2", + "_id": "content-type@1.0.2", + "_inBundle": false, + "_integrity": "sha1-t9ETrueo3Se9IRM8TcJSnfFyHu0=", + "_location": "/content-type", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "content-type@~1.0.2", + "name": "content-type", + "escapedName": "content-type", + "rawSpec": "~1.0.2", + "saveSpec": null, + "fetchSpec": "~1.0.2" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.2.tgz", + "_shasum": "b7d113aee7a8dd27bd21133c4dc2529df1721eed", + "_spec": "content-type@~1.0.2", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/content-type/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Create and parse HTTP Content-Type header", + "devDependencies": { + "istanbul": "0.4.3", + "mocha": "~1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/content-type#readme", + "keywords": [ + "content-type", + "http", + "req", + "res", + "rfc7231" + ], + "license": "MIT", + "name": "content-type", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/content-type.git" + }, + "scripts": { + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "1.0.2" +} diff --git a/8 node/node_modules/cookie-signature/.npmignore b/8 node/node_modules/cookie-signature/.npmignore new file mode 100644 index 000000000..f1250e584 --- /dev/null +++ b/8 node/node_modules/cookie-signature/.npmignore @@ -0,0 +1,4 @@ +support +test +examples +*.sock diff --git a/8 node/node_modules/cookie-signature/History.md b/8 node/node_modules/cookie-signature/History.md new file mode 100644 index 000000000..78513cc3d --- /dev/null +++ b/8 node/node_modules/cookie-signature/History.md @@ -0,0 +1,38 @@ +1.0.6 / 2015-02-03 +================== + +* use `npm test` instead of `make test` to run tests +* clearer assertion messages when checking input + + +1.0.5 / 2014-09-05 +================== + +* add license to package.json + +1.0.4 / 2014-06-25 +================== + + * corrected avoidance of timing attacks (thanks @tenbits!) + +1.0.3 / 2014-01-28 +================== + + * [incorrect] fix for timing attacks + +1.0.2 / 2014-01-28 +================== + + * fix missing repository warning + * fix typo in test + +1.0.1 / 2013-04-15 +================== + + * Revert "Changed underlying HMAC algo. to sha512." + * Revert "Fix for timing attacks on MAC verification." + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/8 node/node_modules/cookie-signature/Readme.md b/8 node/node_modules/cookie-signature/Readme.md new file mode 100644 index 000000000..2559e841b --- /dev/null +++ b/8 node/node_modules/cookie-signature/Readme.md @@ -0,0 +1,42 @@ + +# cookie-signature + + Sign and unsign cookies. + +## Example + +```js +var cookie = require('cookie-signature'); + +var val = cookie.sign('hello', 'tobiiscool'); +val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI'); + +var val = cookie.sign('hello', 'tobiiscool'); +cookie.unsign(val, 'tobiiscool').should.equal('hello'); +cookie.unsign(val, 'luna').should.be.false; +``` + +## License + +(The MIT License) + +Copyright (c) 2012 LearnBoost <tj@learnboost.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/8 node/node_modules/cookie-signature/index.js b/8 node/node_modules/cookie-signature/index.js new file mode 100644 index 000000000..b8c9463a2 --- /dev/null +++ b/8 node/node_modules/cookie-signature/index.js @@ -0,0 +1,51 @@ +/** + * Module dependencies. + */ + +var crypto = require('crypto'); + +/** + * Sign the given `val` with `secret`. + * + * @param {String} val + * @param {String} secret + * @return {String} + * @api private + */ + +exports.sign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + return val + '.' + crypto + .createHmac('sha256', secret) + .update(val) + .digest('base64') + .replace(/\=+$/, ''); +}; + +/** + * Unsign and decode the given `val` with `secret`, + * returning `false` if the signature is invalid. + * + * @param {String} val + * @param {String} secret + * @return {String|Boolean} + * @api private + */ + +exports.unsign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + var str = val.slice(0, val.lastIndexOf('.')) + , mac = exports.sign(str, secret); + + return sha1(mac) == sha1(val) ? str : false; +}; + +/** + * Private + */ + +function sha1(str){ + return crypto.createHash('sha1').update(str).digest('hex'); +} diff --git a/8 node/node_modules/cookie-signature/package.json b/8 node/node_modules/cookie-signature/package.json new file mode 100644 index 000000000..444c0841a --- /dev/null +++ b/8 node/node_modules/cookie-signature/package.json @@ -0,0 +1,57 @@ +{ + "_from": "cookie-signature@1.0.6", + "_id": "cookie-signature@1.0.6", + "_inBundle": false, + "_integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=", + "_location": "/cookie-signature", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "cookie-signature@1.0.6", + "name": "cookie-signature", + "escapedName": "cookie-signature", + "rawSpec": "1.0.6", + "saveSpec": null, + "fetchSpec": "1.0.6" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "_shasum": "e303a882b342cc3ee8ca513a79999734dab3ae2c", + "_spec": "cookie-signature@1.0.6", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@learnboost.com" + }, + "bugs": { + "url": "https://github.com/visionmedia/node-cookie-signature/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "Sign and unsign cookies", + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "homepage": "https://github.com/visionmedia/node-cookie-signature#readme", + "keywords": [ + "cookie", + "sign", + "unsign" + ], + "license": "MIT", + "main": "index", + "name": "cookie-signature", + "repository": { + "type": "git", + "url": "git+https://github.com/visionmedia/node-cookie-signature.git" + }, + "scripts": { + "test": "mocha --require should --reporter spec" + }, + "version": "1.0.6" +} diff --git a/8 node/node_modules/cookie/HISTORY.md b/8 node/node_modules/cookie/HISTORY.md new file mode 100644 index 000000000..5bd648542 --- /dev/null +++ b/8 node/node_modules/cookie/HISTORY.md @@ -0,0 +1,118 @@ +0.3.1 / 2016-05-26 +================== + + * Fix `sameSite: true` to work with draft-7 clients + - `true` now sends `SameSite=Strict` instead of `SameSite` + +0.3.0 / 2016-05-26 +================== + + * Add `sameSite` option + - Replaces `firstPartyOnly` option, never implemented by browsers + * Improve error message when `encode` is not a function + * Improve error message when `expires` is not a `Date` + +0.2.4 / 2016-05-20 +================== + + * perf: enable strict mode + * perf: use for loop in parse + * perf: use string concatination for serialization + +0.2.3 / 2015-10-25 +================== + + * Fix cookie `Max-Age` to never be a floating point number + +0.2.2 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.2.1 / 2015-09-17 +================== + + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.2.0 / 2015-08-13 +================== + + * Add `firstPartyOnly` option + * Throw better error for invalid argument to parse + * perf: hoist regular expression + +0.1.5 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.1.4 / 2015-09-17 +================== + + * Throw better error for invalid argument to parse + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.1.3 / 2015-05-19 +================== + + * Reduce the scope of try-catch deopt + * Remove argument reassignments + +0.1.2 / 2014-04-16 +================== + + * Remove unnecessary files from npm package + +0.1.1 / 2014-02-23 +================== + + * Fix bad parse when cookie value contained a comma + * Fix support for `maxAge` of `0` + +0.1.0 / 2013-05-01 +================== + + * Add `decode` option + * Add `encode` option + +0.0.6 / 2013-04-08 +================== + + * Ignore cookie parts missing `=` + +0.0.5 / 2012-10-29 +================== + + * Return raw cookie value if value unescape errors + +0.0.4 / 2012-06-21 +================== + + * Use encode/decodeURIComponent for cookie encoding/decoding + - Improve server/client interoperability + +0.0.3 / 2012-06-06 +================== + + * Only escape special characters per the cookie RFC + +0.0.2 / 2012-06-01 +================== + + * Fix `maxAge` option to not throw error + +0.0.1 / 2012-05-28 +================== + + * Add more tests + +0.0.0 / 2012-05-28 +================== + + * Initial release diff --git a/8 node/node_modules/cookie/LICENSE b/8 node/node_modules/cookie/LICENSE new file mode 100644 index 000000000..058b6b4ef --- /dev/null +++ b/8 node/node_modules/cookie/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Roman Shtylman +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/8 node/node_modules/cookie/README.md b/8 node/node_modules/cookie/README.md new file mode 100644 index 000000000..db0d07825 --- /dev/null +++ b/8 node/node_modules/cookie/README.md @@ -0,0 +1,220 @@ +# cookie + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Basic HTTP cookie parser and serializer for HTTP servers. + +## Installation + +```sh +$ npm install cookie +``` + +## API + +```js +var cookie = require('cookie'); +``` + +### cookie.parse(str, options) + +Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs. +The `str` argument is the string representing a `Cookie` header value and `options` is an +optional object containing additional parsing options. + +```js +var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2'); +// { foo: 'bar', equation: 'E=mc^2' } +``` + +#### Options + +`cookie.parse` accepts these properties in the options object. + +##### decode + +Specifies a function that will be used to decode a cookie's value. Since the value of a cookie +has a limited character set (and must be a simple string), this function can be used to decode +a previously-encoded cookie value into a JavaScript string or other object. + +The default function is the global `decodeURIComponent`, which will decode any URL-encoded +sequences into their byte representations. + +**note** if an error is thrown from this function, the original, non-decoded cookie value will +be returned as the cookie's value. + +### cookie.serialize(name, value, options) + +Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the +name for the cookie, the `value` argument is the value to set the cookie to, and the `options` +argument is an optional object containing additional serialization options. + +```js +var setCookie = cookie.serialize('foo', 'bar'); +// foo=bar +``` + +#### Options + +`cookie.serialize` accepts these properties in the options object. + +##### domain + +Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6266-5.2.3]. By default, no +domain is set, and most clients will consider the cookie to apply to only the current domain. + +##### encode + +Specifies a function that will be used to encode a cookie's value. Since value of a cookie +has a limited character set (and must be a simple string), this function can be used to encode +a value into a string suited for a cookie's value. + +The default function is the global `ecodeURIComponent`, which will encode a JavaScript string +into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range. + +##### expires + +Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6266-5.2.1]. +By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and +will delete it on a condition like exiting a web browser application. + +**note** the [cookie storage model specification][rfc-6266-5.3] states that if both `expires` and +`magAge` are set, then `maxAge` takes precedence, but it is possiblke not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### httpOnly + +Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6266-5.2.6]. When truthy, +the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not allow client-side +JavaScript to see the cookie in `document.cookie`. + +##### maxAge + +Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6266-5.2.2]. +The given number will be converted to an integer by rounding down. By default, no maximum age is set. + +**note** the [cookie storage model specification][rfc-6266-5.3] states that if both `expires` and +`magAge` are set, then `maxAge` takes precedence, but it is possiblke not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### path + +Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6266-5.2.4]. By default, the path +is considered the ["default path"][rfc-6266-5.1.4]. By default, no maximum age is set, and most +clients will consider this a "non-persistent cookie" and will delete it on a condition like exiting +a web browser application. + +##### sameSite + +Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][draft-west-first-party-cookies-07]. + + - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + - `false` will not set the `SameSite` attribute. + - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement. + - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + +More information about the different enforcement levels can be found in the specification +https://tools.ietf.org/html/draft-west-first-party-cookies-07#section-4.1.1 + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### secure + +Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6266-5.2.5]. When truthy, +the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to +the server in the future if the browser does not have an HTTPS connection. + +## Example + +The following example uses this module in conjunction with the Node.js core HTTP server +to prompt a user for their name and display it back on future visits. + +```js +var cookie = require('cookie'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var url = require('url'); + +function onRequest(req, res) { + // Parse the query string + var query = url.parse(req.url, true, true).query; + + if (query && query.name) { + // Set a new cookie with the name + res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), { + httpOnly: true, + maxAge: 60 * 60 * 24 * 7 // 1 week + })); + + // Redirect back after setting cookie + res.statusCode = 302; + res.setHeader('Location', req.headers.referer || '/'); + res.end(); + return; + } + + // Parse the cookies on the request + var cookies = cookie.parse(req.headers.cookie || ''); + + // Get the visitor name set in the cookie + var name = cookies.name; + + res.setHeader('Content-Type', 'text/html; charset=UTF-8'); + + if (name) { + res.write('

Welcome back, ' + escapeHtml(name) + '!

'); + } else { + res.write('

Hello, new visitor!

'); + } + + res.write('
'); + res.write(' '); + res.end(' values + * + * @param {string} str + * @param {object} [options] + * @return {object} + * @public + */ + +function parse(str, options) { + if (typeof str !== 'string') { + throw new TypeError('argument str must be a string'); + } + + var obj = {} + var opt = options || {}; + var pairs = str.split(pairSplitRegExp); + var dec = opt.decode || decode; + + for (var i = 0; i < pairs.length; i++) { + var pair = pairs[i]; + var eq_idx = pair.indexOf('='); + + // skip things that don't look like key=value + if (eq_idx < 0) { + continue; + } + + var key = pair.substr(0, eq_idx).trim() + var val = pair.substr(++eq_idx, pair.length).trim(); + + // quoted values + if ('"' == val[0]) { + val = val.slice(1, -1); + } + + // only assign once + if (undefined == obj[key]) { + obj[key] = tryDecode(val, dec); + } + } + + return obj; +} + +/** + * Serialize data into a cookie header. + * + * Serialize the a name value pair into a cookie string suitable for + * http headers. An optional options object specified cookie parameters. + * + * serialize('foo', 'bar', { httpOnly: true }) + * => "foo=bar; httpOnly" + * + * @param {string} name + * @param {string} val + * @param {object} [options] + * @return {string} + * @public + */ + +function serialize(name, val, options) { + var opt = options || {}; + var enc = opt.encode || encode; + + if (typeof enc !== 'function') { + throw new TypeError('option encode is invalid'); + } + + if (!fieldContentRegExp.test(name)) { + throw new TypeError('argument name is invalid'); + } + + var value = enc(val); + + if (value && !fieldContentRegExp.test(value)) { + throw new TypeError('argument val is invalid'); + } + + var str = name + '=' + value; + + if (null != opt.maxAge) { + var maxAge = opt.maxAge - 0; + if (isNaN(maxAge)) throw new Error('maxAge should be a Number'); + str += '; Max-Age=' + Math.floor(maxAge); + } + + if (opt.domain) { + if (!fieldContentRegExp.test(opt.domain)) { + throw new TypeError('option domain is invalid'); + } + + str += '; Domain=' + opt.domain; + } + + if (opt.path) { + if (!fieldContentRegExp.test(opt.path)) { + throw new TypeError('option path is invalid'); + } + + str += '; Path=' + opt.path; + } + + if (opt.expires) { + if (typeof opt.expires.toUTCString !== 'function') { + throw new TypeError('option expires is invalid'); + } + + str += '; Expires=' + opt.expires.toUTCString(); + } + + if (opt.httpOnly) { + str += '; HttpOnly'; + } + + if (opt.secure) { + str += '; Secure'; + } + + if (opt.sameSite) { + var sameSite = typeof opt.sameSite === 'string' + ? opt.sameSite.toLowerCase() : opt.sameSite; + + switch (sameSite) { + case true: + str += '; SameSite=Strict'; + break; + case 'lax': + str += '; SameSite=Lax'; + break; + case 'strict': + str += '; SameSite=Strict'; + break; + default: + throw new TypeError('option sameSite is invalid'); + } + } + + return str; +} + +/** + * Try decoding a string using a decoding function. + * + * @param {string} str + * @param {function} decode + * @private + */ + +function tryDecode(str, decode) { + try { + return decode(str); + } catch (e) { + return str; + } +} diff --git a/8 node/node_modules/cookie/package.json b/8 node/node_modules/cookie/package.json new file mode 100644 index 000000000..8ce458d30 --- /dev/null +++ b/8 node/node_modules/cookie/package.json @@ -0,0 +1,71 @@ +{ + "_from": "cookie@0.3.1", + "_id": "cookie@0.3.1", + "_inBundle": false, + "_integrity": "sha1-5+Ch+e9DtMi6klxcWpboBtFoc7s=", + "_location": "/cookie", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "cookie@0.3.1", + "name": "cookie", + "escapedName": "cookie", + "rawSpec": "0.3.1", + "saveSpec": null, + "fetchSpec": "0.3.1" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/cookie/-/cookie-0.3.1.tgz", + "_shasum": "e7e0a1f9ef43b4c8ba925c5c5a96e806d16873bb", + "_spec": "cookie@0.3.1", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Roman Shtylman", + "email": "shtylman@gmail.com" + }, + "bugs": { + "url": "https://github.com/jshttp/cookie/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "HTTP server cookie parsing and serialization", + "devDependencies": { + "istanbul": "0.4.3", + "mocha": "1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/cookie#readme", + "keywords": [ + "cookie", + "cookies" + ], + "license": "MIT", + "name": "cookie", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/cookie.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "0.3.1" +} diff --git a/8 node/node_modules/debug/.coveralls.yml b/8 node/node_modules/debug/.coveralls.yml new file mode 100644 index 000000000..20a706858 --- /dev/null +++ b/8 node/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/8 node/node_modules/debug/.eslintrc b/8 node/node_modules/debug/.eslintrc new file mode 100644 index 000000000..8a37ae2c2 --- /dev/null +++ b/8 node/node_modules/debug/.eslintrc @@ -0,0 +1,11 @@ +{ + "env": { + "browser": true, + "node": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/8 node/node_modules/debug/.npmignore b/8 node/node_modules/debug/.npmignore new file mode 100644 index 000000000..5f60eecc8 --- /dev/null +++ b/8 node/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/8 node/node_modules/debug/.travis.yml b/8 node/node_modules/debug/.travis.yml new file mode 100644 index 000000000..6c6090c3b --- /dev/null +++ b/8 node/node_modules/debug/.travis.yml @@ -0,0 +1,14 @@ + +language: node_js +node_js: + - "6" + - "5" + - "4" + +install: + - make node_modules + +script: + - make lint + - make test + - make coveralls diff --git a/8 node/node_modules/debug/CHANGELOG.md b/8 node/node_modules/debug/CHANGELOG.md new file mode 100644 index 000000000..189dbc824 --- /dev/null +++ b/8 node/node_modules/debug/CHANGELOG.md @@ -0,0 +1,352 @@ + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/8 node/node_modules/debug/LICENSE b/8 node/node_modules/debug/LICENSE new file mode 100644 index 000000000..658c933d2 --- /dev/null +++ b/8 node/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/8 node/node_modules/debug/Makefile b/8 node/node_modules/debug/Makefile new file mode 100644 index 000000000..584da8bf9 --- /dev/null +++ b/8 node/node_modules/debug/Makefile @@ -0,0 +1,50 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +.FORCE: + +install: node_modules + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +lint: .FORCE + eslint browser.js debug.js index.js node.js + +test-node: .FORCE + istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + +test-browser: .FORCE + mkdir -p dist + + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + + karma start --single-run + rimraf dist + +test: .FORCE + concurrently \ + "make test-node" \ + "make test-browser" + +coveralls: + cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +.PHONY: all install clean distclean diff --git a/8 node/node_modules/debug/README.md b/8 node/node_modules/debug/README.md new file mode 100644 index 000000000..f67be6b31 --- /dev/null +++ b/8 node/node_modules/debug/README.md @@ -0,0 +1,312 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny node.js debugging utility modelled after node core's debugging technique. + +**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)** + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + + ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png) + + ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png) + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + + Note that PowerShell uses different syntax to set environment variables. + + ```cmd + $env:DEBUG = "*,-not_this" + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png) + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + + ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png) + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Environment Variables + + When running through Node.js, you can set a few environment variables that will + change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + + __Note:__ The environment variables beginning with `DEBUG_` end up being + converted into an Options object that gets used with `%o`/`%O` formatters. + See the Node.js documentation for + [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) + for the complete list. + +## Formatters + + + Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + +### Custom formatters + + You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + +## Browser support + You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), + or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), + if you don't want to build it yourself. + + Debug's enable state is currently persisted by `localStorage`. + Consider the situation shown below where you have `worker:a` and `worker:b`, + and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + + ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png) + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/debug/component.json b/8 node/node_modules/debug/component.json new file mode 100644 index 000000000..d7118d2f1 --- /dev/null +++ b/8 node/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.6.7", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "src/browser.js", + "scripts": [ + "src/browser.js", + "src/debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/8 node/node_modules/debug/karma.conf.js b/8 node/node_modules/debug/karma.conf.js new file mode 100644 index 000000000..103a82d15 --- /dev/null +++ b/8 node/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/8 node/node_modules/debug/node.js b/8 node/node_modules/debug/node.js new file mode 100644 index 000000000..7fc36fe6d --- /dev/null +++ b/8 node/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/8 node/node_modules/debug/package.json b/8 node/node_modules/debug/package.json new file mode 100644 index 000000000..49a531544 --- /dev/null +++ b/8 node/node_modules/debug/package.json @@ -0,0 +1,90 @@ +{ + "_from": "debug@2.6.7", + "_id": "debug@2.6.7", + "_inBundle": false, + "_integrity": "sha1-krrR9tBbu2u6Isyoi80OyJTChh4=", + "_location": "/debug", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "debug@2.6.7", + "name": "debug", + "escapedName": "debug", + "rawSpec": "2.6.7", + "saveSpec": null, + "fetchSpec": "2.6.7" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/send" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.7.tgz", + "_shasum": "92bad1f6d05bbb6bba22cca88bcd0ec894c2861e", + "_spec": "debug@2.6.7", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "bundleDependencies": false, + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + }, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "rhyneandrew@gmail.com" + } + ], + "dependencies": { + "ms": "2.0.0" + }, + "deprecated": false, + "description": "small debugging utility", + "devDependencies": { + "browserify": "9.0.3", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "homepage": "https://github.com/visionmedia/debug#readme", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./src/index.js", + "name": "debug", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "version": "2.6.7" +} diff --git a/8 node/node_modules/debug/src/browser.js b/8 node/node_modules/debug/src/browser.js new file mode 100644 index 000000000..7978ce722 --- /dev/null +++ b/8 node/node_modules/debug/src/browser.js @@ -0,0 +1,185 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (window && window.process && window.process.type === 'renderer') { + return true; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (document && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (window && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (navigator && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (navigator && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/8 node/node_modules/debug/src/debug.js b/8 node/node_modules/debug/src/debug.js new file mode 100644 index 000000000..6a5e3fc94 --- /dev/null +++ b/8 node/node_modules/debug/src/debug.js @@ -0,0 +1,202 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + return debug; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/8 node/node_modules/debug/src/index.js b/8 node/node_modules/debug/src/index.js new file mode 100644 index 000000000..e12cf4d58 --- /dev/null +++ b/8 node/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process !== 'undefined' && process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/8 node/node_modules/debug/src/node.js b/8 node/node_modules/debug/src/node.js new file mode 100644 index 000000000..af6129768 --- /dev/null +++ b/8 node/node_modules/debug/src/node.js @@ -0,0 +1,246 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; + +if (1 !== fd && 2 !== fd) { + util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')() +} + +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .replace(/\s*\n\s*/g, ' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to `stream`. + */ + +function log() { + return stream.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/8 node/node_modules/depd/History.md b/8 node/node_modules/depd/History.md new file mode 100644 index 000000000..ace117154 --- /dev/null +++ b/8 node/node_modules/depd/History.md @@ -0,0 +1,84 @@ +1.1.0 / 2015-09-14 +================== + + * Enable strict mode in more places + * Support io.js 3.x + * Support io.js 2.x + * Support web browser loading + - Requires bundler like Browserify or webpack + +1.0.1 / 2015-04-07 +================== + + * Fix `TypeError`s when under `'use strict'` code + * Fix useless type name on auto-generated messages + * Support io.js 1.x + * Support Node.js 0.12 + +1.0.0 / 2014-09-17 +================== + + * No changes + +0.4.5 / 2014-09-09 +================== + + * Improve call speed to functions using the function wrapper + * Support Node.js 0.6 + +0.4.4 / 2014-07-27 +================== + + * Work-around v8 generating empty stack traces + +0.4.3 / 2014-07-26 +================== + + * Fix exception when global `Error.stackTraceLimit` is too low + +0.4.2 / 2014-07-19 +================== + + * Correct call site for wrapped functions and properties + +0.4.1 / 2014-07-19 +================== + + * Improve automatic message generation for function properties + +0.4.0 / 2014-07-19 +================== + + * Add `TRACE_DEPRECATION` environment variable + * Remove non-standard grey color from color output + * Support `--no-deprecation` argument + * Support `--trace-deprecation` argument + * Support `deprecate.property(fn, prop, message)` + +0.3.0 / 2014-06-16 +================== + + * Add `NO_DEPRECATION` environment variable + +0.2.0 / 2014-06-15 +================== + + * Add `deprecate.property(obj, prop, message)` + * Remove `supports-color` dependency for node.js 0.8 + +0.1.0 / 2014-06-15 +================== + + * Add `deprecate.function(fn, message)` + * Add `process.on('deprecation', fn)` emitter + * Automatically generate message when omitted from `deprecate()` + +0.0.1 / 2014-06-15 +================== + + * Fix warning for dynamic calls at singe call site + +0.0.0 / 2014-06-15 +================== + + * Initial implementation diff --git a/8 node/node_modules/depd/LICENSE b/8 node/node_modules/depd/LICENSE new file mode 100644 index 000000000..142ede386 --- /dev/null +++ b/8 node/node_modules/depd/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/depd/Readme.md b/8 node/node_modules/depd/Readme.md new file mode 100644 index 000000000..09bb97995 --- /dev/null +++ b/8 node/node_modules/depd/Readme.md @@ -0,0 +1,281 @@ +# depd + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Coverage Status][coveralls-image]][coveralls-url] +[![Gratipay][gratipay-image]][gratipay-url] + +Deprecate all the things + +> With great modules comes great responsibility; mark things deprecated! + +## Install + +This module is installed directly using `npm`: + +```sh +$ npm install depd +``` + +This module can also be bundled with systems like +[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/), +though by default this module will alter it's API to no longer display or +track deprecations. + +## API + +```js +var deprecate = require('depd')('my-module') +``` + +This library allows you to display deprecation messages to your users. +This library goes above and beyond with deprecation warnings by +introspection of the call stack (but only the bits that it is interested +in). + +Instead of just warning on the first invocation of a deprecated +function and never again, this module will warn on the first invocation +of a deprecated function per unique call site, making it ideal to alert +users of all deprecated uses across the code base, rather than just +whatever happens to execute first. + +The deprecation warnings from this module also include the file and line +information for the call into the module that the deprecated function was +in. + +**NOTE** this library has a similar interface to the `debug` module, and +this module uses the calling file to get the boundary for the call stacks, +so you should always create a new `deprecate` object in each file and not +within some central file. + +### depd(namespace) + +Create a new deprecate function that uses the given namespace name in the +messages and will display the call site prior to the stack entering the +file this function was called from. It is highly suggested you use the +name of your module as the namespace. + +### deprecate(message) + +Call this function from deprecated code to display a deprecation message. +This message will appear once per unique caller site. Caller site is the +first call site in the stack in a different file from the caller of this +function. + +If the message is omitted, a message is generated for you based on the site +of the `deprecate()` call and will display the name of the function called, +similar to the name displayed in a stack trace. + +### deprecate.function(fn, message) + +Call this function to wrap a given function in a deprecation message on any +call to the function. An optional message can be supplied to provide a custom +message. + +### deprecate.property(obj, prop, message) + +Call this function to wrap a given property on object in a deprecation message +on any accessing or setting of the property. An optional message can be supplied +to provide a custom message. + +The method must be called on the object where the property belongs (not +inherited from the prototype). + +If the property is a data descriptor, it will be converted to an accessor +descriptor in order to display the deprecation message. + +### process.on('deprecation', fn) + +This module will allow easy capturing of deprecation errors by emitting the +errors as the type "deprecation" on the global `process`. If there are no +listeners for this type, the errors are written to STDERR as normal, but if +there are any listeners, nothing will be written to STDERR and instead only +emitted. From there, you can write the errors in a different format or to a +logging source. + +The error represents the deprecation and is emitted only once with the same +rules as writing to STDERR. The error has the following properties: + + - `message` - This is the message given by the library + - `name` - This is always `'DeprecationError'` + - `namespace` - This is the namespace the deprecation came from + - `stack` - This is the stack of the call to the deprecated thing + +Example `error.stack` output: + +``` +DeprecationError: my-cool-module deprecated oldfunction + at Object. ([eval]-wrapper:6:22) + at Module._compile (module.js:456:26) + at evalScript (node.js:532:25) + at startup (node.js:80:7) + at node.js:902:3 +``` + +### process.env.NO_DEPRECATION + +As a user of modules that are deprecated, the environment variable `NO_DEPRECATION` +is provided as a quick solution to silencing deprecation warnings from being +output. The format of this is similar to that of `DEBUG`: + +```sh +$ NO_DEPRECATION=my-module,othermod node app.js +``` + +This will suppress deprecations from being output for "my-module" and "othermod". +The value is a list of comma-separated namespaces. To suppress every warning +across all namespaces, use the value `*` for a namespace. + +Providing the argument `--no-deprecation` to the `node` executable will suppress +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not suppress the deperecations given to any "deprecation" +event listeners, just the output to STDERR. + +### process.env.TRACE_DEPRECATION + +As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION` +is provided as a solution to getting more detailed location information in deprecation +warnings by including the entire stack trace. The format of this is the same as +`NO_DEPRECATION`: + +```sh +$ TRACE_DEPRECATION=my-module,othermod node app.js +``` + +This will include stack traces for deprecations being output for "my-module" and +"othermod". The value is a list of comma-separated namespaces. To trace every +warning across all namespaces, use the value `*` for a namespace. + +Providing the argument `--trace-deprecation` to the `node` executable will trace +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`. + +## Display + +![message](files/message.png) + +When a user calls a function in your library that you mark deprecated, they +will see the following written to STDERR (in the given colors, similar colors +and layout to the `debug` module): + +``` +bright cyan bright yellow +| | reset cyan +| | | | +▼ ▼ ▼ ▼ +my-cool-module deprecated oldfunction [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ +| | | | +namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +If the user redirects their STDERR to a file or somewhere that does not support +colors, they see (similar layout to the `debug` module): + +``` +Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ ▲ +| | | | | +timestamp of message namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +## Examples + +### Deprecating all calls to a function + +This will display a deprecated message about "oldfunction" being deprecated +from "my-module" on STDERR. + +```js +var deprecate = require('depd')('my-cool-module') + +// message automatically derived from function name +// Object.oldfunction +exports.oldfunction = deprecate.function(function oldfunction() { + // all calls to function are deprecated +}) + +// specific message +exports.oldfunction = deprecate.function(function () { + // all calls to function are deprecated +}, 'oldfunction') +``` + +### Conditionally deprecating a function call + +This will display a deprecated message about "weirdfunction" being deprecated +from "my-module" on STDERR when called with less than 2 arguments. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } +} +``` + +When calling `deprecate` as a function, the warning is counted per call site +within your own module, so you can display different deprecations depending +on different situations and the users will still get all the warnings: + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } else if (typeof arguments[0] !== 'string') { + // calls with non-string first argument are deprecated + deprecate('weirdfunction non-string first arg') + } +} +``` + +### Deprecating property access + +This will display a deprecated message about "oldprop" being deprecated +from "my-module" on STDERR when accessed. A deprecation will be displayed +when setting the value and when getting the value. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.oldprop = 'something' + +// message automatically derives from property name +deprecate.property(exports, 'oldprop') + +// explicit message +deprecate.property(exports, 'oldprop', 'oldprop >= 0.10') +``` + +## License + +[MIT](LICENSE) + +[npm-version-image]: https://img.shields.io/npm/v/depd.svg +[npm-downloads-image]: https://img.shields.io/npm/dm/depd.svg +[npm-url]: https://npmjs.org/package/depd +[travis-image]: https://img.shields.io/travis/dougwilson/nodejs-depd/master.svg?label=linux +[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd +[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/nodejs-depd/master.svg?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd +[coveralls-image]: https://img.shields.io/coveralls/dougwilson/nodejs-depd/master.svg +[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master +[node-image]: https://img.shields.io/node/v/depd.svg +[node-url]: http://nodejs.org/download/ +[gratipay-image]: https://img.shields.io/gratipay/dougwilson.svg +[gratipay-url]: https://www.gratipay.com/dougwilson/ diff --git a/8 node/node_modules/depd/index.js b/8 node/node_modules/depd/index.js new file mode 100644 index 000000000..fddcae875 --- /dev/null +++ b/8 node/node_modules/depd/index.js @@ -0,0 +1,521 @@ +/*! + * depd + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var callSiteToString = require('./lib/compat').callSiteToString +var eventListenerCount = require('./lib/compat').eventListenerCount +var relative = require('path').relative + +/** + * Module exports. + */ + +module.exports = depd + +/** + * Get the path to base files on. + */ + +var basePath = process.cwd() + +/** + * Determine if namespace is contained in the string. + */ + +function containsNamespace(str, namespace) { + var val = str.split(/[ ,]+/) + + namespace = String(namespace).toLowerCase() + + for (var i = 0 ; i < val.length; i++) { + if (!(str = val[i])) continue; + + // namespace contained + if (str === '*' || str.toLowerCase() === namespace) { + return true + } + } + + return false +} + +/** + * Convert a data descriptor to accessor descriptor. + */ + +function convertDataDescriptorToAccessor(obj, prop, message) { + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + var value = descriptor.value + + descriptor.get = function getter() { return value } + + if (descriptor.writable) { + descriptor.set = function setter(val) { return value = val } + } + + delete descriptor.value + delete descriptor.writable + + Object.defineProperty(obj, prop, descriptor) + + return descriptor +} + +/** + * Create arguments string to keep arity. + */ + +function createArgumentsString(arity) { + var str = '' + + for (var i = 0; i < arity; i++) { + str += ', arg' + i + } + + return str.substr(2) +} + +/** + * Create stack string from stack. + */ + +function createStackString(stack) { + var str = this.name + ': ' + this.namespace + + if (this.message) { + str += ' deprecated ' + this.message + } + + for (var i = 0; i < stack.length; i++) { + str += '\n at ' + callSiteToString(stack[i]) + } + + return str +} + +/** + * Create deprecate for namespace in caller. + */ + +function depd(namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + var stack = getStack() + var site = callSiteLocation(stack[1]) + var file = site[0] + + function deprecate(message) { + // call to self as log + log.call(deprecate, message) + } + + deprecate._file = file + deprecate._ignored = isignored(namespace) + deprecate._namespace = namespace + deprecate._traced = istraced(namespace) + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Determine if namespace is ignored. + */ + +function isignored(namespace) { + /* istanbul ignore next: tested in a child processs */ + if (process.noDeprecation) { + // --no-deprecation support + return true + } + + var str = process.env.NO_DEPRECATION || '' + + // namespace ignored + return containsNamespace(str, namespace) +} + +/** + * Determine if namespace is traced. + */ + +function istraced(namespace) { + /* istanbul ignore next: tested in a child processs */ + if (process.traceDeprecation) { + // --trace-deprecation support + return true + } + + var str = process.env.TRACE_DEPRECATION || '' + + // namespace traced + return containsNamespace(str, namespace) +} + +/** + * Display deprecation message. + */ + +function log(message, site) { + var haslisteners = eventListenerCount(process, 'deprecation') !== 0 + + // abort early if no destination + if (!haslisteners && this._ignored) { + return + } + + var caller + var callFile + var callSite + var i = 0 + var seen = false + var stack = getStack() + var file = this._file + + if (site) { + // provided site + callSite = callSiteLocation(stack[1]) + callSite.name = site.name + file = callSite[0] + } else { + // get call site + i = 2 + site = callSiteLocation(stack[i]) + callSite = site + } + + // get caller of deprecated thing in relation to file + for (; i < stack.length; i++) { + caller = callSiteLocation(stack[i]) + callFile = caller[0] + + if (callFile === file) { + seen = true + } else if (callFile === this._file) { + file = this._file + } else if (seen) { + break + } + } + + var key = caller + ? site.join(':') + '__' + caller.join(':') + : undefined + + if (key !== undefined && key in this._warned) { + // already warned + return + } + + this._warned[key] = true + + // generate automatic message from call site + if (!message) { + message = callSite === site || !callSite.name + ? defaultMessage(site) + : defaultMessage(callSite) + } + + // emit deprecation if listeners exist + if (haslisteners) { + var err = DeprecationError(this._namespace, message, stack.slice(i)) + process.emit('deprecation', err) + return + } + + // format and write message + var format = process.stderr.isTTY + ? formatColor + : formatPlain + var msg = format.call(this, message, caller, stack.slice(i)) + process.stderr.write(msg + '\n', 'utf8') + + return +} + +/** + * Get call site location as array. + */ + +function callSiteLocation(callSite) { + var file = callSite.getFileName() || '' + var line = callSite.getLineNumber() + var colm = callSite.getColumnNumber() + + if (callSite.isEval()) { + file = callSite.getEvalOrigin() + ', ' + file + } + + var site = [file, line, colm] + + site.callSite = callSite + site.name = callSite.getFunctionName() + + return site +} + +/** + * Generate a default message from the site. + */ + +function defaultMessage(site) { + var callSite = site.callSite + var funcName = site.name + + // make useful anonymous name + if (!funcName) { + funcName = '' + } + + var context = callSite.getThis() + var typeName = context && callSite.getTypeName() + + // ignore useless type name + if (typeName === 'Object') { + typeName = undefined + } + + // make useful type name + if (typeName === 'Function') { + typeName = context.name || typeName + } + + return typeName && callSite.getMethodName() + ? typeName + '.' + funcName + : funcName +} + +/** + * Format deprecation message without color. + */ + +function formatPlain(msg, caller, stack) { + var timestamp = new Date().toUTCString() + + var formatted = timestamp + + ' ' + this._namespace + + ' deprecated ' + msg + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n at ' + callSiteToString(stack[i]) + } + + return formatted + } + + if (caller) { + formatted += ' at ' + formatLocation(caller) + } + + return formatted +} + +/** + * Format deprecation message with color. + */ + +function formatColor(msg, caller, stack) { + var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' // bold cyan + + ' \x1b[33;1mdeprecated\x1b[22;39m' // bold yellow + + ' \x1b[0m' + msg + '\x1b[39m' // reset + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n \x1b[36mat ' + callSiteToString(stack[i]) + '\x1b[39m' // cyan + } + + return formatted + } + + if (caller) { + formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan + } + + return formatted +} + +/** + * Format call site location. + */ + +function formatLocation(callSite) { + return relative(basePath, callSite[0]) + + ':' + callSite[1] + + ':' + callSite[2] +} + +/** + * Get the stack as array of call sites. + */ + +function getStack() { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = Math.max(10, limit) + + // capture the stack + Error.captureStackTrace(obj) + + // slice this function off the top + var stack = obj.stack.slice(1) + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack +} + +/** + * Capture call site stack from v8. + */ + +function prepareObjectStackTrace(obj, stack) { + return stack +} + +/** + * Return a wrapped function in a deprecation message. + */ + +function wrapfunction(fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + var args = createArgumentsString(fn.length) + var deprecate = this + var stack = getStack() + var site = callSiteLocation(stack[1]) + + site.name = fn.name + + var deprecatedfn = eval('(function (' + args + ') {\n' + + '"use strict"\n' + + 'log.call(deprecate, message, site)\n' + + 'return fn.apply(this, arguments)\n' + + '})') + + return deprecatedfn +} + +/** + * Wrap property in a deprecation message. + */ + +function wrapproperty(obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } + + var deprecate = this + var stack = getStack() + var site = callSiteLocation(stack[1]) + + // set site name + site.name = prop + + // convert data descriptor + if ('value' in descriptor) { + descriptor = convertDataDescriptorToAccessor(obj, prop, message) + } + + var get = descriptor.get + var set = descriptor.set + + // wrap getter + if (typeof get === 'function') { + descriptor.get = function getter() { + log.call(deprecate, message, site) + return get.apply(this, arguments) + } + } + + // wrap setter + if (typeof set === 'function') { + descriptor.set = function setter() { + log.call(deprecate, message, site) + return set.apply(this, arguments) + } + } + + Object.defineProperty(obj, prop, descriptor) +} + +/** + * Create DeprecationError for deprecation + */ + +function DeprecationError(namespace, message, stack) { + var error = new Error() + var stackString + + Object.defineProperty(error, 'constructor', { + value: DeprecationError + }) + + Object.defineProperty(error, 'message', { + configurable: true, + enumerable: false, + value: message, + writable: true + }) + + Object.defineProperty(error, 'name', { + enumerable: false, + configurable: true, + value: 'DeprecationError', + writable: true + }) + + Object.defineProperty(error, 'namespace', { + configurable: true, + enumerable: false, + value: namespace, + writable: true + }) + + Object.defineProperty(error, 'stack', { + configurable: true, + enumerable: false, + get: function () { + if (stackString !== undefined) { + return stackString + } + + // prepare stack trace + return stackString = createStackString.call(this, stack) + }, + set: function setter(val) { + stackString = val + } + }) + + return error +} diff --git a/8 node/node_modules/depd/lib/browser/index.js b/8 node/node_modules/depd/lib/browser/index.js new file mode 100644 index 000000000..f464e0525 --- /dev/null +++ b/8 node/node_modules/depd/lib/browser/index.js @@ -0,0 +1,79 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = depd + +/** + * Create deprecate for namespace in caller. + */ + +function depd(namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + function deprecate(message) { + // no-op in browser + } + + deprecate._file = undefined + deprecate._ignored = true + deprecate._namespace = namespace + deprecate._traced = false + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Return a wrapped function in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapfunction(fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + return fn +} + +/** + * Wrap property in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapproperty(obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } + + return +} diff --git a/8 node/node_modules/depd/lib/compat/buffer-concat.js b/8 node/node_modules/depd/lib/compat/buffer-concat.js new file mode 100644 index 000000000..4b7338102 --- /dev/null +++ b/8 node/node_modules/depd/lib/compat/buffer-concat.js @@ -0,0 +1,35 @@ +/*! + * depd + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = bufferConcat + +/** + * Concatenate an array of Buffers. + */ + +function bufferConcat(bufs) { + var length = 0 + + for (var i = 0, len = bufs.length; i < len; i++) { + length += bufs[i].length + } + + var buf = new Buffer(length) + var pos = 0 + + for (var i = 0, len = bufs.length; i < len; i++) { + bufs[i].copy(buf, pos) + pos += bufs[i].length + } + + return buf +} diff --git a/8 node/node_modules/depd/lib/compat/callsite-tostring.js b/8 node/node_modules/depd/lib/compat/callsite-tostring.js new file mode 100644 index 000000000..9ecef3466 --- /dev/null +++ b/8 node/node_modules/depd/lib/compat/callsite-tostring.js @@ -0,0 +1,103 @@ +/*! + * depd + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = callSiteToString + +/** + * Format a CallSite file location to a string. + */ + +function callSiteFileLocation(callSite) { + var fileName + var fileLocation = '' + + if (callSite.isNative()) { + fileLocation = 'native' + } else if (callSite.isEval()) { + fileName = callSite.getScriptNameOrSourceURL() + if (!fileName) { + fileLocation = callSite.getEvalOrigin() + } + } else { + fileName = callSite.getFileName() + } + + if (fileName) { + fileLocation += fileName + + var lineNumber = callSite.getLineNumber() + if (lineNumber != null) { + fileLocation += ':' + lineNumber + + var columnNumber = callSite.getColumnNumber() + if (columnNumber) { + fileLocation += ':' + columnNumber + } + } + } + + return fileLocation || 'unknown source' +} + +/** + * Format a CallSite to a string. + */ + +function callSiteToString(callSite) { + var addSuffix = true + var fileLocation = callSiteFileLocation(callSite) + var functionName = callSite.getFunctionName() + var isConstructor = callSite.isConstructor() + var isMethodCall = !(callSite.isToplevel() || isConstructor) + var line = '' + + if (isMethodCall) { + var methodName = callSite.getMethodName() + var typeName = getConstructorName(callSite) + + if (functionName) { + if (typeName && functionName.indexOf(typeName) !== 0) { + line += typeName + '.' + } + + line += functionName + + if (methodName && functionName.lastIndexOf('.' + methodName) !== functionName.length - methodName.length - 1) { + line += ' [as ' + methodName + ']' + } + } else { + line += typeName + '.' + (methodName || '') + } + } else if (isConstructor) { + line += 'new ' + (functionName || '') + } else if (functionName) { + line += functionName + } else { + addSuffix = false + line += fileLocation + } + + if (addSuffix) { + line += ' (' + fileLocation + ')' + } + + return line +} + +/** + * Get constructor name of reviver. + */ + +function getConstructorName(obj) { + var receiver = obj.receiver + return (receiver.constructor && receiver.constructor.name) || null +} diff --git a/8 node/node_modules/depd/lib/compat/event-listener-count.js b/8 node/node_modules/depd/lib/compat/event-listener-count.js new file mode 100644 index 000000000..a05fceb79 --- /dev/null +++ b/8 node/node_modules/depd/lib/compat/event-listener-count.js @@ -0,0 +1,22 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = eventListenerCount + +/** + * Get the count of listeners on an event emitter of a specific type. + */ + +function eventListenerCount(emitter, type) { + return emitter.listeners(type).length +} diff --git a/8 node/node_modules/depd/lib/compat/index.js b/8 node/node_modules/depd/lib/compat/index.js new file mode 100644 index 000000000..aa3c1de43 --- /dev/null +++ b/8 node/node_modules/depd/lib/compat/index.js @@ -0,0 +1,84 @@ +/*! + * depd + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Buffer = require('buffer') +var EventEmitter = require('events').EventEmitter + +/** + * Module exports. + * @public + */ + +lazyProperty(module.exports, 'bufferConcat', function bufferConcat() { + return Buffer.concat || require('./buffer-concat') +}) + +lazyProperty(module.exports, 'callSiteToString', function callSiteToString() { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + function prepareObjectStackTrace(obj, stack) { + return stack + } + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = 2 + + // capture the stack + Error.captureStackTrace(obj) + + // slice the stack + var stack = obj.stack.slice() + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack[0].toString ? toString : require('./callsite-tostring') +}) + +lazyProperty(module.exports, 'eventListenerCount', function eventListenerCount() { + return EventEmitter.listenerCount || require('./event-listener-count') +}) + +/** + * Define a lazy property. + */ + +function lazyProperty(obj, prop, getter) { + function get() { + var val = getter() + + Object.defineProperty(obj, prop, { + configurable: true, + enumerable: true, + value: val + }) + + return val + } + + Object.defineProperty(obj, prop, { + configurable: true, + enumerable: true, + get: get + }) +} + +/** + * Call toString() on the obj + */ + +function toString(obj) { + return obj.toString() +} diff --git a/8 node/node_modules/depd/package.json b/8 node/node_modules/depd/package.json new file mode 100644 index 000000000..61d039ff0 --- /dev/null +++ b/8 node/node_modules/depd/package.json @@ -0,0 +1,72 @@ +{ + "_from": "depd@~1.1.0", + "_id": "depd@1.1.0", + "_inBundle": false, + "_integrity": "sha1-4b2Cxqq2ztlluXuIsX7T5SjKGMM=", + "_location": "/depd", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "depd@~1.1.0", + "name": "depd", + "escapedName": "depd", + "rawSpec": "~1.1.0", + "saveSpec": null, + "fetchSpec": "~1.1.0" + }, + "_requiredBy": [ + "/express", + "/http-errors", + "/send" + ], + "_resolved": "https://registry.npmjs.org/depd/-/depd-1.1.0.tgz", + "_shasum": "e1bd82c6aab6ced965b97b88b17ed3e528ca18c3", + "_spec": "depd@~1.1.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "browser": "lib/browser/index.js", + "bugs": { + "url": "https://github.com/dougwilson/nodejs-depd/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Deprecate all the things", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "1.0.0", + "istanbul": "0.3.5", + "mocha": "~1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "lib/", + "History.md", + "LICENSE", + "index.js", + "Readme.md" + ], + "homepage": "https://github.com/dougwilson/nodejs-depd#readme", + "keywords": [ + "deprecate", + "deprecated" + ], + "license": "MIT", + "name": "depd", + "repository": { + "type": "git", + "url": "git+https://github.com/dougwilson/nodejs-depd.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "test": "mocha --reporter spec --bail test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --no-exit test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/" + }, + "version": "1.1.0" +} diff --git a/8 node/node_modules/destroy/LICENSE b/8 node/node_modules/destroy/LICENSE new file mode 100644 index 000000000..a7ae8ee9b --- /dev/null +++ b/8 node/node_modules/destroy/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/8 node/node_modules/destroy/README.md b/8 node/node_modules/destroy/README.md new file mode 100644 index 000000000..6474bc3ce --- /dev/null +++ b/8 node/node_modules/destroy/README.md @@ -0,0 +1,60 @@ +# Destroy + +[![NPM version][npm-image]][npm-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] +[![Gittip][gittip-image]][gittip-url] + +Destroy a stream. + +This module is meant to ensure a stream gets destroyed, handling different APIs +and Node.js bugs. + +## API + +```js +var destroy = require('destroy') +``` + +### destroy(stream) + +Destroy the given stream. In most cases, this is identical to a simple +`stream.destroy()` call. The rules are as follows for a given stream: + + 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()` + and add a listener to the `open` event to call `stream.close()` if it is + fired. This is for a Node.js bug that will leak a file descriptor if + `.destroy()` is called before `open`. + 2. If the `stream` is not an instance of `Stream`, then nothing happens. + 3. If the `stream` has a `.destroy()` method, then call it. + +The function returns the `stream` passed in as the argument. + +## Example + +```js +var destroy = require('destroy') + +var fs = require('fs') +var stream = fs.createReadStream('package.json') + +// ... and later +destroy(stream) +``` + +[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square +[npm-url]: https://npmjs.org/package/destroy +[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square +[github-url]: https://github.com/stream-utils/destroy/tags +[travis-image]: https://img.shields.io/travis/stream-utils/destroy.svg?style=flat-square +[travis-url]: https://travis-ci.org/stream-utils/destroy +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master +[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/destroy +[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square +[gittip-url]: https://www.gittip.com/jonathanong/ diff --git a/8 node/node_modules/destroy/index.js b/8 node/node_modules/destroy/index.js new file mode 100644 index 000000000..6da2d26ee --- /dev/null +++ b/8 node/node_modules/destroy/index.js @@ -0,0 +1,75 @@ +/*! + * destroy + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var ReadStream = require('fs').ReadStream +var Stream = require('stream') + +/** + * Module exports. + * @public + */ + +module.exports = destroy + +/** + * Destroy a stream. + * + * @param {object} stream + * @public + */ + +function destroy(stream) { + if (stream instanceof ReadStream) { + return destroyReadStream(stream) + } + + if (!(stream instanceof Stream)) { + return stream + } + + if (typeof stream.destroy === 'function') { + stream.destroy() + } + + return stream +} + +/** + * Destroy a ReadStream. + * + * @param {object} stream + * @private + */ + +function destroyReadStream(stream) { + stream.destroy() + + if (typeof stream.close === 'function') { + // node.js core bug work-around + stream.on('open', onOpenClose) + } + + return stream +} + +/** + * On open handler to close stream. + * @private + */ + +function onOpenClose() { + if (typeof this.fd === 'number') { + // actually close down the fd + this.close() + } +} diff --git a/8 node/node_modules/destroy/package.json b/8 node/node_modules/destroy/package.json new file mode 100644 index 000000000..85b846013 --- /dev/null +++ b/8 node/node_modules/destroy/package.json @@ -0,0 +1,71 @@ +{ + "_from": "destroy@~1.0.4", + "_id": "destroy@1.0.4", + "_inBundle": false, + "_integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=", + "_location": "/destroy", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "destroy@~1.0.4", + "name": "destroy", + "escapedName": "destroy", + "rawSpec": "~1.0.4", + "saveSpec": null, + "fetchSpec": "~1.0.4" + }, + "_requiredBy": [ + "/send" + ], + "_resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz", + "_shasum": "978857442c44749e4206613e37946205826abd80", + "_spec": "destroy@~1.0.4", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/send", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/stream-utils/destroy/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "destroy a stream if possible", + "devDependencies": { + "istanbul": "0.4.2", + "mocha": "2.3.4" + }, + "files": [ + "index.js", + "LICENSE" + ], + "homepage": "https://github.com/stream-utils/destroy#readme", + "keywords": [ + "stream", + "streams", + "destroy", + "cleanup", + "leak", + "fd" + ], + "license": "MIT", + "name": "destroy", + "repository": { + "type": "git", + "url": "git+https://github.com/stream-utils/destroy.git" + }, + "scripts": { + "test": "mocha --reporter spec", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot" + }, + "version": "1.0.4" +} diff --git a/8 node/node_modules/ee-first/LICENSE b/8 node/node_modules/ee-first/LICENSE new file mode 100644 index 000000000..a7ae8ee9b --- /dev/null +++ b/8 node/node_modules/ee-first/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/8 node/node_modules/ee-first/README.md b/8 node/node_modules/ee-first/README.md new file mode 100644 index 000000000..cbd2478be --- /dev/null +++ b/8 node/node_modules/ee-first/README.md @@ -0,0 +1,80 @@ +# EE First + +[![NPM version][npm-image]][npm-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] +[![Gittip][gittip-image]][gittip-url] + +Get the first event in a set of event emitters and event pairs, +then clean up after itself. + +## Install + +```sh +$ npm install ee-first +``` + +## API + +```js +var first = require('ee-first') +``` + +### first(arr, listener) + +Invoke `listener` on the first event from the list specified in `arr`. `arr` is +an array of arrays, with each array in the format `[ee, ...event]`. `listener` +will be called only once, the first time any of the given events are emitted. If +`error` is one of the listened events, then if that fires first, the `listener` +will be given the `err` argument. + +The `listener` is invoked as `listener(err, ee, event, args)`, where `err` is the +first argument emitted from an `error` event, if applicable; `ee` is the event +emitter that fired; `event` is the string event name that fired; and `args` is an +array of the arguments that were emitted on the event. + +```js +var ee1 = new EventEmitter() +var ee2 = new EventEmitter() + +first([ + [ee1, 'close', 'end', 'error'], + [ee2, 'error'] +], function (err, ee, event, args) { + // listener invoked +}) +``` + +#### .cancel() + +The group of listeners can be cancelled before being invoked and have all the event +listeners removed from the underlying event emitters. + +```js +var thunk = first([ + [ee1, 'close', 'end', 'error'], + [ee2, 'error'] +], function (err, ee, event, args) { + // listener invoked +}) + +// cancel and clean up +thunk.cancel() +``` + +[npm-image]: https://img.shields.io/npm/v/ee-first.svg?style=flat-square +[npm-url]: https://npmjs.org/package/ee-first +[github-tag]: http://img.shields.io/github/tag/jonathanong/ee-first.svg?style=flat-square +[github-url]: https://github.com/jonathanong/ee-first/tags +[travis-image]: https://img.shields.io/travis/jonathanong/ee-first.svg?style=flat-square +[travis-url]: https://travis-ci.org/jonathanong/ee-first +[coveralls-image]: https://img.shields.io/coveralls/jonathanong/ee-first.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/jonathanong/ee-first?branch=master +[license-image]: http://img.shields.io/npm/l/ee-first.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/ee-first.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/ee-first +[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square +[gittip-url]: https://www.gittip.com/jonathanong/ diff --git a/8 node/node_modules/ee-first/index.js b/8 node/node_modules/ee-first/index.js new file mode 100644 index 000000000..501287cd3 --- /dev/null +++ b/8 node/node_modules/ee-first/index.js @@ -0,0 +1,95 @@ +/*! + * ee-first + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = first + +/** + * Get the first event in a set of event emitters and event pairs. + * + * @param {array} stuff + * @param {function} done + * @public + */ + +function first(stuff, done) { + if (!Array.isArray(stuff)) + throw new TypeError('arg must be an array of [ee, events...] arrays') + + var cleanups = [] + + for (var i = 0; i < stuff.length; i++) { + var arr = stuff[i] + + if (!Array.isArray(arr) || arr.length < 2) + throw new TypeError('each array member must be [ee, events...]') + + var ee = arr[0] + + for (var j = 1; j < arr.length; j++) { + var event = arr[j] + var fn = listener(event, callback) + + // listen to the event + ee.on(event, fn) + // push this listener to the list of cleanups + cleanups.push({ + ee: ee, + event: event, + fn: fn, + }) + } + } + + function callback() { + cleanup() + done.apply(null, arguments) + } + + function cleanup() { + var x + for (var i = 0; i < cleanups.length; i++) { + x = cleanups[i] + x.ee.removeListener(x.event, x.fn) + } + } + + function thunk(fn) { + done = fn + } + + thunk.cancel = cleanup + + return thunk +} + +/** + * Create the event listener. + * @private + */ + +function listener(event, done) { + return function onevent(arg1) { + var args = new Array(arguments.length) + var ee = this + var err = event === 'error' + ? arg1 + : null + + // copy args to prevent arguments escaping scope + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i] + } + + done(err, ee, event, args) + } +} diff --git a/8 node/node_modules/ee-first/package.json b/8 node/node_modules/ee-first/package.json new file mode 100644 index 000000000..5eaed93a4 --- /dev/null +++ b/8 node/node_modules/ee-first/package.json @@ -0,0 +1,63 @@ +{ + "_from": "ee-first@1.1.1", + "_id": "ee-first@1.1.1", + "_inBundle": false, + "_integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=", + "_location": "/ee-first", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ee-first@1.1.1", + "name": "ee-first", + "escapedName": "ee-first", + "rawSpec": "1.1.1", + "saveSpec": null, + "fetchSpec": "1.1.1" + }, + "_requiredBy": [ + "/on-finished" + ], + "_resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "_shasum": "590c61156b0ae2f4f0255732a158b266bc56b21d", + "_spec": "ee-first@1.1.1", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/on-finished", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/jonathanong/ee-first/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "return the first event in a set of ee/event pairs", + "devDependencies": { + "istanbul": "0.3.9", + "mocha": "2.2.5" + }, + "files": [ + "index.js", + "LICENSE" + ], + "homepage": "https://github.com/jonathanong/ee-first#readme", + "license": "MIT", + "name": "ee-first", + "repository": { + "type": "git", + "url": "git+https://github.com/jonathanong/ee-first.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.1" +} diff --git a/8 node/node_modules/encodeurl/HISTORY.md b/8 node/node_modules/encodeurl/HISTORY.md new file mode 100644 index 000000000..06d34a5aa --- /dev/null +++ b/8 node/node_modules/encodeurl/HISTORY.md @@ -0,0 +1,9 @@ +1.0.1 / 2016-06-09 +================== + + * Fix encoding unpaired surrogates at start/end of string + +1.0.0 / 2016-06-08 +================== + + * Initial release diff --git a/8 node/node_modules/encodeurl/LICENSE b/8 node/node_modules/encodeurl/LICENSE new file mode 100644 index 000000000..8812229bc --- /dev/null +++ b/8 node/node_modules/encodeurl/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/encodeurl/README.md b/8 node/node_modules/encodeurl/README.md new file mode 100644 index 000000000..b086133cc --- /dev/null +++ b/8 node/node_modules/encodeurl/README.md @@ -0,0 +1,124 @@ +# encodeurl + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Encode a URL to a percent-encoded form, excluding already-encoded sequences + +## Installation + +```sh +$ npm install encodeurl +``` + +## API + +```js +var encodeUrl = require('encodeurl') +``` + +### encodeUrl(url) + +Encode a URL to a percent-encoded form, excluding already-encoded sequences. + +This function will take an already-encoded URL and encode all the non-URL +code points (as UTF-8 byte sequences). This function will not encode the +"%" character unless it is not part of a valid sequence (`%20` will be +left as-is, but `%foo` will be encoded as `%25foo`). + +This encode is meant to be "safe" and does not throw errors. It will try as +hard as it can to properly encode the given URL, including replacing any raw, +unpaired surrogate pairs with the Unicode replacement character prior to +encoding. + +This function is _similar_ to the intrinsic function `encodeURI`, except it +will not encode the `%` character if that is part of a valid sequence, will +not encode `[` and `]` (for IPv6 hostnames) and will replace raw, unpaired +surrogate pairs with the Unicode replacement character (instead of throwing). + +## Examples + +### Encode a URL containing user-controled data + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') + +http.createServer(function onRequest (req, res) { + // get encoded form of inbound url + var url = encodeUrl(req.url) + + // create html message + var body = '

Location ' + escapeHtml(url) + ' not found

' + + // send a 404 + res.statusCode = 404 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.end(body, 'utf-8') +}) +``` + +### Encode a URL for use in a header field + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var url = require('url') + +http.createServer(function onRequest (req, res) { + // parse inbound url + var href = url.parse(req) + + // set new host for redirect + href.host = 'localhost' + href.protocol = 'https:' + href.slashes = true + + // create location header + var location = encodeUrl(url.format(href)) + + // create html message + var body = '

Redirecting to new site: ' + escapeHtml(location) + '

' + + // send a 301 + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.setHeader('Location', location) + res.end(body, 'utf-8') +}) +``` + +## Testing + +```sh +$ npm test +$ npm run lint +``` + +## References + +- [RFC 3986: Uniform Resource Identifier (URI): Generic Syntax][rfc-3986] +- [WHATWG URL Living Standard][whatwg-url] + +[rfc-3986]: https://tools.ietf.org/html/rfc3986 +[whatwg-url]: https://url.spec.whatwg.org/ + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/encodeurl.svg +[npm-url]: https://npmjs.org/package/encodeurl +[node-version-image]: https://img.shields.io/node/v/encodeurl.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/pillarjs/encodeurl.svg +[travis-url]: https://travis-ci.org/pillarjs/encodeurl +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/encodeurl.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/encodeurl?branch=master +[downloads-image]: https://img.shields.io/npm/dm/encodeurl.svg +[downloads-url]: https://npmjs.org/package/encodeurl diff --git a/8 node/node_modules/encodeurl/index.js b/8 node/node_modules/encodeurl/index.js new file mode 100644 index 000000000..ae77cc94d --- /dev/null +++ b/8 node/node_modules/encodeurl/index.js @@ -0,0 +1,60 @@ +/*! + * encodeurl + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = encodeUrl + +/** + * RegExp to match non-URL code points, *after* encoding (i.e. not including "%") + * and including invalid escape sequences. + * @private + */ + +var ENCODE_CHARS_REGEXP = /(?:[^\x21\x25\x26-\x3B\x3D\x3F-\x5B\x5D\x5F\x61-\x7A\x7E]|%(?:[^0-9A-Fa-f]|[0-9A-Fa-f][^0-9A-Fa-f]))+/g + +/** + * RegExp to match unmatched surrogate pair. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REGEXP = /(^|[^\uD800-\uDBFF])[\uDC00-\uDFFF]|[\uD800-\uDBFF]([^\uDC00-\uDFFF]|$)/g + +/** + * String to replace unmatched surrogate pair with. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REPLACE = '$1\uFFFD$2' + +/** + * Encode a URL to a percent-encoded form, excluding already-encoded sequences. + * + * This function will take an already-encoded URL and encode all the non-URL + * code points. This function will not encode the "%" character unless it is + * not part of a valid sequence (`%20` will be left as-is, but `%foo` will + * be encoded as `%25foo`). + * + * This encode is meant to be "safe" and does not throw errors. It will try as + * hard as it can to properly encode the given URL, including replacing any raw, + * unpaired surrogate pairs with the Unicode replacement character prior to + * encoding. + * + * @param {string} url + * @return {string} + * @public + */ + +function encodeUrl (url) { + return String(url) + .replace(UNMATCHED_SURROGATE_PAIR_REGEXP, UNMATCHED_SURROGATE_PAIR_REPLACE) + .replace(ENCODE_CHARS_REGEXP, encodeURI) +} diff --git a/8 node/node_modules/encodeurl/package.json b/8 node/node_modules/encodeurl/package.json new file mode 100644 index 000000000..ebc05f8cd --- /dev/null +++ b/8 node/node_modules/encodeurl/package.json @@ -0,0 +1,76 @@ +{ + "_from": "encodeurl@~1.0.1", + "_id": "encodeurl@1.0.1", + "_inBundle": false, + "_integrity": "sha1-eePVhlU0aQn+bw9Fpd5oEDspTSA=", + "_location": "/encodeurl", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "encodeurl@~1.0.1", + "name": "encodeurl", + "escapedName": "encodeurl", + "rawSpec": "~1.0.1", + "saveSpec": null, + "fetchSpec": "~1.0.1" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/send", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.1.tgz", + "_shasum": "79e3d58655346909fe6f0f45a5de68103b294d20", + "_spec": "encodeurl@~1.0.1", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "bugs": { + "url": "https://github.com/pillarjs/encodeurl/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "Encode a URL to a percent-encoded form, excluding already-encoded sequences", + "devDependencies": { + "eslint": "2.11.1", + "eslint-config-standard": "5.3.1", + "eslint-plugin-promise": "1.3.2", + "eslint-plugin-standard": "1.3.2", + "istanbul": "0.4.3", + "mocha": "2.5.3" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/pillarjs/encodeurl#readme", + "keywords": [ + "encode", + "encodeurl", + "url" + ], + "license": "MIT", + "name": "encodeurl", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/encodeurl.git" + }, + "scripts": { + "lint": "eslint **/*.js", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.0.1" +} diff --git a/8 node/node_modules/escape-html/LICENSE b/8 node/node_modules/escape-html/LICENSE new file mode 100644 index 000000000..2e70de971 --- /dev/null +++ b/8 node/node_modules/escape-html/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2013 TJ Holowaychuk +Copyright (c) 2015 Andreas Lubbe +Copyright (c) 2015 Tiancheng "Timothy" Gu + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/escape-html/Readme.md b/8 node/node_modules/escape-html/Readme.md new file mode 100644 index 000000000..653d9eaa7 --- /dev/null +++ b/8 node/node_modules/escape-html/Readme.md @@ -0,0 +1,43 @@ + +# escape-html + + Escape string for use in HTML + +## Example + +```js +var escape = require('escape-html'); +var html = escape('foo & bar'); +// -> foo & bar +``` + +## Benchmark + +``` +$ npm run-script bench + +> escape-html@1.0.3 bench nodejs-escape-html +> node benchmark/index.js + + + http_parser@1.0 + node@0.10.33 + v8@3.14.5.9 + ares@1.9.0-DEV + uv@0.10.29 + zlib@1.2.3 + modules@11 + openssl@1.0.1j + + 1 test completed. + 2 tests completed. + 3 tests completed. + + no special characters x 19,435,271 ops/sec ±0.85% (187 runs sampled) + single special character x 6,132,421 ops/sec ±0.67% (194 runs sampled) + many special characters x 3,175,826 ops/sec ±0.65% (193 runs sampled) +``` + +## License + + MIT \ No newline at end of file diff --git a/8 node/node_modules/escape-html/index.js b/8 node/node_modules/escape-html/index.js new file mode 100644 index 000000000..bf9e226f4 --- /dev/null +++ b/8 node/node_modules/escape-html/index.js @@ -0,0 +1,78 @@ +/*! + * escape-html + * Copyright(c) 2012-2013 TJ Holowaychuk + * Copyright(c) 2015 Andreas Lubbe + * Copyright(c) 2015 Tiancheng "Timothy" Gu + * MIT Licensed + */ + +'use strict'; + +/** + * Module variables. + * @private + */ + +var matchHtmlRegExp = /["'&<>]/; + +/** + * Module exports. + * @public + */ + +module.exports = escapeHtml; + +/** + * Escape special characters in the given string of html. + * + * @param {string} string The string to escape for inserting into HTML + * @return {string} + * @public + */ + +function escapeHtml(string) { + var str = '' + string; + var match = matchHtmlRegExp.exec(str); + + if (!match) { + return str; + } + + var escape; + var html = ''; + var index = 0; + var lastIndex = 0; + + for (index = match.index; index < str.length; index++) { + switch (str.charCodeAt(index)) { + case 34: // " + escape = '"'; + break; + case 38: // & + escape = '&'; + break; + case 39: // ' + escape = '''; + break; + case 60: // < + escape = '<'; + break; + case 62: // > + escape = '>'; + break; + default: + continue; + } + + if (lastIndex !== index) { + html += str.substring(lastIndex, index); + } + + lastIndex = index + 1; + html += escape; + } + + return lastIndex !== index + ? html + str.substring(lastIndex, index) + : html; +} diff --git a/8 node/node_modules/escape-html/package.json b/8 node/node_modules/escape-html/package.json new file mode 100644 index 000000000..5a148056c --- /dev/null +++ b/8 node/node_modules/escape-html/package.json @@ -0,0 +1,59 @@ +{ + "_from": "escape-html@~1.0.3", + "_id": "escape-html@1.0.3", + "_inBundle": false, + "_integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=", + "_location": "/escape-html", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "escape-html@~1.0.3", + "name": "escape-html", + "escapedName": "escape-html", + "rawSpec": "~1.0.3", + "saveSpec": null, + "fetchSpec": "~1.0.3" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/send", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "_shasum": "0258eae4d3d0c0974de1c169188ef0051d1d1988", + "_spec": "escape-html@~1.0.3", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "bugs": { + "url": "https://github.com/component/escape-html/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Escape string for use in HTML", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "1.0.0" + }, + "files": [ + "LICENSE", + "Readme.md", + "index.js" + ], + "homepage": "https://github.com/component/escape-html#readme", + "keywords": [ + "escape", + "html", + "utility" + ], + "license": "MIT", + "name": "escape-html", + "repository": { + "type": "git", + "url": "git+https://github.com/component/escape-html.git" + }, + "scripts": { + "bench": "node benchmark/index.js" + }, + "version": "1.0.3" +} diff --git a/8 node/node_modules/etag/HISTORY.md b/8 node/node_modules/etag/HISTORY.md new file mode 100644 index 000000000..136da8c69 --- /dev/null +++ b/8 node/node_modules/etag/HISTORY.md @@ -0,0 +1,78 @@ +1.8.0 / 2017-02-18 +================== + + * Use SHA1 instead of MD5 for ETag hashing + - Improves performance for larger entities + - Works with FIPS 140-2 OpenSSL configuration + +1.7.0 / 2015-06-08 +================== + + * Always include entity length in ETags for hash length extensions + * Generate non-Stats ETags using MD5 only (no longer CRC32) + * Improve stat performance by removing hashing + * Remove base64 padding in ETags to shorten + * Use MD5 instead of MD4 in weak ETags over 1KB + +1.6.0 / 2015-05-10 +================== + + * Improve support for JXcore + * Remove requirement of `atime` in the stats object + * Support "fake" stats objects in environments without `fs` + +1.5.1 / 2014-11-19 +================== + + * deps: crc@3.2.1 + - Minor fixes + +1.5.0 / 2014-10-14 +================== + + * Improve string performance + * Slightly improve speed for weak ETags over 1KB + +1.4.0 / 2014-09-21 +================== + + * Support "fake" stats objects + * Support Node.js 0.6 + +1.3.1 / 2014-09-14 +================== + + * Use the (new and improved) `crc` for crc32 + +1.3.0 / 2014-08-29 +================== + + * Default strings to strong ETags + * Improve speed for weak ETags over 1KB + +1.2.1 / 2014-08-29 +================== + + * Use the (much faster) `buffer-crc32` for crc32 + +1.2.0 / 2014-08-24 +================== + + * Add support for file stat objects + +1.1.0 / 2014-08-24 +================== + + * Add fast-path for empty entity + * Add weak ETag generation + * Shrink size of generated ETags + +1.0.1 / 2014-08-24 +================== + + * Fix behavior of string containing Unicode + +1.0.0 / 2014-05-18 +================== + + * Initial release diff --git a/8 node/node_modules/etag/LICENSE b/8 node/node_modules/etag/LICENSE new file mode 100644 index 000000000..cab251c2b --- /dev/null +++ b/8 node/node_modules/etag/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/etag/README.md b/8 node/node_modules/etag/README.md new file mode 100644 index 000000000..9963a5fc4 --- /dev/null +++ b/8 node/node_modules/etag/README.md @@ -0,0 +1,159 @@ +# etag + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create simple HTTP ETags + +This module generates HTTP ETags (as defined in RFC 7232) for use in +HTTP responses. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install etag +``` + +## API + + + +```js +var etag = require('etag') +``` + +### etag(entity, [options]) + +Generate a strong ETag for the given entity. This should be the complete +body of the entity. Strings, `Buffer`s, and `fs.Stats` are accepted. By +default, a strong ETag is generated except for `fs.Stats`, which will +generate a weak ETag (this can be overwritten by `options.weak`). + + + +```js +res.setHeader('ETag', etag(body)) +``` + +#### Options + +`etag` accepts these properties in the options object. + +##### weak + +Specifies if the generated ETag will include the weak validator mark (that +is, the leading `W/`). The actual entity tag is the same. The default value +is `false`, unless the `entity` is `fs.Stats`, in which case it is `true`. + +## Testing + +```sh +$ npm test +``` + +## Benchmark + +```bash +$ npm run-script bench + +> etag@1.8.0 bench nodejs-etag +> node benchmark/index.js + + http_parser@2.7.0 + node@6.9.1 + v8@5.1.281.84 + uv@1.9.1 + zlib@1.2.8 + ares@1.10.1-DEV + icu@57.1 + modules@48 + openssl@1.0.2j + +> node benchmark/body0-100b.js + + 100B body + + 4 tests completed. + +* buffer - strong x 498,600 ops/sec ±0.82% (191 runs sampled) +* buffer - weak x 496,249 ops/sec ±0.59% (179 runs sampled) + string - strong x 466,298 ops/sec ±0.88% (186 runs sampled) + string - weak x 464,298 ops/sec ±0.84% (184 runs sampled) + +> node benchmark/body1-1kb.js + + 1KB body + + 4 tests completed. + +* buffer - strong x 346,535 ops/sec ±0.32% (189 runs sampled) +* buffer - weak x 344,958 ops/sec ±0.52% (185 runs sampled) + string - strong x 259,672 ops/sec ±0.82% (191 runs sampled) + string - weak x 260,931 ops/sec ±0.76% (190 runs sampled) + +> node benchmark/body2-5kb.js + + 5KB body + + 4 tests completed. + +* buffer - strong x 136,510 ops/sec ±0.62% (189 runs sampled) +* buffer - weak x 136,604 ops/sec ±0.51% (191 runs sampled) + string - strong x 80,903 ops/sec ±0.84% (192 runs sampled) + string - weak x 82,785 ops/sec ±0.50% (193 runs sampled) + +> node benchmark/body3-10kb.js + + 10KB body + + 4 tests completed. + +* buffer - strong x 78,650 ops/sec ±0.31% (193 runs sampled) +* buffer - weak x 78,685 ops/sec ±0.41% (193 runs sampled) + string - strong x 43,999 ops/sec ±0.43% (193 runs sampled) + string - weak x 44,081 ops/sec ±0.45% (192 runs sampled) + +> node benchmark/body4-100kb.js + + 100KB body + + 4 tests completed. + + buffer - strong x 8,860 ops/sec ±0.66% (191 runs sampled) +* buffer - weak x 9,030 ops/sec ±0.26% (193 runs sampled) + string - strong x 4,838 ops/sec ±0.16% (194 runs sampled) + string - weak x 4,800 ops/sec ±0.52% (192 runs sampled) + +> node benchmark/stats.js + + stat + + 4 tests completed. + +* real - strong x 1,468,073 ops/sec ±0.32% (191 runs sampled) +* real - weak x 1,446,852 ops/sec ±0.64% (190 runs sampled) + fake - strong x 635,707 ops/sec ±0.33% (194 runs sampled) + fake - weak x 627,708 ops/sec ±0.36% (192 runs sampled) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/etag.svg +[npm-url]: https://npmjs.org/package/etag +[node-version-image]: https://img.shields.io/node/v/etag.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/etag/master.svg +[travis-url]: https://travis-ci.org/jshttp/etag +[coveralls-image]: https://img.shields.io/coveralls/jshttp/etag/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/etag?branch=master +[downloads-image]: https://img.shields.io/npm/dm/etag.svg +[downloads-url]: https://npmjs.org/package/etag diff --git a/8 node/node_modules/etag/index.js b/8 node/node_modules/etag/index.js new file mode 100644 index 000000000..607f1488e --- /dev/null +++ b/8 node/node_modules/etag/index.js @@ -0,0 +1,132 @@ +/*! + * etag + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = etag + +/** + * Module dependencies. + * @private + */ + +var crypto = require('crypto') +var Stats = require('fs').Stats + +/** + * Module variables. + * @private + */ + +var base64PadCharRegExp = /=+$/ +var toString = Object.prototype.toString + +/** + * Generate an entity tag. + * + * @param {Buffer|string} entity + * @return {string} + * @private + */ + +function entitytag (entity) { + if (entity.length === 0) { + // fast-path empty + return '"0-2jmj7l5rSw0yVb/vlWAYkK/YBwk"' + } + + // compute hash of entity + var hash = crypto + .createHash('sha1') + .update(entity, 'utf8') + .digest('base64') + .replace(base64PadCharRegExp, '') + + // compute length of entity + var len = typeof entity === 'string' + ? Buffer.byteLength(entity, 'utf8') + : entity.length + + return '"' + len.toString(16) + '-' + hash + '"' +} + +/** + * Create a simple ETag. + * + * @param {string|Buffer|Stats} entity + * @param {object} [options] + * @param {boolean} [options.weak] + * @return {String} + * @public + */ + +function etag (entity, options) { + if (entity == null) { + throw new TypeError('argument entity is required') + } + + // support fs.Stats object + var isStats = isstats(entity) + var weak = options && typeof options.weak === 'boolean' + ? options.weak + : isStats + + // validate argument + if (!isStats && typeof entity !== 'string' && !Buffer.isBuffer(entity)) { + throw new TypeError('argument entity must be string, Buffer, or fs.Stats') + } + + // generate entity tag + var tag = isStats + ? stattag(entity) + : entitytag(entity) + + return weak + ? 'W/' + tag + : tag +} + +/** + * Determine if object is a Stats object. + * + * @param {object} obj + * @return {boolean} + * @api private + */ + +function isstats (obj) { + // genuine fs.Stats + if (typeof Stats === 'function' && obj instanceof Stats) { + return true + } + + // quack quack + return obj && typeof obj === 'object' && + 'ctime' in obj && toString.call(obj.ctime) === '[object Date]' && + 'mtime' in obj && toString.call(obj.mtime) === '[object Date]' && + 'ino' in obj && typeof obj.ino === 'number' && + 'size' in obj && typeof obj.size === 'number' +} + +/** + * Generate a tag for a stat. + * + * @param {object} stat + * @return {string} + * @private + */ + +function stattag (stat) { + var mtime = stat.mtime.getTime().toString(16) + var size = stat.size.toString(16) + + return '"' + size + '-' + mtime + '"' +} diff --git a/8 node/node_modules/etag/package.json b/8 node/node_modules/etag/package.json new file mode 100644 index 000000000..0cfc4258c --- /dev/null +++ b/8 node/node_modules/etag/package.json @@ -0,0 +1,83 @@ +{ + "_from": "etag@~1.8.0", + "_id": "etag@1.8.0", + "_inBundle": false, + "_integrity": "sha1-b2Ma7zNtbEY2K1F2QETOIWvjwFE=", + "_location": "/etag", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "etag@~1.8.0", + "name": "etag", + "escapedName": "etag", + "rawSpec": "~1.8.0", + "saveSpec": null, + "fetchSpec": "~1.8.0" + }, + "_requiredBy": [ + "/express", + "/send" + ], + "_resolved": "https://registry.npmjs.org/etag/-/etag-1.8.0.tgz", + "_shasum": "6f631aef336d6c46362b51764044ce216be3c051", + "_spec": "etag@~1.8.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/etag/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "David Björklund", + "email": "david.bjorklund@gmail.com" + } + ], + "deprecated": false, + "description": "Create simple HTTP ETags", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.3", + "eslint": "3.15.0", + "eslint-config-standard": "6.2.1", + "eslint-plugin-markdown": "1.0.0-beta.3", + "eslint-plugin-promise": "3.4.2", + "eslint-plugin-standard": "2.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5", + "seedrandom": "2.4.2" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/etag#readme", + "keywords": [ + "etag", + "http", + "res" + ], + "license": "MIT", + "name": "etag", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/etag.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.8.0" +} diff --git a/8 node/node_modules/express/History.md b/8 node/node_modules/express/History.md new file mode 100644 index 000000000..83b439c63 --- /dev/null +++ b/8 node/node_modules/express/History.md @@ -0,0 +1,3270 @@ +4.15.3 / 2017-05-16 +=================== + + * Fix error when `res.set` cannot add charset to `Content-Type` + * deps: debug@2.6.7 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@2.0.0 + * deps: finalhandler@~1.0.3 + - Fix missing `` in HTML document + - deps: debug@2.6.7 + * deps: proxy-addr@~1.1.4 + - deps: ipaddr.js@1.3.0 + * deps: send@0.15.3 + - deps: debug@2.6.7 + - deps: ms@2.0.0 + * deps: serve-static@1.12.3 + - deps: send@0.15.3 + * deps: type-is@~1.6.15 + - deps: mime-types@~2.1.15 + * deps: vary@~1.1.1 + - perf: hoist regular expression + +4.15.2 / 2017-03-06 +=================== + + * deps: qs@6.4.0 + - Fix regression parsing keys starting with `[` + +4.15.1 / 2017-03-05 +=================== + + * deps: send@0.15.1 + - Fix issue when `Date.parse` does not return `NaN` on invalid date + - Fix strict violation in broken environments + * deps: serve-static@1.12.1 + - Fix issue when `Date.parse` does not return `NaN` on invalid date + - deps: send@0.15.1 + +4.15.0 / 2017-03-01 +=================== + + * Add debug message when loading view engine + * Add `next("router")` to exit from router + * Fix case where `router.use` skipped requests routes did not + * Remove usage of `res._headers` private field + - Improves compatibility with Node.js 8 nightly + * Skip routing when `req.url` is not set + * Use `%o` in path debug to tell types apart + * Use `Object.create` to setup request & response prototypes + * Use `setprototypeof` module to replace `__proto__` setting + * Use `statuses` instead of `http` module for status messages + * deps: debug@2.6.1 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable set to `3` or higher + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: etag@~1.8.0 + - Use SHA1 instead of MD5 for ETag hashing + - Works with FIPS 140-2 OpenSSL configuration + * deps: finalhandler@~1.0.0 + - Fix exception when `err` cannot be converted to a string + - Fully URL-encode the pathname in the 404 + - Only include the pathname in the 404 message + - Send complete HTML document + - Set `Content-Security-Policy: default-src 'self'` header + - deps: debug@2.6.1 + * deps: fresh@0.5.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - perf: delay reading header values until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove duplicate conditional + - perf: remove unnecessary boolean coercions + - perf: skip checking modified time if ETag check failed + - perf: skip parsing `If-None-Match` when no `ETag` header + - perf: use `Date.parse` instead of `new Date` + * deps: qs@6.3.1 + - Fix array parsing from skipping empty values + - Fix compacting nested arrays + * deps: send@0.15.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - Remove usage of `res._headers` private field + - Support `If-Match` and `If-Unmodified-Since` headers + - Use `res.getHeaderNames()` when available + - Use `res.headersSent` when available + - deps: debug@2.6.1 + - deps: etag@~1.8.0 + - deps: fresh@0.5.0 + - deps: http-errors@~1.6.1 + * deps: serve-static@1.12.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - Remove usage of `res._headers` private field + - Send complete HTML document in redirect response + - Set default CSP header in redirect response + - Support `If-Match` and `If-Unmodified-Since` headers + - Use `res.getHeaderNames()` when available + - Use `res.headersSent` when available + - deps: send@0.15.0 + * perf: add fast match path for `*` route + * perf: improve `req.ips` performance + +4.14.1 / 2017-01-28 +=================== + + * deps: content-disposition@0.5.2 + * deps: finalhandler@0.5.1 + - Fix exception when `err.headers` is not an object + - deps: statuses@~1.3.1 + - perf: hoist regular expressions + - perf: remove duplicate validation path + * deps: proxy-addr@~1.1.3 + - deps: ipaddr.js@1.2.0 + * deps: send@0.14.2 + - deps: http-errors@~1.5.1 + - deps: ms@0.7.2 + - deps: statuses@~1.3.1 + * deps: serve-static@~1.11.2 + - deps: send@0.14.2 + * deps: type-is@~1.6.14 + - deps: mime-types@~2.1.13 + +4.14.0 / 2016-06-16 +=================== + + * Add `acceptRanges` option to `res.sendFile`/`res.sendfile` + * Add `cacheControl` option to `res.sendFile`/`res.sendfile` + * Add `options` argument to `req.range` + - Includes the `combine` option + * Encode URL in `res.location`/`res.redirect` if not already encoded + * Fix some redirect handling in `res.sendFile`/`res.sendfile` + * Fix Windows absolute path check using forward slashes + * Improve error with invalid arguments to `req.get()` + * Improve performance for `res.json`/`res.jsonp` in most cases + * Improve `Range` header handling in `res.sendFile`/`res.sendfile` + * deps: accepts@~1.3.3 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Many performance improvments + - deps: mime-types@~2.1.11 + - deps: negotiator@0.6.1 + * deps: content-type@~1.0.2 + - perf: enable strict mode + * deps: cookie@0.3.1 + - Add `sameSite` option + - Fix cookie `Max-Age` to never be a floating point number + - Improve error message when `encode` is not a function + - Improve error message when `expires` is not a `Date` + - Throw better error for invalid argument to parse + - Throw on invalid values provided to `serialize` + - perf: enable strict mode + - perf: hoist regular expression + - perf: use for loop in parse + - perf: use string concatination for serialization + * deps: finalhandler@0.5.0 + - Change invalid or non-numeric status code to 500 + - Overwrite status message to match set status code + - Prefer `err.statusCode` if `err.status` is invalid + - Set response headers from `err.headers` object + - Use `statuses` instead of `http` module for status messages + * deps: proxy-addr@~1.1.2 + - Fix accepting various invalid netmasks + - Fix IPv6-mapped IPv4 validation edge cases + - IPv4 netmasks must be contingous + - IPv6 addresses cannot be used as a netmask + - deps: ipaddr.js@1.1.1 + * deps: qs@6.2.0 + - Add `decoder` option in `parse` function + * deps: range-parser@~1.2.0 + - Add `combine` option to combine overlapping ranges + - Fix incorrectly returning -1 when there is at least one valid range + - perf: remove internal function + * deps: send@0.14.1 + - Add `acceptRanges` option + - Add `cacheControl` option + - Attempt to combine multiple ranges into single range + - Correctly inherit from `Stream` class + - Fix `Content-Range` header in 416 responses when using `start`/`end` options + - Fix `Content-Range` header missing from default 416 responses + - Fix redirect error when `path` contains raw non-URL characters + - Fix redirect when `path` starts with multiple forward slashes + - Ignore non-byte `Range` headers + - deps: http-errors@~1.5.0 + - deps: range-parser@~1.2.0 + - deps: statuses@~1.3.0 + - perf: remove argument reassignment + * deps: serve-static@~1.11.1 + - Add `acceptRanges` option + - Add `cacheControl` option + - Attempt to combine multiple ranges into single range + - Fix redirect error when `req.url` contains raw non-URL characters + - Ignore non-byte `Range` headers + - Use status code 301 for redirects + - deps: send@0.14.1 + * deps: type-is@~1.6.13 + - Fix type error when given invalid type to match against + - deps: mime-types@~2.1.11 + * deps: vary@~1.1.0 + - Only accept valid field names in the `field` argument + * perf: use strict equality when possible + +4.13.4 / 2016-01-21 +=================== + + * deps: content-disposition@0.5.1 + - perf: enable strict mode + * deps: cookie@0.1.5 + - Throw on invalid values provided to `serialize` + * deps: depd@~1.1.0 + - Support web browser loading + - perf: enable strict mode + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + * deps: finalhandler@0.4.1 + - deps: escape-html@~1.0.3 + * deps: merge-descriptors@1.0.1 + - perf: enable strict mode + * deps: methods@~1.1.2 + - perf: enable strict mode + * deps: parseurl@~1.3.1 + - perf: enable strict mode + * deps: proxy-addr@~1.0.10 + - deps: ipaddr.js@1.0.5 + - perf: enable strict mode + * deps: range-parser@~1.0.3 + - perf: enable strict mode + * deps: send@0.13.1 + - deps: depd@~1.1.0 + - deps: destroy@~1.0.4 + - deps: escape-html@~1.0.3 + - deps: range-parser@~1.0.3 + * deps: serve-static@~1.10.2 + - deps: escape-html@~1.0.3 + - deps: parseurl@~1.3.0 + - deps: send@0.13.1 + +4.13.3 / 2015-08-02 +=================== + + * Fix infinite loop condition using `mergeParams: true` + * Fix inner numeric indices incorrectly altering parent `req.params` + +4.13.2 / 2015-07-31 +=================== + + * deps: accepts@~1.2.12 + - deps: mime-types@~2.1.4 + * deps: array-flatten@1.1.1 + - perf: enable strict mode + * deps: path-to-regexp@0.1.7 + - Fix regression with escaped round brackets and matching groups + * deps: type-is@~1.6.6 + - deps: mime-types@~2.1.4 + +4.13.1 / 2015-07-05 +=================== + + * deps: accepts@~1.2.10 + - deps: mime-types@~2.1.2 + * deps: qs@4.0.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix various parsing edge cases + * deps: type-is@~1.6.4 + - deps: mime-types@~2.1.2 + - perf: enable strict mode + - perf: remove argument reassignment + +4.13.0 / 2015-06-20 +=================== + + * Add settings to debug output + * Fix `res.format` error when only `default` provided + * Fix issue where `next('route')` in `app.param` would incorrectly skip values + * Fix hiding platform issues with `decodeURIComponent` + - Only `URIError`s are a 400 + * Fix using `*` before params in routes + * Fix using capture groups before params in routes + * Simplify `res.cookie` to call `res.append` + * Use `array-flatten` module for flattening arrays + * deps: accepts@~1.2.9 + - deps: mime-types@~2.1.1 + - perf: avoid argument reassignment & argument slice + - perf: avoid negotiator recursive construction + - perf: enable strict mode + - perf: remove unnecessary bitwise operator + * deps: cookie@0.1.3 + - perf: deduce the scope of try-catch deopt + - perf: remove argument reassignments + * deps: escape-html@1.0.2 + * deps: etag@~1.7.0 + - Always include entity length in ETags for hash length extensions + - Generate non-Stats ETags using MD5 only (no longer CRC32) + - Improve stat performance by removing hashing + - Improve support for JXcore + - Remove base64 padding in ETags to shorten + - Support "fake" stats objects in environments without fs + - Use MD5 instead of MD4 in weak ETags over 1KB + * deps: finalhandler@0.4.0 + - Fix a false-positive when unpiping in Node.js 0.8 + - Support `statusCode` property on `Error` objects + - Use `unpipe` module for unpiping requests + - deps: escape-html@1.0.2 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove argument reassignment + * deps: fresh@0.3.0 + - Add weak `ETag` matching support + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * deps: path-to-regexp@0.1.6 + * deps: send@0.13.0 + - Allow Node.js HTTP server to set `Date` response header + - Fix incorrectly removing `Content-Location` on 304 response + - Improve the default redirect response headers + - Send appropriate headers on default error response + - Use `http-errors` for standard emitted errors + - Use `statuses` instead of `http` module for status messages + - deps: escape-html@1.0.2 + - deps: etag@~1.7.0 + - deps: fresh@0.3.0 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove unnecessary array allocations + * deps: serve-static@~1.10.0 + - Add `fallthrough` option + - Fix reading options from options prototype + - Improve the default redirect response headers + - Malformed URLs now `next()` instead of 400 + - deps: escape-html@1.0.2 + - deps: send@0.13.0 + - perf: enable strict mode + - perf: remove argument reassignment + * deps: type-is@~1.6.3 + - deps: mime-types@~2.1.1 + - perf: reduce try block size + - perf: remove bitwise operations + * perf: enable strict mode + * perf: isolate `app.render` try block + * perf: remove argument reassignments in application + * perf: remove argument reassignments in request prototype + * perf: remove argument reassignments in response prototype + * perf: remove argument reassignments in routing + * perf: remove argument reassignments in `View` + * perf: skip attempting to decode zero length string + * perf: use saved reference to `http.STATUS_CODES` + +4.12.4 / 2015-05-17 +=================== + + * deps: accepts@~1.2.7 + - deps: mime-types@~2.0.11 + - deps: negotiator@0.5.3 + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: depd@~1.0.1 + * deps: etag@~1.6.0 + - Improve support for JXcore + - Support "fake" stats objects in environments without `fs` + * deps: finalhandler@0.3.6 + - deps: debug@~2.2.0 + - deps: on-finished@~2.2.1 + * deps: on-finished@~2.2.1 + - Fix `isFinished(req)` when data buffered + * deps: proxy-addr@~1.0.8 + - deps: ipaddr.js@1.0.1 + * deps: qs@2.4.2 + - Fix allowing parameters like `constructor` + * deps: send@0.12.3 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: etag@~1.6.0 + - deps: ms@0.7.1 + - deps: on-finished@~2.2.1 + * deps: serve-static@~1.9.3 + - deps: send@0.12.3 + * deps: type-is@~1.6.2 + - deps: mime-types@~2.0.11 + +4.12.3 / 2015-03-17 +=================== + + * deps: accepts@~1.2.5 + - deps: mime-types@~2.0.10 + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: finalhandler@0.3.4 + - deps: debug@~2.1.3 + * deps: proxy-addr@~1.0.7 + - deps: ipaddr.js@0.1.9 + * deps: qs@2.4.1 + - Fix error when parameter `hasOwnProperty` is present + * deps: send@0.12.2 + - Throw errors early for invalid `extensions` or `index` options + - deps: debug@~2.1.3 + * deps: serve-static@~1.9.2 + - deps: send@0.12.2 + * deps: type-is@~1.6.1 + - deps: mime-types@~2.0.10 + +4.12.2 / 2015-03-02 +=================== + + * Fix regression where `"Request aborted"` is logged using `res.sendFile` + +4.12.1 / 2015-03-01 +=================== + + * Fix constructing application with non-configurable prototype properties + * Fix `ECONNRESET` errors from `res.sendFile` usage + * Fix `req.host` when using "trust proxy" hops count + * Fix `req.protocol`/`req.secure` when using "trust proxy" hops count + * Fix wrong `code` on aborted connections from `res.sendFile` + * deps: merge-descriptors@1.0.0 + +4.12.0 / 2015-02-23 +=================== + + * Fix `"trust proxy"` setting to inherit when app is mounted + * Generate `ETag`s for all request responses + - No longer restricted to only responses for `GET` and `HEAD` requests + * Use `content-type` to parse `Content-Type` headers + * deps: accepts@~1.2.4 + - Fix preference sorting to be stable for long acceptable lists + - deps: mime-types@~2.0.9 + - deps: negotiator@0.5.1 + * deps: cookie-signature@1.0.6 + * deps: send@0.12.1 + - Always read the stat size from the file + - Fix mutating passed-in `options` + - deps: mime@1.3.4 + * deps: serve-static@~1.9.1 + - deps: send@0.12.1 + * deps: type-is@~1.6.0 + - fix argument reassignment + - fix false-positives in `hasBody` `Transfer-Encoding` check + - support wildcard for both type and subtype (`*/*`) + - deps: mime-types@~2.0.9 + +4.11.2 / 2015-02-01 +=================== + + * Fix `res.redirect` double-calling `res.end` for `HEAD` requests + * deps: accepts@~1.2.3 + - deps: mime-types@~2.0.8 + * deps: proxy-addr@~1.0.6 + - deps: ipaddr.js@0.1.8 + * deps: type-is@~1.5.6 + - deps: mime-types@~2.0.8 + +4.11.1 / 2015-01-20 +=================== + + * deps: send@0.11.1 + - Fix root path disclosure + * deps: serve-static@~1.8.1 + - Fix redirect loop in Node.js 0.11.14 + - Fix root path disclosure + - deps: send@0.11.1 + +4.11.0 / 2015-01-13 +=================== + + * Add `res.append(field, val)` to append headers + * Deprecate leading `:` in `name` for `app.param(name, fn)` + * Deprecate `req.param()` -- use `req.params`, `req.body`, or `req.query` instead + * Deprecate `app.param(fn)` + * Fix `OPTIONS` responses to include the `HEAD` method properly + * Fix `res.sendFile` not always detecting aborted connection + * Match routes iteratively to prevent stack overflows + * deps: accepts@~1.2.2 + - deps: mime-types@~2.0.7 + - deps: negotiator@0.5.0 + * deps: send@0.11.0 + - deps: debug@~2.1.1 + - deps: etag@~1.5.1 + - deps: ms@0.7.0 + - deps: on-finished@~2.2.0 + * deps: serve-static@~1.8.0 + - deps: send@0.11.0 + +4.10.8 / 2015-01-13 +=================== + + * Fix crash from error within `OPTIONS` response handler + * deps: proxy-addr@~1.0.5 + - deps: ipaddr.js@0.1.6 + +4.10.7 / 2015-01-04 +=================== + + * Fix `Allow` header for `OPTIONS` to not contain duplicate methods + * Fix incorrect "Request aborted" for `res.sendFile` when `HEAD` or 304 + * deps: debug@~2.1.1 + * deps: finalhandler@0.3.3 + - deps: debug@~2.1.1 + - deps: on-finished@~2.2.0 + * deps: methods@~1.1.1 + * deps: on-finished@~2.2.0 + * deps: serve-static@~1.7.2 + - Fix potential open redirect when mounted at root + * deps: type-is@~1.5.5 + - deps: mime-types@~2.0.7 + +4.10.6 / 2014-12-12 +=================== + + * Fix exception in `req.fresh`/`req.stale` without response headers + +4.10.5 / 2014-12-10 +=================== + + * Fix `res.send` double-calling `res.end` for `HEAD` requests + * deps: accepts@~1.1.4 + - deps: mime-types@~2.0.4 + * deps: type-is@~1.5.4 + - deps: mime-types@~2.0.4 + +4.10.4 / 2014-11-24 +=================== + + * Fix `res.sendfile` logging standard write errors + +4.10.3 / 2014-11-23 +=================== + + * Fix `res.sendFile` logging standard write errors + * deps: etag@~1.5.1 + * deps: proxy-addr@~1.0.4 + - deps: ipaddr.js@0.1.5 + * deps: qs@2.3.3 + - Fix `arrayLimit` behavior + +4.10.2 / 2014-11-09 +=================== + + * Correctly invoke async router callback asynchronously + * deps: accepts@~1.1.3 + - deps: mime-types@~2.0.3 + * deps: type-is@~1.5.3 + - deps: mime-types@~2.0.3 + +4.10.1 / 2014-10-28 +=================== + + * Fix handling of URLs containing `://` in the path + * deps: qs@2.3.2 + - Fix parsing of mixed objects and values + +4.10.0 / 2014-10-23 +=================== + + * Add support for `app.set('views', array)` + - Views are looked up in sequence in array of directories + * Fix `res.send(status)` to mention `res.sendStatus(status)` + * Fix handling of invalid empty URLs + * Use `content-disposition` module for `res.attachment`/`res.download` + - Sends standards-compliant `Content-Disposition` header + - Full Unicode support + * Use `path.resolve` in view lookup + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + * deps: etag@~1.5.0 + - Improve string performance + - Slightly improve speed for weak ETags over 1KB + * deps: finalhandler@0.3.2 + - Terminate in progress response only on error + - Use `on-finished` to determine request status + - deps: debug@~2.1.0 + - deps: on-finished@~2.1.1 + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + * deps: qs@2.3.0 + - Fix parsing of mixed implicit and explicit arrays + * deps: send@0.10.1 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: etag@~1.5.0 + - deps: on-finished@~2.1.1 + * deps: serve-static@~1.7.1 + - deps: send@0.10.1 + +4.9.8 / 2014-10-17 +================== + + * Fix `res.redirect` body when redirect status specified + * deps: accepts@~1.1.2 + - Fix error when media type has invalid parameter + - deps: negotiator@0.4.9 + +4.9.7 / 2014-10-10 +================== + + * Fix using same param name in array of paths + +4.9.6 / 2014-10-08 +================== + + * deps: accepts@~1.1.1 + - deps: mime-types@~2.0.2 + - deps: negotiator@0.4.8 + * deps: serve-static@~1.6.4 + - Fix redirect loop when index file serving disabled + * deps: type-is@~1.5.2 + - deps: mime-types@~2.0.2 + +4.9.5 / 2014-09-24 +================== + + * deps: etag@~1.4.0 + * deps: proxy-addr@~1.0.3 + - Use `forwarded` npm module + * deps: send@0.9.3 + - deps: etag@~1.4.0 + * deps: serve-static@~1.6.3 + - deps: send@0.9.3 + +4.9.4 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + +4.9.3 / 2014-09-18 +================== + + * deps: proxy-addr@~1.0.2 + - Fix a global leak when multiple subnets are trusted + - deps: ipaddr.js@0.1.3 + +4.9.2 / 2014-09-17 +================== + + * Fix regression for empty string `path` in `app.use` + * Fix `router.use` to accept array of middleware without path + * Improve error message for bad `app.use` arguments + +4.9.1 / 2014-09-16 +================== + + * Fix `app.use` to accept array of middleware without path + * deps: depd@0.4.5 + * deps: etag@~1.3.1 + * deps: send@0.9.2 + - deps: depd@0.4.5 + - deps: etag@~1.3.1 + - deps: range-parser@~1.0.2 + * deps: serve-static@~1.6.2 + - deps: send@0.9.2 + +4.9.0 / 2014-09-08 +================== + + * Add `res.sendStatus` + * Invoke callback for sendfile when client aborts + - Applies to `res.sendFile`, `res.sendfile`, and `res.download` + - `err` will be populated with request aborted error + * Support IP address host in `req.subdomains` + * Use `etag` to generate `ETag` headers + * deps: accepts@~1.1.0 + - update `mime-types` + * deps: cookie-signature@1.0.5 + * deps: debug@~2.0.0 + * deps: finalhandler@0.2.0 + - Set `X-Content-Type-Options: nosniff` header + - deps: debug@~2.0.0 + * deps: fresh@0.2.4 + * deps: media-typer@0.3.0 + - Throw error when parameter format invalid on parse + * deps: qs@2.2.3 + - Fix issue where first empty value in array is discarded + * deps: range-parser@~1.0.2 + * deps: send@0.9.1 + - Add `lastModified` option + - Use `etag` to generate `ETag` header + - deps: debug@~2.0.0 + - deps: fresh@0.2.4 + * deps: serve-static@~1.6.1 + - Add `lastModified` option + - deps: send@0.9.1 + * deps: type-is@~1.5.1 + - fix `hasbody` to be true for `content-length: 0` + - deps: media-typer@0.3.0 + - deps: mime-types@~2.0.1 + * deps: vary@~1.0.0 + - Accept valid `Vary` header string as `field` + +4.8.8 / 2014-09-04 +================== + + * deps: send@0.8.5 + - Fix a path traversal issue when using `root` + - Fix malicious path detection for empty string path + * deps: serve-static@~1.5.4 + - deps: send@0.8.5 + +4.8.7 / 2014-08-29 +================== + + * deps: qs@2.2.2 + - Remove unnecessary cloning + +4.8.6 / 2014-08-27 +================== + + * deps: qs@2.2.0 + - Array parsing fix + - Performance improvements + +4.8.5 / 2014-08-18 +================== + + * deps: send@0.8.3 + - deps: destroy@1.0.3 + - deps: on-finished@2.1.0 + * deps: serve-static@~1.5.3 + - deps: send@0.8.3 + +4.8.4 / 2014-08-14 +================== + + * deps: qs@1.2.2 + * deps: send@0.8.2 + - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + * deps: serve-static@~1.5.2 + - deps: send@0.8.2 + +4.8.3 / 2014-08-10 +================== + + * deps: parseurl@~1.3.0 + * deps: qs@1.2.1 + * deps: serve-static@~1.5.1 + - Fix parsing of weird `req.originalUrl` values + - deps: parseurl@~1.3.0 + - deps: utils-merge@1.0.0 + +4.8.2 / 2014-08-07 +================== + + * deps: qs@1.2.0 + - Fix parsing array of objects + +4.8.1 / 2014-08-06 +================== + + * fix incorrect deprecation warnings on `res.download` + * deps: qs@1.1.0 + - Accept urlencoded square brackets + - Accept empty values in implicit array notation + +4.8.0 / 2014-08-05 +================== + + * add `res.sendFile` + - accepts a file system path instead of a URL + - requires an absolute path or `root` option specified + * deprecate `res.sendfile` -- use `res.sendFile` instead + * support mounted app as any argument to `app.use()` + * deps: qs@1.0.2 + - Complete rewrite + - Limits array length to 20 + - Limits object depth to 5 + - Limits parameters to 1,000 + * deps: send@0.8.1 + - Add `extensions` option + * deps: serve-static@~1.5.0 + - Add `extensions` option + - deps: send@0.8.1 + +4.7.4 / 2014-08-04 +================== + + * fix `res.sendfile` regression for serving directory index files + * deps: send@0.7.4 + - Fix incorrect 403 on Windows and Node.js 0.11 + - Fix serving index files without root dir + * deps: serve-static@~1.4.4 + - deps: send@0.7.4 + +4.7.3 / 2014-08-04 +================== + + * deps: send@0.7.3 + - Fix incorrect 403 on Windows and Node.js 0.11 + * deps: serve-static@~1.4.3 + - Fix incorrect 403 on Windows and Node.js 0.11 + - deps: send@0.7.3 + +4.7.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + * deps: send@0.7.2 + - deps: depd@0.4.4 + * deps: serve-static@~1.4.2 + +4.7.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + * deps: send@0.7.1 + - deps: depd@0.4.3 + * deps: serve-static@~1.4.1 + +4.7.0 / 2014-07-25 +================== + + * fix `req.protocol` for proxy-direct connections + * configurable query parser with `app.set('query parser', parser)` + - `app.set('query parser', 'extended')` parse with "qs" module + - `app.set('query parser', 'simple')` parse with "querystring" core module + - `app.set('query parser', false)` disable query string parsing + - `app.set('query parser', true)` enable simple parsing + * deprecate `res.json(status, obj)` -- use `res.status(status).json(obj)` instead + * deprecate `res.jsonp(status, obj)` -- use `res.status(status).jsonp(obj)` instead + * deprecate `res.send(status, body)` -- use `res.status(status).send(body)` instead + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: finalhandler@0.1.0 + - Respond after request fully read + - deps: debug@1.0.4 + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * deps: send@0.7.0 + - Add `dotfiles` option + - Cap `maxAge` value to 1 year + - deps: debug@1.0.4 + - deps: depd@0.4.2 + * deps: serve-static@~1.4.0 + - deps: parseurl@~1.2.0 + - deps: send@0.7.0 + * perf: prevent multiple `Buffer` creation in `res.send` + +4.6.1 / 2014-07-12 +================== + + * fix `subapp.mountpath` regression for `app.use(subapp)` + +4.6.0 / 2014-07-11 +================== + + * accept multiple callbacks to `app.use()` + * add explicit "Rosetta Flash JSONP abuse" protection + - previous versions are not vulnerable; this is just explicit protection + * catch errors in multiple `req.param(name, fn)` handlers + * deprecate `res.redirect(url, status)` -- use `res.redirect(status, url)` instead + * fix `res.send(status, num)` to send `num` as json (not error) + * remove unnecessary escaping when `res.jsonp` returns JSON response + * support non-string `path` in `app.use(path, fn)` + - supports array of paths + - supports `RegExp` + * router: fix optimization on router exit + * router: refactor location of `try` blocks + * router: speed up standard `app.use(fn)` + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + * deps: finalhandler@0.0.3 + - deps: debug@1.0.3 + * deps: methods@1.1.0 + - add `CONNECT` + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + * deps: path-to-regexp@0.1.3 + * deps: send@0.6.0 + - deps: debug@1.0.3 + * deps: serve-static@~1.3.2 + - deps: parseurl@~1.1.3 + - deps: send@0.6.0 + * perf: fix arguments reassign deopt in some `res` methods + +4.5.1 / 2014-07-06 +================== + + * fix routing regression when altering `req.method` + +4.5.0 / 2014-07-04 +================== + + * add deprecation message to non-plural `req.accepts*` + * add deprecation message to `res.send(body, status)` + * add deprecation message to `res.vary()` + * add `headers` option to `res.sendfile` + - use to set headers on successful file transfer + * add `mergeParams` option to `Router` + - merges `req.params` from parent routes + * add `req.hostname` -- correct name for what `req.host` returns + * deprecate things with `depd` module + * deprecate `req.host` -- use `req.hostname` instead + * fix behavior when handling request without routes + * fix handling when `route.all` is only route + * invoke `router.param()` only when route matches + * restore `req.params` after invoking router + * use `finalhandler` for final response handling + * use `media-typer` to alter content-type charset + * deps: accepts@~1.0.7 + * deps: send@0.5.0 + - Accept string for `maxage` (converted by `ms`) + - Include link in default redirect response + * deps: serve-static@~1.3.0 + - Accept string for `maxAge` (converted by `ms`) + - Add `setHeaders` option + - Include HTML link in redirect response + - deps: send@0.5.0 + * deps: type-is@~1.3.2 + +4.4.5 / 2014-06-26 +================== + + * deps: cookie-signature@1.0.4 + - fix for timing attacks + +4.4.4 / 2014-06-20 +================== + + * fix `res.attachment` Unicode filenames in Safari + * fix "trim prefix" debug message in `express:router` + * deps: accepts@~1.0.5 + * deps: buffer-crc32@0.2.3 + +4.4.3 / 2014-06-11 +================== + + * fix persistence of modified `req.params[name]` from `app.param()` + * deps: accepts@1.0.3 + - deps: negotiator@0.4.6 + * deps: debug@1.0.2 + * deps: send@0.4.3 + - Do not throw un-catchable error on file open race condition + - Use `escape-html` for HTML escaping + - deps: debug@1.0.2 + - deps: finished@1.2.2 + - deps: fresh@0.2.2 + * deps: serve-static@1.2.3 + - Do not throw un-catchable error on file open race condition + - deps: send@0.4.3 + +4.4.2 / 2014-06-09 +================== + + * fix catching errors from top-level handlers + * use `vary` module for `res.vary` + * deps: debug@1.0.1 + * deps: proxy-addr@1.0.1 + * deps: send@0.4.2 + - fix "event emitter leak" warnings + - deps: debug@1.0.1 + - deps: finished@1.2.1 + * deps: serve-static@1.2.2 + - fix "event emitter leak" warnings + - deps: send@0.4.2 + * deps: type-is@1.2.1 + +4.4.1 / 2014-06-02 +================== + + * deps: methods@1.0.1 + * deps: send@0.4.1 + - Send `max-age` in `Cache-Control` in correct format + * deps: serve-static@1.2.1 + - use `escape-html` for escaping + - deps: send@0.4.1 + +4.4.0 / 2014-05-30 +================== + + * custom etag control with `app.set('etag', val)` + - `app.set('etag', function(body, encoding){ return '"etag"' })` custom etag generation + - `app.set('etag', 'weak')` weak tag + - `app.set('etag', 'strong')` strong etag + - `app.set('etag', false)` turn off + - `app.set('etag', true)` standard etag + * mark `res.send` ETag as weak and reduce collisions + * update accepts to 1.0.2 + - Fix interpretation when header not in request + * update send to 0.4.0 + - Calculate ETag with md5 for reduced collisions + - Ignore stream errors after request ends + - deps: debug@0.8.1 + * update serve-static to 1.2.0 + - Calculate ETag with md5 for reduced collisions + - Ignore stream errors after request ends + - deps: send@0.4.0 + +4.3.2 / 2014-05-28 +================== + + * fix handling of errors from `router.param()` callbacks + +4.3.1 / 2014-05-23 +================== + + * revert "fix behavior of multiple `app.VERB` for the same path" + - this caused a regression in the order of route execution + +4.3.0 / 2014-05-21 +================== + + * add `req.baseUrl` to access the path stripped from `req.url` in routes + * fix behavior of multiple `app.VERB` for the same path + * fix issue routing requests among sub routers + * invoke `router.param()` only when necessary instead of every match + * proper proxy trust with `app.set('trust proxy', trust)` + - `app.set('trust proxy', 1)` trust first hop + - `app.set('trust proxy', 'loopback')` trust loopback addresses + - `app.set('trust proxy', '10.0.0.1')` trust single IP + - `app.set('trust proxy', '10.0.0.1/16')` trust subnet + - `app.set('trust proxy', '10.0.0.1, 10.0.0.2')` trust list + - `app.set('trust proxy', false)` turn off + - `app.set('trust proxy', true)` trust everything + * set proper `charset` in `Content-Type` for `res.send` + * update type-is to 1.2.0 + - support suffix matching + +4.2.0 / 2014-05-11 +================== + + * deprecate `app.del()` -- use `app.delete()` instead + * deprecate `res.json(obj, status)` -- use `res.json(status, obj)` instead + - the edge-case `res.json(status, num)` requires `res.status(status).json(num)` + * deprecate `res.jsonp(obj, status)` -- use `res.jsonp(status, obj)` instead + - the edge-case `res.jsonp(status, num)` requires `res.status(status).jsonp(num)` + * fix `req.next` when inside router instance + * include `ETag` header in `HEAD` requests + * keep previous `Content-Type` for `res.jsonp` + * support PURGE method + - add `app.purge` + - add `router.purge` + - include PURGE in `app.all` + * update debug to 0.8.0 + - add `enable()` method + - change from stderr to stdout + * update methods to 1.0.0 + - add PURGE + +4.1.2 / 2014-05-08 +================== + + * fix `req.host` for IPv6 literals + * fix `res.jsonp` error if callback param is object + +4.1.1 / 2014-04-27 +================== + + * fix package.json to reflect supported node version + +4.1.0 / 2014-04-24 +================== + + * pass options from `res.sendfile` to `send` + * preserve casing of headers in `res.header` and `res.set` + * support unicode file names in `res.attachment` and `res.download` + * update accepts to 1.0.1 + - deps: negotiator@0.4.0 + * update cookie to 0.1.2 + - Fix for maxAge == 0 + - made compat with expires field + * update send to 0.3.0 + - Accept API options in options object + - Coerce option types + - Control whether to generate etags + - Default directory access to 403 when index disabled + - Fix sending files with dots without root set + - Include file path in etag + - Make "Can't set headers after they are sent." catchable + - Send full entity-body for multi range requests + - Set etags to "weak" + - Support "If-Range" header + - Support multiple index paths + - deps: mime@1.2.11 + * update serve-static to 1.1.0 + - Accept options directly to `send` module + - Resolve relative paths at middleware setup + - Use parseurl to parse the URL from request + - deps: send@0.3.0 + * update type-is to 1.1.0 + - add non-array values support + - add `multipart` as a shorthand + +4.0.0 / 2014-04-09 +================== + + * remove: + - node 0.8 support + - connect and connect's patches except for charset handling + - express(1) - moved to [express-generator](https://github.com/expressjs/generator) + - `express.createServer()` - it has been deprecated for a long time. Use `express()` + - `app.configure` - use logic in your own app code + - `app.router` - is removed + - `req.auth` - use `basic-auth` instead + - `req.accepted*` - use `req.accepts*()` instead + - `res.location` - relative URL resolution is removed + - `res.charset` - include the charset in the content type when using `res.set()` + - all bundled middleware except `static` + * change: + - `app.route` -> `app.mountpath` when mounting an express app in another express app + - `json spaces` no longer enabled by default in development + - `req.accepts*` -> `req.accepts*s` - i.e. `req.acceptsEncoding` -> `req.acceptsEncodings` + - `req.params` is now an object instead of an array + - `res.locals` is no longer a function. It is a plain js object. Treat it as such. + - `res.headerSent` -> `res.headersSent` to match node.js ServerResponse object + * refactor: + - `req.accepts*` with [accepts](https://github.com/expressjs/accepts) + - `req.is` with [type-is](https://github.com/expressjs/type-is) + - [path-to-regexp](https://github.com/component/path-to-regexp) + * add: + - `app.router()` - returns the app Router instance + - `app.route()` - Proxy to the app's `Router#route()` method to create a new route + - Router & Route - public API + +3.21.2 / 2015-07-31 +=================== + + * deps: connect@2.30.2 + - deps: body-parser@~1.13.3 + - deps: compression@~1.5.2 + - deps: errorhandler@~1.4.2 + - deps: method-override@~2.3.5 + - deps: serve-index@~1.7.2 + - deps: type-is@~1.6.6 + - deps: vhost@~3.0.1 + * deps: vary@~1.0.1 + - Fix setting empty header from empty `field` + - perf: enable strict mode + - perf: remove argument reassignments + +3.21.1 / 2015-07-05 +=================== + + * deps: basic-auth@~1.0.3 + * deps: connect@2.30.1 + - deps: body-parser@~1.13.2 + - deps: compression@~1.5.1 + - deps: errorhandler@~1.4.1 + - deps: morgan@~1.6.1 + - deps: pause@0.1.0 + - deps: qs@4.0.0 + - deps: serve-index@~1.7.1 + - deps: type-is@~1.6.4 + +3.21.0 / 2015-06-18 +=================== + + * deps: basic-auth@1.0.2 + - perf: enable strict mode + - perf: hoist regular expression + - perf: parse with regular expressions + - perf: remove argument reassignment + * deps: connect@2.30.0 + - deps: body-parser@~1.13.1 + - deps: bytes@2.1.0 + - deps: compression@~1.5.0 + - deps: cookie@0.1.3 + - deps: cookie-parser@~1.3.5 + - deps: csurf@~1.8.3 + - deps: errorhandler@~1.4.0 + - deps: express-session@~1.11.3 + - deps: finalhandler@0.4.0 + - deps: fresh@0.3.0 + - deps: morgan@~1.6.0 + - deps: serve-favicon@~2.3.0 + - deps: serve-index@~1.7.0 + - deps: serve-static@~1.10.0 + - deps: type-is@~1.6.3 + * deps: cookie@0.1.3 + - perf: deduce the scope of try-catch deopt + - perf: remove argument reassignments + * deps: escape-html@1.0.2 + * deps: etag@~1.7.0 + - Always include entity length in ETags for hash length extensions + - Generate non-Stats ETags using MD5 only (no longer CRC32) + - Improve stat performance by removing hashing + - Improve support for JXcore + - Remove base64 padding in ETags to shorten + - Support "fake" stats objects in environments without fs + - Use MD5 instead of MD4 in weak ETags over 1KB + * deps: fresh@0.3.0 + - Add weak `ETag` matching support + * deps: mkdirp@0.5.1 + - Work in global strict mode + * deps: send@0.13.0 + - Allow Node.js HTTP server to set `Date` response header + - Fix incorrectly removing `Content-Location` on 304 response + - Improve the default redirect response headers + - Send appropriate headers on default error response + - Use `http-errors` for standard emitted errors + - Use `statuses` instead of `http` module for status messages + - deps: escape-html@1.0.2 + - deps: etag@~1.7.0 + - deps: fresh@0.3.0 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove unnecessary array allocations + +3.20.3 / 2015-05-17 +=================== + + * deps: connect@2.29.2 + - deps: body-parser@~1.12.4 + - deps: compression@~1.4.4 + - deps: connect-timeout@~1.6.2 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: errorhandler@~1.3.6 + - deps: finalhandler@0.3.6 + - deps: method-override@~2.3.3 + - deps: morgan@~1.5.3 + - deps: qs@2.4.2 + - deps: response-time@~2.3.1 + - deps: serve-favicon@~2.2.1 + - deps: serve-index@~1.6.4 + - deps: serve-static@~1.9.3 + - deps: type-is@~1.6.2 + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: depd@~1.0.1 + * deps: proxy-addr@~1.0.8 + - deps: ipaddr.js@1.0.1 + * deps: send@0.12.3 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: etag@~1.6.0 + - deps: ms@0.7.1 + - deps: on-finished@~2.2.1 + +3.20.2 / 2015-03-16 +=================== + + * deps: connect@2.29.1 + - deps: body-parser@~1.12.2 + - deps: compression@~1.4.3 + - deps: connect-timeout@~1.6.1 + - deps: debug@~2.1.3 + - deps: errorhandler@~1.3.5 + - deps: express-session@~1.10.4 + - deps: finalhandler@0.3.4 + - deps: method-override@~2.3.2 + - deps: morgan@~1.5.2 + - deps: qs@2.4.1 + - deps: serve-index@~1.6.3 + - deps: serve-static@~1.9.2 + - deps: type-is@~1.6.1 + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: merge-descriptors@1.0.0 + * deps: proxy-addr@~1.0.7 + - deps: ipaddr.js@0.1.9 + * deps: send@0.12.2 + - Throw errors early for invalid `extensions` or `index` options + - deps: debug@~2.1.3 + +3.20.1 / 2015-02-28 +=================== + + * Fix `req.host` when using "trust proxy" hops count + * Fix `req.protocol`/`req.secure` when using "trust proxy" hops count + +3.20.0 / 2015-02-18 +=================== + + * Fix `"trust proxy"` setting to inherit when app is mounted + * Generate `ETag`s for all request responses + - No longer restricted to only responses for `GET` and `HEAD` requests + * Use `content-type` to parse `Content-Type` headers + * deps: connect@2.29.0 + - Use `content-type` to parse `Content-Type` headers + - deps: body-parser@~1.12.0 + - deps: compression@~1.4.1 + - deps: connect-timeout@~1.6.0 + - deps: cookie-parser@~1.3.4 + - deps: cookie-signature@1.0.6 + - deps: csurf@~1.7.0 + - deps: errorhandler@~1.3.4 + - deps: express-session@~1.10.3 + - deps: http-errors@~1.3.1 + - deps: response-time@~2.3.0 + - deps: serve-index@~1.6.2 + - deps: serve-static@~1.9.1 + - deps: type-is@~1.6.0 + * deps: cookie-signature@1.0.6 + * deps: send@0.12.1 + - Always read the stat size from the file + - Fix mutating passed-in `options` + - deps: mime@1.3.4 + +3.19.2 / 2015-02-01 +=================== + + * deps: connect@2.28.3 + - deps: compression@~1.3.1 + - deps: csurf@~1.6.6 + - deps: errorhandler@~1.3.3 + - deps: express-session@~1.10.2 + - deps: serve-index@~1.6.1 + - deps: type-is@~1.5.6 + * deps: proxy-addr@~1.0.6 + - deps: ipaddr.js@0.1.8 + +3.19.1 / 2015-01-20 +=================== + + * deps: connect@2.28.2 + - deps: body-parser@~1.10.2 + - deps: serve-static@~1.8.1 + * deps: send@0.11.1 + - Fix root path disclosure + +3.19.0 / 2015-01-09 +=================== + + * Fix `OPTIONS` responses to include the `HEAD` method property + * Use `readline` for prompt in `express(1)` + * deps: commander@2.6.0 + * deps: connect@2.28.1 + - deps: body-parser@~1.10.1 + - deps: compression@~1.3.0 + - deps: connect-timeout@~1.5.0 + - deps: csurf@~1.6.4 + - deps: debug@~2.1.1 + - deps: errorhandler@~1.3.2 + - deps: express-session@~1.10.1 + - deps: finalhandler@0.3.3 + - deps: method-override@~2.3.1 + - deps: morgan@~1.5.1 + - deps: serve-favicon@~2.2.0 + - deps: serve-index@~1.6.0 + - deps: serve-static@~1.8.0 + - deps: type-is@~1.5.5 + * deps: debug@~2.1.1 + * deps: methods@~1.1.1 + * deps: proxy-addr@~1.0.5 + - deps: ipaddr.js@0.1.6 + * deps: send@0.11.0 + - deps: debug@~2.1.1 + - deps: etag@~1.5.1 + - deps: ms@0.7.0 + - deps: on-finished@~2.2.0 + +3.18.6 / 2014-12-12 +=================== + + * Fix exception in `req.fresh`/`req.stale` without response headers + +3.18.5 / 2014-12-11 +=================== + + * deps: connect@2.27.6 + - deps: compression@~1.2.2 + - deps: express-session@~1.9.3 + - deps: http-errors@~1.2.8 + - deps: serve-index@~1.5.3 + - deps: type-is@~1.5.4 + +3.18.4 / 2014-11-23 +=================== + + * deps: connect@2.27.4 + - deps: body-parser@~1.9.3 + - deps: compression@~1.2.1 + - deps: errorhandler@~1.2.3 + - deps: express-session@~1.9.2 + - deps: qs@2.3.3 + - deps: serve-favicon@~2.1.7 + - deps: serve-static@~1.5.1 + - deps: type-is@~1.5.3 + * deps: etag@~1.5.1 + * deps: proxy-addr@~1.0.4 + - deps: ipaddr.js@0.1.5 + +3.18.3 / 2014-11-09 +=================== + + * deps: connect@2.27.3 + - Correctly invoke async callback asynchronously + - deps: csurf@~1.6.3 + +3.18.2 / 2014-10-28 +=================== + + * deps: connect@2.27.2 + - Fix handling of URLs containing `://` in the path + - deps: body-parser@~1.9.2 + - deps: qs@2.3.2 + +3.18.1 / 2014-10-22 +=================== + + * Fix internal `utils.merge` deprecation warnings + * deps: connect@2.27.1 + - deps: body-parser@~1.9.1 + - deps: express-session@~1.9.1 + - deps: finalhandler@0.3.2 + - deps: morgan@~1.4.1 + - deps: qs@2.3.0 + - deps: serve-static@~1.7.1 + * deps: send@0.10.1 + - deps: on-finished@~2.1.1 + +3.18.0 / 2014-10-17 +=================== + + * Use `content-disposition` module for `res.attachment`/`res.download` + - Sends standards-compliant `Content-Disposition` header + - Full Unicode support + * Use `etag` module to generate `ETag` headers + * deps: connect@2.27.0 + - Use `http-errors` module for creating errors + - Use `utils-merge` module for merging objects + - deps: body-parser@~1.9.0 + - deps: compression@~1.2.0 + - deps: connect-timeout@~1.4.0 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: express-session@~1.9.0 + - deps: finalhandler@0.3.1 + - deps: method-override@~2.3.0 + - deps: morgan@~1.4.0 + - deps: response-time@~2.2.0 + - deps: serve-favicon@~2.1.6 + - deps: serve-index@~1.5.0 + - deps: serve-static@~1.7.0 + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + * deps: send@0.10.0 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: etag@~1.5.0 + +3.17.8 / 2014-10-15 +=================== + + * deps: connect@2.26.6 + - deps: compression@~1.1.2 + - deps: csurf@~1.6.2 + - deps: errorhandler@~1.2.2 + +3.17.7 / 2014-10-08 +=================== + + * deps: connect@2.26.5 + - Fix accepting non-object arguments to `logger` + - deps: serve-static@~1.6.4 + +3.17.6 / 2014-10-02 +=================== + + * deps: connect@2.26.4 + - deps: morgan@~1.3.2 + - deps: type-is@~1.5.2 + +3.17.5 / 2014-09-24 +=================== + + * deps: connect@2.26.3 + - deps: body-parser@~1.8.4 + - deps: serve-favicon@~2.1.5 + - deps: serve-static@~1.6.3 + * deps: proxy-addr@~1.0.3 + - Use `forwarded` npm module + * deps: send@0.9.3 + - deps: etag@~1.4.0 + +3.17.4 / 2014-09-19 +=================== + + * deps: connect@2.26.2 + - deps: body-parser@~1.8.3 + - deps: qs@2.2.4 + +3.17.3 / 2014-09-18 +=================== + + * deps: proxy-addr@~1.0.2 + - Fix a global leak when multiple subnets are trusted + - deps: ipaddr.js@0.1.3 + +3.17.2 / 2014-09-15 +=================== + + * Use `crc` instead of `buffer-crc32` for speed + * deps: connect@2.26.1 + - deps: body-parser@~1.8.2 + - deps: depd@0.4.5 + - deps: express-session@~1.8.2 + - deps: morgan@~1.3.1 + - deps: serve-favicon@~2.1.3 + - deps: serve-static@~1.6.2 + * deps: depd@0.4.5 + * deps: send@0.9.2 + - deps: depd@0.4.5 + - deps: etag@~1.3.1 + - deps: range-parser@~1.0.2 + +3.17.1 / 2014-09-08 +=================== + + * Fix error in `req.subdomains` on empty host + +3.17.0 / 2014-09-08 +=================== + + * Support `X-Forwarded-Host` in `req.subdomains` + * Support IP address host in `req.subdomains` + * deps: connect@2.26.0 + - deps: body-parser@~1.8.1 + - deps: compression@~1.1.0 + - deps: connect-timeout@~1.3.0 + - deps: cookie-parser@~1.3.3 + - deps: cookie-signature@1.0.5 + - deps: csurf@~1.6.1 + - deps: debug@~2.0.0 + - deps: errorhandler@~1.2.0 + - deps: express-session@~1.8.1 + - deps: finalhandler@0.2.0 + - deps: fresh@0.2.4 + - deps: media-typer@0.3.0 + - deps: method-override@~2.2.0 + - deps: morgan@~1.3.0 + - deps: qs@2.2.3 + - deps: serve-favicon@~2.1.3 + - deps: serve-index@~1.2.1 + - deps: serve-static@~1.6.1 + - deps: type-is@~1.5.1 + - deps: vhost@~3.0.0 + * deps: cookie-signature@1.0.5 + * deps: debug@~2.0.0 + * deps: fresh@0.2.4 + * deps: media-typer@0.3.0 + - Throw error when parameter format invalid on parse + * deps: range-parser@~1.0.2 + * deps: send@0.9.1 + - Add `lastModified` option + - Use `etag` to generate `ETag` header + - deps: debug@~2.0.0 + - deps: fresh@0.2.4 + * deps: vary@~1.0.0 + - Accept valid `Vary` header string as `field` + +3.16.10 / 2014-09-04 +==================== + + * deps: connect@2.25.10 + - deps: serve-static@~1.5.4 + * deps: send@0.8.5 + - Fix a path traversal issue when using `root` + - Fix malicious path detection for empty string path + +3.16.9 / 2014-08-29 +=================== + + * deps: connect@2.25.9 + - deps: body-parser@~1.6.7 + - deps: qs@2.2.2 + +3.16.8 / 2014-08-27 +=================== + + * deps: connect@2.25.8 + - deps: body-parser@~1.6.6 + - deps: csurf@~1.4.1 + - deps: qs@2.2.0 + +3.16.7 / 2014-08-18 +=================== + + * deps: connect@2.25.7 + - deps: body-parser@~1.6.5 + - deps: express-session@~1.7.6 + - deps: morgan@~1.2.3 + - deps: serve-static@~1.5.3 + * deps: send@0.8.3 + - deps: destroy@1.0.3 + - deps: on-finished@2.1.0 + +3.16.6 / 2014-08-14 +=================== + + * deps: connect@2.25.6 + - deps: body-parser@~1.6.4 + - deps: qs@1.2.2 + - deps: serve-static@~1.5.2 + * deps: send@0.8.2 + - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + +3.16.5 / 2014-08-11 +=================== + + * deps: connect@2.25.5 + - Fix backwards compatibility in `logger` + +3.16.4 / 2014-08-10 +=================== + + * Fix original URL parsing in `res.location` + * deps: connect@2.25.4 + - Fix `query` middleware breaking with argument + - deps: body-parser@~1.6.3 + - deps: compression@~1.0.11 + - deps: connect-timeout@~1.2.2 + - deps: express-session@~1.7.5 + - deps: method-override@~2.1.3 + - deps: on-headers@~1.0.0 + - deps: parseurl@~1.3.0 + - deps: qs@1.2.1 + - deps: response-time@~2.0.1 + - deps: serve-index@~1.1.6 + - deps: serve-static@~1.5.1 + * deps: parseurl@~1.3.0 + +3.16.3 / 2014-08-07 +=================== + + * deps: connect@2.25.3 + - deps: multiparty@3.3.2 + +3.16.2 / 2014-08-07 +=================== + + * deps: connect@2.25.2 + - deps: body-parser@~1.6.2 + - deps: qs@1.2.0 + +3.16.1 / 2014-08-06 +=================== + + * deps: connect@2.25.1 + - deps: body-parser@~1.6.1 + - deps: qs@1.1.0 + +3.16.0 / 2014-08-05 +=================== + + * deps: connect@2.25.0 + - deps: body-parser@~1.6.0 + - deps: compression@~1.0.10 + - deps: csurf@~1.4.0 + - deps: express-session@~1.7.4 + - deps: qs@1.0.2 + - deps: serve-static@~1.5.0 + * deps: send@0.8.1 + - Add `extensions` option + +3.15.3 / 2014-08-04 +=================== + + * fix `res.sendfile` regression for serving directory index files + * deps: connect@2.24.3 + - deps: serve-index@~1.1.5 + - deps: serve-static@~1.4.4 + * deps: send@0.7.4 + - Fix incorrect 403 on Windows and Node.js 0.11 + - Fix serving index files without root dir + +3.15.2 / 2014-07-27 +=================== + + * deps: connect@2.24.2 + - deps: body-parser@~1.5.2 + - deps: depd@0.4.4 + - deps: express-session@~1.7.2 + - deps: morgan@~1.2.2 + - deps: serve-static@~1.4.2 + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + * deps: send@0.7.2 + - deps: depd@0.4.4 + +3.15.1 / 2014-07-26 +=================== + + * deps: connect@2.24.1 + - deps: body-parser@~1.5.1 + - deps: depd@0.4.3 + - deps: express-session@~1.7.1 + - deps: morgan@~1.2.1 + - deps: serve-index@~1.1.4 + - deps: serve-static@~1.4.1 + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + * deps: send@0.7.1 + - deps: depd@0.4.3 + +3.15.0 / 2014-07-22 +=================== + + * Fix `req.protocol` for proxy-direct connections + * Pass options from `res.sendfile` to `send` + * deps: connect@2.24.0 + - deps: body-parser@~1.5.0 + - deps: compression@~1.0.9 + - deps: connect-timeout@~1.2.1 + - deps: debug@1.0.4 + - deps: depd@0.4.2 + - deps: express-session@~1.7.0 + - deps: finalhandler@0.1.0 + - deps: method-override@~2.1.2 + - deps: morgan@~1.2.0 + - deps: multiparty@3.3.1 + - deps: parseurl@~1.2.0 + - deps: serve-static@~1.4.0 + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * deps: send@0.7.0 + - Add `dotfiles` option + - Cap `maxAge` value to 1 year + - deps: debug@1.0.4 + - deps: depd@0.4.2 + +3.14.0 / 2014-07-11 +=================== + + * add explicit "Rosetta Flash JSONP abuse" protection + - previous versions are not vulnerable; this is just explicit protection + * deprecate `res.redirect(url, status)` -- use `res.redirect(status, url)` instead + * fix `res.send(status, num)` to send `num` as json (not error) + * remove unnecessary escaping when `res.jsonp` returns JSON response + * deps: basic-auth@1.0.0 + - support empty password + - support empty username + * deps: connect@2.23.0 + - deps: debug@1.0.3 + - deps: express-session@~1.6.4 + - deps: method-override@~2.1.0 + - deps: parseurl@~1.1.3 + - deps: serve-static@~1.3.1 + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + * deps: methods@1.1.0 + - add `CONNECT` + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + +3.13.0 / 2014-07-03 +=================== + + * add deprecation message to `app.configure` + * add deprecation message to `req.auth` + * use `basic-auth` to parse `Authorization` header + * deps: connect@2.22.0 + - deps: csurf@~1.3.0 + - deps: express-session@~1.6.1 + - deps: multiparty@3.3.0 + - deps: serve-static@~1.3.0 + * deps: send@0.5.0 + - Accept string for `maxage` (converted by `ms`) + - Include link in default redirect response + +3.12.1 / 2014-06-26 +=================== + + * deps: connect@2.21.1 + - deps: cookie-parser@1.3.2 + - deps: cookie-signature@1.0.4 + - deps: express-session@~1.5.2 + - deps: type-is@~1.3.2 + * deps: cookie-signature@1.0.4 + - fix for timing attacks + +3.12.0 / 2014-06-21 +=================== + + * use `media-typer` to alter content-type charset + * deps: connect@2.21.0 + - deprecate `connect(middleware)` -- use `app.use(middleware)` instead + - deprecate `connect.createServer()` -- use `connect()` instead + - fix `res.setHeader()` patch to work with with get -> append -> set pattern + - deps: compression@~1.0.8 + - deps: errorhandler@~1.1.1 + - deps: express-session@~1.5.0 + - deps: serve-index@~1.1.3 + +3.11.0 / 2014-06-19 +=================== + + * deprecate things with `depd` module + * deps: buffer-crc32@0.2.3 + * deps: connect@2.20.2 + - deprecate `verify` option to `json` -- use `body-parser` npm module instead + - deprecate `verify` option to `urlencoded` -- use `body-parser` npm module instead + - deprecate things with `depd` module + - use `finalhandler` for final response handling + - use `media-typer` to parse `content-type` for charset + - deps: body-parser@1.4.3 + - deps: connect-timeout@1.1.1 + - deps: cookie-parser@1.3.1 + - deps: csurf@1.2.2 + - deps: errorhandler@1.1.0 + - deps: express-session@1.4.0 + - deps: multiparty@3.2.9 + - deps: serve-index@1.1.2 + - deps: type-is@1.3.1 + - deps: vhost@2.0.0 + +3.10.5 / 2014-06-11 +=================== + + * deps: connect@2.19.6 + - deps: body-parser@1.3.1 + - deps: compression@1.0.7 + - deps: debug@1.0.2 + - deps: serve-index@1.1.1 + - deps: serve-static@1.2.3 + * deps: debug@1.0.2 + * deps: send@0.4.3 + - Do not throw un-catchable error on file open race condition + - Use `escape-html` for HTML escaping + - deps: debug@1.0.2 + - deps: finished@1.2.2 + - deps: fresh@0.2.2 + +3.10.4 / 2014-06-09 +=================== + + * deps: connect@2.19.5 + - fix "event emitter leak" warnings + - deps: csurf@1.2.1 + - deps: debug@1.0.1 + - deps: serve-static@1.2.2 + - deps: type-is@1.2.1 + * deps: debug@1.0.1 + * deps: send@0.4.2 + - fix "event emitter leak" warnings + - deps: finished@1.2.1 + - deps: debug@1.0.1 + +3.10.3 / 2014-06-05 +=================== + + * use `vary` module for `res.vary` + * deps: connect@2.19.4 + - deps: errorhandler@1.0.2 + - deps: method-override@2.0.2 + - deps: serve-favicon@2.0.1 + * deps: debug@1.0.0 + +3.10.2 / 2014-06-03 +=================== + + * deps: connect@2.19.3 + - deps: compression@1.0.6 + +3.10.1 / 2014-06-03 +=================== + + * deps: connect@2.19.2 + - deps: compression@1.0.4 + * deps: proxy-addr@1.0.1 + +3.10.0 / 2014-06-02 +=================== + + * deps: connect@2.19.1 + - deprecate `methodOverride()` -- use `method-override` npm module instead + - deps: body-parser@1.3.0 + - deps: method-override@2.0.1 + - deps: multiparty@3.2.8 + - deps: response-time@2.0.0 + - deps: serve-static@1.2.1 + * deps: methods@1.0.1 + * deps: send@0.4.1 + - Send `max-age` in `Cache-Control` in correct format + +3.9.0 / 2014-05-30 +================== + + * custom etag control with `app.set('etag', val)` + - `app.set('etag', function(body, encoding){ return '"etag"' })` custom etag generation + - `app.set('etag', 'weak')` weak tag + - `app.set('etag', 'strong')` strong etag + - `app.set('etag', false)` turn off + - `app.set('etag', true)` standard etag + * Include ETag in HEAD requests + * mark `res.send` ETag as weak and reduce collisions + * update connect to 2.18.0 + - deps: compression@1.0.3 + - deps: serve-index@1.1.0 + - deps: serve-static@1.2.0 + * update send to 0.4.0 + - Calculate ETag with md5 for reduced collisions + - Ignore stream errors after request ends + - deps: debug@0.8.1 + +3.8.1 / 2014-05-27 +================== + + * update connect to 2.17.3 + - deps: body-parser@1.2.2 + - deps: express-session@1.2.1 + - deps: method-override@1.0.2 + +3.8.0 / 2014-05-21 +================== + + * keep previous `Content-Type` for `res.jsonp` + * set proper `charset` in `Content-Type` for `res.send` + * update connect to 2.17.1 + - fix `res.charset` appending charset when `content-type` has one + - deps: express-session@1.2.0 + - deps: morgan@1.1.1 + - deps: serve-index@1.0.3 + +3.7.0 / 2014-05-18 +================== + + * proper proxy trust with `app.set('trust proxy', trust)` + - `app.set('trust proxy', 1)` trust first hop + - `app.set('trust proxy', 'loopback')` trust loopback addresses + - `app.set('trust proxy', '10.0.0.1')` trust single IP + - `app.set('trust proxy', '10.0.0.1/16')` trust subnet + - `app.set('trust proxy', '10.0.0.1, 10.0.0.2')` trust list + - `app.set('trust proxy', false)` turn off + - `app.set('trust proxy', true)` trust everything + * update connect to 2.16.2 + - deprecate `res.headerSent` -- use `res.headersSent` + - deprecate `res.on("header")` -- use on-headers module instead + - fix edge-case in `res.appendHeader` that would append in wrong order + - json: use body-parser + - urlencoded: use body-parser + - dep: bytes@1.0.0 + - dep: cookie-parser@1.1.0 + - dep: csurf@1.2.0 + - dep: express-session@1.1.0 + - dep: method-override@1.0.1 + +3.6.0 / 2014-05-09 +================== + + * deprecate `app.del()` -- use `app.delete()` instead + * deprecate `res.json(obj, status)` -- use `res.json(status, obj)` instead + - the edge-case `res.json(status, num)` requires `res.status(status).json(num)` + * deprecate `res.jsonp(obj, status)` -- use `res.jsonp(status, obj)` instead + - the edge-case `res.jsonp(status, num)` requires `res.status(status).jsonp(num)` + * support PURGE method + - add `app.purge` + - add `router.purge` + - include PURGE in `app.all` + * update connect to 2.15.0 + * Add `res.appendHeader` + * Call error stack even when response has been sent + * Patch `res.headerSent` to return Boolean + * Patch `res.headersSent` for node.js 0.8 + * Prevent default 404 handler after response sent + * dep: compression@1.0.2 + * dep: connect-timeout@1.1.0 + * dep: debug@^0.8.0 + * dep: errorhandler@1.0.1 + * dep: express-session@1.0.4 + * dep: morgan@1.0.1 + * dep: serve-favicon@2.0.0 + * dep: serve-index@1.0.2 + * update debug to 0.8.0 + * add `enable()` method + * change from stderr to stdout + * update methods to 1.0.0 + - add PURGE + * update mkdirp to 0.5.0 + +3.5.3 / 2014-05-08 +================== + + * fix `req.host` for IPv6 literals + * fix `res.jsonp` error if callback param is object + +3.5.2 / 2014-04-24 +================== + + * update connect to 2.14.5 + * update cookie to 0.1.2 + * update mkdirp to 0.4.0 + * update send to 0.3.0 + +3.5.1 / 2014-03-25 +================== + + * pin less-middleware in generated app + +3.5.0 / 2014-03-06 +================== + + * bump deps + +3.4.8 / 2014-01-13 +================== + + * prevent incorrect automatic OPTIONS responses #1868 @dpatti + * update binary and examples for jade 1.0 #1876 @yossi, #1877 @reqshark, #1892 @matheusazzi + * throw 400 in case of malformed paths @rlidwka + +3.4.7 / 2013-12-10 +================== + + * update connect + +3.4.6 / 2013-12-01 +================== + + * update connect (raw-body) + +3.4.5 / 2013-11-27 +================== + + * update connect + * res.location: remove leading ./ #1802 @kapouer + * res.redirect: fix `res.redirect('toString') #1829 @michaelficarra + * res.send: always send ETag when content-length > 0 + * router: add Router.all() method + +3.4.4 / 2013-10-29 +================== + + * update connect + * update supertest + * update methods + * express(1): replace bodyParser() with urlencoded() and json() #1795 @chirag04 + +3.4.3 / 2013-10-23 +================== + + * update connect + +3.4.2 / 2013-10-18 +================== + + * update connect + * downgrade commander + +3.4.1 / 2013-10-15 +================== + + * update connect + * update commander + * jsonp: check if callback is a function + * router: wrap encodeURIComponent in a try/catch #1735 (@lxe) + * res.format: now includes charset @1747 (@sorribas) + * res.links: allow multiple calls @1746 (@sorribas) + +3.4.0 / 2013-09-07 +================== + + * add res.vary(). Closes #1682 + * update connect + +3.3.8 / 2013-09-02 +================== + + * update connect + +3.3.7 / 2013-08-28 +================== + + * update connect + +3.3.6 / 2013-08-27 +================== + + * Revert "remove charset from json responses. Closes #1631" (causes issues in some clients) + * add: req.accepts take an argument list + +3.3.4 / 2013-07-08 +================== + + * update send and connect + +3.3.3 / 2013-07-04 +================== + + * update connect + +3.3.2 / 2013-07-03 +================== + + * update connect + * update send + * remove .version export + +3.3.1 / 2013-06-27 +================== + + * update connect + +3.3.0 / 2013-06-26 +================== + + * update connect + * add support for multiple X-Forwarded-Proto values. Closes #1646 + * change: remove charset from json responses. Closes #1631 + * change: return actual booleans from req.accept* functions + * fix jsonp callback array throw + +3.2.6 / 2013-06-02 +================== + + * update connect + +3.2.5 / 2013-05-21 +================== + + * update connect + * update node-cookie + * add: throw a meaningful error when there is no default engine + * change generation of ETags with res.send() to GET requests only. Closes #1619 + +3.2.4 / 2013-05-09 +================== + + * fix `req.subdomains` when no Host is present + * fix `req.host` when no Host is present, return undefined + +3.2.3 / 2013-05-07 +================== + + * update connect / qs + +3.2.2 / 2013-05-03 +================== + + * update qs + +3.2.1 / 2013-04-29 +================== + + * add app.VERB() paths array deprecation warning + * update connect + * update qs and remove all ~ semver crap + * fix: accept number as value of Signed Cookie + +3.2.0 / 2013-04-15 +================== + + * add "view" constructor setting to override view behaviour + * add req.acceptsEncoding(name) + * add req.acceptedEncodings + * revert cookie signature change causing session race conditions + * fix sorting of Accept values of the same quality + +3.1.2 / 2013-04-12 +================== + + * add support for custom Accept parameters + * update cookie-signature + +3.1.1 / 2013-04-01 +================== + + * add X-Forwarded-Host support to `req.host` + * fix relative redirects + * update mkdirp + * update buffer-crc32 + * remove legacy app.configure() method from app template. + +3.1.0 / 2013-01-25 +================== + + * add support for leading "." in "view engine" setting + * add array support to `res.set()` + * add node 0.8.x to travis.yml + * add "subdomain offset" setting for tweaking `req.subdomains` + * add `res.location(url)` implementing `res.redirect()`-like setting of Location + * use app.get() for x-powered-by setting for inheritance + * fix colons in passwords for `req.auth` + +3.0.6 / 2013-01-04 +================== + + * add http verb methods to Router + * update connect + * fix mangling of the `res.cookie()` options object + * fix jsonp whitespace escape. Closes #1132 + +3.0.5 / 2012-12-19 +================== + + * add throwing when a non-function is passed to a route + * fix: explicitly remove Transfer-Encoding header from 204 and 304 responses + * revert "add 'etag' option" + +3.0.4 / 2012-12-05 +================== + + * add 'etag' option to disable `res.send()` Etags + * add escaping of urls in text/plain in `res.redirect()` + for old browsers interpreting as html + * change crc32 module for a more liberal license + * update connect + +3.0.3 / 2012-11-13 +================== + + * update connect + * update cookie module + * fix cookie max-age + +3.0.2 / 2012-11-08 +================== + + * add OPTIONS to cors example. Closes #1398 + * fix route chaining regression. Closes #1397 + +3.0.1 / 2012-11-01 +================== + + * update connect + +3.0.0 / 2012-10-23 +================== + + * add `make clean` + * add "Basic" check to req.auth + * add `req.auth` test coverage + * add cb && cb(payload) to `res.jsonp()`. Closes #1374 + * add backwards compat for `res.redirect()` status. Closes #1336 + * add support for `res.json()` to retain previously defined Content-Types. Closes #1349 + * update connect + * change `res.redirect()` to utilize a pathname-relative Location again. Closes #1382 + * remove non-primitive string support for `res.send()` + * fix view-locals example. Closes #1370 + * fix route-separation example + +3.0.0rc5 / 2012-09-18 +================== + + * update connect + * add redis search example + * add static-files example + * add "x-powered-by" setting (`app.disable('x-powered-by')`) + * add "application/octet-stream" redirect Accept test case. Closes #1317 + +3.0.0rc4 / 2012-08-30 +================== + + * add `res.jsonp()`. Closes #1307 + * add "verbose errors" option to error-pages example + * add another route example to express(1) so people are not so confused + * add redis online user activity tracking example + * update connect dep + * fix etag quoting. Closes #1310 + * fix error-pages 404 status + * fix jsonp callback char restrictions + * remove old OPTIONS default response + +3.0.0rc3 / 2012-08-13 +================== + + * update connect dep + * fix signed cookies to work with `connect.cookieParser()` ("s:" prefix was missing) [tnydwrds] + * fix `res.render()` clobbering of "locals" + +3.0.0rc2 / 2012-08-03 +================== + + * add CORS example + * update connect dep + * deprecate `.createServer()` & remove old stale examples + * fix: escape `res.redirect()` link + * fix vhost example + +3.0.0rc1 / 2012-07-24 +================== + + * add more examples to view-locals + * add scheme-relative redirects (`res.redirect("//foo.com")`) support + * update cookie dep + * update connect dep + * update send dep + * fix `express(1)` -h flag, use -H for hogan. Closes #1245 + * fix `res.sendfile()` socket error handling regression + +3.0.0beta7 / 2012-07-16 +================== + + * update connect dep for `send()` root normalization regression + +3.0.0beta6 / 2012-07-13 +================== + + * add `err.view` property for view errors. Closes #1226 + * add "jsonp callback name" setting + * add support for "/foo/:bar*" non-greedy matches + * change `res.sendfile()` to use `send()` module + * change `res.send` to use "response-send" module + * remove `app.locals.use` and `res.locals.use`, use regular middleware + +3.0.0beta5 / 2012-07-03 +================== + + * add "make check" support + * add route-map example + * add `res.json(obj, status)` support back for BC + * add "methods" dep, remove internal methods module + * update connect dep + * update auth example to utilize cores pbkdf2 + * updated tests to use "supertest" + +3.0.0beta4 / 2012-06-25 +================== + + * Added `req.auth` + * Added `req.range(size)` + * Added `res.links(obj)` + * Added `res.send(body, status)` support back for backwards compat + * Added `.default()` support to `res.format()` + * Added 2xx / 304 check to `req.fresh` + * Revert "Added + support to the router" + * Fixed `res.send()` freshness check, respect res.statusCode + +3.0.0beta3 / 2012-06-15 +================== + + * Added hogan `--hjs` to express(1) [nullfirm] + * Added another example to content-negotiation + * Added `fresh` dep + * Changed: `res.send()` always checks freshness + * Fixed: expose connects mime module. Closes #1165 + +3.0.0beta2 / 2012-06-06 +================== + + * Added `+` support to the router + * Added `req.host` + * Changed `req.param()` to check route first + * Update connect dep + +3.0.0beta1 / 2012-06-01 +================== + + * Added `res.format()` callback to override default 406 behaviour + * Fixed `res.redirect()` 406. Closes #1154 + +3.0.0alpha5 / 2012-05-30 +================== + + * Added `req.ip` + * Added `{ signed: true }` option to `res.cookie()` + * Removed `res.signedCookie()` + * Changed: dont reverse `req.ips` + * Fixed "trust proxy" setting check for `req.ips` + +3.0.0alpha4 / 2012-05-09 +================== + + * Added: allow `[]` in jsonp callback. Closes #1128 + * Added `PORT` env var support in generated template. Closes #1118 [benatkin] + * Updated: connect 2.2.2 + +3.0.0alpha3 / 2012-05-04 +================== + + * Added public `app.routes`. Closes #887 + * Added _view-locals_ example + * Added _mvc_ example + * Added `res.locals.use()`. Closes #1120 + * Added conditional-GET support to `res.send()` + * Added: coerce `res.set()` values to strings + * Changed: moved `static()` in generated apps below router + * Changed: `res.send()` only set ETag when not previously set + * Changed connect 2.2.1 dep + * Changed: `make test` now runs unit / acceptance tests + * Fixed req/res proto inheritance + +3.0.0alpha2 / 2012-04-26 +================== + + * Added `make benchmark` back + * Added `res.send()` support for `String` objects + * Added client-side data exposing example + * Added `res.header()` and `req.header()` aliases for BC + * Added `express.createServer()` for BC + * Perf: memoize parsed urls + * Perf: connect 2.2.0 dep + * Changed: make `expressInit()` middleware self-aware + * Fixed: use app.get() for all core settings + * Fixed redis session example + * Fixed session example. Closes #1105 + * Fixed generated express dep. Closes #1078 + +3.0.0alpha1 / 2012-04-15 +================== + + * Added `app.locals.use(callback)` + * Added `app.locals` object + * Added `app.locals(obj)` + * Added `res.locals` object + * Added `res.locals(obj)` + * Added `res.format()` for content-negotiation + * Added `app.engine()` + * Added `res.cookie()` JSON cookie support + * Added "trust proxy" setting + * Added `req.subdomains` + * Added `req.protocol` + * Added `req.secure` + * Added `req.path` + * Added `req.ips` + * Added `req.fresh` + * Added `req.stale` + * Added comma-delimited / array support for `req.accepts()` + * Added debug instrumentation + * Added `res.set(obj)` + * Added `res.set(field, value)` + * Added `res.get(field)` + * Added `app.get(setting)`. Closes #842 + * Added `req.acceptsLanguage()` + * Added `req.acceptsCharset()` + * Added `req.accepted` + * Added `req.acceptedLanguages` + * Added `req.acceptedCharsets` + * Added "json replacer" setting + * Added "json spaces" setting + * Added X-Forwarded-Proto support to `res.redirect()`. Closes #92 + * Added `--less` support to express(1) + * Added `express.response` prototype + * Added `express.request` prototype + * Added `express.application` prototype + * Added `app.path()` + * Added `app.render()` + * Added `res.type()` to replace `res.contentType()` + * Changed: `res.redirect()` to add relative support + * Changed: enable "jsonp callback" by default + * Changed: renamed "case sensitive routes" to "case sensitive routing" + * Rewrite of all tests with mocha + * Removed "root" setting + * Removed `res.redirect('home')` support + * Removed `req.notify()` + * Removed `app.register()` + * Removed `app.redirect()` + * Removed `app.is()` + * Removed `app.helpers()` + * Removed `app.dynamicHelpers()` + * Fixed `res.sendfile()` with non-GET. Closes #723 + * Fixed express(1) public dir for windows. Closes #866 + +2.5.9/ 2012-04-02 +================== + + * Added support for PURGE request method [pbuyle] + * Fixed `express(1)` generated app `app.address()` before `listening` [mmalecki] + +2.5.8 / 2012-02-08 +================== + + * Update mkdirp dep. Closes #991 + +2.5.7 / 2012-02-06 +================== + + * Fixed `app.all` duplicate DELETE requests [mscdex] + +2.5.6 / 2012-01-13 +================== + + * Updated hamljs dev dep. Closes #953 + +2.5.5 / 2012-01-08 +================== + + * Fixed: set `filename` on cached templates [matthewleon] + +2.5.4 / 2012-01-02 +================== + + * Fixed `express(1)` eol on 0.4.x. Closes #947 + +2.5.3 / 2011-12-30 +================== + + * Fixed `req.is()` when a charset is present + +2.5.2 / 2011-12-10 +================== + + * Fixed: express(1) LF -> CRLF for windows + +2.5.1 / 2011-11-17 +================== + + * Changed: updated connect to 1.8.x + * Removed sass.js support from express(1) + +2.5.0 / 2011-10-24 +================== + + * Added ./routes dir for generated app by default + * Added npm install reminder to express(1) app gen + * Added 0.5.x support + * Removed `make test-cov` since it wont work with node 0.5.x + * Fixed express(1) public dir for windows. Closes #866 + +2.4.7 / 2011-10-05 +================== + + * Added mkdirp to express(1). Closes #795 + * Added simple _json-config_ example + * Added shorthand for the parsed request's pathname via `req.path` + * Changed connect dep to 1.7.x to fix npm issue... + * Fixed `res.redirect()` __HEAD__ support. [reported by xerox] + * Fixed `req.flash()`, only escape args + * Fixed absolute path checking on windows. Closes #829 [reported by andrewpmckenzie] + +2.4.6 / 2011-08-22 +================== + + * Fixed multiple param callback regression. Closes #824 [reported by TroyGoode] + +2.4.5 / 2011-08-19 +================== + + * Added support for routes to handle errors. Closes #809 + * Added `app.routes.all()`. Closes #803 + * Added "basepath" setting to work in conjunction with reverse proxies etc. + * Refactored `Route` to use a single array of callbacks + * Added support for multiple callbacks for `app.param()`. Closes #801 +Closes #805 + * Changed: removed .call(self) for route callbacks + * Dependency: `qs >= 0.3.1` + * Fixed `res.redirect()` on windows due to `join()` usage. Closes #808 + +2.4.4 / 2011-08-05 +================== + + * Fixed `res.header()` intention of a set, even when `undefined` + * Fixed `*`, value no longer required + * Fixed `res.send(204)` support. Closes #771 + +2.4.3 / 2011-07-14 +================== + + * Added docs for `status` option special-case. Closes #739 + * Fixed `options.filename`, exposing the view path to template engines + +2.4.2. / 2011-07-06 +================== + + * Revert "removed jsonp stripping" for XSS + +2.4.1 / 2011-07-06 +================== + + * Added `res.json()` JSONP support. Closes #737 + * Added _extending-templates_ example. Closes #730 + * Added "strict routing" setting for trailing slashes + * Added support for multiple envs in `app.configure()` calls. Closes #735 + * Changed: `res.send()` using `res.json()` + * Changed: when cookie `path === null` don't default it + * Changed; default cookie path to "home" setting. Closes #731 + * Removed _pids/logs_ creation from express(1) + +2.4.0 / 2011-06-28 +================== + + * Added chainable `res.status(code)` + * Added `res.json()`, an explicit version of `res.send(obj)` + * Added simple web-service example + +2.3.12 / 2011-06-22 +================== + + * \#express is now on freenode! come join! + * Added `req.get(field, param)` + * Added links to Japanese documentation, thanks @hideyukisaito! + * Added; the `express(1)` generated app outputs the env + * Added `content-negotiation` example + * Dependency: connect >= 1.5.1 < 2.0.0 + * Fixed view layout bug. Closes #720 + * Fixed; ignore body on 304. Closes #701 + +2.3.11 / 2011-06-04 +================== + + * Added `npm test` + * Removed generation of dummy test file from `express(1)` + * Fixed; `express(1)` adds express as a dep + * Fixed; prune on `prepublish` + +2.3.10 / 2011-05-27 +================== + + * Added `req.route`, exposing the current route + * Added _package.json_ generation support to `express(1)` + * Fixed call to `app.param()` function for optional params. Closes #682 + +2.3.9 / 2011-05-25 +================== + + * Fixed bug-ish with `../' in `res.partial()` calls + +2.3.8 / 2011-05-24 +================== + + * Fixed `app.options()` + +2.3.7 / 2011-05-23 +================== + + * Added route `Collection`, ex: `app.get('/user/:id').remove();` + * Added support for `app.param(fn)` to define param logic + * Removed `app.param()` support for callback with return value + * Removed module.parent check from express(1) generated app. Closes #670 + * Refactored router. Closes #639 + +2.3.6 / 2011-05-20 +================== + + * Changed; using devDependencies instead of git submodules + * Fixed redis session example + * Fixed markdown example + * Fixed view caching, should not be enabled in development + +2.3.5 / 2011-05-20 +================== + + * Added export `.view` as alias for `.View` + +2.3.4 / 2011-05-08 +================== + + * Added `./examples/say` + * Fixed `res.sendfile()` bug preventing the transfer of files with spaces + +2.3.3 / 2011-05-03 +================== + + * Added "case sensitive routes" option. + * Changed; split methods supported per rfc [slaskis] + * Fixed route-specific middleware when using the same callback function several times + +2.3.2 / 2011-04-27 +================== + + * Fixed view hints + +2.3.1 / 2011-04-26 +================== + + * Added `app.match()` as `app.match.all()` + * Added `app.lookup()` as `app.lookup.all()` + * Added `app.remove()` for `app.remove.all()` + * Added `app.remove.VERB()` + * Fixed template caching collision issue. Closes #644 + * Moved router over from connect and started refactor + +2.3.0 / 2011-04-25 +================== + + * Added options support to `res.clearCookie()` + * Added `res.helpers()` as alias of `res.locals()` + * Added; json defaults to UTF-8 with `res.send()`. Closes #632. [Daniel * Dependency `connect >= 1.4.0` + * Changed; auto set Content-Type in res.attachement [Aaron Heckmann] + * Renamed "cache views" to "view cache". Closes #628 + * Fixed caching of views when using several apps. Closes #637 + * Fixed gotcha invoking `app.param()` callbacks once per route middleware. +Closes #638 + * Fixed partial lookup precedence. Closes #631 +Shaw] + +2.2.2 / 2011-04-12 +================== + + * Added second callback support for `res.download()` connection errors + * Fixed `filename` option passing to template engine + +2.2.1 / 2011-04-04 +================== + + * Added `layout(path)` helper to change the layout within a view. Closes #610 + * Fixed `partial()` collection object support. + Previously only anything with `.length` would work. + When `.length` is present one must still be aware of holes, + however now `{ collection: {foo: 'bar'}}` is valid, exposes + `keyInCollection` and `keysInCollection`. + + * Performance improved with better view caching + * Removed `request` and `response` locals + * Changed; errorHandler page title is now `Express` instead of `Connect` + +2.2.0 / 2011-03-30 +================== + + * Added `app.lookup.VERB()`, ex `app.lookup.put('/user/:id')`. Closes #606 + * Added `app.match.VERB()`, ex `app.match.put('/user/12')`. Closes #606 + * Added `app.VERB(path)` as alias of `app.lookup.VERB()`. + * Dependency `connect >= 1.2.0` + +2.1.1 / 2011-03-29 +================== + + * Added; expose `err.view` object when failing to locate a view + * Fixed `res.partial()` call `next(err)` when no callback is given [reported by aheckmann] + * Fixed; `res.send(undefined)` responds with 204 [aheckmann] + +2.1.0 / 2011-03-24 +================== + + * Added `/_?` partial lookup support. Closes #447 + * Added `request`, `response`, and `app` local variables + * Added `settings` local variable, containing the app's settings + * Added `req.flash()` exception if `req.session` is not available + * Added `res.send(bool)` support (json response) + * Fixed stylus example for latest version + * Fixed; wrap try/catch around `res.render()` + +2.0.0 / 2011-03-17 +================== + + * Fixed up index view path alternative. + * Changed; `res.locals()` without object returns the locals + +2.0.0rc3 / 2011-03-17 +================== + + * Added `res.locals(obj)` to compliment `res.local(key, val)` + * Added `res.partial()` callback support + * Fixed recursive error reporting issue in `res.render()` + +2.0.0rc2 / 2011-03-17 +================== + + * Changed; `partial()` "locals" are now optional + * Fixed `SlowBuffer` support. Closes #584 [reported by tyrda01] + * Fixed .filename view engine option [reported by drudge] + * Fixed blog example + * Fixed `{req,res}.app` reference when mounting [Ben Weaver] + +2.0.0rc / 2011-03-14 +================== + + * Fixed; expose `HTTPSServer` constructor + * Fixed express(1) default test charset. Closes #579 [reported by secoif] + * Fixed; default charset to utf-8 instead of utf8 for lame IE [reported by NickP] + +2.0.0beta3 / 2011-03-09 +================== + + * Added support for `res.contentType()` literal + The original `res.contentType('.json')`, + `res.contentType('application/json')`, and `res.contentType('json')` + will work now. + * Added `res.render()` status option support back + * Added charset option for `res.render()` + * Added `.charset` support (via connect 1.0.4) + * Added view resolution hints when in development and a lookup fails + * Added layout lookup support relative to the page view. + For example while rendering `./views/user/index.jade` if you create + `./views/user/layout.jade` it will be used in favour of the root layout. + * Fixed `res.redirect()`. RFC states absolute url [reported by unlink] + * Fixed; default `res.send()` string charset to utf8 + * Removed `Partial` constructor (not currently used) + +2.0.0beta2 / 2011-03-07 +================== + + * Added res.render() `.locals` support back to aid in migration process + * Fixed flash example + +2.0.0beta / 2011-03-03 +================== + + * Added HTTPS support + * Added `res.cookie()` maxAge support + * Added `req.header()` _Referrer_ / _Referer_ special-case, either works + * Added mount support for `res.redirect()`, now respects the mount-point + * Added `union()` util, taking place of `merge(clone())` combo + * Added stylus support to express(1) generated app + * Added secret to session middleware used in examples and generated app + * Added `res.local(name, val)` for progressive view locals + * Added default param support to `req.param(name, default)` + * Added `app.disabled()` and `app.enabled()` + * Added `app.register()` support for omitting leading ".", either works + * Added `res.partial()`, using the same interface as `partial()` within a view. Closes #539 + * Added `app.param()` to map route params to async/sync logic + * Added; aliased `app.helpers()` as `app.locals()`. Closes #481 + * Added extname with no leading "." support to `res.contentType()` + * Added `cache views` setting, defaulting to enabled in "production" env + * Added index file partial resolution, eg: partial('user') may try _views/user/index.jade_. + * Added `req.accepts()` support for extensions + * Changed; `res.download()` and `res.sendfile()` now utilize Connect's + static file server `connect.static.send()`. + * Changed; replaced `connect.utils.mime()` with npm _mime_ module + * Changed; allow `req.query` to be pre-defined (via middleware or other parent + * Changed view partial resolution, now relative to parent view + * Changed view engine signature. no longer `engine.render(str, options, callback)`, now `engine.compile(str, options) -> Function`, the returned function accepts `fn(locals)`. + * Fixed `req.param()` bug returning Array.prototype methods. Closes #552 + * Fixed; using `Stream#pipe()` instead of `sys.pump()` in `res.sendfile()` + * Fixed; using _qs_ module instead of _querystring_ + * Fixed; strip unsafe chars from jsonp callbacks + * Removed "stream threshold" setting + +1.0.8 / 2011-03-01 +================== + + * Allow `req.query` to be pre-defined (via middleware or other parent app) + * "connect": ">= 0.5.0 < 1.0.0". Closes #547 + * Removed the long deprecated __EXPRESS_ENV__ support + +1.0.7 / 2011-02-07 +================== + + * Fixed `render()` setting inheritance. + Mounted apps would not inherit "view engine" + +1.0.6 / 2011-02-07 +================== + + * Fixed `view engine` setting bug when period is in dirname + +1.0.5 / 2011-02-05 +================== + + * Added secret to generated app `session()` call + +1.0.4 / 2011-02-05 +================== + + * Added `qs` dependency to _package.json_ + * Fixed namespaced `require()`s for latest connect support + +1.0.3 / 2011-01-13 +================== + + * Remove unsafe characters from JSONP callback names [Ryan Grove] + +1.0.2 / 2011-01-10 +================== + + * Removed nested require, using `connect.router` + +1.0.1 / 2010-12-29 +================== + + * Fixed for middleware stacked via `createServer()` + previously the `foo` middleware passed to `createServer(foo)` + would not have access to Express methods such as `res.send()` + or props like `req.query` etc. + +1.0.0 / 2010-11-16 +================== + + * Added; deduce partial object names from the last segment. + For example by default `partial('forum/post', postObject)` will + give you the _post_ object, providing a meaningful default. + * Added http status code string representation to `res.redirect()` body + * Added; `res.redirect()` supporting _text/plain_ and _text/html_ via __Accept__. + * Added `req.is()` to aid in content negotiation + * Added partial local inheritance [suggested by masylum]. Closes #102 + providing access to parent template locals. + * Added _-s, --session[s]_ flag to express(1) to add session related middleware + * Added _--template_ flag to express(1) to specify the + template engine to use. + * Added _--css_ flag to express(1) to specify the + stylesheet engine to use (or just plain css by default). + * Added `app.all()` support [thanks aheckmann] + * Added partial direct object support. + You may now `partial('user', user)` providing the "user" local, + vs previously `partial('user', { object: user })`. + * Added _route-separation_ example since many people question ways + to do this with CommonJS modules. Also view the _blog_ example for + an alternative. + * Performance; caching view path derived partial object names + * Fixed partial local inheritance precedence. [reported by Nick Poulden] Closes #454 + * Fixed jsonp support; _text/javascript_ as per mailinglist discussion + +1.0.0rc4 / 2010-10-14 +================== + + * Added _NODE_ENV_ support, _EXPRESS_ENV_ is deprecated and will be removed in 1.0.0 + * Added route-middleware support (very helpful, see the [docs](http://expressjs.com/guide.html#Route-Middleware)) + * Added _jsonp callback_ setting to enable/disable jsonp autowrapping [Dav Glass] + * Added callback query check on response.send to autowrap JSON objects for simple webservice implementations [Dav Glass] + * Added `partial()` support for array-like collections. Closes #434 + * Added support for swappable querystring parsers + * Added session usage docs. Closes #443 + * Added dynamic helper caching. Closes #439 [suggested by maritz] + * Added authentication example + * Added basic Range support to `res.sendfile()` (and `res.download()` etc) + * Changed; `express(1)` generated app using 2 spaces instead of 4 + * Default env to "development" again [aheckmann] + * Removed _context_ option is no more, use "scope" + * Fixed; exposing _./support_ libs to examples so they can run without installs + * Fixed mvc example + +1.0.0rc3 / 2010-09-20 +================== + + * Added confirmation for `express(1)` app generation. Closes #391 + * Added extending of flash formatters via `app.flashFormatters` + * Added flash formatter support. Closes #411 + * Added streaming support to `res.sendfile()` using `sys.pump()` when >= "stream threshold" + * Added _stream threshold_ setting for `res.sendfile()` + * Added `res.send()` __HEAD__ support + * Added `res.clearCookie()` + * Added `res.cookie()` + * Added `res.render()` headers option + * Added `res.redirect()` response bodies + * Added `res.render()` status option support. Closes #425 [thanks aheckmann] + * Fixed `res.sendfile()` responding with 403 on malicious path + * Fixed `res.download()` bug; when an error occurs remove _Content-Disposition_ + * Fixed; mounted apps settings now inherit from parent app [aheckmann] + * Fixed; stripping Content-Length / Content-Type when 204 + * Fixed `res.send()` 204. Closes #419 + * Fixed multiple _Set-Cookie_ headers via `res.header()`. Closes #402 + * Fixed bug messing with error handlers when `listenFD()` is called instead of `listen()`. [thanks guillermo] + + +1.0.0rc2 / 2010-08-17 +================== + + * Added `app.register()` for template engine mapping. Closes #390 + * Added `res.render()` callback support as second argument (no options) + * Added callback support to `res.download()` + * Added callback support for `res.sendfile()` + * Added support for middleware access via `express.middlewareName()` vs `connect.middlewareName()` + * Added "partials" setting to docs + * Added default expresso tests to `express(1)` generated app. Closes #384 + * Fixed `res.sendfile()` error handling, defer via `next()` + * Fixed `res.render()` callback when a layout is used [thanks guillermo] + * Fixed; `make install` creating ~/.node_libraries when not present + * Fixed issue preventing error handlers from being defined anywhere. Closes #387 + +1.0.0rc / 2010-07-28 +================== + + * Added mounted hook. Closes #369 + * Added connect dependency to _package.json_ + + * Removed "reload views" setting and support code + development env never caches, production always caches. + + * Removed _param_ in route callbacks, signature is now + simply (req, res, next), previously (req, res, params, next). + Use _req.params_ for path captures, _req.query_ for GET params. + + * Fixed "home" setting + * Fixed middleware/router precedence issue. Closes #366 + * Fixed; _configure()_ callbacks called immediately. Closes #368 + +1.0.0beta2 / 2010-07-23 +================== + + * Added more examples + * Added; exporting `Server` constructor + * Added `Server#helpers()` for view locals + * Added `Server#dynamicHelpers()` for dynamic view locals. Closes #349 + * Added support for absolute view paths + * Added; _home_ setting defaults to `Server#route` for mounted apps. Closes #363 + * Added Guillermo Rauch to the contributor list + * Added support for "as" for non-collection partials. Closes #341 + * Fixed _install.sh_, ensuring _~/.node_libraries_ exists. Closes #362 [thanks jf] + * Fixed `res.render()` exceptions, now passed to `next()` when no callback is given [thanks guillermo] + * Fixed instanceof `Array` checks, now `Array.isArray()` + * Fixed express(1) expansion of public dirs. Closes #348 + * Fixed middleware precedence. Closes #345 + * Fixed view watcher, now async [thanks aheckmann] + +1.0.0beta / 2010-07-15 +================== + + * Re-write + - much faster + - much lighter + - Check [ExpressJS.com](http://expressjs.com) for migration guide and updated docs + +0.14.0 / 2010-06-15 +================== + + * Utilize relative requires + * Added Static bufferSize option [aheckmann] + * Fixed caching of view and partial subdirectories [aheckmann] + * Fixed mime.type() comments now that ".ext" is not supported + * Updated haml submodule + * Updated class submodule + * Removed bin/express + +0.13.0 / 2010-06-01 +================== + + * Added node v0.1.97 compatibility + * Added support for deleting cookies via Request#cookie('key', null) + * Updated haml submodule + * Fixed not-found page, now using using charset utf-8 + * Fixed show-exceptions page, now using using charset utf-8 + * Fixed view support due to fs.readFile Buffers + * Changed; mime.type() no longer accepts ".type" due to node extname() changes + +0.12.0 / 2010-05-22 +================== + + * Added node v0.1.96 compatibility + * Added view `helpers` export which act as additional local variables + * Updated haml submodule + * Changed ETag; removed inode, modified time only + * Fixed LF to CRLF for setting multiple cookies + * Fixed cookie complation; values are now urlencoded + * Fixed cookies parsing; accepts quoted values and url escaped cookies + +0.11.0 / 2010-05-06 +================== + + * Added support for layouts using different engines + - this.render('page.html.haml', { layout: 'super-cool-layout.html.ejs' }) + - this.render('page.html.haml', { layout: 'foo' }) // assumes 'foo.html.haml' + - this.render('page.html.haml', { layout: false }) // no layout + * Updated ext submodule + * Updated haml submodule + * Fixed EJS partial support by passing along the context. Issue #307 + +0.10.1 / 2010-05-03 +================== + + * Fixed binary uploads. + +0.10.0 / 2010-04-30 +================== + + * Added charset support via Request#charset (automatically assigned to 'UTF-8' when respond()'s + encoding is set to 'utf8' or 'utf-8'. + * Added "encoding" option to Request#render(). Closes #299 + * Added "dump exceptions" setting, which is enabled by default. + * Added simple ejs template engine support + * Added error response support for text/plain, application/json. Closes #297 + * Added callback function param to Request#error() + * Added Request#sendHead() + * Added Request#stream() + * Added support for Request#respond(304, null) for empty response bodies + * Added ETag support to Request#sendfile() + * Added options to Request#sendfile(), passed to fs.createReadStream() + * Added filename arg to Request#download() + * Performance enhanced due to pre-reversing plugins so that plugins.reverse() is not called on each request + * Performance enhanced by preventing several calls to toLowerCase() in Router#match() + * Changed; Request#sendfile() now streams + * Changed; Renamed Request#halt() to Request#respond(). Closes #289 + * Changed; Using sys.inspect() instead of JSON.encode() for error output + * Changed; run() returns the http.Server instance. Closes #298 + * Changed; Defaulting Server#host to null (INADDR_ANY) + * Changed; Logger "common" format scale of 0.4f + * Removed Logger "request" format + * Fixed; Catching ENOENT in view caching, preventing error when "views/partials" is not found + * Fixed several issues with http client + * Fixed Logger Content-Length output + * Fixed bug preventing Opera from retaining the generated session id. Closes #292 + +0.9.0 / 2010-04-14 +================== + + * Added DSL level error() route support + * Added DSL level notFound() route support + * Added Request#error() + * Added Request#notFound() + * Added Request#render() callback function. Closes #258 + * Added "max upload size" setting + * Added "magic" variables to collection partials (\_\_index\_\_, \_\_length\_\_, \_\_isFirst\_\_, \_\_isLast\_\_). Closes #254 + * Added [haml.js](http://github.com/visionmedia/haml.js) submodule; removed haml-js + * Added callback function support to Request#halt() as 3rd/4th arg + * Added preprocessing of route param wildcards using param(). Closes #251 + * Added view partial support (with collections etc) + * Fixed bug preventing falsey params (such as ?page=0). Closes #286 + * Fixed setting of multiple cookies. Closes #199 + * Changed; view naming convention is now NAME.TYPE.ENGINE (for example page.html.haml) + * Changed; session cookie is now httpOnly + * Changed; Request is no longer global + * Changed; Event is no longer global + * Changed; "sys" module is no longer global + * Changed; moved Request#download to Static plugin where it belongs + * Changed; Request instance created before body parsing. Closes #262 + * Changed; Pre-caching views in memory when "cache view contents" is enabled. Closes #253 + * Changed; Pre-caching view partials in memory when "cache view partials" is enabled + * Updated support to node --version 0.1.90 + * Updated dependencies + * Removed set("session cookie") in favour of use(Session, { cookie: { ... }}) + * Removed utils.mixin(); use Object#mergeDeep() + +0.8.0 / 2010-03-19 +================== + + * Added coffeescript example app. Closes #242 + * Changed; cache api now async friendly. Closes #240 + * Removed deprecated 'express/static' support. Use 'express/plugins/static' + +0.7.6 / 2010-03-19 +================== + + * Added Request#isXHR. Closes #229 + * Added `make install` (for the executable) + * Added `express` executable for setting up simple app templates + * Added "GET /public/*" to Static plugin, defaulting to /public + * Added Static plugin + * Fixed; Request#render() only calls cache.get() once + * Fixed; Namespacing View caches with "view:" + * Fixed; Namespacing Static caches with "static:" + * Fixed; Both example apps now use the Static plugin + * Fixed set("views"). Closes #239 + * Fixed missing space for combined log format + * Deprecated Request#sendfile() and 'express/static' + * Removed Server#running + +0.7.5 / 2010-03-16 +================== + + * Added Request#flash() support without args, now returns all flashes + * Updated ext submodule + +0.7.4 / 2010-03-16 +================== + + * Fixed session reaper + * Changed; class.js replacing js-oo Class implementation (quite a bit faster, no browser cruft) + +0.7.3 / 2010-03-16 +================== + + * Added package.json + * Fixed requiring of haml / sass due to kiwi removal + +0.7.2 / 2010-03-16 +================== + + * Fixed GIT submodules (HAH!) + +0.7.1 / 2010-03-16 +================== + + * Changed; Express now using submodules again until a PM is adopted + * Changed; chat example using millisecond conversions from ext + +0.7.0 / 2010-03-15 +================== + + * Added Request#pass() support (finds the next matching route, or the given path) + * Added Logger plugin (default "common" format replaces CommonLogger) + * Removed Profiler plugin + * Removed CommonLogger plugin + +0.6.0 / 2010-03-11 +================== + + * Added seed.yml for kiwi package management support + * Added HTTP client query string support when method is GET. Closes #205 + + * Added support for arbitrary view engines. + For example "foo.engine.html" will now require('engine'), + the exports from this module are cached after the first require(). + + * Added async plugin support + + * Removed usage of RESTful route funcs as http client + get() etc, use http.get() and friends + + * Removed custom exceptions + +0.5.0 / 2010-03-10 +================== + + * Added ext dependency (library of js extensions) + * Removed extname() / basename() utils. Use path module + * Removed toArray() util. Use arguments.values + * Removed escapeRegexp() util. Use RegExp.escape() + * Removed process.mixin() dependency. Use utils.mixin() + * Removed Collection + * Removed ElementCollection + * Shameless self promotion of ebook "Advanced JavaScript" (http://dev-mag.com) ;) + +0.4.0 / 2010-02-11 +================== + + * Added flash() example to sample upload app + * Added high level restful http client module (express/http) + * Changed; RESTful route functions double as HTTP clients. Closes #69 + * Changed; throwing error when routes are added at runtime + * Changed; defaulting render() context to the current Request. Closes #197 + * Updated haml submodule + +0.3.0 / 2010-02-11 +================== + + * Updated haml / sass submodules. Closes #200 + * Added flash message support. Closes #64 + * Added accepts() now allows multiple args. fixes #117 + * Added support for plugins to halt. Closes #189 + * Added alternate layout support. Closes #119 + * Removed Route#run(). Closes #188 + * Fixed broken specs due to use(Cookie) missing + +0.2.1 / 2010-02-05 +================== + + * Added "plot" format option for Profiler (for gnuplot processing) + * Added request number to Profiler plugin + * Fixed binary encoding for multi-part file uploads, was previously defaulting to UTF8 + * Fixed issue with routes not firing when not files are present. Closes #184 + * Fixed process.Promise -> events.Promise + +0.2.0 / 2010-02-03 +================== + + * Added parseParam() support for name[] etc. (allows for file inputs with "multiple" attr) Closes #180 + * Added Both Cache and Session option "reapInterval" may be "reapEvery". Closes #174 + * Added expiration support to cache api with reaper. Closes #133 + * Added cache Store.Memory#reap() + * Added Cache; cache api now uses first class Cache instances + * Added abstract session Store. Closes #172 + * Changed; cache Memory.Store#get() utilizing Collection + * Renamed MemoryStore -> Store.Memory + * Fixed use() of the same plugin several time will always use latest options. Closes #176 + +0.1.0 / 2010-02-03 +================== + + * Changed; Hooks (before / after) pass request as arg as well as evaluated in their context + * Updated node support to 0.1.27 Closes #169 + * Updated dirname(__filename) -> __dirname + * Updated libxmljs support to v0.2.0 + * Added session support with memory store / reaping + * Added quick uid() helper + * Added multi-part upload support + * Added Sass.js support / submodule + * Added production env caching view contents and static files + * Added static file caching. Closes #136 + * Added cache plugin with memory stores + * Added support to StaticFile so that it works with non-textual files. + * Removed dirname() helper + * Removed several globals (now their modules must be required) + +0.0.2 / 2010-01-10 +================== + + * Added view benchmarks; currently haml vs ejs + * Added Request#attachment() specs. Closes #116 + * Added use of node's parseQuery() util. Closes #123 + * Added `make init` for submodules + * Updated Haml + * Updated sample chat app to show messages on load + * Updated libxmljs parseString -> parseHtmlString + * Fixed `make init` to work with older versions of git + * Fixed specs can now run independent specs for those who cant build deps. Closes #127 + * Fixed issues introduced by the node url module changes. Closes 126. + * Fixed two assertions failing due to Collection#keys() returning strings + * Fixed faulty Collection#toArray() spec due to keys() returning strings + * Fixed `make test` now builds libxmljs.node before testing + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/8 node/node_modules/express/LICENSE b/8 node/node_modules/express/LICENSE new file mode 100644 index 000000000..aa927e44e --- /dev/null +++ b/8 node/node_modules/express/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2009-2014 TJ Holowaychuk +Copyright (c) 2013-2014 Roman Shtylman +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/express/Readme.md b/8 node/node_modules/express/Readme.md new file mode 100644 index 000000000..786756a1c --- /dev/null +++ b/8 node/node_modules/express/Readme.md @@ -0,0 +1,141 @@ +[![Express Logo](https://i.cloudup.com/zfY6lL7eFa-3000x3000.png)](http://expressjs.com/) + + Fast, unopinionated, minimalist web framework for [node](http://nodejs.org). + + [![NPM Version][npm-image]][npm-url] + [![NPM Downloads][downloads-image]][downloads-url] + [![Linux Build][travis-image]][travis-url] + [![Windows Build][appveyor-image]][appveyor-url] + [![Test Coverage][coveralls-image]][coveralls-url] + +```js +var express = require('express') +var app = express() + +app.get('/', function (req, res) { + res.send('Hello World') +}) + +app.listen(3000) +``` + +## Installation + +```bash +$ npm install express +``` + +## Features + + * Robust routing + * Focus on high performance + * Super-high test coverage + * HTTP helpers (redirection, caching, etc) + * View system supporting 14+ template engines + * Content negotiation + * Executable for generating applications quickly + +## Docs & Community + + * [Website and Documentation](http://expressjs.com/) - [[website repo](https://github.com/expressjs/expressjs.com)] + * [#express](https://webchat.freenode.net/?channels=express) on freenode IRC + * [Github Organization](https://github.com/expressjs) for Official Middleware & Modules + * Visit the [Wiki](https://github.com/expressjs/express/wiki) + * [Google Group](https://groups.google.com/group/express-js) for discussion + * [Gitter](https://gitter.im/expressjs/express) for support and discussion + +**PROTIP** Be sure to read [Migrating from 3.x to 4.x](https://github.com/expressjs/express/wiki/Migrating-from-3.x-to-4.x) as well as [New features in 4.x](https://github.com/expressjs/express/wiki/New-features-in-4.x). + +### Security Issues + +If you discover a security vulnerability in Express, please see [Security Policies and Procedures](Security.md). + +## Quick Start + + The quickest way to get started with express is to utilize the executable [`express(1)`](https://github.com/expressjs/generator) to generate an application as shown below: + + Install the executable. The executable's major version will match Express's: + +```bash +$ npm install -g express-generator@4 +``` + + Create the app: + +```bash +$ express /tmp/foo && cd /tmp/foo +``` + + Install dependencies: + +```bash +$ npm install +``` + + Start the server: + +```bash +$ npm start +``` + +## Philosophy + + The Express philosophy is to provide small, robust tooling for HTTP servers, making + it a great solution for single page applications, web sites, hybrids, or public + HTTP APIs. + + Express does not force you to use any specific ORM or template engine. With support for over + 14 template engines via [Consolidate.js](https://github.com/tj/consolidate.js), + you can quickly craft your perfect framework. + +## Examples + + To view the examples, clone the Express repo and install the dependencies: + +```bash +$ git clone git://github.com/expressjs/express.git --depth 1 +$ cd express +$ npm install +``` + + Then run whichever example you want: + +```bash +$ node examples/content-negotiation +``` + +## Tests + + To run the test suite, first install the dependencies, then run `npm test`: + +```bash +$ npm install +$ npm test +``` + +## People + +The original author of Express is [TJ Holowaychuk](https://github.com/tj) [![TJ's Gratipay][gratipay-image-visionmedia]][gratipay-url-visionmedia] + +The current lead maintainer is [Douglas Christopher Wilson](https://github.com/dougwilson) [![Doug's Gratipay][gratipay-image-dougwilson]][gratipay-url-dougwilson] + +[List of all contributors](https://github.com/expressjs/express/graphs/contributors) + +## License + + [MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/express.svg +[npm-url]: https://npmjs.org/package/express +[downloads-image]: https://img.shields.io/npm/dm/express.svg +[downloads-url]: https://npmjs.org/package/express +[travis-image]: https://img.shields.io/travis/expressjs/express/master.svg?label=linux +[travis-url]: https://travis-ci.org/expressjs/express +[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/express/master.svg?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/express +[coveralls-image]: https://img.shields.io/coveralls/expressjs/express/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/express?branch=master +[gratipay-image-visionmedia]: https://img.shields.io/gratipay/visionmedia.svg +[gratipay-url-visionmedia]: https://gratipay.com/visionmedia/ +[gratipay-image-dougwilson]: https://img.shields.io/gratipay/dougwilson.svg +[gratipay-url-dougwilson]: https://gratipay.com/dougwilson/ diff --git a/8 node/node_modules/express/index.js b/8 node/node_modules/express/index.js new file mode 100644 index 000000000..d219b0c87 --- /dev/null +++ b/8 node/node_modules/express/index.js @@ -0,0 +1,11 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +module.exports = require('./lib/express'); diff --git a/8 node/node_modules/express/lib/application.js b/8 node/node_modules/express/lib/application.js new file mode 100644 index 000000000..1abe8d08f --- /dev/null +++ b/8 node/node_modules/express/lib/application.js @@ -0,0 +1,644 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var finalhandler = require('finalhandler'); +var Router = require('./router'); +var methods = require('methods'); +var middleware = require('./middleware/init'); +var query = require('./middleware/query'); +var debug = require('debug')('express:application'); +var View = require('./view'); +var http = require('http'); +var compileETag = require('./utils').compileETag; +var compileQueryParser = require('./utils').compileQueryParser; +var compileTrust = require('./utils').compileTrust; +var deprecate = require('depd')('express'); +var flatten = require('array-flatten'); +var merge = require('utils-merge'); +var resolve = require('path').resolve; +var setPrototypeOf = require('setprototypeof') +var slice = Array.prototype.slice; + +/** + * Application prototype. + */ + +var app = exports = module.exports = {}; + +/** + * Variable for trust proxy inheritance back-compat + * @private + */ + +var trustProxyDefaultSymbol = '@@symbol:trust_proxy_default'; + +/** + * Initialize the server. + * + * - setup default configuration + * - setup default middleware + * - setup route reflection methods + * + * @private + */ + +app.init = function init() { + this.cache = {}; + this.engines = {}; + this.settings = {}; + + this.defaultConfiguration(); +}; + +/** + * Initialize application configuration. + * @private + */ + +app.defaultConfiguration = function defaultConfiguration() { + var env = process.env.NODE_ENV || 'development'; + + // default settings + this.enable('x-powered-by'); + this.set('etag', 'weak'); + this.set('env', env); + this.set('query parser', 'extended'); + this.set('subdomain offset', 2); + this.set('trust proxy', false); + + // trust proxy inherit back-compat + Object.defineProperty(this.settings, trustProxyDefaultSymbol, { + configurable: true, + value: true + }); + + debug('booting in %s mode', env); + + this.on('mount', function onmount(parent) { + // inherit trust proxy + if (this.settings[trustProxyDefaultSymbol] === true + && typeof parent.settings['trust proxy fn'] === 'function') { + delete this.settings['trust proxy']; + delete this.settings['trust proxy fn']; + } + + // inherit protos + setPrototypeOf(this.request, parent.request) + setPrototypeOf(this.response, parent.response) + setPrototypeOf(this.engines, parent.engines) + setPrototypeOf(this.settings, parent.settings) + }); + + // setup locals + this.locals = Object.create(null); + + // top-most app is mounted at / + this.mountpath = '/'; + + // default locals + this.locals.settings = this.settings; + + // default configuration + this.set('view', View); + this.set('views', resolve('views')); + this.set('jsonp callback name', 'callback'); + + if (env === 'production') { + this.enable('view cache'); + } + + Object.defineProperty(this, 'router', { + get: function() { + throw new Error('\'app.router\' is deprecated!\nPlease see the 3.x to 4.x migration guide for details on how to update your app.'); + } + }); +}; + +/** + * lazily adds the base router if it has not yet been added. + * + * We cannot add the base router in the defaultConfiguration because + * it reads app settings which might be set after that has run. + * + * @private + */ +app.lazyrouter = function lazyrouter() { + if (!this._router) { + this._router = new Router({ + caseSensitive: this.enabled('case sensitive routing'), + strict: this.enabled('strict routing') + }); + + this._router.use(query(this.get('query parser fn'))); + this._router.use(middleware.init(this)); + } +}; + +/** + * Dispatch a req, res pair into the application. Starts pipeline processing. + * + * If no callback is provided, then default error handlers will respond + * in the event of an error bubbling through the stack. + * + * @private + */ + +app.handle = function handle(req, res, callback) { + var router = this._router; + + // final handler + var done = callback || finalhandler(req, res, { + env: this.get('env'), + onerror: logerror.bind(this) + }); + + // no routes + if (!router) { + debug('no routes defined on app'); + done(); + return; + } + + router.handle(req, res, done); +}; + +/** + * Proxy `Router#use()` to add middleware to the app router. + * See Router#use() documentation for details. + * + * If the _fn_ parameter is an express app, then it will be + * mounted at the _route_ specified. + * + * @public + */ + +app.use = function use(fn) { + var offset = 0; + var path = '/'; + + // default path to '/' + // disambiguate app.use([fn]) + if (typeof fn !== 'function') { + var arg = fn; + + while (Array.isArray(arg) && arg.length !== 0) { + arg = arg[0]; + } + + // first arg is the path + if (typeof arg !== 'function') { + offset = 1; + path = fn; + } + } + + var fns = flatten(slice.call(arguments, offset)); + + if (fns.length === 0) { + throw new TypeError('app.use() requires middleware functions'); + } + + // setup router + this.lazyrouter(); + var router = this._router; + + fns.forEach(function (fn) { + // non-express app + if (!fn || !fn.handle || !fn.set) { + return router.use(path, fn); + } + + debug('.use app under %s', path); + fn.mountpath = path; + fn.parent = this; + + // restore .app property on req and res + router.use(path, function mounted_app(req, res, next) { + var orig = req.app; + fn.handle(req, res, function (err) { + setPrototypeOf(req, orig.request) + setPrototypeOf(res, orig.response) + next(err); + }); + }); + + // mounted an app + fn.emit('mount', this); + }, this); + + return this; +}; + +/** + * Proxy to the app `Router#route()` + * Returns a new `Route` instance for the _path_. + * + * Routes are isolated middleware stacks for specific paths. + * See the Route api docs for details. + * + * @public + */ + +app.route = function route(path) { + this.lazyrouter(); + return this._router.route(path); +}; + +/** + * Register the given template engine callback `fn` + * as `ext`. + * + * By default will `require()` the engine based on the + * file extension. For example if you try to render + * a "foo.ejs" file Express will invoke the following internally: + * + * app.engine('ejs', require('ejs').__express); + * + * For engines that do not provide `.__express` out of the box, + * or if you wish to "map" a different extension to the template engine + * you may use this method. For example mapping the EJS template engine to + * ".html" files: + * + * app.engine('html', require('ejs').renderFile); + * + * In this case EJS provides a `.renderFile()` method with + * the same signature that Express expects: `(path, options, callback)`, + * though note that it aliases this method as `ejs.__express` internally + * so if you're using ".ejs" extensions you dont need to do anything. + * + * Some template engines do not follow this convention, the + * [Consolidate.js](https://github.com/tj/consolidate.js) + * library was created to map all of node's popular template + * engines to follow this convention, thus allowing them to + * work seamlessly within Express. + * + * @param {String} ext + * @param {Function} fn + * @return {app} for chaining + * @public + */ + +app.engine = function engine(ext, fn) { + if (typeof fn !== 'function') { + throw new Error('callback function required'); + } + + // get file extension + var extension = ext[0] !== '.' + ? '.' + ext + : ext; + + // store engine + this.engines[extension] = fn; + + return this; +}; + +/** + * Proxy to `Router#param()` with one added api feature. The _name_ parameter + * can be an array of names. + * + * See the Router#param() docs for more details. + * + * @param {String|Array} name + * @param {Function} fn + * @return {app} for chaining + * @public + */ + +app.param = function param(name, fn) { + this.lazyrouter(); + + if (Array.isArray(name)) { + for (var i = 0; i < name.length; i++) { + this.param(name[i], fn); + } + + return this; + } + + this._router.param(name, fn); + + return this; +}; + +/** + * Assign `setting` to `val`, or return `setting`'s value. + * + * app.set('foo', 'bar'); + * app.get('foo'); + * // => "bar" + * + * Mounted servers inherit their parent server's settings. + * + * @param {String} setting + * @param {*} [val] + * @return {Server} for chaining + * @public + */ + +app.set = function set(setting, val) { + if (arguments.length === 1) { + // app.get(setting) + return this.settings[setting]; + } + + debug('set "%s" to %o', setting, val); + + // set value + this.settings[setting] = val; + + // trigger matched settings + switch (setting) { + case 'etag': + this.set('etag fn', compileETag(val)); + break; + case 'query parser': + this.set('query parser fn', compileQueryParser(val)); + break; + case 'trust proxy': + this.set('trust proxy fn', compileTrust(val)); + + // trust proxy inherit back-compat + Object.defineProperty(this.settings, trustProxyDefaultSymbol, { + configurable: true, + value: false + }); + + break; + } + + return this; +}; + +/** + * Return the app's absolute pathname + * based on the parent(s) that have + * mounted it. + * + * For example if the application was + * mounted as "/admin", which itself + * was mounted as "/blog" then the + * return value would be "/blog/admin". + * + * @return {String} + * @private + */ + +app.path = function path() { + return this.parent + ? this.parent.path() + this.mountpath + : ''; +}; + +/** + * Check if `setting` is enabled (truthy). + * + * app.enabled('foo') + * // => false + * + * app.enable('foo') + * app.enabled('foo') + * // => true + * + * @param {String} setting + * @return {Boolean} + * @public + */ + +app.enabled = function enabled(setting) { + return Boolean(this.set(setting)); +}; + +/** + * Check if `setting` is disabled. + * + * app.disabled('foo') + * // => true + * + * app.enable('foo') + * app.disabled('foo') + * // => false + * + * @param {String} setting + * @return {Boolean} + * @public + */ + +app.disabled = function disabled(setting) { + return !this.set(setting); +}; + +/** + * Enable `setting`. + * + * @param {String} setting + * @return {app} for chaining + * @public + */ + +app.enable = function enable(setting) { + return this.set(setting, true); +}; + +/** + * Disable `setting`. + * + * @param {String} setting + * @return {app} for chaining + * @public + */ + +app.disable = function disable(setting) { + return this.set(setting, false); +}; + +/** + * Delegate `.VERB(...)` calls to `router.VERB(...)`. + */ + +methods.forEach(function(method){ + app[method] = function(path){ + if (method === 'get' && arguments.length === 1) { + // app.get(setting) + return this.set(path); + } + + this.lazyrouter(); + + var route = this._router.route(path); + route[method].apply(route, slice.call(arguments, 1)); + return this; + }; +}); + +/** + * Special-cased "all" method, applying the given route `path`, + * middleware, and callback to _every_ HTTP method. + * + * @param {String} path + * @param {Function} ... + * @return {app} for chaining + * @public + */ + +app.all = function all(path) { + this.lazyrouter(); + + var route = this._router.route(path); + var args = slice.call(arguments, 1); + + for (var i = 0; i < methods.length; i++) { + route[methods[i]].apply(route, args); + } + + return this; +}; + +// del -> delete alias + +app.del = deprecate.function(app.delete, 'app.del: Use app.delete instead'); + +/** + * Render the given view `name` name with `options` + * and a callback accepting an error and the + * rendered template string. + * + * Example: + * + * app.render('email', { name: 'Tobi' }, function(err, html){ + * // ... + * }) + * + * @param {String} name + * @param {Object|Function} options or fn + * @param {Function} callback + * @public + */ + +app.render = function render(name, options, callback) { + var cache = this.cache; + var done = callback; + var engines = this.engines; + var opts = options; + var renderOptions = {}; + var view; + + // support callback function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + // merge app.locals + merge(renderOptions, this.locals); + + // merge options._locals + if (opts._locals) { + merge(renderOptions, opts._locals); + } + + // merge options + merge(renderOptions, opts); + + // set .cache unless explicitly provided + if (renderOptions.cache == null) { + renderOptions.cache = this.enabled('view cache'); + } + + // primed cache + if (renderOptions.cache) { + view = cache[name]; + } + + // view + if (!view) { + var View = this.get('view'); + + view = new View(name, { + defaultEngine: this.get('view engine'), + root: this.get('views'), + engines: engines + }); + + if (!view.path) { + var dirs = Array.isArray(view.root) && view.root.length > 1 + ? 'directories "' + view.root.slice(0, -1).join('", "') + '" or "' + view.root[view.root.length - 1] + '"' + : 'directory "' + view.root + '"' + var err = new Error('Failed to lookup view "' + name + '" in views ' + dirs); + err.view = view; + return done(err); + } + + // prime the cache + if (renderOptions.cache) { + cache[name] = view; + } + } + + // render + tryRender(view, renderOptions, done); +}; + +/** + * Listen for connections. + * + * A node `http.Server` is returned, with this + * application (which is a `Function`) as its + * callback. If you wish to create both an HTTP + * and HTTPS server you may do so with the "http" + * and "https" modules as shown here: + * + * var http = require('http') + * , https = require('https') + * , express = require('express') + * , app = express(); + * + * http.createServer(app).listen(80); + * https.createServer({ ... }, app).listen(443); + * + * @return {http.Server} + * @public + */ + +app.listen = function listen() { + var server = http.createServer(this); + return server.listen.apply(server, arguments); +}; + +/** + * Log error using console.error. + * + * @param {Error} err + * @private + */ + +function logerror(err) { + /* istanbul ignore next */ + if (this.get('env') !== 'test') console.error(err.stack || err.toString()); +} + +/** + * Try rendering a view. + * @private + */ + +function tryRender(view, options, callback) { + try { + view.render(options, callback); + } catch (err) { + callback(err); + } +} diff --git a/8 node/node_modules/express/lib/express.js b/8 node/node_modules/express/lib/express.js new file mode 100644 index 000000000..187e4e2d7 --- /dev/null +++ b/8 node/node_modules/express/lib/express.js @@ -0,0 +1,111 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + */ + +var EventEmitter = require('events').EventEmitter; +var mixin = require('merge-descriptors'); +var proto = require('./application'); +var Route = require('./router/route'); +var Router = require('./router'); +var req = require('./request'); +var res = require('./response'); + +/** + * Expose `createApplication()`. + */ + +exports = module.exports = createApplication; + +/** + * Create an express application. + * + * @return {Function} + * @api public + */ + +function createApplication() { + var app = function(req, res, next) { + app.handle(req, res, next); + }; + + mixin(app, EventEmitter.prototype, false); + mixin(app, proto, false); + + // expose the prototype that will get set on requests + app.request = Object.create(req, { + app: { configurable: true, enumerable: true, writable: true, value: app } + }) + + // expose the prototype that will get set on responses + app.response = Object.create(res, { + app: { configurable: true, enumerable: true, writable: true, value: app } + }) + + app.init(); + return app; +} + +/** + * Expose the prototypes. + */ + +exports.application = proto; +exports.request = req; +exports.response = res; + +/** + * Expose constructors. + */ + +exports.Route = Route; +exports.Router = Router; + +/** + * Expose middleware + */ + +exports.query = require('./middleware/query'); +exports.static = require('serve-static'); + +/** + * Replace removed middleware with an appropriate error message. + */ + +[ + 'json', + 'urlencoded', + 'bodyParser', + 'compress', + 'cookieSession', + 'session', + 'logger', + 'cookieParser', + 'favicon', + 'responseTime', + 'errorHandler', + 'timeout', + 'methodOverride', + 'vhost', + 'csrf', + 'directory', + 'limit', + 'multipart', + 'staticCache', +].forEach(function (name) { + Object.defineProperty(exports, name, { + get: function () { + throw new Error('Most middleware (like ' + name + ') is no longer bundled with Express and must be installed separately. Please see https://github.com/senchalabs/connect#middleware.'); + }, + configurable: true + }); +}); diff --git a/8 node/node_modules/express/lib/middleware/init.js b/8 node/node_modules/express/lib/middleware/init.js new file mode 100644 index 000000000..dfd042747 --- /dev/null +++ b/8 node/node_modules/express/lib/middleware/init.js @@ -0,0 +1,43 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var setPrototypeOf = require('setprototypeof') + +/** + * Initialization middleware, exposing the + * request and response to each other, as well + * as defaulting the X-Powered-By header field. + * + * @param {Function} app + * @return {Function} + * @api private + */ + +exports.init = function(app){ + return function expressInit(req, res, next){ + if (app.enabled('x-powered-by')) res.setHeader('X-Powered-By', 'Express'); + req.res = res; + res.req = req; + req.next = next; + + setPrototypeOf(req, app.request) + setPrototypeOf(res, app.response) + + res.locals = res.locals || Object.create(null); + + next(); + }; +}; + diff --git a/8 node/node_modules/express/lib/middleware/query.js b/8 node/node_modules/express/lib/middleware/query.js new file mode 100644 index 000000000..5f76f8458 --- /dev/null +++ b/8 node/node_modules/express/lib/middleware/query.js @@ -0,0 +1,46 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + */ + +var parseUrl = require('parseurl'); +var qs = require('qs'); + +/** + * @param {Object} options + * @return {Function} + * @api public + */ + +module.exports = function query(options) { + var opts = Object.create(options || null); + var queryparse = qs.parse; + + if (typeof options === 'function') { + queryparse = options; + opts = undefined; + } + + if (opts !== undefined && opts.allowPrototypes === undefined) { + // back-compat for qs module + opts.allowPrototypes = true; + } + + return function query(req, res, next){ + if (!req.query) { + var val = parseUrl(req).query; + req.query = queryparse(val, opts); + } + + next(); + }; +}; diff --git a/8 node/node_modules/express/lib/request.js b/8 node/node_modules/express/lib/request.js new file mode 100644 index 000000000..3432e6776 --- /dev/null +++ b/8 node/node_modules/express/lib/request.js @@ -0,0 +1,517 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var accepts = require('accepts'); +var deprecate = require('depd')('express'); +var isIP = require('net').isIP; +var typeis = require('type-is'); +var http = require('http'); +var fresh = require('fresh'); +var parseRange = require('range-parser'); +var parse = require('parseurl'); +var proxyaddr = require('proxy-addr'); + +/** + * Request prototype. + * @public + */ + +var req = Object.create(http.IncomingMessage.prototype) + +/** + * Module exports. + * @public + */ + +module.exports = req + +/** + * Return request header. + * + * The `Referrer` header field is special-cased, + * both `Referrer` and `Referer` are interchangeable. + * + * Examples: + * + * req.get('Content-Type'); + * // => "text/plain" + * + * req.get('content-type'); + * // => "text/plain" + * + * req.get('Something'); + * // => undefined + * + * Aliased as `req.header()`. + * + * @param {String} name + * @return {String} + * @public + */ + +req.get = +req.header = function header(name) { + if (!name) { + throw new TypeError('name argument is required to req.get'); + } + + if (typeof name !== 'string') { + throw new TypeError('name must be a string to req.get'); + } + + var lc = name.toLowerCase(); + + switch (lc) { + case 'referer': + case 'referrer': + return this.headers.referrer + || this.headers.referer; + default: + return this.headers[lc]; + } +}; + +/** + * To do: update docs. + * + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single MIME type string + * such as "application/json", an extension name + * such as "json", a comma-delimited list such as "json, html, text/plain", + * an argument list such as `"json", "html", "text/plain"`, + * or an array `["json", "html", "text/plain"]`. When a list + * or array is given, the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * req.accepts('html'); + * // => "html" + * + * // Accept: text/*, application/json + * req.accepts('html'); + * // => "html" + * req.accepts('text/html'); + * // => "text/html" + * req.accepts('json, text'); + * // => "json" + * req.accepts('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * req.accepts('image/png'); + * req.accepts('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * req.accepts(['html', 'json']); + * req.accepts('html', 'json'); + * req.accepts('html, json'); + * // => "json" + * + * @param {String|Array} type(s) + * @return {String|Array|Boolean} + * @public + */ + +req.accepts = function(){ + var accept = accepts(this); + return accept.types.apply(accept, arguments); +}; + +/** + * Check if the given `encoding`s are accepted. + * + * @param {String} ...encoding + * @return {String|Array} + * @public + */ + +req.acceptsEncodings = function(){ + var accept = accepts(this); + return accept.encodings.apply(accept, arguments); +}; + +req.acceptsEncoding = deprecate.function(req.acceptsEncodings, + 'req.acceptsEncoding: Use acceptsEncodings instead'); + +/** + * Check if the given `charset`s are acceptable, + * otherwise you should respond with 406 "Not Acceptable". + * + * @param {String} ...charset + * @return {String|Array} + * @public + */ + +req.acceptsCharsets = function(){ + var accept = accepts(this); + return accept.charsets.apply(accept, arguments); +}; + +req.acceptsCharset = deprecate.function(req.acceptsCharsets, + 'req.acceptsCharset: Use acceptsCharsets instead'); + +/** + * Check if the given `lang`s are acceptable, + * otherwise you should respond with 406 "Not Acceptable". + * + * @param {String} ...lang + * @return {String|Array} + * @public + */ + +req.acceptsLanguages = function(){ + var accept = accepts(this); + return accept.languages.apply(accept, arguments); +}; + +req.acceptsLanguage = deprecate.function(req.acceptsLanguages, + 'req.acceptsLanguage: Use acceptsLanguages instead'); + +/** + * Parse Range header field, capping to the given `size`. + * + * Unspecified ranges such as "0-" require knowledge of your resource length. In + * the case of a byte range this is of course the total number of bytes. If the + * Range header field is not given `undefined` is returned, `-1` when unsatisfiable, + * and `-2` when syntactically invalid. + * + * When ranges are returned, the array has a "type" property which is the type of + * range that is required (most commonly, "bytes"). Each array element is an object + * with a "start" and "end" property for the portion of the range. + * + * The "combine" option can be set to `true` and overlapping & adjacent ranges + * will be combined into a single range. + * + * NOTE: remember that ranges are inclusive, so for example "Range: users=0-3" + * should respond with 4 users when available, not 3. + * + * @param {number} size + * @param {object} [options] + * @param {boolean} [options.combine=false] + * @return {number|array} + * @public + */ + +req.range = function range(size, options) { + var range = this.get('Range'); + if (!range) return; + return parseRange(size, range, options); +}; + +/** + * Return the value of param `name` when present or `defaultValue`. + * + * - Checks route placeholders, ex: _/user/:id_ + * - Checks body params, ex: id=12, {"id":12} + * - Checks query string params, ex: ?id=12 + * + * To utilize request bodies, `req.body` + * should be an object. This can be done by using + * the `bodyParser()` middleware. + * + * @param {String} name + * @param {Mixed} [defaultValue] + * @return {String} + * @public + */ + +req.param = function param(name, defaultValue) { + var params = this.params || {}; + var body = this.body || {}; + var query = this.query || {}; + + var args = arguments.length === 1 + ? 'name' + : 'name, default'; + deprecate('req.param(' + args + '): Use req.params, req.body, or req.query instead'); + + if (null != params[name] && params.hasOwnProperty(name)) return params[name]; + if (null != body[name]) return body[name]; + if (null != query[name]) return query[name]; + + return defaultValue; +}; + +/** + * Check if the incoming request contains the "Content-Type" + * header field, and it contains the give mime `type`. + * + * Examples: + * + * // With Content-Type: text/html; charset=utf-8 + * req.is('html'); + * req.is('text/html'); + * req.is('text/*'); + * // => true + * + * // When Content-Type is application/json + * req.is('json'); + * req.is('application/json'); + * req.is('application/*'); + * // => true + * + * req.is('html'); + * // => false + * + * @param {String|Array} types... + * @return {String|false|null} + * @public + */ + +req.is = function is(types) { + var arr = types; + + // support flattened arguments + if (!Array.isArray(types)) { + arr = new Array(arguments.length); + for (var i = 0; i < arr.length; i++) { + arr[i] = arguments[i]; + } + } + + return typeis(this, arr); +}; + +/** + * Return the protocol string "http" or "https" + * when requested with TLS. When the "trust proxy" + * setting trusts the socket address, the + * "X-Forwarded-Proto" header field will be trusted + * and used if present. + * + * If you're running behind a reverse proxy that + * supplies https for you this may be enabled. + * + * @return {String} + * @public + */ + +defineGetter(req, 'protocol', function protocol(){ + var proto = this.connection.encrypted + ? 'https' + : 'http'; + var trust = this.app.get('trust proxy fn'); + + if (!trust(this.connection.remoteAddress, 0)) { + return proto; + } + + // Note: X-Forwarded-Proto is normally only ever a + // single value, but this is to be safe. + proto = this.get('X-Forwarded-Proto') || proto; + return proto.split(/\s*,\s*/)[0]; +}); + +/** + * Short-hand for: + * + * req.protocol === 'https' + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'secure', function secure(){ + return this.protocol === 'https'; +}); + +/** + * Return the remote address from the trusted proxy. + * + * The is the remote address on the socket unless + * "trust proxy" is set. + * + * @return {String} + * @public + */ + +defineGetter(req, 'ip', function ip(){ + var trust = this.app.get('trust proxy fn'); + return proxyaddr(this, trust); +}); + +/** + * When "trust proxy" is set, trusted proxy addresses + client. + * + * For example if the value were "client, proxy1, proxy2" + * you would receive the array `["client", "proxy1", "proxy2"]` + * where "proxy2" is the furthest down-stream and "proxy1" and + * "proxy2" were trusted. + * + * @return {Array} + * @public + */ + +defineGetter(req, 'ips', function ips() { + var trust = this.app.get('trust proxy fn'); + var addrs = proxyaddr.all(this, trust); + + // reverse the order (to farthest -> closest) + // and remove socket address + addrs.reverse().pop() + + return addrs +}); + +/** + * Return subdomains as an array. + * + * Subdomains are the dot-separated parts of the host before the main domain of + * the app. By default, the domain of the app is assumed to be the last two + * parts of the host. This can be changed by setting "subdomain offset". + * + * For example, if the domain is "tobi.ferrets.example.com": + * If "subdomain offset" is not set, req.subdomains is `["ferrets", "tobi"]`. + * If "subdomain offset" is 3, req.subdomains is `["tobi"]`. + * + * @return {Array} + * @public + */ + +defineGetter(req, 'subdomains', function subdomains() { + var hostname = this.hostname; + + if (!hostname) return []; + + var offset = this.app.get('subdomain offset'); + var subdomains = !isIP(hostname) + ? hostname.split('.').reverse() + : [hostname]; + + return subdomains.slice(offset); +}); + +/** + * Short-hand for `url.parse(req.url).pathname`. + * + * @return {String} + * @public + */ + +defineGetter(req, 'path', function path() { + return parse(this).pathname; +}); + +/** + * Parse the "Host" header field to a hostname. + * + * When the "trust proxy" setting trusts the socket + * address, the "X-Forwarded-Host" header field will + * be trusted. + * + * @return {String} + * @public + */ + +defineGetter(req, 'hostname', function hostname(){ + var trust = this.app.get('trust proxy fn'); + var host = this.get('X-Forwarded-Host'); + + if (!host || !trust(this.connection.remoteAddress, 0)) { + host = this.get('Host'); + } + + if (!host) return; + + // IPv6 literal support + var offset = host[0] === '[' + ? host.indexOf(']') + 1 + : 0; + var index = host.indexOf(':', offset); + + return index !== -1 + ? host.substring(0, index) + : host; +}); + +// TODO: change req.host to return host in next major + +defineGetter(req, 'host', deprecate.function(function host(){ + return this.hostname; +}, 'req.host: Use req.hostname instead')); + +/** + * Check if the request is fresh, aka + * Last-Modified and/or the ETag + * still match. + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'fresh', function(){ + var method = this.method; + var res = this.res + var status = res.statusCode + + // GET or HEAD for weak freshness validation only + if ('GET' !== method && 'HEAD' !== method) return false; + + // 2xx or 304 as per rfc2616 14.26 + if ((status >= 200 && status < 300) || 304 === status) { + return fresh(this.headers, { + 'etag': res.get('ETag'), + 'last-modified': res.get('Last-Modified') + }) + } + + return false; +}); + +/** + * Check if the request is stale, aka + * "Last-Modified" and / or the "ETag" for the + * resource has changed. + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'stale', function stale(){ + return !this.fresh; +}); + +/** + * Check if the request was an _XMLHttpRequest_. + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'xhr', function xhr(){ + var val = this.get('X-Requested-With') || ''; + return val.toLowerCase() === 'xmlhttprequest'; +}); + +/** + * Helper function for creating a getter on an object. + * + * @param {Object} obj + * @param {String} name + * @param {Function} getter + * @private + */ +function defineGetter(obj, name, getter) { + Object.defineProperty(obj, name, { + configurable: true, + enumerable: true, + get: getter + }); +} diff --git a/8 node/node_modules/express/lib/response.js b/8 node/node_modules/express/lib/response.js new file mode 100644 index 000000000..b852a60e2 --- /dev/null +++ b/8 node/node_modules/express/lib/response.js @@ -0,0 +1,1076 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var contentDisposition = require('content-disposition'); +var deprecate = require('depd')('express'); +var encodeUrl = require('encodeurl'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var isAbsolute = require('./utils').isAbsolute; +var onFinished = require('on-finished'); +var path = require('path'); +var statuses = require('statuses') +var merge = require('utils-merge'); +var sign = require('cookie-signature').sign; +var normalizeType = require('./utils').normalizeType; +var normalizeTypes = require('./utils').normalizeTypes; +var setCharset = require('./utils').setCharset; +var cookie = require('cookie'); +var send = require('send'); +var extname = path.extname; +var mime = send.mime; +var resolve = path.resolve; +var vary = require('vary'); + +/** + * Response prototype. + * @public + */ + +var res = Object.create(http.ServerResponse.prototype) + +/** + * Module exports. + * @public + */ + +module.exports = res + +/** + * Module variables. + * @private + */ + +var charsetRegExp = /;\s*charset\s*=/; + +/** + * Set status `code`. + * + * @param {Number} code + * @return {ServerResponse} + * @public + */ + +res.status = function status(code) { + this.statusCode = code; + return this; +}; + +/** + * Set Link header field with the given `links`. + * + * Examples: + * + * res.links({ + * next: 'http://api.example.com/users?page=2', + * last: 'http://api.example.com/users?page=5' + * }); + * + * @param {Object} links + * @return {ServerResponse} + * @public + */ + +res.links = function(links){ + var link = this.get('Link') || ''; + if (link) link += ', '; + return this.set('Link', link + Object.keys(links).map(function(rel){ + return '<' + links[rel] + '>; rel="' + rel + '"'; + }).join(', ')); +}; + +/** + * Send a response. + * + * Examples: + * + * res.send(new Buffer('wahoo')); + * res.send({ some: 'json' }); + * res.send('

some html

'); + * + * @param {string|number|boolean|object|Buffer} body + * @public + */ + +res.send = function send(body) { + var chunk = body; + var encoding; + var len; + var req = this.req; + var type; + + // settings + var app = this.app; + + // allow status / body + if (arguments.length === 2) { + // res.send(body, status) backwards compat + if (typeof arguments[0] !== 'number' && typeof arguments[1] === 'number') { + deprecate('res.send(body, status): Use res.status(status).send(body) instead'); + this.statusCode = arguments[1]; + } else { + deprecate('res.send(status, body): Use res.status(status).send(body) instead'); + this.statusCode = arguments[0]; + chunk = arguments[1]; + } + } + + // disambiguate res.send(status) and res.send(status, num) + if (typeof chunk === 'number' && arguments.length === 1) { + // res.send(status) will set status message as text string + if (!this.get('Content-Type')) { + this.type('txt'); + } + + deprecate('res.send(status): Use res.sendStatus(status) instead'); + this.statusCode = chunk; + chunk = statuses[chunk] + } + + switch (typeof chunk) { + // string defaulting to html + case 'string': + if (!this.get('Content-Type')) { + this.type('html'); + } + break; + case 'boolean': + case 'number': + case 'object': + if (chunk === null) { + chunk = ''; + } else if (Buffer.isBuffer(chunk)) { + if (!this.get('Content-Type')) { + this.type('bin'); + } + } else { + return this.json(chunk); + } + break; + } + + // write strings in utf-8 + if (typeof chunk === 'string') { + encoding = 'utf8'; + type = this.get('Content-Type'); + + // reflect this in content-type + if (typeof type === 'string') { + this.set('Content-Type', setCharset(type, 'utf-8')); + } + } + + // populate Content-Length + if (chunk !== undefined) { + if (!Buffer.isBuffer(chunk)) { + // convert chunk to Buffer; saves later double conversions + chunk = new Buffer(chunk, encoding); + encoding = undefined; + } + + len = chunk.length; + this.set('Content-Length', len); + } + + // populate ETag + var etag; + var generateETag = len !== undefined && app.get('etag fn'); + if (typeof generateETag === 'function' && !this.get('ETag')) { + if ((etag = generateETag(chunk, encoding))) { + this.set('ETag', etag); + } + } + + // freshness + if (req.fresh) this.statusCode = 304; + + // strip irrelevant headers + if (204 === this.statusCode || 304 === this.statusCode) { + this.removeHeader('Content-Type'); + this.removeHeader('Content-Length'); + this.removeHeader('Transfer-Encoding'); + chunk = ''; + } + + if (req.method === 'HEAD') { + // skip body for HEAD + this.end(); + } else { + // respond + this.end(chunk, encoding); + } + + return this; +}; + +/** + * Send JSON response. + * + * Examples: + * + * res.json(null); + * res.json({ user: 'tj' }); + * + * @param {string|number|boolean|object} obj + * @public + */ + +res.json = function json(obj) { + var val = obj; + + // allow status / body + if (arguments.length === 2) { + // res.json(body, status) backwards compat + if (typeof arguments[1] === 'number') { + deprecate('res.json(obj, status): Use res.status(status).json(obj) instead'); + this.statusCode = arguments[1]; + } else { + deprecate('res.json(status, obj): Use res.status(status).json(obj) instead'); + this.statusCode = arguments[0]; + val = arguments[1]; + } + } + + // settings + var app = this.app; + var replacer = app.get('json replacer'); + var spaces = app.get('json spaces'); + var body = stringify(val, replacer, spaces); + + // content-type + if (!this.get('Content-Type')) { + this.set('Content-Type', 'application/json'); + } + + return this.send(body); +}; + +/** + * Send JSON response with JSONP callback support. + * + * Examples: + * + * res.jsonp(null); + * res.jsonp({ user: 'tj' }); + * + * @param {string|number|boolean|object} obj + * @public + */ + +res.jsonp = function jsonp(obj) { + var val = obj; + + // allow status / body + if (arguments.length === 2) { + // res.json(body, status) backwards compat + if (typeof arguments[1] === 'number') { + deprecate('res.jsonp(obj, status): Use res.status(status).json(obj) instead'); + this.statusCode = arguments[1]; + } else { + deprecate('res.jsonp(status, obj): Use res.status(status).jsonp(obj) instead'); + this.statusCode = arguments[0]; + val = arguments[1]; + } + } + + // settings + var app = this.app; + var replacer = app.get('json replacer'); + var spaces = app.get('json spaces'); + var body = stringify(val, replacer, spaces); + var callback = this.req.query[app.get('jsonp callback name')]; + + // content-type + if (!this.get('Content-Type')) { + this.set('X-Content-Type-Options', 'nosniff'); + this.set('Content-Type', 'application/json'); + } + + // fixup callback + if (Array.isArray(callback)) { + callback = callback[0]; + } + + // jsonp + if (typeof callback === 'string' && callback.length !== 0) { + this.charset = 'utf-8'; + this.set('X-Content-Type-Options', 'nosniff'); + this.set('Content-Type', 'text/javascript'); + + // restrict callback charset + callback = callback.replace(/[^\[\]\w$.]/g, ''); + + // replace chars not allowed in JavaScript that are in JSON + body = body + .replace(/\u2028/g, '\\u2028') + .replace(/\u2029/g, '\\u2029'); + + // the /**/ is a specific security mitigation for "Rosetta Flash JSONP abuse" + // the typeof check is just to reduce client error noise + body = '/**/ typeof ' + callback + ' === \'function\' && ' + callback + '(' + body + ');'; + } + + return this.send(body); +}; + +/** + * Send given HTTP status code. + * + * Sets the response status to `statusCode` and the body of the + * response to the standard description from node's http.STATUS_CODES + * or the statusCode number if no description. + * + * Examples: + * + * res.sendStatus(200); + * + * @param {number} statusCode + * @public + */ + +res.sendStatus = function sendStatus(statusCode) { + var body = statuses[statusCode] || String(statusCode) + + this.statusCode = statusCode; + this.type('txt'); + + return this.send(body); +}; + +/** + * Transfer the file at the given `path`. + * + * Automatically sets the _Content-Type_ response header field. + * The callback `callback(err)` is invoked when the transfer is complete + * or when an error occurs. Be sure to check `res.sentHeader` + * if you wish to attempt responding, as the header and some data + * may have already been transferred. + * + * Options: + * + * - `maxAge` defaulting to 0 (can be string converted by `ms`) + * - `root` root directory for relative filenames + * - `headers` object of headers to serve with file + * - `dotfiles` serve dotfiles, defaulting to false; can be `"allow"` to send them + * + * Other options are passed along to `send`. + * + * Examples: + * + * The following example illustrates how `res.sendFile()` may + * be used as an alternative for the `static()` middleware for + * dynamic situations. The code backing `res.sendFile()` is actually + * the same code, so HTTP cache support etc is identical. + * + * app.get('/user/:uid/photos/:file', function(req, res){ + * var uid = req.params.uid + * , file = req.params.file; + * + * req.user.mayViewFilesFrom(uid, function(yes){ + * if (yes) { + * res.sendFile('/uploads/' + uid + '/' + file); + * } else { + * res.send(403, 'Sorry! you cant see that.'); + * } + * }); + * }); + * + * @public + */ + +res.sendFile = function sendFile(path, options, callback) { + var done = callback; + var req = this.req; + var res = this; + var next = req.next; + var opts = options || {}; + + if (!path) { + throw new TypeError('path argument is required to res.sendFile'); + } + + // support function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + if (!opts.root && !isAbsolute(path)) { + throw new TypeError('path must be absolute or specify root to res.sendFile'); + } + + // create file stream + var pathname = encodeURI(path); + var file = send(req, pathname, opts); + + // transfer + sendfile(res, file, opts, function (err) { + if (done) return done(err); + if (err && err.code === 'EISDIR') return next(); + + // next() all but write errors + if (err && err.code !== 'ECONNABORTED' && err.syscall !== 'write') { + next(err); + } + }); +}; + +/** + * Transfer the file at the given `path`. + * + * Automatically sets the _Content-Type_ response header field. + * The callback `callback(err)` is invoked when the transfer is complete + * or when an error occurs. Be sure to check `res.sentHeader` + * if you wish to attempt responding, as the header and some data + * may have already been transferred. + * + * Options: + * + * - `maxAge` defaulting to 0 (can be string converted by `ms`) + * - `root` root directory for relative filenames + * - `headers` object of headers to serve with file + * - `dotfiles` serve dotfiles, defaulting to false; can be `"allow"` to send them + * + * Other options are passed along to `send`. + * + * Examples: + * + * The following example illustrates how `res.sendfile()` may + * be used as an alternative for the `static()` middleware for + * dynamic situations. The code backing `res.sendfile()` is actually + * the same code, so HTTP cache support etc is identical. + * + * app.get('/user/:uid/photos/:file', function(req, res){ + * var uid = req.params.uid + * , file = req.params.file; + * + * req.user.mayViewFilesFrom(uid, function(yes){ + * if (yes) { + * res.sendfile('/uploads/' + uid + '/' + file); + * } else { + * res.send(403, 'Sorry! you cant see that.'); + * } + * }); + * }); + * + * @public + */ + +res.sendfile = function (path, options, callback) { + var done = callback; + var req = this.req; + var res = this; + var next = req.next; + var opts = options || {}; + + // support function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + // create file stream + var file = send(req, path, opts); + + // transfer + sendfile(res, file, opts, function (err) { + if (done) return done(err); + if (err && err.code === 'EISDIR') return next(); + + // next() all but write errors + if (err && err.code !== 'ECONNABORT' && err.syscall !== 'write') { + next(err); + } + }); +}; + +res.sendfile = deprecate.function(res.sendfile, + 'res.sendfile: Use res.sendFile instead'); + +/** + * Transfer the file at the given `path` as an attachment. + * + * Optionally providing an alternate attachment `filename`, + * and optional callback `callback(err)`. The callback is invoked + * when the data transfer is complete, or when an error has + * ocurred. Be sure to check `res.headersSent` if you plan to respond. + * + * This method uses `res.sendfile()`. + * + * @public + */ + +res.download = function download(path, filename, callback) { + var done = callback; + var name = filename; + + // support function as second arg + if (typeof filename === 'function') { + done = filename; + name = null; + } + + // set Content-Disposition when file is sent + var headers = { + 'Content-Disposition': contentDisposition(name || path) + }; + + // Resolve the full path for sendFile + var fullPath = resolve(path); + + return this.sendFile(fullPath, { headers: headers }, done); +}; + +/** + * Set _Content-Type_ response header with `type` through `mime.lookup()` + * when it does not contain "/", or set the Content-Type to `type` otherwise. + * + * Examples: + * + * res.type('.html'); + * res.type('html'); + * res.type('json'); + * res.type('application/json'); + * res.type('png'); + * + * @param {String} type + * @return {ServerResponse} for chaining + * @public + */ + +res.contentType = +res.type = function contentType(type) { + var ct = type.indexOf('/') === -1 + ? mime.lookup(type) + : type; + + return this.set('Content-Type', ct); +}; + +/** + * Respond to the Acceptable formats using an `obj` + * of mime-type callbacks. + * + * This method uses `req.accepted`, an array of + * acceptable types ordered by their quality values. + * When "Accept" is not present the _first_ callback + * is invoked, otherwise the first match is used. When + * no match is performed the server responds with + * 406 "Not Acceptable". + * + * Content-Type is set for you, however if you choose + * you may alter this within the callback using `res.type()` + * or `res.set('Content-Type', ...)`. + * + * res.format({ + * 'text/plain': function(){ + * res.send('hey'); + * }, + * + * 'text/html': function(){ + * res.send('

hey

'); + * }, + * + * 'appliation/json': function(){ + * res.send({ message: 'hey' }); + * } + * }); + * + * In addition to canonicalized MIME types you may + * also use extnames mapped to these types: + * + * res.format({ + * text: function(){ + * res.send('hey'); + * }, + * + * html: function(){ + * res.send('

hey

'); + * }, + * + * json: function(){ + * res.send({ message: 'hey' }); + * } + * }); + * + * By default Express passes an `Error` + * with a `.status` of 406 to `next(err)` + * if a match is not made. If you provide + * a `.default` callback it will be invoked + * instead. + * + * @param {Object} obj + * @return {ServerResponse} for chaining + * @public + */ + +res.format = function(obj){ + var req = this.req; + var next = req.next; + + var fn = obj.default; + if (fn) delete obj.default; + var keys = Object.keys(obj); + + var key = keys.length > 0 + ? req.accepts(keys) + : false; + + this.vary("Accept"); + + if (key) { + this.set('Content-Type', normalizeType(key).value); + obj[key](req, this, next); + } else if (fn) { + fn(); + } else { + var err = new Error('Not Acceptable'); + err.status = err.statusCode = 406; + err.types = normalizeTypes(keys).map(function(o){ return o.value }); + next(err); + } + + return this; +}; + +/** + * Set _Content-Disposition_ header to _attachment_ with optional `filename`. + * + * @param {String} filename + * @return {ServerResponse} + * @public + */ + +res.attachment = function attachment(filename) { + if (filename) { + this.type(extname(filename)); + } + + this.set('Content-Disposition', contentDisposition(filename)); + + return this; +}; + +/** + * Append additional header `field` with value `val`. + * + * Example: + * + * res.append('Link', ['', '']); + * res.append('Set-Cookie', 'foo=bar; Path=/; HttpOnly'); + * res.append('Warning', '199 Miscellaneous warning'); + * + * @param {String} field + * @param {String|Array} val + * @return {ServerResponse} for chaining + * @public + */ + +res.append = function append(field, val) { + var prev = this.get(field); + var value = val; + + if (prev) { + // concat the new and prev vals + value = Array.isArray(prev) ? prev.concat(val) + : Array.isArray(val) ? [prev].concat(val) + : [prev, val]; + } + + return this.set(field, value); +}; + +/** + * Set header `field` to `val`, or pass + * an object of header fields. + * + * Examples: + * + * res.set('Foo', ['bar', 'baz']); + * res.set('Accept', 'application/json'); + * res.set({ Accept: 'text/plain', 'X-API-Key': 'tobi' }); + * + * Aliased as `res.header()`. + * + * @param {String|Object} field + * @param {String|Array} val + * @return {ServerResponse} for chaining + * @public + */ + +res.set = +res.header = function header(field, val) { + if (arguments.length === 2) { + var value = Array.isArray(val) + ? val.map(String) + : String(val); + + // add charset to content-type + if (field.toLowerCase() === 'content-type') { + if (Array.isArray(value)) { + throw new TypeError('Content-Type cannot be set to an Array'); + } + if (!charsetRegExp.test(value)) { + var charset = mime.charsets.lookup(value.split(';')[0]); + if (charset) value += '; charset=' + charset.toLowerCase(); + } + } + + this.setHeader(field, value); + } else { + for (var key in field) { + this.set(key, field[key]); + } + } + return this; +}; + +/** + * Get value for header `field`. + * + * @param {String} field + * @return {String} + * @public + */ + +res.get = function(field){ + return this.getHeader(field); +}; + +/** + * Clear cookie `name`. + * + * @param {String} name + * @param {Object} [options] + * @return {ServerResponse} for chaining + * @public + */ + +res.clearCookie = function clearCookie(name, options) { + var opts = merge({ expires: new Date(1), path: '/' }, options); + + return this.cookie(name, '', opts); +}; + +/** + * Set cookie `name` to `value`, with the given `options`. + * + * Options: + * + * - `maxAge` max-age in milliseconds, converted to `expires` + * - `signed` sign the cookie + * - `path` defaults to "/" + * + * Examples: + * + * // "Remember Me" for 15 minutes + * res.cookie('rememberme', '1', { expires: new Date(Date.now() + 900000), httpOnly: true }); + * + * // save as above + * res.cookie('rememberme', '1', { maxAge: 900000, httpOnly: true }) + * + * @param {String} name + * @param {String|Object} value + * @param {Object} [options] + * @return {ServerResponse} for chaining + * @public + */ + +res.cookie = function (name, value, options) { + var opts = merge({}, options); + var secret = this.req.secret; + var signed = opts.signed; + + if (signed && !secret) { + throw new Error('cookieParser("secret") required for signed cookies'); + } + + var val = typeof value === 'object' + ? 'j:' + JSON.stringify(value) + : String(value); + + if (signed) { + val = 's:' + sign(val, secret); + } + + if ('maxAge' in opts) { + opts.expires = new Date(Date.now() + opts.maxAge); + opts.maxAge /= 1000; + } + + if (opts.path == null) { + opts.path = '/'; + } + + this.append('Set-Cookie', cookie.serialize(name, String(val), opts)); + + return this; +}; + +/** + * Set the location header to `url`. + * + * The given `url` can also be "back", which redirects + * to the _Referrer_ or _Referer_ headers or "/". + * + * Examples: + * + * res.location('/foo/bar').; + * res.location('http://example.com'); + * res.location('../login'); + * + * @param {String} url + * @return {ServerResponse} for chaining + * @public + */ + +res.location = function location(url) { + var loc = url; + + // "back" is an alias for the referrer + if (url === 'back') { + loc = this.req.get('Referrer') || '/'; + } + + // set location + return this.set('Location', encodeUrl(loc)); +}; + +/** + * Redirect to the given `url` with optional response `status` + * defaulting to 302. + * + * The resulting `url` is determined by `res.location()`, so + * it will play nicely with mounted apps, relative paths, + * `"back"` etc. + * + * Examples: + * + * res.redirect('/foo/bar'); + * res.redirect('http://example.com'); + * res.redirect(301, 'http://example.com'); + * res.redirect('../login'); // /blog/post/1 -> /blog/login + * + * @public + */ + +res.redirect = function redirect(url) { + var address = url; + var body; + var status = 302; + + // allow status / url + if (arguments.length === 2) { + if (typeof arguments[0] === 'number') { + status = arguments[0]; + address = arguments[1]; + } else { + deprecate('res.redirect(url, status): Use res.redirect(status, url) instead'); + status = arguments[1]; + } + } + + // Set location header + address = this.location(address).get('Location'); + + // Support text/{plain,html} by default + this.format({ + text: function(){ + body = statuses[status] + '. Redirecting to ' + address + }, + + html: function(){ + var u = escapeHtml(address); + body = '

' + statuses[status] + '. Redirecting to ' + u + '

' + }, + + default: function(){ + body = ''; + } + }); + + // Respond + this.statusCode = status; + this.set('Content-Length', Buffer.byteLength(body)); + + if (this.req.method === 'HEAD') { + this.end(); + } else { + this.end(body); + } +}; + +/** + * Add `field` to Vary. If already present in the Vary set, then + * this call is simply ignored. + * + * @param {Array|String} field + * @return {ServerResponse} for chaining + * @public + */ + +res.vary = function(field){ + // checks for back-compat + if (!field || (Array.isArray(field) && !field.length)) { + deprecate('res.vary(): Provide a field name'); + return this; + } + + vary(this, field); + + return this; +}; + +/** + * Render `view` with the given `options` and optional callback `fn`. + * When a callback function is given a response will _not_ be made + * automatically, otherwise a response of _200_ and _text/html_ is given. + * + * Options: + * + * - `cache` boolean hinting to the engine it should cache + * - `filename` filename of the view being rendered + * + * @public + */ + +res.render = function render(view, options, callback) { + var app = this.req.app; + var done = callback; + var opts = options || {}; + var req = this.req; + var self = this; + + // support callback function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + // merge res.locals + opts._locals = self.locals; + + // default callback to respond + done = done || function (err, str) { + if (err) return req.next(err); + self.send(str); + }; + + // render + app.render(view, opts, done); +}; + +// pipe the send file stream +function sendfile(res, file, options, callback) { + var done = false; + var streaming; + + // request aborted + function onaborted() { + if (done) return; + done = true; + + var err = new Error('Request aborted'); + err.code = 'ECONNABORTED'; + callback(err); + } + + // directory + function ondirectory() { + if (done) return; + done = true; + + var err = new Error('EISDIR, read'); + err.code = 'EISDIR'; + callback(err); + } + + // errors + function onerror(err) { + if (done) return; + done = true; + callback(err); + } + + // ended + function onend() { + if (done) return; + done = true; + callback(); + } + + // file + function onfile() { + streaming = false; + } + + // finished + function onfinish(err) { + if (err && err.code === 'ECONNRESET') return onaborted(); + if (err) return onerror(err); + if (done) return; + + setImmediate(function () { + if (streaming !== false && !done) { + onaborted(); + return; + } + + if (done) return; + done = true; + callback(); + }); + } + + // streaming + function onstream() { + streaming = true; + } + + file.on('directory', ondirectory); + file.on('end', onend); + file.on('error', onerror); + file.on('file', onfile); + file.on('stream', onstream); + onFinished(res, onfinish); + + if (options.headers) { + // set headers on successful transfer + file.on('headers', function headers(res) { + var obj = options.headers; + var keys = Object.keys(obj); + + for (var i = 0; i < keys.length; i++) { + var k = keys[i]; + res.setHeader(k, obj[k]); + } + }); + } + + // pipe + file.pipe(res); +} + +/** + * Stringify JSON, like JSON.stringify, but v8 optimized. + * @private + */ + +function stringify(value, replacer, spaces) { + // v8 checks arguments.length for optimizing simple call + // https://bugs.chromium.org/p/v8/issues/detail?id=4730 + return replacer || spaces + ? JSON.stringify(value, replacer, spaces) + : JSON.stringify(value); +} diff --git a/8 node/node_modules/express/lib/router/index.js b/8 node/node_modules/express/lib/router/index.js new file mode 100644 index 000000000..51db4c28f --- /dev/null +++ b/8 node/node_modules/express/lib/router/index.js @@ -0,0 +1,662 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var Route = require('./route'); +var Layer = require('./layer'); +var methods = require('methods'); +var mixin = require('utils-merge'); +var debug = require('debug')('express:router'); +var deprecate = require('depd')('express'); +var flatten = require('array-flatten'); +var parseUrl = require('parseurl'); +var setPrototypeOf = require('setprototypeof') + +/** + * Module variables. + * @private + */ + +var objectRegExp = /^\[object (\S+)\]$/; +var slice = Array.prototype.slice; +var toString = Object.prototype.toString; + +/** + * Initialize a new `Router` with the given `options`. + * + * @param {Object} options + * @return {Router} which is an callable function + * @public + */ + +var proto = module.exports = function(options) { + var opts = options || {}; + + function router(req, res, next) { + router.handle(req, res, next); + } + + // mixin Router class functions + setPrototypeOf(router, proto) + + router.params = {}; + router._params = []; + router.caseSensitive = opts.caseSensitive; + router.mergeParams = opts.mergeParams; + router.strict = opts.strict; + router.stack = []; + + return router; +}; + +/** + * Map the given param placeholder `name`(s) to the given callback. + * + * Parameter mapping is used to provide pre-conditions to routes + * which use normalized placeholders. For example a _:user_id_ parameter + * could automatically load a user's information from the database without + * any additional code, + * + * The callback uses the same signature as middleware, the only difference + * being that the value of the placeholder is passed, in this case the _id_ + * of the user. Once the `next()` function is invoked, just like middleware + * it will continue on to execute the route, or subsequent parameter functions. + * + * Just like in middleware, you must either respond to the request or call next + * to avoid stalling the request. + * + * app.param('user_id', function(req, res, next, id){ + * User.find(id, function(err, user){ + * if (err) { + * return next(err); + * } else if (!user) { + * return next(new Error('failed to load user')); + * } + * req.user = user; + * next(); + * }); + * }); + * + * @param {String} name + * @param {Function} fn + * @return {app} for chaining + * @public + */ + +proto.param = function param(name, fn) { + // param logic + if (typeof name === 'function') { + deprecate('router.param(fn): Refactor to use path params'); + this._params.push(name); + return; + } + + // apply param functions + var params = this._params; + var len = params.length; + var ret; + + if (name[0] === ':') { + deprecate('router.param(' + JSON.stringify(name) + ', fn): Use router.param(' + JSON.stringify(name.substr(1)) + ', fn) instead'); + name = name.substr(1); + } + + for (var i = 0; i < len; ++i) { + if (ret = params[i](name, fn)) { + fn = ret; + } + } + + // ensure we end up with a + // middleware function + if ('function' !== typeof fn) { + throw new Error('invalid param() call for ' + name + ', got ' + fn); + } + + (this.params[name] = this.params[name] || []).push(fn); + return this; +}; + +/** + * Dispatch a req, res into the router. + * @private + */ + +proto.handle = function handle(req, res, out) { + var self = this; + + debug('dispatching %s %s', req.method, req.url); + + var idx = 0; + var protohost = getProtohost(req.url) || '' + var removed = ''; + var slashAdded = false; + var paramcalled = {}; + + // store options for OPTIONS request + // only used if OPTIONS request + var options = []; + + // middleware and routes + var stack = self.stack; + + // manage inter-router variables + var parentParams = req.params; + var parentUrl = req.baseUrl || ''; + var done = restore(out, req, 'baseUrl', 'next', 'params'); + + // setup next layer + req.next = next; + + // for options requests, respond with a default if nothing else responds + if (req.method === 'OPTIONS') { + done = wrap(done, function(old, err) { + if (err || options.length === 0) return old(err); + sendOptionsResponse(res, options, old); + }); + } + + // setup basic req values + req.baseUrl = parentUrl; + req.originalUrl = req.originalUrl || req.url; + + next(); + + function next(err) { + var layerError = err === 'route' + ? null + : err; + + // remove added slash + if (slashAdded) { + req.url = req.url.substr(1); + slashAdded = false; + } + + // restore altered req.url + if (removed.length !== 0) { + req.baseUrl = parentUrl; + req.url = protohost + removed + req.url.substr(protohost.length); + removed = ''; + } + + // signal to exit router + if (layerError === 'router') { + setImmediate(done, null) + return + } + + // no more matching layers + if (idx >= stack.length) { + setImmediate(done, layerError); + return; + } + + // get pathname of request + var path = getPathname(req); + + if (path == null) { + return done(layerError); + } + + // find next matching layer + var layer; + var match; + var route; + + while (match !== true && idx < stack.length) { + layer = stack[idx++]; + match = matchLayer(layer, path); + route = layer.route; + + if (typeof match !== 'boolean') { + // hold on to layerError + layerError = layerError || match; + } + + if (match !== true) { + continue; + } + + if (!route) { + // process non-route handlers normally + continue; + } + + if (layerError) { + // routes do not match with a pending error + match = false; + continue; + } + + var method = req.method; + var has_method = route._handles_method(method); + + // build up automatic options response + if (!has_method && method === 'OPTIONS') { + appendMethods(options, route._options()); + } + + // don't even bother matching route + if (!has_method && method !== 'HEAD') { + match = false; + continue; + } + } + + // no match + if (match !== true) { + return done(layerError); + } + + // store route for dispatch on change + if (route) { + req.route = route; + } + + // Capture one-time layer values + req.params = self.mergeParams + ? mergeParams(layer.params, parentParams) + : layer.params; + var layerPath = layer.path; + + // this should be done for the layer + self.process_params(layer, paramcalled, req, res, function (err) { + if (err) { + return next(layerError || err); + } + + if (route) { + return layer.handle_request(req, res, next); + } + + trim_prefix(layer, layerError, layerPath, path); + }); + } + + function trim_prefix(layer, layerError, layerPath, path) { + if (layerPath.length !== 0) { + // Validate path breaks on a path separator + var c = path[layerPath.length] + if (c && c !== '/' && c !== '.') return next(layerError) + + // Trim off the part of the url that matches the route + // middleware (.use stuff) needs to have the path stripped + debug('trim prefix (%s) from url %s', layerPath, req.url); + removed = layerPath; + req.url = protohost + req.url.substr(protohost.length + removed.length); + + // Ensure leading slash + if (!protohost && req.url[0] !== '/') { + req.url = '/' + req.url; + slashAdded = true; + } + + // Setup base URL (no trailing slash) + req.baseUrl = parentUrl + (removed[removed.length - 1] === '/' + ? removed.substring(0, removed.length - 1) + : removed); + } + + debug('%s %s : %s', layer.name, layerPath, req.originalUrl); + + if (layerError) { + layer.handle_error(layerError, req, res, next); + } else { + layer.handle_request(req, res, next); + } + } +}; + +/** + * Process any parameters for the layer. + * @private + */ + +proto.process_params = function process_params(layer, called, req, res, done) { + var params = this.params; + + // captured parameters from the layer, keys and values + var keys = layer.keys; + + // fast track + if (!keys || keys.length === 0) { + return done(); + } + + var i = 0; + var name; + var paramIndex = 0; + var key; + var paramVal; + var paramCallbacks; + var paramCalled; + + // process params in order + // param callbacks can be async + function param(err) { + if (err) { + return done(err); + } + + if (i >= keys.length ) { + return done(); + } + + paramIndex = 0; + key = keys[i++]; + name = key.name; + paramVal = req.params[name]; + paramCallbacks = params[name]; + paramCalled = called[name]; + + if (paramVal === undefined || !paramCallbacks) { + return param(); + } + + // param previously called with same value or error occurred + if (paramCalled && (paramCalled.match === paramVal + || (paramCalled.error && paramCalled.error !== 'route'))) { + // restore value + req.params[name] = paramCalled.value; + + // next param + return param(paramCalled.error); + } + + called[name] = paramCalled = { + error: null, + match: paramVal, + value: paramVal + }; + + paramCallback(); + } + + // single param callbacks + function paramCallback(err) { + var fn = paramCallbacks[paramIndex++]; + + // store updated value + paramCalled.value = req.params[key.name]; + + if (err) { + // store error + paramCalled.error = err; + param(err); + return; + } + + if (!fn) return param(); + + try { + fn(req, res, paramCallback, paramVal, key.name); + } catch (e) { + paramCallback(e); + } + } + + param(); +}; + +/** + * Use the given middleware function, with optional path, defaulting to "/". + * + * Use (like `.all`) will run for any http METHOD, but it will not add + * handlers for those methods so OPTIONS requests will not consider `.use` + * functions even if they could respond. + * + * The other difference is that _route_ path is stripped and not visible + * to the handler function. The main effect of this feature is that mounted + * handlers can operate without any code changes regardless of the "prefix" + * pathname. + * + * @public + */ + +proto.use = function use(fn) { + var offset = 0; + var path = '/'; + + // default path to '/' + // disambiguate router.use([fn]) + if (typeof fn !== 'function') { + var arg = fn; + + while (Array.isArray(arg) && arg.length !== 0) { + arg = arg[0]; + } + + // first arg is the path + if (typeof arg !== 'function') { + offset = 1; + path = fn; + } + } + + var callbacks = flatten(slice.call(arguments, offset)); + + if (callbacks.length === 0) { + throw new TypeError('Router.use() requires middleware functions'); + } + + for (var i = 0; i < callbacks.length; i++) { + var fn = callbacks[i]; + + if (typeof fn !== 'function') { + throw new TypeError('Router.use() requires middleware function but got a ' + gettype(fn)); + } + + // add the middleware + debug('use %o %s', path, fn.name || '') + + var layer = new Layer(path, { + sensitive: this.caseSensitive, + strict: false, + end: false + }, fn); + + layer.route = undefined; + + this.stack.push(layer); + } + + return this; +}; + +/** + * Create a new Route for the given path. + * + * Each route contains a separate middleware stack and VERB handlers. + * + * See the Route api documentation for details on adding handlers + * and middleware to routes. + * + * @param {String} path + * @return {Route} + * @public + */ + +proto.route = function route(path) { + var route = new Route(path); + + var layer = new Layer(path, { + sensitive: this.caseSensitive, + strict: this.strict, + end: true + }, route.dispatch.bind(route)); + + layer.route = route; + + this.stack.push(layer); + return route; +}; + +// create Router#VERB functions +methods.concat('all').forEach(function(method){ + proto[method] = function(path){ + var route = this.route(path) + route[method].apply(route, slice.call(arguments, 1)); + return this; + }; +}); + +// append methods to a list of methods +function appendMethods(list, addition) { + for (var i = 0; i < addition.length; i++) { + var method = addition[i]; + if (list.indexOf(method) === -1) { + list.push(method); + } + } +} + +// get pathname of request +function getPathname(req) { + try { + return parseUrl(req).pathname; + } catch (err) { + return undefined; + } +} + +// Get get protocol + host for a URL +function getProtohost(url) { + if (typeof url !== 'string' || url.length === 0 || url[0] === '/') { + return undefined + } + + var searchIndex = url.indexOf('?') + var pathLength = searchIndex !== -1 + ? searchIndex + : url.length + var fqdnIndex = url.substr(0, pathLength).indexOf('://') + + return fqdnIndex !== -1 + ? url.substr(0, url.indexOf('/', 3 + fqdnIndex)) + : undefined +} + +// get type for error message +function gettype(obj) { + var type = typeof obj; + + if (type !== 'object') { + return type; + } + + // inspect [[Class]] for objects + return toString.call(obj) + .replace(objectRegExp, '$1'); +} + +/** + * Match path to a layer. + * + * @param {Layer} layer + * @param {string} path + * @private + */ + +function matchLayer(layer, path) { + try { + return layer.match(path); + } catch (err) { + return err; + } +} + +// merge params with parent params +function mergeParams(params, parent) { + if (typeof parent !== 'object' || !parent) { + return params; + } + + // make copy of parent for base + var obj = mixin({}, parent); + + // simple non-numeric merging + if (!(0 in params) || !(0 in parent)) { + return mixin(obj, params); + } + + var i = 0; + var o = 0; + + // determine numeric gaps + while (i in params) { + i++; + } + + while (o in parent) { + o++; + } + + // offset numeric indices in params before merge + for (i--; i >= 0; i--) { + params[i + o] = params[i]; + + // create holes for the merge when necessary + if (i < o) { + delete params[i]; + } + } + + return mixin(obj, params); +} + +// restore obj props after function +function restore(fn, obj) { + var props = new Array(arguments.length - 2); + var vals = new Array(arguments.length - 2); + + for (var i = 0; i < props.length; i++) { + props[i] = arguments[i + 2]; + vals[i] = obj[props[i]]; + } + + return function () { + // restore vals + for (var i = 0; i < props.length; i++) { + obj[props[i]] = vals[i]; + } + + return fn.apply(this, arguments); + }; +} + +// send an OPTIONS response +function sendOptionsResponse(res, options, next) { + try { + var body = options.join(','); + res.set('Allow', body); + res.send(body); + } catch (err) { + next(err); + } +} + +// wrap a function +function wrap(old, fn) { + return function proxy() { + var args = new Array(arguments.length + 1); + + args[0] = old; + for (var i = 0, len = arguments.length; i < len; i++) { + args[i + 1] = arguments[i]; + } + + fn.apply(this, args); + }; +} diff --git a/8 node/node_modules/express/lib/router/layer.js b/8 node/node_modules/express/lib/router/layer.js new file mode 100644 index 000000000..4dc8e86d4 --- /dev/null +++ b/8 node/node_modules/express/lib/router/layer.js @@ -0,0 +1,181 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var pathRegexp = require('path-to-regexp'); +var debug = require('debug')('express:router:layer'); + +/** + * Module variables. + * @private + */ + +var hasOwnProperty = Object.prototype.hasOwnProperty; + +/** + * Module exports. + * @public + */ + +module.exports = Layer; + +function Layer(path, options, fn) { + if (!(this instanceof Layer)) { + return new Layer(path, options, fn); + } + + debug('new %o', path) + var opts = options || {}; + + this.handle = fn; + this.name = fn.name || ''; + this.params = undefined; + this.path = undefined; + this.regexp = pathRegexp(path, this.keys = [], opts); + + // set fast path flags + this.regexp.fast_star = path === '*' + this.regexp.fast_slash = path === '/' && opts.end === false +} + +/** + * Handle the error for the layer. + * + * @param {Error} error + * @param {Request} req + * @param {Response} res + * @param {function} next + * @api private + */ + +Layer.prototype.handle_error = function handle_error(error, req, res, next) { + var fn = this.handle; + + if (fn.length !== 4) { + // not a standard error handler + return next(error); + } + + try { + fn(error, req, res, next); + } catch (err) { + next(err); + } +}; + +/** + * Handle the request for the layer. + * + * @param {Request} req + * @param {Response} res + * @param {function} next + * @api private + */ + +Layer.prototype.handle_request = function handle(req, res, next) { + var fn = this.handle; + + if (fn.length > 3) { + // not a standard request handler + return next(); + } + + try { + fn(req, res, next); + } catch (err) { + next(err); + } +}; + +/** + * Check if this route matches `path`, if so + * populate `.params`. + * + * @param {String} path + * @return {Boolean} + * @api private + */ + +Layer.prototype.match = function match(path) { + var match + + if (path != null) { + // fast path non-ending match for / (any path matches) + if (this.regexp.fast_slash) { + this.params = {} + this.path = '' + return true + } + + // fast path for * (everything matched in a param) + if (this.regexp.fast_star) { + this.params = {'0': decode_param(path)} + this.path = path + return true + } + + // match the path + match = this.regexp.exec(path) + } + + if (!match) { + this.params = undefined; + this.path = undefined; + return false; + } + + // store values + this.params = {}; + this.path = match[0] + + var keys = this.keys; + var params = this.params; + + for (var i = 1; i < match.length; i++) { + var key = keys[i - 1]; + var prop = key.name; + var val = decode_param(match[i]) + + if (val !== undefined || !(hasOwnProperty.call(params, prop))) { + params[prop] = val; + } + } + + return true; +}; + +/** + * Decode param value. + * + * @param {string} val + * @return {string} + * @private + */ + +function decode_param(val) { + if (typeof val !== 'string' || val.length === 0) { + return val; + } + + try { + return decodeURIComponent(val); + } catch (err) { + if (err instanceof URIError) { + err.message = 'Failed to decode param \'' + val + '\''; + err.status = err.statusCode = 400; + } + + throw err; + } +} diff --git a/8 node/node_modules/express/lib/router/route.js b/8 node/node_modules/express/lib/router/route.js new file mode 100644 index 000000000..ea82ed29d --- /dev/null +++ b/8 node/node_modules/express/lib/router/route.js @@ -0,0 +1,216 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var debug = require('debug')('express:router:route'); +var flatten = require('array-flatten'); +var Layer = require('./layer'); +var methods = require('methods'); + +/** + * Module variables. + * @private + */ + +var slice = Array.prototype.slice; +var toString = Object.prototype.toString; + +/** + * Module exports. + * @public + */ + +module.exports = Route; + +/** + * Initialize `Route` with the given `path`, + * + * @param {String} path + * @public + */ + +function Route(path) { + this.path = path; + this.stack = []; + + debug('new %o', path) + + // route handlers for various http methods + this.methods = {}; +} + +/** + * Determine if the route handles a given method. + * @private + */ + +Route.prototype._handles_method = function _handles_method(method) { + if (this.methods._all) { + return true; + } + + var name = method.toLowerCase(); + + if (name === 'head' && !this.methods['head']) { + name = 'get'; + } + + return Boolean(this.methods[name]); +}; + +/** + * @return {Array} supported HTTP methods + * @private + */ + +Route.prototype._options = function _options() { + var methods = Object.keys(this.methods); + + // append automatic head + if (this.methods.get && !this.methods.head) { + methods.push('head'); + } + + for (var i = 0; i < methods.length; i++) { + // make upper case + methods[i] = methods[i].toUpperCase(); + } + + return methods; +}; + +/** + * dispatch req, res into this route + * @private + */ + +Route.prototype.dispatch = function dispatch(req, res, done) { + var idx = 0; + var stack = this.stack; + if (stack.length === 0) { + return done(); + } + + var method = req.method.toLowerCase(); + if (method === 'head' && !this.methods['head']) { + method = 'get'; + } + + req.route = this; + + next(); + + function next(err) { + // signal to exit route + if (err && err === 'route') { + return done(); + } + + // signal to exit router + if (err && err === 'router') { + return done(err) + } + + var layer = stack[idx++]; + if (!layer) { + return done(err); + } + + if (layer.method && layer.method !== method) { + return next(err); + } + + if (err) { + layer.handle_error(err, req, res, next); + } else { + layer.handle_request(req, res, next); + } + } +}; + +/** + * Add a handler for all HTTP verbs to this route. + * + * Behaves just like middleware and can respond or call `next` + * to continue processing. + * + * You can use multiple `.all` call to add multiple handlers. + * + * function check_something(req, res, next){ + * next(); + * }; + * + * function validate_user(req, res, next){ + * next(); + * }; + * + * route + * .all(validate_user) + * .all(check_something) + * .get(function(req, res, next){ + * res.send('hello world'); + * }); + * + * @param {function} handler + * @return {Route} for chaining + * @api public + */ + +Route.prototype.all = function all() { + var handles = flatten(slice.call(arguments)); + + for (var i = 0; i < handles.length; i++) { + var handle = handles[i]; + + if (typeof handle !== 'function') { + var type = toString.call(handle); + var msg = 'Route.all() requires callback functions but got a ' + type; + throw new TypeError(msg); + } + + var layer = Layer('/', {}, handle); + layer.method = undefined; + + this.methods._all = true; + this.stack.push(layer); + } + + return this; +}; + +methods.forEach(function(method){ + Route.prototype[method] = function(){ + var handles = flatten(slice.call(arguments)); + + for (var i = 0; i < handles.length; i++) { + var handle = handles[i]; + + if (typeof handle !== 'function') { + var type = toString.call(handle); + var msg = 'Route.' + method + '() requires callback functions but got a ' + type; + throw new Error(msg); + } + + debug('%s %o', method, this.path) + + var layer = Layer('/', {}, handle); + layer.method = method; + + this.methods[method] = true; + this.stack.push(layer); + } + + return this; + }; +}); diff --git a/8 node/node_modules/express/lib/utils.js b/8 node/node_modules/express/lib/utils.js new file mode 100644 index 000000000..f418c5807 --- /dev/null +++ b/8 node/node_modules/express/lib/utils.js @@ -0,0 +1,299 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @api private + */ + +var contentDisposition = require('content-disposition'); +var contentType = require('content-type'); +var deprecate = require('depd')('express'); +var flatten = require('array-flatten'); +var mime = require('send').mime; +var basename = require('path').basename; +var etag = require('etag'); +var proxyaddr = require('proxy-addr'); +var qs = require('qs'); +var querystring = require('querystring'); + +/** + * Return strong ETag for `body`. + * + * @param {String|Buffer} body + * @param {String} [encoding] + * @return {String} + * @api private + */ + +exports.etag = function (body, encoding) { + var buf = !Buffer.isBuffer(body) + ? new Buffer(body, encoding) + : body; + + return etag(buf, {weak: false}); +}; + +/** + * Return weak ETag for `body`. + * + * @param {String|Buffer} body + * @param {String} [encoding] + * @return {String} + * @api private + */ + +exports.wetag = function wetag(body, encoding){ + var buf = !Buffer.isBuffer(body) + ? new Buffer(body, encoding) + : body; + + return etag(buf, {weak: true}); +}; + +/** + * Check if `path` looks absolute. + * + * @param {String} path + * @return {Boolean} + * @api private + */ + +exports.isAbsolute = function(path){ + if ('/' === path[0]) return true; + if (':' === path[1] && ('\\' === path[2] || '/' === path[2])) return true; // Windows device path + if ('\\\\' === path.substring(0, 2)) return true; // Microsoft Azure absolute path +}; + +/** + * Flatten the given `arr`. + * + * @param {Array} arr + * @return {Array} + * @api private + */ + +exports.flatten = deprecate.function(flatten, + 'utils.flatten: use array-flatten npm module instead'); + +/** + * Normalize the given `type`, for example "html" becomes "text/html". + * + * @param {String} type + * @return {Object} + * @api private + */ + +exports.normalizeType = function(type){ + return ~type.indexOf('/') + ? acceptParams(type) + : { value: mime.lookup(type), params: {} }; +}; + +/** + * Normalize `types`, for example "html" becomes "text/html". + * + * @param {Array} types + * @return {Array} + * @api private + */ + +exports.normalizeTypes = function(types){ + var ret = []; + + for (var i = 0; i < types.length; ++i) { + ret.push(exports.normalizeType(types[i])); + } + + return ret; +}; + +/** + * Generate Content-Disposition header appropriate for the filename. + * non-ascii filenames are urlencoded and a filename* parameter is added + * + * @param {String} filename + * @return {String} + * @api private + */ + +exports.contentDisposition = deprecate.function(contentDisposition, + 'utils.contentDisposition: use content-disposition npm module instead'); + +/** + * Parse accept params `str` returning an + * object with `.value`, `.quality` and `.params`. + * also includes `.originalIndex` for stable sorting + * + * @param {String} str + * @return {Object} + * @api private + */ + +function acceptParams(str, index) { + var parts = str.split(/ *; */); + var ret = { value: parts[0], quality: 1, params: {}, originalIndex: index }; + + for (var i = 1; i < parts.length; ++i) { + var pms = parts[i].split(/ *= */); + if ('q' === pms[0]) { + ret.quality = parseFloat(pms[1]); + } else { + ret.params[pms[0]] = pms[1]; + } + } + + return ret; +} + +/** + * Compile "etag" value to function. + * + * @param {Boolean|String|Function} val + * @return {Function} + * @api private + */ + +exports.compileETag = function(val) { + var fn; + + if (typeof val === 'function') { + return val; + } + + switch (val) { + case true: + fn = exports.wetag; + break; + case false: + break; + case 'strong': + fn = exports.etag; + break; + case 'weak': + fn = exports.wetag; + break; + default: + throw new TypeError('unknown value for etag function: ' + val); + } + + return fn; +} + +/** + * Compile "query parser" value to function. + * + * @param {String|Function} val + * @return {Function} + * @api private + */ + +exports.compileQueryParser = function compileQueryParser(val) { + var fn; + + if (typeof val === 'function') { + return val; + } + + switch (val) { + case true: + fn = querystring.parse; + break; + case false: + fn = newObject; + break; + case 'extended': + fn = parseExtendedQueryString; + break; + case 'simple': + fn = querystring.parse; + break; + default: + throw new TypeError('unknown value for query parser function: ' + val); + } + + return fn; +} + +/** + * Compile "proxy trust" value to function. + * + * @param {Boolean|String|Number|Array|Function} val + * @return {Function} + * @api private + */ + +exports.compileTrust = function(val) { + if (typeof val === 'function') return val; + + if (val === true) { + // Support plain true/false + return function(){ return true }; + } + + if (typeof val === 'number') { + // Support trusting hop count + return function(a, i){ return i < val }; + } + + if (typeof val === 'string') { + // Support comma-separated values + val = val.split(/ *, */); + } + + return proxyaddr.compile(val || []); +} + +/** + * Set the charset in a given Content-Type string. + * + * @param {String} type + * @param {String} charset + * @return {String} + * @api private + */ + +exports.setCharset = function setCharset(type, charset) { + if (!type || !charset) { + return type; + } + + // parse type + var parsed = contentType.parse(type); + + // set charset + parsed.parameters.charset = charset; + + // format type + return contentType.format(parsed); +}; + +/** + * Parse an extended query string with qs. + * + * @return {Object} + * @private + */ + +function parseExtendedQueryString(str) { + return qs.parse(str, { + allowPrototypes: true + }); +} + +/** + * Return new empty object. + * + * @return {Object} + * @api private + */ + +function newObject() { + return {}; +} diff --git a/8 node/node_modules/express/lib/view.js b/8 node/node_modules/express/lib/view.js new file mode 100644 index 000000000..1728725d2 --- /dev/null +++ b/8 node/node_modules/express/lib/view.js @@ -0,0 +1,175 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var debug = require('debug')('express:view'); +var path = require('path'); +var fs = require('fs'); +var utils = require('./utils'); + +/** + * Module variables. + * @private + */ + +var dirname = path.dirname; +var basename = path.basename; +var extname = path.extname; +var join = path.join; +var resolve = path.resolve; + +/** + * Module exports. + * @public + */ + +module.exports = View; + +/** + * Initialize a new `View` with the given `name`. + * + * Options: + * + * - `defaultEngine` the default template engine name + * - `engines` template engine require() cache + * - `root` root path for view lookup + * + * @param {string} name + * @param {object} options + * @public + */ + +function View(name, options) { + var opts = options || {}; + + this.defaultEngine = opts.defaultEngine; + this.ext = extname(name); + this.name = name; + this.root = opts.root; + + if (!this.ext && !this.defaultEngine) { + throw new Error('No default engine was specified and no extension was provided.'); + } + + var fileName = name; + + if (!this.ext) { + // get extension from default engine name + this.ext = this.defaultEngine[0] !== '.' + ? '.' + this.defaultEngine + : this.defaultEngine; + + fileName += this.ext; + } + + if (!opts.engines[this.ext]) { + // load engine + var mod = this.ext.substr(1) + debug('require "%s"', mod) + opts.engines[this.ext] = require(mod).__express + } + + // store loaded engine + this.engine = opts.engines[this.ext]; + + // lookup path + this.path = this.lookup(fileName); +} + +/** + * Lookup view by the given `name` + * + * @param {string} name + * @private + */ + +View.prototype.lookup = function lookup(name) { + var path; + var roots = [].concat(this.root); + + debug('lookup "%s"', name); + + for (var i = 0; i < roots.length && !path; i++) { + var root = roots[i]; + + // resolve the path + var loc = resolve(root, name); + var dir = dirname(loc); + var file = basename(loc); + + // resolve the file + path = this.resolve(dir, file); + } + + return path; +}; + +/** + * Render with the given options. + * + * @param {object} options + * @param {function} callback + * @private + */ + +View.prototype.render = function render(options, callback) { + debug('render "%s"', this.path); + this.engine(this.path, options, callback); +}; + +/** + * Resolve the file within the given directory. + * + * @param {string} dir + * @param {string} file + * @private + */ + +View.prototype.resolve = function resolve(dir, file) { + var ext = this.ext; + + // . + var path = join(dir, file); + var stat = tryStat(path); + + if (stat && stat.isFile()) { + return path; + } + + // /index. + path = join(dir, basename(file, ext), 'index' + ext); + stat = tryStat(path); + + if (stat && stat.isFile()) { + return path; + } +}; + +/** + * Return a stat, maybe. + * + * @param {string} path + * @return {fs.Stats} + * @private + */ + +function tryStat(path) { + debug('stat "%s"', path); + + try { + return fs.statSync(path); + } catch (e) { + return undefined; + } +} diff --git a/8 node/node_modules/express/package.json b/8 node/node_modules/express/package.json new file mode 100644 index 000000000..8cc504ce0 --- /dev/null +++ b/8 node/node_modules/express/package.json @@ -0,0 +1,151 @@ +{ + "_from": "express", + "_id": "express@4.15.3", + "_inBundle": false, + "_integrity": "sha1-urZdDwOqgMNYQIly/HAPkWlEtmI=", + "_location": "/express", + "_phantomChildren": {}, + "_requested": { + "type": "tag", + "registry": true, + "raw": "express", + "name": "express", + "escapedName": "express", + "rawSpec": "", + "saveSpec": null, + "fetchSpec": "latest" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "https://registry.npmjs.org/express/-/express-4.15.3.tgz", + "_shasum": "bab65d0f03aa80c358408972fc700f916944b662", + "_spec": "express", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "bugs": { + "url": "https://github.com/expressjs/express/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Aaron Heckmann", + "email": "aaron.heckmann+github@gmail.com" + }, + { + "name": "Ciaran Jessup", + "email": "ciaranj@gmail.com" + }, + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Guillermo Rauch", + "email": "rauchg@gmail.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com" + }, + { + "name": "Roman Shtylman", + "email": "shtylman+expressjs@gmail.com" + }, + { + "name": "Young Jae Sim", + "email": "hanul@hanul.me" + } + ], + "dependencies": { + "accepts": "~1.3.3", + "array-flatten": "1.1.1", + "content-disposition": "0.5.2", + "content-type": "~1.0.2", + "cookie": "0.3.1", + "cookie-signature": "1.0.6", + "debug": "2.6.7", + "depd": "~1.1.0", + "encodeurl": "~1.0.1", + "escape-html": "~1.0.3", + "etag": "~1.8.0", + "finalhandler": "~1.0.3", + "fresh": "0.5.0", + "merge-descriptors": "1.0.1", + "methods": "~1.1.2", + "on-finished": "~2.3.0", + "parseurl": "~1.3.1", + "path-to-regexp": "0.1.7", + "proxy-addr": "~1.1.4", + "qs": "6.4.0", + "range-parser": "~1.2.0", + "send": "0.15.3", + "serve-static": "1.12.3", + "setprototypeof": "1.0.3", + "statuses": "~1.3.1", + "type-is": "~1.6.15", + "utils-merge": "1.0.0", + "vary": "~1.1.1" + }, + "deprecated": false, + "description": "Fast, unopinionated, minimalist web framework", + "devDependencies": { + "after": "0.8.2", + "body-parser": "1.17.1", + "connect-redis": "~2.4.1", + "cookie-parser": "~1.4.3", + "cookie-session": "~1.2.0", + "ejs": "2.5.6", + "express-session": "1.15.2", + "hbs": "4.0.1", + "istanbul": "0.4.5", + "marked": "0.3.6", + "method-override": "2.3.8", + "mocha": "3.4.1", + "morgan": "1.8.1", + "multiparty": "4.1.3", + "pbkdf2-password": "1.2.1", + "should": "11.2.1", + "supertest": "1.2.0", + "vhost": "~3.0.2" + }, + "engines": { + "node": ">= 0.10.0" + }, + "files": [ + "LICENSE", + "History.md", + "Readme.md", + "index.js", + "lib/" + ], + "homepage": "http://expressjs.com/", + "keywords": [ + "express", + "framework", + "sinatra", + "web", + "rest", + "restful", + "router", + "app", + "api" + ], + "license": "MIT", + "name": "express", + "repository": { + "type": "git", + "url": "git+https://github.com/expressjs/express.git" + }, + "scripts": { + "test": "mocha --require test/support/env --reporter spec --bail --check-leaks test/ test/acceptance/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --require test/support/env --reporter spec --check-leaks test/ test/acceptance/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --require test/support/env --reporter dot --check-leaks test/ test/acceptance/", + "test-tap": "mocha --require test/support/env --reporter tap --check-leaks test/ test/acceptance/" + }, + "version": "4.15.3" +} diff --git a/8 node/node_modules/finalhandler/HISTORY.md b/8 node/node_modules/finalhandler/HISTORY.md new file mode 100644 index 000000000..b1ff016f0 --- /dev/null +++ b/8 node/node_modules/finalhandler/HISTORY.md @@ -0,0 +1,150 @@ +1.0.3 / 2017-05-16 +================== + + * deps: debug@2.6.7 + - deps: ms@2.0.0 + +1.0.2 / 2017-04-22 +================== + + * deps: debug@2.6.4 + - deps: ms@0.7.3 + +1.0.1 / 2017-03-21 +================== + + * Fix missing `` in HTML document + * deps: debug@2.6.3 + - Fix: `DEBUG_MAX_ARRAY_LENGTH` + +1.0.0 / 2017-02-15 +================== + + * Fix exception when `err` cannot be converted to a string + * Fully URL-encode the pathname in the 404 message + * Only include the pathname in the 404 message + * Send complete HTML document + * Set `Content-Security-Policy: default-src 'self'` header + * deps: debug@2.6.1 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable set to `3` or higher + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + +0.5.1 / 2016-11-12 +================== + + * Fix exception when `err.headers` is not an object + * deps: statuses@~1.3.1 + * perf: hoist regular expressions + * perf: remove duplicate validation path + +0.5.0 / 2016-06-15 +================== + + * Change invalid or non-numeric status code to 500 + * Overwrite status message to match set status code + * Prefer `err.statusCode` if `err.status` is invalid + * Set response headers from `err.headers` object + * Use `statuses` instead of `http` module for status messages + - Includes all defined status messages + +0.4.1 / 2015-12-02 +================== + + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + +0.4.0 / 2015-06-14 +================== + + * Fix a false-positive when unpiping in Node.js 0.8 + * Support `statusCode` property on `Error` objects + * Use `unpipe` module for unpiping requests + * deps: escape-html@1.0.2 + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * perf: enable strict mode + * perf: remove argument reassignment + +0.3.6 / 2015-05-11 +================== + + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + +0.3.5 / 2015-04-22 +================== + + * deps: on-finished@~2.2.1 + - Fix `isFinished(req)` when data buffered + +0.3.4 / 2015-03-15 +================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + +0.3.3 / 2015-01-01 +================== + + * deps: debug@~2.1.1 + * deps: on-finished@~2.2.0 + +0.3.2 / 2014-10-22 +================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + +0.3.1 / 2014-10-16 +================== + + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + +0.3.0 / 2014-09-17 +================== + + * Terminate in progress response only on error + * Use `on-finished` to determine request status + +0.2.0 / 2014-09-03 +================== + + * Set `X-Content-Type-Options: nosniff` header + * deps: debug@~2.0.0 + +0.1.0 / 2014-07-16 +================== + + * Respond after request fully read + - prevents hung responses and socket hang ups + * deps: debug@1.0.4 + +0.0.3 / 2014-07-11 +================== + + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + +0.0.2 / 2014-06-19 +================== + + * Handle invalid status codes + +0.0.1 / 2014-06-05 +================== + + * deps: debug@1.0.2 + +0.0.0 / 2014-06-05 +================== + + * Extracted from connect/express diff --git a/8 node/node_modules/finalhandler/LICENSE b/8 node/node_modules/finalhandler/LICENSE new file mode 100644 index 000000000..fb3098277 --- /dev/null +++ b/8 node/node_modules/finalhandler/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/finalhandler/README.md b/8 node/node_modules/finalhandler/README.md new file mode 100644 index 000000000..84c3d2af1 --- /dev/null +++ b/8 node/node_modules/finalhandler/README.md @@ -0,0 +1,146 @@ +# finalhandler + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Node.js function to invoke as the final step to respond to HTTP request. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install finalhandler +``` + +## API + +``` +var finalhandler = require('finalhandler') +``` + +### finalhandler(req, res, [options]) + +Returns function to be invoked as the final step for the given `req` and `res`. +This function is to be invoked as `fn(err)`. If `err` is falsy, the handler will +write out a 404 response to the `res`. If it is truthy, an error response will +be written out to the `res`. + +When an error is written, the following information is added to the response: + + * The `res.statusCode` is set from `err.status` (or `err.statusCode`). If + this value is outside the 4xx or 5xx range, it will be set to 500. + * The `res.statusMessage` is set according to the status code. + * The body will be the HTML of the status code message if `env` is + `'production'`, otherwise will be `err.stack`. + * Any headers specified in an `err.headers` object. + +The final handler will also unpipe anything from `req` when it is invoked. + +#### options.env + +By default, the environment is determined by `NODE_ENV` variable, but it can be +overridden by this option. + +#### options.onerror + +Provide a function to be called with the `err` when it exists. Can be used for +writing errors to a central location without excessive function generation. Called +as `onerror(err, req, res)`. + +## Examples + +### always 404 + +```js +var finalhandler = require('finalhandler') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + done() +}) + +server.listen(3000) +``` + +### perform simple action + +```js +var finalhandler = require('finalhandler') +var fs = require('fs') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + + fs.readFile('index.html', function (err, buf) { + if (err) return done(err) + res.setHeader('Content-Type', 'text/html') + res.end(buf) + }) +}) + +server.listen(3000) +``` + +### use with middleware-style functions + +```js +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +var serve = serveStatic('public') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + serve(req, res, done) +}) + +server.listen(3000) +``` + +### keep log of all errors + +```js +var finalhandler = require('finalhandler') +var fs = require('fs') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res, {onerror: logerror}) + + fs.readFile('index.html', function (err, buf) { + if (err) return done(err) + res.setHeader('Content-Type', 'text/html') + res.end(buf) + }) +}) + +server.listen(3000) + +function logerror (err) { + console.error(err.stack || err.toString()) +} +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/finalhandler.svg +[npm-url]: https://npmjs.org/package/finalhandler +[node-image]: https://img.shields.io/node/v/finalhandler.svg +[node-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/pillarjs/finalhandler.svg +[travis-url]: https://travis-ci.org/pillarjs/finalhandler +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/finalhandler.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/finalhandler?branch=master +[downloads-image]: https://img.shields.io/npm/dm/finalhandler.svg +[downloads-url]: https://npmjs.org/package/finalhandler diff --git a/8 node/node_modules/finalhandler/index.js b/8 node/node_modules/finalhandler/index.js new file mode 100644 index 000000000..87974ca03 --- /dev/null +++ b/8 node/node_modules/finalhandler/index.js @@ -0,0 +1,300 @@ +/*! + * finalhandler + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var debug = require('debug')('finalhandler') +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var onFinished = require('on-finished') +var parseUrl = require('parseurl') +var statuses = require('statuses') +var unpipe = require('unpipe') + +/** + * Module variables. + * @private + */ + +var DOUBLE_SPACE_REGEXP = /\x20{2}/g +var NEWLINE_REGEXP = /\n/g + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function (fn) { process.nextTick(fn.bind.apply(fn, arguments)) } +var isFinished = onFinished.isFinished + +/** + * Create a minimal HTML document. + * + * @param {string} message + * @private + */ + +function createHtmlDocument (message) { + var body = escapeHtml(message) + .replace(NEWLINE_REGEXP, '
') + .replace(DOUBLE_SPACE_REGEXP, '  ') + + return '\n' + + '\n' + + '\n' + + '\n' + + 'Error\n' + + '\n' + + '\n' + + '
' + body + '
\n' + + '\n' + + '\n' +} + +/** + * Module exports. + * @public + */ + +module.exports = finalhandler + +/** + * Create a function to handle the final response. + * + * @param {Request} req + * @param {Response} res + * @param {Object} [options] + * @return {Function} + * @public + */ + +function finalhandler (req, res, options) { + var opts = options || {} + + // get environment + var env = opts.env || process.env.NODE_ENV || 'development' + + // get error callback + var onerror = opts.onerror + + return function (err) { + var headers + var msg + var status + + // ignore 404 on in-flight response + if (!err && res._header) { + debug('cannot 404 after headers sent') + return + } + + // unhandled error + if (err) { + // respect status code from error + status = getErrorStatusCode(err) + + // respect headers from error + if (status !== undefined) { + headers = getErrorHeaders(err) + } + + // fallback to status code on response + if (status === undefined) { + status = getResponseStatusCode(res) + } + + // get error message + msg = getErrorMessage(err, status, env) + } else { + // not found + status = 404 + msg = 'Cannot ' + req.method + ' ' + encodeUrl(parseUrl.original(req).pathname) + } + + debug('default %s', status) + + // schedule onerror callback + if (err && onerror) { + defer(onerror, err, req, res) + } + + // cannot actually respond + if (res._header) { + debug('cannot %d after headers sent', status) + req.socket.destroy() + return + } + + // send response + send(req, res, status, headers, msg) + } +} + +/** + * Get headers from Error object. + * + * @param {Error} err + * @return {object} + * @private + */ + +function getErrorHeaders (err) { + if (!err.headers || typeof err.headers !== 'object') { + return undefined + } + + var headers = Object.create(null) + var keys = Object.keys(err.headers) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + headers[key] = err.headers[key] + } + + return headers +} + +/** + * Get message from Error object, fallback to status message. + * + * @param {Error} err + * @param {number} status + * @param {string} env + * @return {string} + * @private + */ + +function getErrorMessage (err, status, env) { + var msg + + if (env !== 'production') { + // use err.stack, which typically includes err.message + msg = err.stack + + // fallback to err.toString() when possible + if (!msg && typeof err.toString === 'function') { + msg = err.toString() + } + } + + return msg || statuses[status] +} + +/** + * Get status code from Error object. + * + * @param {Error} err + * @return {number} + * @private + */ + +function getErrorStatusCode (err) { + // check err.status + if (typeof err.status === 'number' && err.status >= 400 && err.status < 600) { + return err.status + } + + // check err.statusCode + if (typeof err.statusCode === 'number' && err.statusCode >= 400 && err.statusCode < 600) { + return err.statusCode + } + + return undefined +} + +/** + * Get status code from response. + * + * @param {OutgoingMessage} res + * @return {number} + * @private + */ + +function getResponseStatusCode (res) { + var status = res.statusCode + + // default status code to 500 if outside valid range + if (typeof status !== 'number' || status < 400 || status > 599) { + status = 500 + } + + return status +} + +/** + * Send response. + * + * @param {IncomingMessage} req + * @param {OutgoingMessage} res + * @param {number} status + * @param {object} headers + * @param {string} message + * @private + */ + +function send (req, res, status, headers, message) { + function write () { + // response body + var body = createHtmlDocument(message) + + // response status + res.statusCode = status + res.statusMessage = statuses[status] + + // response headers + setHeaders(res, headers) + + // security headers + res.setHeader('Content-Security-Policy', "default-src 'self'") + res.setHeader('X-Content-Type-Options', 'nosniff') + + // standard headers + res.setHeader('Content-Type', 'text/html; charset=utf-8') + res.setHeader('Content-Length', Buffer.byteLength(body, 'utf8')) + + if (req.method === 'HEAD') { + res.end() + return + } + + res.end(body, 'utf8') + } + + if (isFinished(req)) { + write() + return + } + + // unpipe everything from the request + unpipe(req) + + // flush the request + onFinished(req, write) + req.resume() +} + +/** + * Set response headers from an object. + * + * @param {OutgoingMessage} res + * @param {object} headers + * @private + */ + +function setHeaders (res, headers) { + if (!headers) { + return + } + + var keys = Object.keys(headers) + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + res.setHeader(key, headers[key]) + } +} diff --git a/8 node/node_modules/finalhandler/package.json b/8 node/node_modules/finalhandler/package.json new file mode 100644 index 000000000..d5771845f --- /dev/null +++ b/8 node/node_modules/finalhandler/package.json @@ -0,0 +1,80 @@ +{ + "_from": "finalhandler@~1.0.3", + "_id": "finalhandler@1.0.3", + "_inBundle": false, + "_integrity": "sha1-70fneVDpmXgOhgIqVg4yF+DQzIk=", + "_location": "/finalhandler", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "finalhandler@~1.0.3", + "name": "finalhandler", + "escapedName": "finalhandler", + "rawSpec": "~1.0.3", + "saveSpec": null, + "fetchSpec": "~1.0.3" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.0.3.tgz", + "_shasum": "ef47e77950e999780e86022a560e3217e0d0cc89", + "_spec": "finalhandler@~1.0.3", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/pillarjs/finalhandler/issues" + }, + "bundleDependencies": false, + "dependencies": { + "debug": "2.6.7", + "encodeurl": "~1.0.1", + "escape-html": "~1.0.3", + "on-finished": "~2.3.0", + "parseurl": "~1.3.1", + "statuses": "~1.3.1", + "unpipe": "~1.0.0" + }, + "deprecated": false, + "description": "Node.js final http responder", + "devDependencies": { + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.2.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-node": "4.2.2", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "2.5.3", + "readable-stream": "2.2.9", + "safe-buffer": "5.0.1", + "supertest": "1.1.0" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/pillarjs/finalhandler#readme", + "license": "MIT", + "name": "finalhandler", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/finalhandler.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "1.0.3" +} diff --git a/8 node/node_modules/forwarded/HISTORY.md b/8 node/node_modules/forwarded/HISTORY.md new file mode 100644 index 000000000..97fa1d102 --- /dev/null +++ b/8 node/node_modules/forwarded/HISTORY.md @@ -0,0 +1,4 @@ +0.1.0 / 2014-09-21 +================== + + * Initial release diff --git a/8 node/node_modules/forwarded/LICENSE b/8 node/node_modules/forwarded/LICENSE new file mode 100644 index 000000000..b7dce6cf9 --- /dev/null +++ b/8 node/node_modules/forwarded/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/forwarded/README.md b/8 node/node_modules/forwarded/README.md new file mode 100644 index 000000000..2b4988fa2 --- /dev/null +++ b/8 node/node_modules/forwarded/README.md @@ -0,0 +1,53 @@ +# forwarded + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Parse HTTP X-Forwarded-For header + +## Installation + +```sh +$ npm install forwarded +``` + +## API + +```js +var forwarded = require('forwarded') +``` + +### forwarded(req) + +```js +var addresses = forwarded(req) +``` + +Parse the `X-Forwarded-For` header from the request. Returns an array +of the addresses, including the socket address for the `req`. In reverse +order (i.e. index `0` is the socket address and the last index is the +furthest address, typically the end-user). + +## Testing + +```sh +$ npm test +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/forwarded.svg?style=flat +[npm-url]: https://npmjs.org/package/forwarded +[node-version-image]: https://img.shields.io/node/v/forwarded.svg?style=flat +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/forwarded.svg?style=flat +[travis-url]: https://travis-ci.org/jshttp/forwarded +[coveralls-image]: https://img.shields.io/coveralls/jshttp/forwarded.svg?style=flat +[coveralls-url]: https://coveralls.io/r/jshttp/forwarded?branch=master +[downloads-image]: https://img.shields.io/npm/dm/forwarded.svg?style=flat +[downloads-url]: https://npmjs.org/package/forwarded diff --git a/8 node/node_modules/forwarded/index.js b/8 node/node_modules/forwarded/index.js new file mode 100644 index 000000000..2f5c34088 --- /dev/null +++ b/8 node/node_modules/forwarded/index.js @@ -0,0 +1,35 @@ +/*! + * forwarded + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = forwarded + +/** + * Get all addresses in the request, using the `X-Forwarded-For` header. + * + * @param {Object} req + * @api public + */ + +function forwarded(req) { + if (!req) { + throw new TypeError('argument req is required') + } + + // simple header parsing + var proxyAddrs = (req.headers['x-forwarded-for'] || '') + .split(/ *, */) + .filter(Boolean) + .reverse() + var socketAddr = req.connection.remoteAddress + var addrs = [socketAddr].concat(proxyAddrs) + + // return all addresses + return addrs +} diff --git a/8 node/node_modules/forwarded/package.json b/8 node/node_modules/forwarded/package.json new file mode 100644 index 000000000..19eabc3b8 --- /dev/null +++ b/8 node/node_modules/forwarded/package.json @@ -0,0 +1,68 @@ +{ + "_from": "forwarded@~0.1.0", + "_id": "forwarded@0.1.0", + "_inBundle": false, + "_integrity": "sha1-Ge+YdMSuHCl7zweP3mOgm2aoQ2M=", + "_location": "/forwarded", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "forwarded@~0.1.0", + "name": "forwarded", + "escapedName": "forwarded", + "rawSpec": "~0.1.0", + "saveSpec": null, + "fetchSpec": "~0.1.0" + }, + "_requiredBy": [ + "/proxy-addr" + ], + "_resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.0.tgz", + "_shasum": "19ef9874c4ae1c297bcf078fde63a09b66a84363", + "_spec": "forwarded@~0.1.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/proxy-addr", + "bugs": { + "url": "https://github.com/jshttp/forwarded/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "Parse HTTP X-Forwarded-For header", + "devDependencies": { + "istanbul": "0.3.2", + "mocha": "~1.21.4" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/forwarded#readme", + "keywords": [ + "x-forwarded-for", + "http", + "req" + ], + "license": "MIT", + "name": "forwarded", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/forwarded.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.1.0" +} diff --git a/8 node/node_modules/fresh/HISTORY.md b/8 node/node_modules/fresh/HISTORY.md new file mode 100644 index 000000000..edd6c0586 --- /dev/null +++ b/8 node/node_modules/fresh/HISTORY.md @@ -0,0 +1,58 @@ +0.5.0 / 2017-02-21 +================== + + * Fix incorrect result when `If-None-Match` has both `*` and ETags + * Fix weak `ETag` matching to match spec + * perf: delay reading header values until needed + * perf: skip checking modified time if ETag check failed + * perf: skip parsing `If-None-Match` when no `ETag` header + * perf: use `Date.parse` instead of `new Date` + +0.4.0 / 2017-02-05 +================== + + * Fix false detection of `no-cache` request directive + * perf: enable strict mode + * perf: hoist regular expressions + * perf: remove duplicate conditional + * perf: remove unnecessary boolean coercions + +0.3.0 / 2015-05-12 +================== + + * Add weak `ETag` matching support + +0.2.4 / 2014-09-07 +================== + + * Support Node.js 0.6 + +0.2.3 / 2014-09-07 +================== + + * Move repository to jshttp + +0.2.2 / 2014-02-19 +================== + + * Revert "Fix for blank page on Safari reload" + +0.2.1 / 2014-01-29 +================== + + * Fix for blank page on Safari reload + +0.2.0 / 2013-08-11 +================== + + * Return stale for `Cache-Control: no-cache` + +0.1.0 / 2012-06-15 +================== + + * Add `If-None-Match: *` support + +0.0.1 / 2012-06-10 +================== + + * Initial release diff --git a/8 node/node_modules/fresh/LICENSE b/8 node/node_modules/fresh/LICENSE new file mode 100644 index 000000000..1434ade75 --- /dev/null +++ b/8 node/node_modules/fresh/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012 TJ Holowaychuk +Copyright (c) 2016-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/fresh/README.md b/8 node/node_modules/fresh/README.md new file mode 100644 index 000000000..d2b63e59c --- /dev/null +++ b/8 node/node_modules/fresh/README.md @@ -0,0 +1,113 @@ +# fresh + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP response freshness testing + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +``` +$ npm install fresh +``` + +## API + +```js +var fresh = require('fresh') +``` + +### fresh(reqHeaders, resHeaders) + +Check freshness of the response using request and response headers. + +When the response is still "fresh" in the client's cache `true` is +returned, otherwise `false` is returned to indicate that the client +cache is now stale and the full response should be sent. + +When a client sends the `Cache-Control: no-cache` request header to +indicate an end-to-end reload request, this module will return `false` +to make handling these requests transparent. + +## Known Issues + +This module is designed to only follow the HTTP specifications, not +to work-around all kinda of client bugs (especially since this module +typically does not recieve enough information to understand what the +client actually is). + +There is a known issue that in certain versions of Safari, Safari +will incorrectly make a request that allows this module to validate +freshness of the resource even when Safari does not have a +representation of the resource in the cache. The module +[jumanji](https://www.npmjs.com/package/jumanji) can be used in +an Express application to work-around this issue and also provides +links to further reading on this Safari bug. + +## Example + +### API usage + +```js +var reqHeaders = { 'if-none-match': '"foo"' } +var resHeaders = { 'etag': '"bar"' } +fresh(reqHeaders, resHeaders) +// => false + +var reqHeaders = { 'if-none-match': '"foo"' } +var resHeaders = { 'etag': '"foo"' } +fresh(reqHeaders, resHeaders) +// => true +``` + +### Using with Node.js http server + +```js +var fresh = require('fresh') +var http = require('http') + +var server = http.createServer(function (req, res) { + // perform server logic + // ... including adding ETag / Last-Modified response headers + + if (isFresh(req, res)) { + // client has a fresh copy of resource + res.statusCode = 304 + res.end() + return + } + + // send the resource +}) + +function isFresh (req, res) { + return fresh(req.headers, { + 'etag': res.getHeader('ETag'), + 'last-modified': res.getHeader('Last-Modified') + }) +} + +server.listen(3000) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/fresh.svg +[npm-url]: https://npmjs.org/package/fresh +[node-version-image]: https://img.shields.io/node/v/fresh.svg +[node-version-url]: https://nodejs.org/en/ +[travis-image]: https://img.shields.io/travis/jshttp/fresh/master.svg +[travis-url]: https://travis-ci.org/jshttp/fresh +[coveralls-image]: https://img.shields.io/coveralls/jshttp/fresh/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/fresh?branch=master +[downloads-image]: https://img.shields.io/npm/dm/fresh.svg +[downloads-url]: https://npmjs.org/package/fresh diff --git a/8 node/node_modules/fresh/index.js b/8 node/node_modules/fresh/index.js new file mode 100644 index 000000000..bd9812ef3 --- /dev/null +++ b/8 node/node_modules/fresh/index.js @@ -0,0 +1,81 @@ +/*! + * fresh + * Copyright(c) 2012 TJ Holowaychuk + * Copyright(c) 2016-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * RegExp to check for no-cache token in Cache-Control. + * @private + */ + +var CACHE_CONTROL_NO_CACHE_REGEXP = /(?:^|,)\s*?no-cache\s*?(?:,|$)/ + +/** + * Simple expression to split token list. + * @private + */ + +var TOKEN_LIST_REGEXP = / *, */ + +/** + * Module exports. + * @public + */ + +module.exports = fresh + +/** + * Check freshness of the response using request and response headers. + * + * @param {Object} reqHeaders + * @param {Object} resHeaders + * @return {Boolean} + * @public + */ + +function fresh (reqHeaders, resHeaders) { + // fields + var modifiedSince = reqHeaders['if-modified-since'] + var noneMatch = reqHeaders['if-none-match'] + + // unconditional request + if (!modifiedSince && !noneMatch) { + return false + } + + // Always return stale when Cache-Control: no-cache + // to support end-to-end reload requests + // https://tools.ietf.org/html/rfc2616#section-14.9.4 + var cacheControl = reqHeaders['cache-control'] + if (cacheControl && CACHE_CONTROL_NO_CACHE_REGEXP.test(cacheControl)) { + return false + } + + // if-none-match + if (noneMatch && noneMatch !== '*') { + var etag = resHeaders['etag'] + var etagStale = !etag || noneMatch.split(TOKEN_LIST_REGEXP).every(function (match) { + return match !== etag && match !== 'W/' + etag && 'W/' + match !== etag + }) + + if (etagStale) { + return false + } + } + + // if-modified-since + if (modifiedSince) { + var lastModified = resHeaders['last-modified'] + var modifiedStale = !lastModified || Date.parse(lastModified) > Date.parse(modifiedSince) + + if (modifiedStale) { + return false + } + } + + return true +} diff --git a/8 node/node_modules/fresh/package.json b/8 node/node_modules/fresh/package.json new file mode 100644 index 000000000..c20270b75 --- /dev/null +++ b/8 node/node_modules/fresh/package.json @@ -0,0 +1,84 @@ +{ + "_from": "fresh@0.5.0", + "_id": "fresh@0.5.0", + "_inBundle": false, + "_integrity": "sha1-9HTKXmqSRtb9jglTz6m5yAWvp44=", + "_location": "/fresh", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "fresh@0.5.0", + "name": "fresh", + "escapedName": "fresh", + "rawSpec": "0.5.0", + "saveSpec": null, + "fetchSpec": "0.5.0" + }, + "_requiredBy": [ + "/express", + "/send" + ], + "_resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.0.tgz", + "_shasum": "f474ca5e6a9246d6fd8e0953cfa9b9c805afa78e", + "_spec": "fresh@0.5.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + }, + "bugs": { + "url": "https://github.com/jshttp/fresh/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "deprecated": false, + "description": "HTTP response freshness testing", + "devDependencies": { + "eslint": "3.16.0", + "eslint-config-standard": "6.2.1", + "eslint-plugin-promise": "3.4.2", + "eslint-plugin-standard": "2.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "homepage": "https://github.com/jshttp/fresh#readme", + "keywords": [ + "fresh", + "http", + "conditional", + "cache" + ], + "license": "MIT", + "name": "fresh", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/fresh.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.5.0" +} diff --git a/8 node/node_modules/http-errors/HISTORY.md b/8 node/node_modules/http-errors/HISTORY.md new file mode 100644 index 000000000..94b6b29a9 --- /dev/null +++ b/8 node/node_modules/http-errors/HISTORY.md @@ -0,0 +1,118 @@ +2017-02-20 / 1.6.1 +================== + + * deps: setprototypeof@1.0.3 + - Fix shim for old browsers + +2017-02-14 / 1.6.0 +================== + + * Accept custom 4xx and 5xx status codes in factory + * Add deprecation message to `"I'mateapot"` export + * Deprecate passing status code as anything except first argument in factory + * Deprecate using non-error status codes + * Make `message` property enumerable for `HttpError`s + +2016-11-16 / 1.5.1 +================== + + * deps: inherits@2.0.3 + - Fix issue loading in browser + * deps: setprototypeof@1.0.2 + * deps: statuses@'>= 1.3.1 < 2' + +2016-05-18 / 1.5.0 +================== + + * Support new code `421 Misdirected Request` + * Use `setprototypeof` module to replace `__proto__` setting + * deps: statuses@'>= 1.3.0 < 2' + - Add `421 Misdirected Request` + - perf: enable strict mode + * perf: enable strict mode + +2016-01-28 / 1.4.0 +================== + + * Add `HttpError` export, for `err instanceof createError.HttpError` + * deps: inherits@2.0.1 + * deps: statuses@'>= 1.2.1 < 2' + - Fix message for status 451 + - Remove incorrect nginx status code + +2015-02-02 / 1.3.1 +================== + + * Fix regression where status can be overwritten in `createError` `props` + +2015-02-01 / 1.3.0 +================== + + * Construct errors using defined constructors from `createError` + * Fix error names that are not identifiers + - `createError["I'mateapot"]` is now `createError.ImATeapot` + * Set a meaningful `name` property on constructed errors + +2014-12-09 / 1.2.8 +================== + + * Fix stack trace from exported function + * Remove `arguments.callee` usage + +2014-10-14 / 1.2.7 +================== + + * Remove duplicate line + +2014-10-02 / 1.2.6 +================== + + * Fix `expose` to be `true` for `ClientError` constructor + +2014-09-28 / 1.2.5 +================== + + * deps: statuses@1 + +2014-09-21 / 1.2.4 +================== + + * Fix dependency version to work with old `npm`s + +2014-09-21 / 1.2.3 +================== + + * deps: statuses@~1.1.0 + +2014-09-21 / 1.2.2 +================== + + * Fix publish error + +2014-09-21 / 1.2.1 +================== + + * Support Node.js 0.6 + * Use `inherits` instead of `util` + +2014-09-09 / 1.2.0 +================== + + * Fix the way inheriting functions + * Support `expose` being provided in properties argument + +2014-09-08 / 1.1.0 +================== + + * Default status to 500 + * Support provided `error` to extend + +2014-09-08 / 1.0.1 +================== + + * Fix accepting string message + +2014-09-08 / 1.0.0 +================== + + * Initial release diff --git a/8 node/node_modules/http-errors/LICENSE b/8 node/node_modules/http-errors/LICENSE new file mode 100644 index 000000000..82af4df54 --- /dev/null +++ b/8 node/node_modules/http-errors/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com +Copyright (c) 2016 Douglas Christopher Wilson doug@somethingdoug.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/8 node/node_modules/http-errors/README.md b/8 node/node_modules/http-errors/README.md new file mode 100644 index 000000000..79663d82f --- /dev/null +++ b/8 node/node_modules/http-errors/README.md @@ -0,0 +1,135 @@ +# http-errors + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create HTTP errors for Express, Koa, Connect, etc. with ease. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install http-errors +``` + +## Example + +```js +var createError = require('http-errors') +var express = require('express') +var app = express() + +app.use(function (req, res, next) { + if (!req.user) return next(createError(401, 'Please login to view this page.')) + next() +}) +``` + +## API + +This is the current API, currently extracted from Koa and subject to change. + +All errors inherit from JavaScript `Error` and the exported `createError.HttpError`. + +### Error Properties + +- `expose` - can be used to signal if `message` should be sent to the client, + defaulting to `false` when `status` >= 500 +- `headers` - can be an object of header names to values to be sent to the + client, defaulting to `undefined`. When defined, the key names should all + be lower-cased +- `message` - the traditional error message, which should be kept short and all + single line +- `status` - the status code of the error, mirroring `statusCode` for general + compatibility +- `statusCode` - the status code of the error, defaulting to `500` + +### createError([status], [message], [properties]) + + + +```js +var err = createError(404, 'This video does not exist!') +``` + +- `status: 500` - the status code as a number +- `message` - the message of the error, defaulting to node's text for that status code. +- `properties` - custom properties to attach to the object + +### new createError\[code || name\](\[msg]\)) + + + +```js +var err = new createError.NotFound() +``` + +- `code` - the status code as a number +- `name` - the name of the error as a "bumpy case", i.e. `NotFound` or `InternalServerError`. + +#### List of all constructors + +|Status Code|Constructor Name | +|-----------|-----------------------------| +|400 |BadRequest | +|401 |Unauthorized | +|402 |PaymentRequired | +|403 |Forbidden | +|404 |NotFound | +|405 |MethodNotAllowed | +|406 |NotAcceptable | +|407 |ProxyAuthenticationRequired | +|408 |RequestTimeout | +|409 |Conflict | +|410 |Gone | +|411 |LengthRequired | +|412 |PreconditionFailed | +|413 |PayloadTooLarge | +|414 |URITooLong | +|415 |UnsupportedMediaType | +|416 |RangeNotSatisfiable | +|417 |ExpectationFailed | +|418 |ImATeapot | +|421 |MisdirectedRequest | +|422 |UnprocessableEntity | +|423 |Locked | +|424 |FailedDependency | +|425 |UnorderedCollection | +|426 |UpgradeRequired | +|428 |PreconditionRequired | +|429 |TooManyRequests | +|431 |RequestHeaderFieldsTooLarge | +|451 |UnavailableForLegalReasons | +|500 |InternalServerError | +|501 |NotImplemented | +|502 |BadGateway | +|503 |ServiceUnavailable | +|504 |GatewayTimeout | +|505 |HTTPVersionNotSupported | +|506 |VariantAlsoNegotiates | +|507 |InsufficientStorage | +|508 |LoopDetected | +|509 |BandwidthLimitExceeded | +|510 |NotExtended | +|511 |NetworkAuthenticationRequired| + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/http-errors.svg +[npm-url]: https://npmjs.org/package/http-errors +[node-version-image]: https://img.shields.io/node/v/http-errors.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/http-errors.svg +[travis-url]: https://travis-ci.org/jshttp/http-errors +[coveralls-image]: https://img.shields.io/coveralls/jshttp/http-errors.svg +[coveralls-url]: https://coveralls.io/r/jshttp/http-errors +[downloads-image]: https://img.shields.io/npm/dm/http-errors.svg +[downloads-url]: https://npmjs.org/package/http-errors diff --git a/8 node/node_modules/http-errors/index.js b/8 node/node_modules/http-errors/index.js new file mode 100644 index 000000000..9509303ed --- /dev/null +++ b/8 node/node_modules/http-errors/index.js @@ -0,0 +1,260 @@ +/*! + * http-errors + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var deprecate = require('depd')('http-errors') +var setPrototypeOf = require('setprototypeof') +var statuses = require('statuses') +var inherits = require('inherits') + +/** + * Module exports. + * @public + */ + +module.exports = createError +module.exports.HttpError = createHttpErrorConstructor() + +// Populate exports for all constructors +populateConstructorExports(module.exports, statuses.codes, module.exports.HttpError) + +/** + * Get the code class of a status code. + * @private + */ + +function codeClass (status) { + return Number(String(status).charAt(0) + '00') +} + +/** + * Create a new HTTP Error. + * + * @returns {Error} + * @public + */ + +function createError () { + // so much arity going on ~_~ + var err + var msg + var status = 500 + var props = {} + for (var i = 0; i < arguments.length; i++) { + var arg = arguments[i] + if (arg instanceof Error) { + err = arg + status = err.status || err.statusCode || status + continue + } + switch (typeof arg) { + case 'string': + msg = arg + break + case 'number': + status = arg + if (i !== 0) { + deprecate('non-first-argument status code; replace with createError(' + arg + ', ...)') + } + break + case 'object': + props = arg + break + } + } + + if (typeof status === 'number' && (status < 400 || status >= 600)) { + deprecate('non-error status code; use only 4xx or 5xx status codes') + } + + if (typeof status !== 'number' || + (!statuses[status] && (status < 400 || status >= 600))) { + status = 500 + } + + // constructor + var HttpError = createError[status] || createError[codeClass(status)] + + if (!err) { + // create error + err = HttpError + ? new HttpError(msg) + : new Error(msg || statuses[status]) + Error.captureStackTrace(err, createError) + } + + if (!HttpError || !(err instanceof HttpError) || err.status !== status) { + // add properties to generic error + err.expose = status < 500 + err.status = err.statusCode = status + } + + for (var key in props) { + if (key !== 'status' && key !== 'statusCode') { + err[key] = props[key] + } + } + + return err +} + +/** + * Create HTTP error abstract base class. + * @private + */ + +function createHttpErrorConstructor () { + function HttpError () { + throw new TypeError('cannot construct abstract class') + } + + inherits(HttpError, Error) + + return HttpError +} + +/** + * Create a constructor for a client error. + * @private + */ + +function createClientErrorConstructor (HttpError, name, code) { + var className = name.match(/Error$/) ? name : name + 'Error' + + function ClientError (message) { + // create the error object + var msg = message != null ? message : statuses[code] + var err = new Error(msg) + + // capture a stack trace to the construction point + Error.captureStackTrace(err, ClientError) + + // adjust the [[Prototype]] + setPrototypeOf(err, ClientError.prototype) + + // redefine the error message + Object.defineProperty(err, 'message', { + enumerable: true, + configurable: true, + value: msg, + writable: true + }) + + // redefine the error name + Object.defineProperty(err, 'name', { + enumerable: false, + configurable: true, + value: className, + writable: true + }) + + return err + } + + inherits(ClientError, HttpError) + + ClientError.prototype.status = code + ClientError.prototype.statusCode = code + ClientError.prototype.expose = true + + return ClientError +} + +/** + * Create a constructor for a server error. + * @private + */ + +function createServerErrorConstructor (HttpError, name, code) { + var className = name.match(/Error$/) ? name : name + 'Error' + + function ServerError (message) { + // create the error object + var msg = message != null ? message : statuses[code] + var err = new Error(msg) + + // capture a stack trace to the construction point + Error.captureStackTrace(err, ServerError) + + // adjust the [[Prototype]] + setPrototypeOf(err, ServerError.prototype) + + // redefine the error message + Object.defineProperty(err, 'message', { + enumerable: true, + configurable: true, + value: msg, + writable: true + }) + + // redefine the error name + Object.defineProperty(err, 'name', { + enumerable: false, + configurable: true, + value: className, + writable: true + }) + + return err + } + + inherits(ServerError, HttpError) + + ServerError.prototype.status = code + ServerError.prototype.statusCode = code + ServerError.prototype.expose = false + + return ServerError +} + +/** + * Populate the exports object with constructors for every error class. + * @private + */ + +function populateConstructorExports (exports, codes, HttpError) { + codes.forEach(function forEachCode (code) { + var CodeError + var name = toIdentifier(statuses[code]) + + switch (codeClass(code)) { + case 400: + CodeError = createClientErrorConstructor(HttpError, name, code) + break + case 500: + CodeError = createServerErrorConstructor(HttpError, name, code) + break + } + + if (CodeError) { + // export the constructor + exports[code] = CodeError + exports[name] = CodeError + } + }) + + // backwards-compatibility + exports["I'mateapot"] = deprecate.function(exports.ImATeapot, + '"I\'mateapot"; use "ImATeapot" instead') +} + +/** + * Convert a string of words to a JavaScript identifier. + * @private + */ + +function toIdentifier (str) { + return str.split(' ').map(function (token) { + return token.slice(0, 1).toUpperCase() + token.slice(1) + }).join('').replace(/[^ _0-9a-z]/gi, '') +} diff --git a/8 node/node_modules/http-errors/package.json b/8 node/node_modules/http-errors/package.json new file mode 100644 index 000000000..2a21daabe --- /dev/null +++ b/8 node/node_modules/http-errors/package.json @@ -0,0 +1,88 @@ +{ + "_from": "http-errors@~1.6.1", + "_id": "http-errors@1.6.1", + "_inBundle": false, + "_integrity": "sha1-X4uO2YrKVFZWv1cplzh/kEpyIlc=", + "_location": "/http-errors", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "http-errors@~1.6.1", + "name": "http-errors", + "escapedName": "http-errors", + "rawSpec": "~1.6.1", + "saveSpec": null, + "fetchSpec": "~1.6.1" + }, + "_requiredBy": [ + "/send" + ], + "_resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.6.1.tgz", + "_shasum": "5f8b8ed98aca545656bf572997387f904a722257", + "_spec": "http-errors@~1.6.1", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/send", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/jshttp/http-errors/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Alan Plum", + "email": "me@pluma.io" + }, + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "dependencies": { + "depd": "1.1.0", + "inherits": "2.0.3", + "setprototypeof": "1.0.3", + "statuses": ">= 1.3.1 < 2" + }, + "deprecated": false, + "description": "Create HTTP error objects", + "devDependencies": { + "eslint": "3.16.0", + "eslint-config-standard": "6.2.1", + "eslint-plugin-markdown": "1.0.0-beta.3", + "eslint-plugin-promise": "3.4.2", + "eslint-plugin-standard": "2.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "index.js", + "HISTORY.md", + "LICENSE", + "README.md" + ], + "homepage": "https://github.com/jshttp/http-errors#readme", + "keywords": [ + "http", + "error" + ], + "license": "MIT", + "name": "http-errors", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/http-errors.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot" + }, + "version": "1.6.1" +} diff --git a/8 node/node_modules/inherits/LICENSE b/8 node/node_modules/inherits/LICENSE new file mode 100644 index 000000000..dea3013d6 --- /dev/null +++ b/8 node/node_modules/inherits/LICENSE @@ -0,0 +1,16 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM +LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR +OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR +PERFORMANCE OF THIS SOFTWARE. + diff --git a/8 node/node_modules/inherits/README.md b/8 node/node_modules/inherits/README.md new file mode 100644 index 000000000..b1c566585 --- /dev/null +++ b/8 node/node_modules/inherits/README.md @@ -0,0 +1,42 @@ +Browser-friendly inheritance fully compatible with standard node.js +[inherits](http://nodejs.org/api/util.html#util_util_inherits_constructor_superconstructor). + +This package exports standard `inherits` from node.js `util` module in +node environment, but also provides alternative browser-friendly +implementation through [browser +field](https://gist.github.com/shtylman/4339901). Alternative +implementation is a literal copy of standard one located in standalone +module to avoid requiring of `util`. It also has a shim for old +browsers with no `Object.create` support. + +While keeping you sure you are using standard `inherits` +implementation in node.js environment, it allows bundlers such as +[browserify](https://github.com/substack/node-browserify) to not +include full `util` package to your client code if all you need is +just `inherits` function. It worth, because browser shim for `util` +package is large and `inherits` is often the single function you need +from it. + +It's recommended to use this package instead of +`require('util').inherits` for any code that has chances to be used +not only in node.js but in browser too. + +## usage + +```js +var inherits = require('inherits'); +// then use exactly as the standard one +``` + +## note on version ~1.0 + +Version ~1.0 had completely different motivation and is not compatible +neither with 2.0 nor with standard node.js `inherits`. + +If you are using version ~1.0 and planning to switch to ~2.0, be +careful: + +* new version uses `super_` instead of `super` for referencing + superclass +* new version overwrites current prototype while old one preserves any + existing fields on it diff --git a/8 node/node_modules/inherits/inherits.js b/8 node/node_modules/inherits/inherits.js new file mode 100644 index 000000000..3b94763a7 --- /dev/null +++ b/8 node/node_modules/inherits/inherits.js @@ -0,0 +1,7 @@ +try { + var util = require('util'); + if (typeof util.inherits !== 'function') throw ''; + module.exports = util.inherits; +} catch (e) { + module.exports = require('./inherits_browser.js'); +} diff --git a/8 node/node_modules/inherits/inherits_browser.js b/8 node/node_modules/inherits/inherits_browser.js new file mode 100644 index 000000000..c1e78a75e --- /dev/null +++ b/8 node/node_modules/inherits/inherits_browser.js @@ -0,0 +1,23 @@ +if (typeof Object.create === 'function') { + // implementation from standard node.js 'util' module + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + ctor.prototype = Object.create(superCtor.prototype, { + constructor: { + value: ctor, + enumerable: false, + writable: true, + configurable: true + } + }); + }; +} else { + // old school shim for old browsers + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + var TempCtor = function () {} + TempCtor.prototype = superCtor.prototype + ctor.prototype = new TempCtor() + ctor.prototype.constructor = ctor + } +} diff --git a/8 node/node_modules/inherits/package.json b/8 node/node_modules/inherits/package.json new file mode 100644 index 000000000..d0116f702 --- /dev/null +++ b/8 node/node_modules/inherits/package.json @@ -0,0 +1,61 @@ +{ + "_from": "inherits@2.0.3", + "_id": "inherits@2.0.3", + "_inBundle": false, + "_integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=", + "_location": "/inherits", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "inherits@2.0.3", + "name": "inherits", + "escapedName": "inherits", + "rawSpec": "2.0.3", + "saveSpec": null, + "fetchSpec": "2.0.3" + }, + "_requiredBy": [ + "/http-errors" + ], + "_resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "_shasum": "633c2c83e3da42a502f52466022480f4208261de", + "_spec": "inherits@2.0.3", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/http-errors", + "browser": "./inherits_browser.js", + "bugs": { + "url": "https://github.com/isaacs/inherits/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Browser-friendly inheritance fully compatible with standard node.js inherits()", + "devDependencies": { + "tap": "^7.1.0" + }, + "files": [ + "inherits.js", + "inherits_browser.js" + ], + "homepage": "https://github.com/isaacs/inherits#readme", + "keywords": [ + "inheritance", + "class", + "klass", + "oop", + "object-oriented", + "inherits", + "browser", + "browserify" + ], + "license": "ISC", + "main": "./inherits.js", + "name": "inherits", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/inherits.git" + }, + "scripts": { + "test": "node test" + }, + "version": "2.0.3" +} diff --git a/8 node/node_modules/ipaddr.js/.npmignore b/8 node/node_modules/ipaddr.js/.npmignore new file mode 100644 index 000000000..7a1537ba0 --- /dev/null +++ b/8 node/node_modules/ipaddr.js/.npmignore @@ -0,0 +1,2 @@ +.idea +node_modules diff --git a/8 node/node_modules/ipaddr.js/.travis.yml b/8 node/node_modules/ipaddr.js/.travis.yml new file mode 100644 index 000000000..aa3d14acc --- /dev/null +++ b/8 node/node_modules/ipaddr.js/.travis.yml @@ -0,0 +1,10 @@ +language: node_js + +node_js: + - "0.10" + - "0.11" + - "0.12" + - "4.0" + - "4.1" + - "4.2" + - "5" diff --git a/8 node/node_modules/ipaddr.js/Cakefile b/8 node/node_modules/ipaddr.js/Cakefile new file mode 100644 index 000000000..7fd355a7b --- /dev/null +++ b/8 node/node_modules/ipaddr.js/Cakefile @@ -0,0 +1,18 @@ +fs = require 'fs' +CoffeeScript = require 'coffee-script' +nodeunit = require 'nodeunit' +UglifyJS = require 'uglify-js' + +task 'build', 'build the JavaScript files from CoffeeScript source', build = (cb) -> + source = fs.readFileSync 'src/ipaddr.coffee' + fs.writeFileSync 'lib/ipaddr.js', CoffeeScript.compile source.toString() + + invoke 'test' + invoke 'compress' + +task 'test', 'run the bundled tests', (cb) -> + nodeunit.reporters.default.run ['test'] + +task 'compress', 'uglify the resulting javascript', (cb) -> + result = UglifyJS.minify('lib/ipaddr.js') + fs.writeFileSync('ipaddr.min.js', result.code) diff --git a/8 node/node_modules/ipaddr.js/LICENSE b/8 node/node_modules/ipaddr.js/LICENSE new file mode 100644 index 000000000..3493f0dfc --- /dev/null +++ b/8 node/node_modules/ipaddr.js/LICENSE @@ -0,0 +1,19 @@ +Copyright (C) 2011 Peter Zotov + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/8 node/node_modules/ipaddr.js/README.md b/8 node/node_modules/ipaddr.js/README.md new file mode 100644 index 000000000..1d2b42dc8 --- /dev/null +++ b/8 node/node_modules/ipaddr.js/README.md @@ -0,0 +1,211 @@ +# ipaddr.js — an IPv6 and IPv4 address manipulation library [![Build Status](https://travis-ci.org/whitequark/ipaddr.js.svg)](https://travis-ci.org/whitequark/ipaddr.js) + +ipaddr.js is a small (1.9K minified and gzipped) library for manipulating +IP addresses in JavaScript environments. It runs on both CommonJS runtimes +(e.g. [nodejs]) and in a web browser. + +ipaddr.js allows you to verify and parse string representation of an IP +address, match it against a CIDR range or range list, determine if it falls +into some reserved ranges (examples include loopback and private ranges), +and convert between IPv4 and IPv4-mapped IPv6 addresses. + +[nodejs]: http://nodejs.org + +## Installation + +`npm install ipaddr.js` + +or + +`bower install ipaddr.js` + +## API + +ipaddr.js defines one object in the global scope: `ipaddr`. In CommonJS, +it is exported from the module: + +```js +var ipaddr = require('ipaddr.js'); +``` + +The API consists of several global methods and two classes: ipaddr.IPv6 and ipaddr.IPv4. + +### Global methods + +There are three global methods defined: `ipaddr.isValid`, `ipaddr.parse` and +`ipaddr.process`. All of them receive a string as a single parameter. + +The `ipaddr.isValid` method returns `true` if the address is a valid IPv4 or +IPv6 address, and `false` otherwise. It does not throw any exceptions. + +The `ipaddr.parse` method returns an object representing the IP address, +or throws an `Error` if the passed string is not a valid representation of an +IP address. + +The `ipaddr.process` method works just like the `ipaddr.parse` one, but it +automatically converts IPv4-mapped IPv6 addresses to their IPv4 couterparts +before returning. It is useful when you have a Node.js instance listening +on an IPv6 socket, and the `net.ivp6.bindv6only` sysctl parameter (or its +equivalent on non-Linux OS) is set to 0. In this case, you can accept IPv4 +connections on your IPv6-only socket, but the remote address will be mangled. +Use `ipaddr.process` method to automatically demangle it. + +### Object representation + +Parsing methods return an object which descends from `ipaddr.IPv6` or +`ipaddr.IPv4`. These objects share some properties, but most of them differ. + +#### Shared properties + +One can determine the type of address by calling `addr.kind()`. It will return +either `"ipv6"` or `"ipv4"`. + +An address can be converted back to its string representation with `addr.toString()`. +Note that this method: + * does not return the original string used to create the object (in fact, there is + no way of getting that string) + * returns a compact representation (when it is applicable) + +A `match(range, bits)` method can be used to check if the address falls into a +certain CIDR range. +Note that an address can be (obviously) matched only against an address of the same type. + +For example: + +```js +var addr = ipaddr.parse("2001:db8:1234::1"); +var range = ipaddr.parse("2001:db8::"); + +addr.match(range, 32); // => true +``` + +Alternatively, `match` can also be called as `match([range, bits])`. In this way, +it can be used together with the `parseCIDR(string)` method, which parses an IP +address together with a CIDR range. + +For example: + +```js +var addr = ipaddr.parse("2001:db8:1234::1"); + +addr.match(ipaddr.parseCIDR("2001:db8::/32")); // => true +``` + +A `range()` method returns one of predefined names for several special ranges defined +by IP protocols. The exact names (and their respective CIDR ranges) can be looked up +in the source: [IPv6 ranges] and [IPv4 ranges]. Some common ones include `"unicast"` +(the default one) and `"reserved"`. + +You can match against your own range list by using +`ipaddr.subnetMatch(address, rangeList, defaultName)` method. It can work with both +IPv6 and IPv4 addresses, and accepts a name-to-subnet map as the range list. For example: + +```js +var rangeList = { + documentationOnly: [ ipaddr.parse('2001:db8::'), 32 ], + tunnelProviders: [ + [ ipaddr.parse('2001:470::'), 32 ], // he.net + [ ipaddr.parse('2001:5c0::'), 32 ] // freenet6 + ] +}; +ipaddr.subnetMatch(ipaddr.parse('2001:470:8:66::1'), rangeList, 'unknown'); // => "he.net" +``` + +The addresses can be converted to their byte representation with `toByteArray()`. +(Actually, JavaScript mostly does not know about byte buffers. They are emulated with +arrays of numbers, each in range of 0..255.) + +```js +var bytes = ipaddr.parse('2a00:1450:8007::68').toByteArray(); // ipv6.google.com +bytes // => [42, 0x00, 0x14, 0x50, 0x80, 0x07, 0x00, , 0x00, 0x68 ] +``` + +The `ipaddr.IPv4` and `ipaddr.IPv6` objects have some methods defined, too. All of them +have the same interface for both protocols, and are similar to global methods. + +`ipaddr.IPvX.isValid(string)` can be used to check if the string is a valid address +for particular protocol, and `ipaddr.IPvX.parse(string)` is the error-throwing parser. + +`ipaddr.IPvX.isValid(string)` uses the same format for parsing as the POSIX `inet_ntoa` function, which accepts unusual formats like `0xc0.168.1.1` or `0x10000000`. The function `ipaddr.IPv4.isValidFourPartDecimal(string)` validates the IPv4 address and also ensures that it is written in four-part decimal format. + +[IPv6 ranges]: https://github.com/whitequark/ipaddr.js/blob/master/src/ipaddr.coffee#L186 +[IPv4 ranges]: https://github.com/whitequark/ipaddr.js/blob/master/src/ipaddr.coffee#L71 + +#### IPv6 properties + +Sometimes you will want to convert IPv6 not to a compact string representation (with +the `::` substitution); the `toNormalizedString()` method will return an address where +all zeroes are explicit. + +For example: + +```js +var addr = ipaddr.parse("2001:0db8::0001"); +addr.toString(); // => "2001:db8::1" +addr.toNormalizedString(); // => "2001:db8:0:0:0:0:0:1" +``` + +The `isIPv4MappedAddress()` method will return `true` if this address is an IPv4-mapped +one, and `toIPv4Address()` will return an IPv4 object address. + +To access the underlying binary representation of the address, use `addr.parts`. + +```js +var addr = ipaddr.parse("2001:db8:10::1234:DEAD"); +addr.parts // => [0x2001, 0xdb8, 0x10, 0, 0, 0, 0x1234, 0xdead] +``` + +#### IPv4 properties + +`toIPv4MappedAddress()` will return a corresponding IPv4-mapped IPv6 address. + +To access the underlying representation of the address, use `addr.octets`. + +```js +var addr = ipaddr.parse("192.168.1.1"); +addr.octets // => [192, 168, 1, 1] +``` + +`prefixLengthFromSubnetMask()` will return a CIDR prefix length for a valid IPv4 netmask or +false if the netmask is not valid. + +```js +ipaddr.IPv4.parse('255.255.255.240').prefixLengthFromSubnetMask() == 28 +ipaddr.IPv4.parse('255.192.164.0').prefixLengthFromSubnetMask() == null +``` + +#### Conversion + +IPv4 and IPv6 can be converted bidirectionally to and from network byte order (MSB) byte arrays. + +The `fromByteArray()` method will take an array and create an appropriate IPv4 or IPv6 object +if the input satisfies the requirements. For IPv4 it has to be an array of four 8-bit values, +while for IPv6 it has to be an array of sixteen 8-bit values. + +For example: +```js +var addr = ipaddr.fromByteArray([0x7f, 0, 0, 1]); +addr.toString(); // => "127.0.0.1" +``` + +or + +```js +var addr = ipaddr.fromByteArray([0x20, 1, 0xd, 0xb8, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]) +addr.toString(); // => "2001:db8::1" +``` + +Both objects also offer a `toByteArray()` method, which returns an array in network byte order (MSB). + +For example: +```js +var addr = ipaddr.parse("127.0.0.1"); +addr.toByteArray(); // => [0x7f, 0, 0, 1] +``` + +or + +```js +var addr = ipaddr.parse("2001:db8::1"); +addr.toByteArray(); // => [0x20, 1, 0xd, 0xb8, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1] +``` diff --git a/8 node/node_modules/ipaddr.js/bower.json b/8 node/node_modules/ipaddr.js/bower.json new file mode 100644 index 000000000..2f5093e95 --- /dev/null +++ b/8 node/node_modules/ipaddr.js/bower.json @@ -0,0 +1,29 @@ +{ + "name": "ipaddr.js", + "version": "1.3.0", + "homepage": "https://github.com/whitequark/ipaddr.js", + "authors": [ + "whitequark " + ], + "description": "IP address manipulation library in JavaScript (CoffeeScript, actually)", + "main": "lib/ipaddr.js", + "moduleType": [ + "globals", + "node" + ], + "keywords": [ + "javscript", + "ip", + "address", + "ipv4", + "ipv6" + ], + "license": "MIT", + "ignore": [ + "**/.*", + "node_modules", + "bower_components", + "test", + "tests" + ] +} diff --git a/8 node/node_modules/ipaddr.js/ipaddr.min.js b/8 node/node_modules/ipaddr.js/ipaddr.min.js new file mode 100644 index 000000000..d90a4804a --- /dev/null +++ b/8 node/node_modules/ipaddr.js/ipaddr.min.js @@ -0,0 +1 @@ +(function(){var r,t,n,e,i,o,a,s;t={},s=this,"undefined"!=typeof module&&null!==module&&module.exports?module.exports=t:s.ipaddr=t,a=function(r,t,n,e){var i,o;if(r.length!==t.length)throw new Error("ipaddr: cannot match CIDR for objects with different lengths");for(i=0;e>0;){if(o=n-e,o<0&&(o=0),r[i]>>o!=t[i]>>o)return!1;e-=n,i+=1}return!0},t.subnetMatch=function(r,t,n){var e,i,o,a,s;null==n&&(n="unicast");for(e in t)for(i=t[e],!i[0]||i[0]instanceof Array||(i=[i]),a=0,s=i.length;a=0;t=a+=-1){if(!((n=this.octets[t])in o))return null;if(i=o[n],e&&0!==i)return null;8!==i&&(e=!0),r+=i}return 32-r},r}(),n="(0?\\d+|0x[a-f0-9]+)",e={fourOctet:new RegExp("^"+n+"\\."+n+"\\."+n+"\\."+n+"$","i"),longValue:new RegExp("^"+n+"$","i")},t.IPv4.parser=function(r){var t,n,i,o,a;if(n=function(r){return"0"===r[0]&&"x"!==r[1]?parseInt(r,8):parseInt(r)},t=r.match(e.fourOctet))return function(){var r,e,o,a;for(o=t.slice(1,6),a=[],r=0,e=o.length;r4294967295||a<0)throw new Error("ipaddr: address outside defined range");return function(){var r,t;for(t=[],o=r=0;r<=24;o=r+=8)t.push(a>>o&255);return t}().reverse()}return null},t.IPv6=function(){function r(r){var t,n,e,i,o,a;if(16===r.length)for(this.parts=[],t=e=0;e<=14;t=e+=2)this.parts.push(r[t]<<8|r[t+1]);else{if(8!==r.length)throw new Error("ipaddr: ipv6 part count should be 8 or 16");this.parts=r}for(a=this.parts,i=0,o=a.length;i>8),r.push(255&t);return r},r.prototype.toNormalizedString=function(){var r;return function(){var t,n,e,i;for(e=this.parts,i=[],t=0,n=e.length;t>8,255&r,n>>8,255&n])},r}(),i="(?:[0-9a-f]+::?)+",o={native:new RegExp("^(::)?("+i+")?([0-9a-f]+)?(::)?$","i"),transitional:new RegExp("^((?:"+i+")|(?:::)(?:"+i+")?)"+n+"\\."+n+"\\."+n+"\\."+n+"$","i")},r=function(r,t){var n,e,i,o,a;if(r.indexOf("::")!==r.lastIndexOf("::"))return null;for(n=0,e=-1;(e=r.indexOf(":",e+1))>=0;)n++;if("::"===r.substr(0,2)&&n--,"::"===r.substr(-2,2)&&n--,n>t)return null;for(a=t-n,o=":";a--;)o+="0:";return r=r.replace("::",o),":"===r[0]&&(r=r.slice(1)),":"===r[r.length-1]&&(r=r.slice(0,-1)),function(){var t,n,e,o;for(e=r.split(":"),o=[],t=0,n=e.length;t=0&&t<=32)return[this.parse(n[1]),t];throw new Error("ipaddr: string is not formatted like an IPv4 CIDR range")},t.IPv6.parseCIDR=function(r){var t,n;if((n=r.match(/^(.+)\/(\d+)$/))&&(t=parseInt(n[2]))>=0&&t<=128)return[this.parse(n[1]),t];throw new Error("ipaddr: string is not formatted like an IPv6 CIDR range")},t.isValid=function(r){return t.IPv6.isValid(r)||t.IPv4.isValid(r)},t.parse=function(r){if(t.IPv6.isValid(r))return t.IPv6.parse(r);if(t.IPv4.isValid(r))return t.IPv4.parse(r);throw new Error("ipaddr: the address has neither IPv6 nor IPv4 format")},t.parseCIDR=function(r){try{return t.IPv6.parseCIDR(r)}catch(n){n;try{return t.IPv4.parseCIDR(r)}catch(r){throw r,new Error("ipaddr: the address has neither IPv6 nor IPv4 CIDR format")}}},t.fromByteArray=function(r){var n;if(4===(n=r.length))return new t.IPv4(r);if(16===n)return new t.IPv6(r);throw new Error("ipaddr: the binary input is neither an IPv6 nor IPv4 address")},t.process=function(r){var t;return t=this.parse(r),"ipv6"===t.kind()&&t.isIPv4MappedAddress()?t.toIPv4Address():t}}).call(this); \ No newline at end of file diff --git a/8 node/node_modules/ipaddr.js/lib/ipaddr.js b/8 node/node_modules/ipaddr.js/lib/ipaddr.js new file mode 100644 index 000000000..8bef4077a --- /dev/null +++ b/8 node/node_modules/ipaddr.js/lib/ipaddr.js @@ -0,0 +1,535 @@ +(function() { + var expandIPv6, ipaddr, ipv4Part, ipv4Regexes, ipv6Part, ipv6Regexes, matchCIDR, root; + + ipaddr = {}; + + root = this; + + if ((typeof module !== "undefined" && module !== null) && module.exports) { + module.exports = ipaddr; + } else { + root['ipaddr'] = ipaddr; + } + + matchCIDR = function(first, second, partSize, cidrBits) { + var part, shift; + if (first.length !== second.length) { + throw new Error("ipaddr: cannot match CIDR for objects with different lengths"); + } + part = 0; + while (cidrBits > 0) { + shift = partSize - cidrBits; + if (shift < 0) { + shift = 0; + } + if (first[part] >> shift !== second[part] >> shift) { + return false; + } + cidrBits -= partSize; + part += 1; + } + return true; + }; + + ipaddr.subnetMatch = function(address, rangeList, defaultName) { + var rangeName, rangeSubnets, subnet, _i, _len; + if (defaultName == null) { + defaultName = 'unicast'; + } + for (rangeName in rangeList) { + rangeSubnets = rangeList[rangeName]; + if (rangeSubnets[0] && !(rangeSubnets[0] instanceof Array)) { + rangeSubnets = [rangeSubnets]; + } + for (_i = 0, _len = rangeSubnets.length; _i < _len; _i++) { + subnet = rangeSubnets[_i]; + if (address.match.apply(address, subnet)) { + return rangeName; + } + } + } + return defaultName; + }; + + ipaddr.IPv4 = (function() { + function IPv4(octets) { + var octet, _i, _len; + if (octets.length !== 4) { + throw new Error("ipaddr: ipv4 octet count should be 4"); + } + for (_i = 0, _len = octets.length; _i < _len; _i++) { + octet = octets[_i]; + if (!((0 <= octet && octet <= 255))) { + throw new Error("ipaddr: ipv4 octet should fit in 8 bits"); + } + } + this.octets = octets; + } + + IPv4.prototype.kind = function() { + return 'ipv4'; + }; + + IPv4.prototype.toString = function() { + return this.octets.join("."); + }; + + IPv4.prototype.toByteArray = function() { + return this.octets.slice(0); + }; + + IPv4.prototype.match = function(other, cidrRange) { + var _ref; + if (cidrRange === void 0) { + _ref = other, other = _ref[0], cidrRange = _ref[1]; + } + if (other.kind() !== 'ipv4') { + throw new Error("ipaddr: cannot match ipv4 address with non-ipv4 one"); + } + return matchCIDR(this.octets, other.octets, 8, cidrRange); + }; + + IPv4.prototype.SpecialRanges = { + unspecified: [[new IPv4([0, 0, 0, 0]), 8]], + broadcast: [[new IPv4([255, 255, 255, 255]), 32]], + multicast: [[new IPv4([224, 0, 0, 0]), 4]], + linkLocal: [[new IPv4([169, 254, 0, 0]), 16]], + loopback: [[new IPv4([127, 0, 0, 0]), 8]], + carrierGradeNat: [[new IPv4([100, 64, 0, 0]), 10]], + "private": [[new IPv4([10, 0, 0, 0]), 8], [new IPv4([172, 16, 0, 0]), 12], [new IPv4([192, 168, 0, 0]), 16]], + reserved: [[new IPv4([192, 0, 0, 0]), 24], [new IPv4([192, 0, 2, 0]), 24], [new IPv4([192, 88, 99, 0]), 24], [new IPv4([198, 51, 100, 0]), 24], [new IPv4([203, 0, 113, 0]), 24], [new IPv4([240, 0, 0, 0]), 4]] + }; + + IPv4.prototype.range = function() { + return ipaddr.subnetMatch(this, this.SpecialRanges); + }; + + IPv4.prototype.toIPv4MappedAddress = function() { + return ipaddr.IPv6.parse("::ffff:" + (this.toString())); + }; + + IPv4.prototype.prefixLengthFromSubnetMask = function() { + var cidr, i, octet, stop, zeros, zerotable, _i; + zerotable = { + 0: 8, + 128: 7, + 192: 6, + 224: 5, + 240: 4, + 248: 3, + 252: 2, + 254: 1, + 255: 0 + }; + cidr = 0; + stop = false; + for (i = _i = 3; _i >= 0; i = _i += -1) { + octet = this.octets[i]; + if (octet in zerotable) { + zeros = zerotable[octet]; + if (stop && zeros !== 0) { + return null; + } + if (zeros !== 8) { + stop = true; + } + cidr += zeros; + } else { + return null; + } + } + return 32 - cidr; + }; + + return IPv4; + + })(); + + ipv4Part = "(0?\\d+|0x[a-f0-9]+)"; + + ipv4Regexes = { + fourOctet: new RegExp("^" + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "$", 'i'), + longValue: new RegExp("^" + ipv4Part + "$", 'i') + }; + + ipaddr.IPv4.parser = function(string) { + var match, parseIntAuto, part, shift, value; + parseIntAuto = function(string) { + if (string[0] === "0" && string[1] !== "x") { + return parseInt(string, 8); + } else { + return parseInt(string); + } + }; + if (match = string.match(ipv4Regexes.fourOctet)) { + return (function() { + var _i, _len, _ref, _results; + _ref = match.slice(1, 6); + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + part = _ref[_i]; + _results.push(parseIntAuto(part)); + } + return _results; + })(); + } else if (match = string.match(ipv4Regexes.longValue)) { + value = parseIntAuto(match[1]); + if (value > 0xffffffff || value < 0) { + throw new Error("ipaddr: address outside defined range"); + } + return ((function() { + var _i, _results; + _results = []; + for (shift = _i = 0; _i <= 24; shift = _i += 8) { + _results.push((value >> shift) & 0xff); + } + return _results; + })()).reverse(); + } else { + return null; + } + }; + + ipaddr.IPv6 = (function() { + function IPv6(parts) { + var i, part, _i, _j, _len, _ref; + if (parts.length === 16) { + this.parts = []; + for (i = _i = 0; _i <= 14; i = _i += 2) { + this.parts.push((parts[i] << 8) | parts[i + 1]); + } + } else if (parts.length === 8) { + this.parts = parts; + } else { + throw new Error("ipaddr: ipv6 part count should be 8 or 16"); + } + _ref = this.parts; + for (_j = 0, _len = _ref.length; _j < _len; _j++) { + part = _ref[_j]; + if (!((0 <= part && part <= 0xffff))) { + throw new Error("ipaddr: ipv6 part should fit in 16 bits"); + } + } + } + + IPv6.prototype.kind = function() { + return 'ipv6'; + }; + + IPv6.prototype.toString = function() { + var compactStringParts, part, pushPart, state, stringParts, _i, _len; + stringParts = (function() { + var _i, _len, _ref, _results; + _ref = this.parts; + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + part = _ref[_i]; + _results.push(part.toString(16)); + } + return _results; + }).call(this); + compactStringParts = []; + pushPart = function(part) { + return compactStringParts.push(part); + }; + state = 0; + for (_i = 0, _len = stringParts.length; _i < _len; _i++) { + part = stringParts[_i]; + switch (state) { + case 0: + if (part === '0') { + pushPart(''); + } else { + pushPart(part); + } + state = 1; + break; + case 1: + if (part === '0') { + state = 2; + } else { + pushPart(part); + } + break; + case 2: + if (part !== '0') { + pushPart(''); + pushPart(part); + state = 3; + } + break; + case 3: + pushPart(part); + } + } + if (state === 2) { + pushPart(''); + pushPart(''); + } + return compactStringParts.join(":"); + }; + + IPv6.prototype.toByteArray = function() { + var bytes, part, _i, _len, _ref; + bytes = []; + _ref = this.parts; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + part = _ref[_i]; + bytes.push(part >> 8); + bytes.push(part & 0xff); + } + return bytes; + }; + + IPv6.prototype.toNormalizedString = function() { + var part; + return ((function() { + var _i, _len, _ref, _results; + _ref = this.parts; + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + part = _ref[_i]; + _results.push(part.toString(16)); + } + return _results; + }).call(this)).join(":"); + }; + + IPv6.prototype.match = function(other, cidrRange) { + var _ref; + if (cidrRange === void 0) { + _ref = other, other = _ref[0], cidrRange = _ref[1]; + } + if (other.kind() !== 'ipv6') { + throw new Error("ipaddr: cannot match ipv6 address with non-ipv6 one"); + } + return matchCIDR(this.parts, other.parts, 16, cidrRange); + }; + + IPv6.prototype.SpecialRanges = { + unspecified: [new IPv6([0, 0, 0, 0, 0, 0, 0, 0]), 128], + linkLocal: [new IPv6([0xfe80, 0, 0, 0, 0, 0, 0, 0]), 10], + multicast: [new IPv6([0xff00, 0, 0, 0, 0, 0, 0, 0]), 8], + loopback: [new IPv6([0, 0, 0, 0, 0, 0, 0, 1]), 128], + uniqueLocal: [new IPv6([0xfc00, 0, 0, 0, 0, 0, 0, 0]), 7], + ipv4Mapped: [new IPv6([0, 0, 0, 0, 0, 0xffff, 0, 0]), 96], + rfc6145: [new IPv6([0, 0, 0, 0, 0xffff, 0, 0, 0]), 96], + rfc6052: [new IPv6([0x64, 0xff9b, 0, 0, 0, 0, 0, 0]), 96], + '6to4': [new IPv6([0x2002, 0, 0, 0, 0, 0, 0, 0]), 16], + teredo: [new IPv6([0x2001, 0, 0, 0, 0, 0, 0, 0]), 32], + reserved: [[new IPv6([0x2001, 0xdb8, 0, 0, 0, 0, 0, 0]), 32]] + }; + + IPv6.prototype.range = function() { + return ipaddr.subnetMatch(this, this.SpecialRanges); + }; + + IPv6.prototype.isIPv4MappedAddress = function() { + return this.range() === 'ipv4Mapped'; + }; + + IPv6.prototype.toIPv4Address = function() { + var high, low, _ref; + if (!this.isIPv4MappedAddress()) { + throw new Error("ipaddr: trying to convert a generic ipv6 address to ipv4"); + } + _ref = this.parts.slice(-2), high = _ref[0], low = _ref[1]; + return new ipaddr.IPv4([high >> 8, high & 0xff, low >> 8, low & 0xff]); + }; + + return IPv6; + + })(); + + ipv6Part = "(?:[0-9a-f]+::?)+"; + + ipv6Regexes = { + "native": new RegExp("^(::)?(" + ipv6Part + ")?([0-9a-f]+)?(::)?$", 'i'), + transitional: new RegExp(("^((?:" + ipv6Part + ")|(?:::)(?:" + ipv6Part + ")?)") + ("" + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "$"), 'i') + }; + + expandIPv6 = function(string, parts) { + var colonCount, lastColon, part, replacement, replacementCount; + if (string.indexOf('::') !== string.lastIndexOf('::')) { + return null; + } + colonCount = 0; + lastColon = -1; + while ((lastColon = string.indexOf(':', lastColon + 1)) >= 0) { + colonCount++; + } + if (string.substr(0, 2) === '::') { + colonCount--; + } + if (string.substr(-2, 2) === '::') { + colonCount--; + } + if (colonCount > parts) { + return null; + } + replacementCount = parts - colonCount; + replacement = ':'; + while (replacementCount--) { + replacement += '0:'; + } + string = string.replace('::', replacement); + if (string[0] === ':') { + string = string.slice(1); + } + if (string[string.length - 1] === ':') { + string = string.slice(0, -1); + } + return (function() { + var _i, _len, _ref, _results; + _ref = string.split(":"); + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + part = _ref[_i]; + _results.push(parseInt(part, 16)); + } + return _results; + })(); + }; + + ipaddr.IPv6.parser = function(string) { + var match, octet, octets, parts, _i, _len; + if (string.match(ipv6Regexes['native'])) { + return expandIPv6(string, 8); + } else if (match = string.match(ipv6Regexes['transitional'])) { + parts = expandIPv6(match[1].slice(0, -1), 6); + if (parts) { + octets = [parseInt(match[2]), parseInt(match[3]), parseInt(match[4]), parseInt(match[5])]; + for (_i = 0, _len = octets.length; _i < _len; _i++) { + octet = octets[_i]; + if (!((0 <= octet && octet <= 255))) { + return null; + } + } + parts.push(octets[0] << 8 | octets[1]); + parts.push(octets[2] << 8 | octets[3]); + return parts; + } + } + return null; + }; + + ipaddr.IPv4.isIPv4 = ipaddr.IPv6.isIPv6 = function(string) { + return this.parser(string) !== null; + }; + + ipaddr.IPv4.isValid = function(string) { + var e; + try { + new this(this.parser(string)); + return true; + } catch (_error) { + e = _error; + return false; + } + }; + + ipaddr.IPv4.isValidFourPartDecimal = function(string) { + if (ipaddr.IPv4.isValid(string) && string.match(/^\d+(\.\d+){3}$/)) { + return true; + } else { + return false; + } + }; + + ipaddr.IPv6.isValid = function(string) { + var e; + if (typeof string === "string" && string.indexOf(":") === -1) { + return false; + } + try { + new this(this.parser(string)); + return true; + } catch (_error) { + e = _error; + return false; + } + }; + + ipaddr.IPv4.parse = ipaddr.IPv6.parse = function(string) { + var parts; + parts = this.parser(string); + if (parts === null) { + throw new Error("ipaddr: string is not formatted like ip address"); + } + return new this(parts); + }; + + ipaddr.IPv4.parseCIDR = function(string) { + var maskLength, match; + if (match = string.match(/^(.+)\/(\d+)$/)) { + maskLength = parseInt(match[2]); + if (maskLength >= 0 && maskLength <= 32) { + return [this.parse(match[1]), maskLength]; + } + } + throw new Error("ipaddr: string is not formatted like an IPv4 CIDR range"); + }; + + ipaddr.IPv6.parseCIDR = function(string) { + var maskLength, match; + if (match = string.match(/^(.+)\/(\d+)$/)) { + maskLength = parseInt(match[2]); + if (maskLength >= 0 && maskLength <= 128) { + return [this.parse(match[1]), maskLength]; + } + } + throw new Error("ipaddr: string is not formatted like an IPv6 CIDR range"); + }; + + ipaddr.isValid = function(string) { + return ipaddr.IPv6.isValid(string) || ipaddr.IPv4.isValid(string); + }; + + ipaddr.parse = function(string) { + if (ipaddr.IPv6.isValid(string)) { + return ipaddr.IPv6.parse(string); + } else if (ipaddr.IPv4.isValid(string)) { + return ipaddr.IPv4.parse(string); + } else { + throw new Error("ipaddr: the address has neither IPv6 nor IPv4 format"); + } + }; + + ipaddr.parseCIDR = function(string) { + var e; + try { + return ipaddr.IPv6.parseCIDR(string); + } catch (_error) { + e = _error; + try { + return ipaddr.IPv4.parseCIDR(string); + } catch (_error) { + e = _error; + throw new Error("ipaddr: the address has neither IPv6 nor IPv4 CIDR format"); + } + } + }; + + ipaddr.fromByteArray = function(bytes) { + var length; + length = bytes.length; + if (length === 4) { + return new ipaddr.IPv4(bytes); + } else if (length === 16) { + return new ipaddr.IPv6(bytes); + } else { + throw new Error("ipaddr: the binary input is neither an IPv6 nor IPv4 address"); + } + }; + + ipaddr.process = function(string) { + var addr; + addr = this.parse(string); + if (addr.kind() === 'ipv6' && addr.isIPv4MappedAddress()) { + return addr.toIPv4Address(); + } else { + return addr; + } + }; + +}).call(this); diff --git a/8 node/node_modules/ipaddr.js/package.json b/8 node/node_modules/ipaddr.js/package.json new file mode 100644 index 000000000..4efdc2321 --- /dev/null +++ b/8 node/node_modules/ipaddr.js/package.json @@ -0,0 +1,64 @@ +{ + "_from": "ipaddr.js@1.3.0", + "_id": "ipaddr.js@1.3.0", + "_inBundle": false, + "_integrity": "sha1-HgOlL9rYOou7KyXL9JmLTP/NPew=", + "_location": "/ipaddr.js", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ipaddr.js@1.3.0", + "name": "ipaddr.js", + "escapedName": "ipaddr.js", + "rawSpec": "1.3.0", + "saveSpec": null, + "fetchSpec": "1.3.0" + }, + "_requiredBy": [ + "/proxy-addr" + ], + "_resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.3.0.tgz", + "_shasum": "1e03a52fdad83a8bbb2b25cbf4998b4cffcd3dec", + "_spec": "ipaddr.js@1.3.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/proxy-addr", + "author": { + "name": "whitequark", + "email": "whitequark@whitequark.org" + }, + "bugs": { + "url": "https://github.com/whitequark/ipaddr.js/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "A library for manipulating IPv4 and IPv6 addresses in JavaScript.", + "devDependencies": { + "coffee-script": "~1.6", + "nodeunit": ">=0.8.2 <0.8.7", + "uglify-js": "latest" + }, + "directories": { + "lib": "./lib" + }, + "engines": { + "node": ">= 0.10" + }, + "homepage": "https://github.com/whitequark/ipaddr.js#readme", + "keywords": [ + "ip", + "ipv4", + "ipv6" + ], + "license": "MIT", + "main": "./lib/ipaddr", + "name": "ipaddr.js", + "repository": { + "type": "git", + "url": "git://github.com/whitequark/ipaddr.js.git" + }, + "scripts": { + "test": "cake build test" + }, + "version": "1.3.0" +} diff --git a/8 node/node_modules/ipaddr.js/src/ipaddr.coffee b/8 node/node_modules/ipaddr.js/src/ipaddr.coffee new file mode 100644 index 000000000..941014c82 --- /dev/null +++ b/8 node/node_modules/ipaddr.js/src/ipaddr.coffee @@ -0,0 +1,460 @@ +# Define the main object +ipaddr = {} + +root = this + +# Export for both the CommonJS and browser-like environment +if module? && module.exports + module.exports = ipaddr +else + root['ipaddr'] = ipaddr + +# A generic CIDR (Classless Inter-Domain Routing) RFC1518 range matcher. +matchCIDR = (first, second, partSize, cidrBits) -> + if first.length != second.length + throw new Error "ipaddr: cannot match CIDR for objects with different lengths" + + part = 0 + while cidrBits > 0 + shift = partSize - cidrBits + shift = 0 if shift < 0 + + if first[part] >> shift != second[part] >> shift + return false + + cidrBits -= partSize + part += 1 + + return true + +# An utility function to ease named range matching. See examples below. +ipaddr.subnetMatch = (address, rangeList, defaultName='unicast') -> + for rangeName, rangeSubnets of rangeList + # ECMA5 Array.isArray isn't available everywhere + if rangeSubnets[0] && !(rangeSubnets[0] instanceof Array) + rangeSubnets = [ rangeSubnets ] + + for subnet in rangeSubnets + return rangeName if address.match.apply(address, subnet) + + return defaultName + +# An IPv4 address (RFC791). +class ipaddr.IPv4 + # Constructs a new IPv4 address from an array of four octets + # in network order (MSB first) + # Verifies the input. + constructor: (octets) -> + if octets.length != 4 + throw new Error "ipaddr: ipv4 octet count should be 4" + + for octet in octets + if !(0 <= octet <= 255) + throw new Error "ipaddr: ipv4 octet should fit in 8 bits" + + @octets = octets + + # The 'kind' method exists on both IPv4 and IPv6 classes. + kind: -> + return 'ipv4' + + # Returns the address in convenient, decimal-dotted format. + toString: -> + return @octets.join "." + + # Returns an array of byte-sized values in network order (MSB first) + toByteArray: -> + return @octets.slice(0) # octets.clone + + # Checks if this address matches other one within given CIDR range. + match: (other, cidrRange) -> + if cidrRange == undefined + [other, cidrRange] = other + + if other.kind() != 'ipv4' + throw new Error "ipaddr: cannot match ipv4 address with non-ipv4 one" + + return matchCIDR(this.octets, other.octets, 8, cidrRange) + + # Special IPv4 address ranges. + # See also https://en.wikipedia.org/wiki/Reserved_IP_addresses + SpecialRanges: + unspecified: [ + [ new IPv4([0, 0, 0, 0]), 8 ] + ] + broadcast: [ + [ new IPv4([255, 255, 255, 255]), 32 ] + ] + multicast: [ # RFC3171 + [ new IPv4([224, 0, 0, 0]), 4 ] + ] + linkLocal: [ # RFC3927 + [ new IPv4([169, 254, 0, 0]), 16 ] + ] + loopback: [ # RFC5735 + [ new IPv4([127, 0, 0, 0]), 8 ] + ] + carrierGradeNat: [ # RFC6598 + [ new IPv4([100, 64, 0, 0]), 10 ] + ] + private: [ # RFC1918 + [ new IPv4([10, 0, 0, 0]), 8 ] + [ new IPv4([172, 16, 0, 0]), 12 ] + [ new IPv4([192, 168, 0, 0]), 16 ] + ] + reserved: [ # Reserved and testing-only ranges; RFCs 5735, 5737, 2544, 1700 + [ new IPv4([192, 0, 0, 0]), 24 ] + [ new IPv4([192, 0, 2, 0]), 24 ] + [ new IPv4([192, 88, 99, 0]), 24 ] + [ new IPv4([198, 51, 100, 0]), 24 ] + [ new IPv4([203, 0, 113, 0]), 24 ] + [ new IPv4([240, 0, 0, 0]), 4 ] + ] + + # Checks if the address corresponds to one of the special ranges. + range: -> + return ipaddr.subnetMatch(this, @SpecialRanges) + + # Convrets this IPv4 address to an IPv4-mapped IPv6 address. + toIPv4MappedAddress: -> + return ipaddr.IPv6.parse "::ffff:#{@toString()}" + + # returns a number of leading ones in IPv4 address, making sure that + # the rest is a solid sequence of 0's (valid netmask) + # returns either the CIDR length or null if mask is not valid + prefixLengthFromSubnetMask: -> + # number of zeroes in octet + zerotable = + 0: 8 + 128: 7 + 192: 6 + 224: 5 + 240: 4 + 248: 3 + 252: 2 + 254: 1 + 255: 0 + + cidr = 0 + # non-zero encountered stop scanning for zeroes + stop = false + for i in [3..0] by -1 + octet = @octets[i] + if octet of zerotable + zeros = zerotable[octet] + if stop and zeros != 0 + return null + unless zeros == 8 + stop = true + cidr += zeros + else + return null + return 32 - cidr + +# A list of regular expressions that match arbitrary IPv4 addresses, +# for which a number of weird notations exist. +# Note that an address like 0010.0xa5.1.1 is considered legal. +ipv4Part = "(0?\\d+|0x[a-f0-9]+)" +ipv4Regexes = + fourOctet: new RegExp "^#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}$", 'i' + longValue: new RegExp "^#{ipv4Part}$", 'i' + +# Classful variants (like a.b, where a is an octet, and b is a 24-bit +# value representing last three octets; this corresponds to a class C +# address) are omitted due to classless nature of modern Internet. +ipaddr.IPv4.parser = (string) -> + parseIntAuto = (string) -> + if string[0] == "0" && string[1] != "x" + parseInt(string, 8) + else + parseInt(string) + + # parseInt recognizes all that octal & hexadecimal weirdness for us + if match = string.match(ipv4Regexes.fourOctet) + return (parseIntAuto(part) for part in match[1..5]) + else if match = string.match(ipv4Regexes.longValue) + value = parseIntAuto(match[1]) + if value > 0xffffffff || value < 0 + throw new Error "ipaddr: address outside defined range" + return ((value >> shift) & 0xff for shift in [0..24] by 8).reverse() + else + return null + +# An IPv6 address (RFC2460) +class ipaddr.IPv6 + # Constructs an IPv6 address from an array of eight 16-bit parts + # or sixteen 8-bit parts in network order (MSB first). + # Throws an error if the input is invalid. + constructor: (parts) -> + if parts.length == 16 + @parts = [] + for i in [0..14] by 2 + @parts.push((parts[i] << 8) | parts[i + 1]) + else if parts.length == 8 + @parts = parts + else + throw new Error "ipaddr: ipv6 part count should be 8 or 16" + + for part in @parts + if !(0 <= part <= 0xffff) + throw new Error "ipaddr: ipv6 part should fit in 16 bits" + + # The 'kind' method exists on both IPv4 and IPv6 classes. + kind: -> + return 'ipv6' + + # Returns the address in compact, human-readable format like + # 2001:db8:8:66::1 + toString: -> + stringParts = (part.toString(16) for part in @parts) + + compactStringParts = [] + pushPart = (part) -> compactStringParts.push part + + state = 0 + for part in stringParts + switch state + when 0 + if part == '0' + pushPart('') + else + pushPart(part) + + state = 1 + when 1 + if part == '0' + state = 2 + else + pushPart(part) + when 2 + unless part == '0' + pushPart('') + pushPart(part) + state = 3 + when 3 + pushPart(part) + + if state == 2 + pushPart('') + pushPart('') + + return compactStringParts.join ":" + + # Returns an array of byte-sized values in network order (MSB first) + toByteArray: -> + bytes = [] + for part in @parts + bytes.push(part >> 8) + bytes.push(part & 0xff) + + return bytes + + # Returns the address in expanded format with all zeroes included, like + # 2001:db8:8:66:0:0:0:1 + toNormalizedString: -> + return (part.toString(16) for part in @parts).join ":" + + # Checks if this address matches other one within given CIDR range. + match: (other, cidrRange) -> + if cidrRange == undefined + [other, cidrRange] = other + + if other.kind() != 'ipv6' + throw new Error "ipaddr: cannot match ipv6 address with non-ipv6 one" + + return matchCIDR(this.parts, other.parts, 16, cidrRange) + + # Special IPv6 ranges + SpecialRanges: + unspecified: [ new IPv6([0, 0, 0, 0, 0, 0, 0, 0]), 128 ] # RFC4291, here and after + linkLocal: [ new IPv6([0xfe80, 0, 0, 0, 0, 0, 0, 0]), 10 ] + multicast: [ new IPv6([0xff00, 0, 0, 0, 0, 0, 0, 0]), 8 ] + loopback: [ new IPv6([0, 0, 0, 0, 0, 0, 0, 1]), 128 ] + uniqueLocal: [ new IPv6([0xfc00, 0, 0, 0, 0, 0, 0, 0]), 7 ] + ipv4Mapped: [ new IPv6([0, 0, 0, 0, 0, 0xffff, 0, 0]), 96 ] + rfc6145: [ new IPv6([0, 0, 0, 0, 0xffff, 0, 0, 0]), 96 ] # RFC6145 + rfc6052: [ new IPv6([0x64, 0xff9b, 0, 0, 0, 0, 0, 0]), 96 ] # RFC6052 + '6to4': [ new IPv6([0x2002, 0, 0, 0, 0, 0, 0, 0]), 16 ] # RFC3056 + teredo: [ new IPv6([0x2001, 0, 0, 0, 0, 0, 0, 0]), 32 ] # RFC6052, RFC6146 + reserved: [ + [ new IPv6([ 0x2001, 0xdb8, 0, 0, 0, 0, 0, 0]), 32 ] # RFC4291 + ] + + # Checks if the address corresponds to one of the special ranges. + range: -> + return ipaddr.subnetMatch(this, @SpecialRanges) + + # Checks if this address is an IPv4-mapped IPv6 address. + isIPv4MappedAddress: -> + return @range() == 'ipv4Mapped' + + # Converts this address to IPv4 address if it is an IPv4-mapped IPv6 address. + # Throws an error otherwise. + toIPv4Address: -> + unless @isIPv4MappedAddress() + throw new Error "ipaddr: trying to convert a generic ipv6 address to ipv4" + + [high, low] = @parts[-2..-1] + + return new ipaddr.IPv4([high >> 8, high & 0xff, low >> 8, low & 0xff]) + +# IPv6-matching regular expressions. +# For IPv6, the task is simpler: it is enough to match the colon-delimited +# hexadecimal IPv6 and a transitional variant with dotted-decimal IPv4 at +# the end. +ipv6Part = "(?:[0-9a-f]+::?)+" +ipv6Regexes = + native: new RegExp "^(::)?(#{ipv6Part})?([0-9a-f]+)?(::)?$", 'i' + transitional: new RegExp "^((?:#{ipv6Part})|(?:::)(?:#{ipv6Part})?)" + + "#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}$", 'i' + +# Expand :: in an IPv6 address or address part consisting of `parts` groups. +expandIPv6 = (string, parts) -> + # More than one '::' means invalid adddress + if string.indexOf('::') != string.lastIndexOf('::') + return null + + # How many parts do we already have? + colonCount = 0 + lastColon = -1 + while (lastColon = string.indexOf(':', lastColon + 1)) >= 0 + colonCount++ + + # 0::0 is two parts more than :: + colonCount-- if string.substr(0, 2) == '::' + colonCount-- if string.substr(-2, 2) == '::' + + # The following loop would hang if colonCount > parts + if colonCount > parts + return null + + # replacement = ':' + '0:' * (parts - colonCount) + replacementCount = parts - colonCount + replacement = ':' + while replacementCount-- + replacement += '0:' + + # Insert the missing zeroes + string = string.replace('::', replacement) + + # Trim any garbage which may be hanging around if :: was at the edge in + # the source string + string = string[1..-1] if string[0] == ':' + string = string[0..-2] if string[string.length-1] == ':' + + return (parseInt(part, 16) for part in string.split(":")) + +# Parse an IPv6 address. +ipaddr.IPv6.parser = (string) -> + if string.match(ipv6Regexes['native']) + return expandIPv6(string, 8) + + else if match = string.match(ipv6Regexes['transitional']) + parts = expandIPv6(match[1][0..-2], 6) + if parts + octets = [parseInt(match[2]), parseInt(match[3]), + parseInt(match[4]), parseInt(match[5])] + for octet in octets + if !(0 <= octet <= 255) + return null + + parts.push(octets[0] << 8 | octets[1]) + parts.push(octets[2] << 8 | octets[3]) + return parts + + return null + +# Checks if a given string is formatted like IPv4/IPv6 address. +ipaddr.IPv4.isIPv4 = ipaddr.IPv6.isIPv6 = (string) -> + return @parser(string) != null + +# Checks if a given string is a valid IPv4/IPv6 address. +ipaddr.IPv4.isValid = (string) -> + try + new this(@parser(string)) + return true + catch e + return false + +ipaddr.IPv4.isValidFourPartDecimal = (string) -> + if ipaddr.IPv4.isValid(string) and string.match(/^\d+(\.\d+){3}$/) + return true + else + return false + +ipaddr.IPv6.isValid = (string) -> + # Since IPv6.isValid is always called first, this shortcut + # provides a substantial performance gain. + if typeof string == "string" and string.indexOf(":") == -1 + return false + + try + new this(@parser(string)) + return true + catch e + return false + +# Tries to parse and validate a string with IPv4/IPv6 address. +# Throws an error if it fails. +ipaddr.IPv4.parse = ipaddr.IPv6.parse = (string) -> + parts = @parser(string) + if parts == null + throw new Error "ipaddr: string is not formatted like ip address" + + return new this(parts) + +ipaddr.IPv4.parseCIDR = (string) -> + if match = string.match(/^(.+)\/(\d+)$/) + maskLength = parseInt(match[2]) + if maskLength >= 0 and maskLength <= 32 + return [@parse(match[1]), maskLength] + + throw new Error "ipaddr: string is not formatted like an IPv4 CIDR range" + +ipaddr.IPv6.parseCIDR = (string) -> + if match = string.match(/^(.+)\/(\d+)$/) + maskLength = parseInt(match[2]) + if maskLength >= 0 and maskLength <= 128 + return [@parse(match[1]), maskLength] + + throw new Error "ipaddr: string is not formatted like an IPv6 CIDR range" + +# Checks if the address is valid IP address +ipaddr.isValid = (string) -> + return ipaddr.IPv6.isValid(string) || ipaddr.IPv4.isValid(string) + +# Try to parse an address and throw an error if it is impossible +ipaddr.parse = (string) -> + if ipaddr.IPv6.isValid(string) + return ipaddr.IPv6.parse(string) + else if ipaddr.IPv4.isValid(string) + return ipaddr.IPv4.parse(string) + else + throw new Error "ipaddr: the address has neither IPv6 nor IPv4 format" + +ipaddr.parseCIDR = (string) -> + try + return ipaddr.IPv6.parseCIDR(string) + catch e + try + return ipaddr.IPv4.parseCIDR(string) + catch e + throw new Error "ipaddr: the address has neither IPv6 nor IPv4 CIDR format" + +# Try to parse an array in network order (MSB first) for IPv4 and IPv6 +ipaddr.fromByteArray = (bytes) -> + length = bytes.length + if length == 4 + return new ipaddr.IPv4(bytes) + else if length == 16 + return new ipaddr.IPv6(bytes) + else + throw new Error "ipaddr: the binary input is neither an IPv6 nor IPv4 address" + +# Parse an address and return plain IPv4 address if it is an IPv4-mapped address +ipaddr.process = (string) -> + addr = @parse(string) + if addr.kind() == 'ipv6' && addr.isIPv4MappedAddress() + return addr.toIPv4Address() + else + return addr diff --git a/8 node/node_modules/ipaddr.js/test/ipaddr.test.coffee b/8 node/node_modules/ipaddr.js/test/ipaddr.test.coffee new file mode 100644 index 000000000..34ec7d969 --- /dev/null +++ b/8 node/node_modules/ipaddr.js/test/ipaddr.test.coffee @@ -0,0 +1,346 @@ +ipaddr = require '../lib/ipaddr' + +module.exports = + 'should define main classes': (test) -> + test.ok(ipaddr.IPv4?, 'defines IPv4 class') + test.ok(ipaddr.IPv6?, 'defines IPv6 class') + test.done() + + 'can construct IPv4 from octets': (test) -> + test.doesNotThrow -> + new ipaddr.IPv4([192, 168, 1, 2]) + test.done() + + 'refuses to construct invalid IPv4': (test) -> + test.throws -> + new ipaddr.IPv4([300, 1, 2, 3]) + test.throws -> + new ipaddr.IPv4([8, 8, 8]) + test.done() + + 'converts IPv4 to string correctly': (test) -> + addr = new ipaddr.IPv4([192, 168, 1, 1]) + test.equal(addr.toString(), '192.168.1.1') + test.done() + + 'returns correct kind for IPv4': (test) -> + addr = new ipaddr.IPv4([1, 2, 3, 4]) + test.equal(addr.kind(), 'ipv4') + test.done() + + 'allows to access IPv4 octets': (test) -> + addr = new ipaddr.IPv4([42, 0, 0, 0]) + test.equal(addr.octets[0], 42) + test.done() + + 'checks IPv4 address format': (test) -> + test.equal(ipaddr.IPv4.isIPv4('192.168.007.0xa'), true) + test.equal(ipaddr.IPv4.isIPv4('1024.0.0.1'), true) + test.equal(ipaddr.IPv4.isIPv4('8.0xa.wtf.6'), false) + test.done() + + 'validates IPv4 addresses': (test) -> + test.equal(ipaddr.IPv4.isValid('192.168.007.0xa'), true) + test.equal(ipaddr.IPv4.isValid('1024.0.0.1'), false) + test.equal(ipaddr.IPv4.isValid('8.0xa.wtf.6'), false) + test.done() + + 'parses IPv4 in several weird formats': (test) -> + test.deepEqual(ipaddr.IPv4.parse('192.168.1.1').octets, [192, 168, 1, 1]) + test.deepEqual(ipaddr.IPv4.parse('0xc0.168.1.1').octets, [192, 168, 1, 1]) + test.deepEqual(ipaddr.IPv4.parse('192.0250.1.1').octets, [192, 168, 1, 1]) + test.deepEqual(ipaddr.IPv4.parse('0xc0a80101').octets, [192, 168, 1, 1]) + test.deepEqual(ipaddr.IPv4.parse('030052000401').octets, [192, 168, 1, 1]) + test.deepEqual(ipaddr.IPv4.parse('3232235777').octets, [192, 168, 1, 1]) + test.done() + + 'barfs at invalid IPv4': (test) -> + test.throws -> + ipaddr.IPv4.parse('10.0.0.wtf') + test.done() + + 'matches IPv4 CIDR correctly': (test) -> + addr = new ipaddr.IPv4([10, 5, 0, 1]) + test.equal(addr.match(ipaddr.IPv4.parse('0.0.0.0'), 0), true) + test.equal(addr.match(ipaddr.IPv4.parse('11.0.0.0'), 8), false) + test.equal(addr.match(ipaddr.IPv4.parse('10.0.0.0'), 8), true) + test.equal(addr.match(ipaddr.IPv4.parse('10.0.0.1'), 8), true) + test.equal(addr.match(ipaddr.IPv4.parse('10.0.0.10'), 8), true) + test.equal(addr.match(ipaddr.IPv4.parse('10.5.5.0'), 16), true) + test.equal(addr.match(ipaddr.IPv4.parse('10.4.5.0'), 16), false) + test.equal(addr.match(ipaddr.IPv4.parse('10.4.5.0'), 15), true) + test.equal(addr.match(ipaddr.IPv4.parse('10.5.0.2'), 32), false) + test.equal(addr.match(addr, 32), true) + test.done() + + 'parses IPv4 CIDR correctly': (test) -> + addr = new ipaddr.IPv4([10, 5, 0, 1]) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('0.0.0.0/0')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('11.0.0.0/8')), false) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.0.0.0/8')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.0.0.1/8')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.0.0.10/8')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.5.5.0/16')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.4.5.0/16')), false) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.4.5.0/15')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.5.0.2/32')), false) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.5.0.1/32')), true) + test.throws -> + ipaddr.IPv4.parseCIDR('10.5.0.1') + test.throws -> + ipaddr.IPv4.parseCIDR('0.0.0.0/-1') + test.throws -> + ipaddr.IPv4.parseCIDR('0.0.0.0/33') + test.done() + + 'detects reserved IPv4 networks': (test) -> + test.equal(ipaddr.IPv4.parse('0.0.0.0').range(), 'unspecified') + test.equal(ipaddr.IPv4.parse('0.1.0.0').range(), 'unspecified') + test.equal(ipaddr.IPv4.parse('10.1.0.1').range(), 'private') + test.equal(ipaddr.IPv4.parse('100.64.0.0').range(), 'carrierGradeNat') + test.equal(ipaddr.IPv4.parse('100.127.255.255').range(), 'carrierGradeNat') + test.equal(ipaddr.IPv4.parse('192.168.2.1').range(), 'private') + test.equal(ipaddr.IPv4.parse('224.100.0.1').range(), 'multicast') + test.equal(ipaddr.IPv4.parse('169.254.15.0').range(), 'linkLocal') + test.equal(ipaddr.IPv4.parse('127.1.1.1').range(), 'loopback') + test.equal(ipaddr.IPv4.parse('255.255.255.255').range(), 'broadcast') + test.equal(ipaddr.IPv4.parse('240.1.2.3').range(), 'reserved') + test.equal(ipaddr.IPv4.parse('8.8.8.8').range(), 'unicast') + test.done() + + 'checks the conventional IPv4 address format': (test) -> + test.equal(ipaddr.IPv4.isValidFourPartDecimal('192.168.1.1'), true) + test.equal(ipaddr.IPv4.isValidFourPartDecimal('0xc0.168.1.1'), false) + test.done() + + 'can construct IPv6 from 16bit parts': (test) -> + test.doesNotThrow -> + new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1]) + test.done() + + 'can construct IPv6 from 8bit parts': (test) -> + test.doesNotThrow -> + new ipaddr.IPv6([0x20, 0x01, 0xd, 0xb8, 0xf5, 0x3a, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]) + test.deepEqual(new ipaddr.IPv6([0x20, 0x01, 0xd, 0xb8, 0xf5, 0x3a, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]), + new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1])) + test.done() + + 'refuses to construct invalid IPv6': (test) -> + test.throws -> + new ipaddr.IPv6([0xfffff, 0, 0, 0, 0, 0, 0, 1]) + test.throws -> + new ipaddr.IPv6([0xfffff, 0, 0, 0, 0, 0, 1]) + test.throws -> + new ipaddr.IPv6([0xffff, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]) + test.done() + + 'converts IPv6 to string correctly': (test) -> + addr = new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1]) + test.equal(addr.toNormalizedString(), '2001:db8:f53a:0:0:0:0:1') + test.equal(addr.toString(), '2001:db8:f53a::1') + test.equal(new ipaddr.IPv6([0, 0, 0, 0, 0, 0, 0, 1]).toString(), '::1') + test.equal(new ipaddr.IPv6([0x2001, 0xdb8, 0, 0, 0, 0, 0, 0]).toString(), '2001:db8::') + test.done() + + 'returns correct kind for IPv6': (test) -> + addr = new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1]) + test.equal(addr.kind(), 'ipv6') + test.done() + + 'allows to access IPv6 address parts': (test) -> + addr = new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 42, 0, 1]) + test.equal(addr.parts[5], 42) + test.done() + + 'checks IPv6 address format': (test) -> + test.equal(ipaddr.IPv6.isIPv6('2001:db8:F53A::1'), true) + test.equal(ipaddr.IPv6.isIPv6('200001::1'), true) + test.equal(ipaddr.IPv6.isIPv6('::ffff:192.168.1.1'), true) + test.equal(ipaddr.IPv6.isIPv6('::ffff:300.168.1.1'), false) + test.equal(ipaddr.IPv6.isIPv6('::ffff:300.168.1.1:0'), false) + test.equal(ipaddr.IPv6.isIPv6('fe80::wtf'), false) + test.done() + + 'validates IPv6 addresses': (test) -> + test.equal(ipaddr.IPv6.isValid('2001:db8:F53A::1'), true) + test.equal(ipaddr.IPv6.isValid('200001::1'), false) + test.equal(ipaddr.IPv6.isValid('::ffff:192.168.1.1'), true) + test.equal(ipaddr.IPv6.isValid('::ffff:300.168.1.1'), false) + test.equal(ipaddr.IPv6.isValid('::ffff:300.168.1.1:0'), false) + test.equal(ipaddr.IPv6.isValid('::ffff:222.1.41.9000'), false) + test.equal(ipaddr.IPv6.isValid('2001:db8::F53A::1'), false) + test.equal(ipaddr.IPv6.isValid('fe80::wtf'), false) + test.equal(ipaddr.IPv6.isValid('2002::2:'), false) + test.equal(ipaddr.IPv6.isValid(undefined), false) + test.done() + + 'parses IPv6 in different formats': (test) -> + test.deepEqual(ipaddr.IPv6.parse('2001:db8:F53A:0:0:0:0:1').parts, [0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1]) + test.deepEqual(ipaddr.IPv6.parse('fe80::10').parts, [0xfe80, 0, 0, 0, 0, 0, 0, 0x10]) + test.deepEqual(ipaddr.IPv6.parse('2001:db8:F53A::').parts, [0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 0]) + test.deepEqual(ipaddr.IPv6.parse('::1').parts, [0, 0, 0, 0, 0, 0, 0, 1]) + test.deepEqual(ipaddr.IPv6.parse('::').parts, [0, 0, 0, 0, 0, 0, 0, 0]) + test.done() + + 'barfs at invalid IPv6': (test) -> + test.throws -> + ipaddr.IPv6.parse('fe80::0::1') + test.done() + + 'matches IPv6 CIDR correctly': (test) -> + addr = ipaddr.IPv6.parse('2001:db8:f53a::1') + test.equal(addr.match(ipaddr.IPv6.parse('::'), 0), true) + test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f53a::1:1'), 64), true) + test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f53b::1:1'), 48), false) + test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f531::1:1'), 44), true) + test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f500::1'), 40), true) + test.equal(addr.match(ipaddr.IPv6.parse('2001:db9:f500::1'), 40), false) + test.equal(addr.match(addr, 128), true) + test.done() + + 'parses IPv6 CIDR correctly': (test) -> + addr = ipaddr.IPv6.parse('2001:db8:f53a::1') + test.equal(addr.match(ipaddr.IPv6.parseCIDR('::/0')), true) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db8:f53a::1:1/64')), true) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db8:f53b::1:1/48')), false) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db8:f531::1:1/44')), true) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db8:f500::1/40')), true) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db9:f500::1/40')), false) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db8:f53a::1/128')), true) + test.throws -> + ipaddr.IPv6.parseCIDR('2001:db8:f53a::1') + test.throws -> + ipaddr.IPv6.parseCIDR('2001:db8:f53a::1/-1') + test.throws -> + ipaddr.IPv6.parseCIDR('2001:db8:f53a::1/129') + test.done() + + 'converts between IPv4-mapped IPv6 addresses and IPv4 addresses': (test) -> + addr = ipaddr.IPv4.parse('77.88.21.11') + mapped = addr.toIPv4MappedAddress() + test.deepEqual(mapped.parts, [0, 0, 0, 0, 0, 0xffff, 0x4d58, 0x150b]) + test.deepEqual(mapped.toIPv4Address().octets, addr.octets) + test.done() + + 'refuses to convert non-IPv4-mapped IPv6 address to IPv4 address': (test) -> + test.throws -> + ipaddr.IPv6.parse('2001:db8::1').toIPv4Address() + test.done() + + 'detects reserved IPv6 networks': (test) -> + test.equal(ipaddr.IPv6.parse('::').range(), 'unspecified') + test.equal(ipaddr.IPv6.parse('fe80::1234:5678:abcd:0123').range(), 'linkLocal') + test.equal(ipaddr.IPv6.parse('ff00::1234').range(), 'multicast') + test.equal(ipaddr.IPv6.parse('::1').range(), 'loopback') + test.equal(ipaddr.IPv6.parse('fc00::').range(), 'uniqueLocal') + test.equal(ipaddr.IPv6.parse('::ffff:192.168.1.10').range(), 'ipv4Mapped') + test.equal(ipaddr.IPv6.parse('::ffff:0:192.168.1.10').range(), 'rfc6145') + test.equal(ipaddr.IPv6.parse('64:ff9b::1234').range(), 'rfc6052') + test.equal(ipaddr.IPv6.parse('2002:1f63:45e8::1').range(), '6to4') + test.equal(ipaddr.IPv6.parse('2001::4242').range(), 'teredo') + test.equal(ipaddr.IPv6.parse('2001:db8::3210').range(), 'reserved') + test.equal(ipaddr.IPv6.parse('2001:470:8:66::1').range(), 'unicast') + test.done() + + 'is able to determine IP address type': (test) -> + test.equal(ipaddr.parse('8.8.8.8').kind(), 'ipv4') + test.equal(ipaddr.parse('2001:db8:3312::1').kind(), 'ipv6') + test.done() + + 'throws an error if tried to parse an invalid address': (test) -> + test.throws -> + ipaddr.parse('::some.nonsense') + test.done() + + 'correctly processes IPv4-mapped addresses': (test) -> + test.equal(ipaddr.process('8.8.8.8').kind(), 'ipv4') + test.equal(ipaddr.process('2001:db8:3312::1').kind(), 'ipv6') + test.equal(ipaddr.process('::ffff:192.168.1.1').kind(), 'ipv4') + test.done() + + 'correctly converts IPv6 and IPv4 addresses to byte arrays': (test) -> + test.deepEqual(ipaddr.parse('1.2.3.4').toByteArray(), + [0x1, 0x2, 0x3, 0x4]); + # Fuck yeah. The first byte of Google's IPv6 address is 42. 42! + test.deepEqual(ipaddr.parse('2a00:1450:8007::68').toByteArray(), + [42, 0x00, 0x14, 0x50, 0x80, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x68 ]) + test.done() + + 'correctly parses 1 as an IPv4 address': (test) -> + test.equal(ipaddr.IPv6.isValid('1'), false) + test.equal(ipaddr.IPv4.isValid('1'), true) + test.deepEqual(new ipaddr.IPv4([0, 0, 0, 1]), ipaddr.parse('1')) + test.done() + + 'correctly detects IPv4 and IPv6 CIDR addresses': (test) -> + test.deepEqual([ipaddr.IPv6.parse('fc00::'), 64], + ipaddr.parseCIDR('fc00::/64')) + test.deepEqual([ipaddr.IPv4.parse('1.2.3.4'), 5], + ipaddr.parseCIDR('1.2.3.4/5')) + test.done() + + 'does not consider a very large or very small number a valid IP address': (test) -> + test.equal(ipaddr.isValid('4999999999'), false) + test.equal(ipaddr.isValid('-1'), false) + test.done() + + 'does not hang on ::8:8:8:8:8:8:8:8:8': (test) -> + test.equal(ipaddr.IPv6.isValid('::8:8:8:8:8:8:8:8:8'), false) + test.done() + + 'subnetMatch does not fail on empty range': (test) -> + ipaddr.subnetMatch(new ipaddr.IPv4([1,2,3,4]), {}, false) + ipaddr.subnetMatch(new ipaddr.IPv4([1,2,3,4]), {subnet: []}, false) + test.done() + + 'subnetMatch returns default subnet on empty range': (test) -> + test.equal(ipaddr.subnetMatch(new ipaddr.IPv4([1,2,3,4]), {}, false), false) + test.equal(ipaddr.subnetMatch(new ipaddr.IPv4([1,2,3,4]), {subnet: []}, false), false) + test.done() + + 'is able to determine IP address type from byte array input': (test) -> + test.equal(ipaddr.fromByteArray([0x7f, 0, 0, 1]).kind(), 'ipv4') + test.equal(ipaddr.fromByteArray([0x20, 0x01, 0xd, 0xb8, 0xf5, 0x3a, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]).kind(), 'ipv6') + test.throws -> + ipaddr.fromByteArray([1]) + test.done() + + 'prefixLengthFromSubnetMask returns proper CIDR notation for standard IPv4 masks': (test) -> + test.equal(ipaddr.IPv4.parse('255.255.255.255').prefixLengthFromSubnetMask(), 32) + test.equal(ipaddr.IPv4.parse('255.255.255.254').prefixLengthFromSubnetMask(), 31) + test.equal(ipaddr.IPv4.parse('255.255.255.252').prefixLengthFromSubnetMask(), 30) + test.equal(ipaddr.IPv4.parse('255.255.255.248').prefixLengthFromSubnetMask(), 29) + test.equal(ipaddr.IPv4.parse('255.255.255.240').prefixLengthFromSubnetMask(), 28) + test.equal(ipaddr.IPv4.parse('255.255.255.224').prefixLengthFromSubnetMask(), 27) + test.equal(ipaddr.IPv4.parse('255.255.255.192').prefixLengthFromSubnetMask(), 26) + test.equal(ipaddr.IPv4.parse('255.255.255.128').prefixLengthFromSubnetMask(), 25) + test.equal(ipaddr.IPv4.parse('255.255.255.0').prefixLengthFromSubnetMask(), 24) + test.equal(ipaddr.IPv4.parse('255.255.254.0').prefixLengthFromSubnetMask(), 23) + test.equal(ipaddr.IPv4.parse('255.255.252.0').prefixLengthFromSubnetMask(), 22) + test.equal(ipaddr.IPv4.parse('255.255.248.0').prefixLengthFromSubnetMask(), 21) + test.equal(ipaddr.IPv4.parse('255.255.240.0').prefixLengthFromSubnetMask(), 20) + test.equal(ipaddr.IPv4.parse('255.255.224.0').prefixLengthFromSubnetMask(), 19) + test.equal(ipaddr.IPv4.parse('255.255.192.0').prefixLengthFromSubnetMask(), 18) + test.equal(ipaddr.IPv4.parse('255.255.128.0').prefixLengthFromSubnetMask(), 17) + test.equal(ipaddr.IPv4.parse('255.255.0.0').prefixLengthFromSubnetMask(), 16) + test.equal(ipaddr.IPv4.parse('255.254.0.0').prefixLengthFromSubnetMask(), 15) + test.equal(ipaddr.IPv4.parse('255.252.0.0').prefixLengthFromSubnetMask(), 14) + test.equal(ipaddr.IPv4.parse('255.248.0.0').prefixLengthFromSubnetMask(), 13) + test.equal(ipaddr.IPv4.parse('255.240.0.0').prefixLengthFromSubnetMask(), 12) + test.equal(ipaddr.IPv4.parse('255.224.0.0').prefixLengthFromSubnetMask(), 11) + test.equal(ipaddr.IPv4.parse('255.192.0.0').prefixLengthFromSubnetMask(), 10) + test.equal(ipaddr.IPv4.parse('255.128.0.0').prefixLengthFromSubnetMask(), 9) + test.equal(ipaddr.IPv4.parse('255.0.0.0').prefixLengthFromSubnetMask(), 8) + test.equal(ipaddr.IPv4.parse('254.0.0.0').prefixLengthFromSubnetMask(), 7) + test.equal(ipaddr.IPv4.parse('252.0.0.0').prefixLengthFromSubnetMask(), 6) + test.equal(ipaddr.IPv4.parse('248.0.0.0').prefixLengthFromSubnetMask(), 5) + test.equal(ipaddr.IPv4.parse('240.0.0.0').prefixLengthFromSubnetMask(), 4) + test.equal(ipaddr.IPv4.parse('224.0.0.0').prefixLengthFromSubnetMask(), 3) + test.equal(ipaddr.IPv4.parse('192.0.0.0').prefixLengthFromSubnetMask(), 2) + test.equal(ipaddr.IPv4.parse('128.0.0.0').prefixLengthFromSubnetMask(), 1) + test.equal(ipaddr.IPv4.parse('0.0.0.0').prefixLengthFromSubnetMask(), 0) + # negative cases + test.equal(ipaddr.IPv4.parse('192.168.255.0').prefixLengthFromSubnetMask(), null) + test.equal(ipaddr.IPv4.parse('255.0.255.0').prefixLengthFromSubnetMask(), null) + test.done() + diff --git a/8 node/node_modules/media-typer/HISTORY.md b/8 node/node_modules/media-typer/HISTORY.md new file mode 100644 index 000000000..62c200316 --- /dev/null +++ b/8 node/node_modules/media-typer/HISTORY.md @@ -0,0 +1,22 @@ +0.3.0 / 2014-09-07 +================== + + * Support Node.js 0.6 + * Throw error when parameter format invalid on parse + +0.2.0 / 2014-06-18 +================== + + * Add `typer.format()` to format media types + +0.1.0 / 2014-06-17 +================== + + * Accept `req` as argument to `parse` + * Accept `res` as argument to `parse` + * Parse media type with extra LWS between type and first parameter + +0.0.0 / 2014-06-13 +================== + + * Initial implementation diff --git a/8 node/node_modules/media-typer/LICENSE b/8 node/node_modules/media-typer/LICENSE new file mode 100644 index 000000000..b7dce6cf9 --- /dev/null +++ b/8 node/node_modules/media-typer/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/media-typer/README.md b/8 node/node_modules/media-typer/README.md new file mode 100644 index 000000000..d8df62347 --- /dev/null +++ b/8 node/node_modules/media-typer/README.md @@ -0,0 +1,81 @@ +# media-typer + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Simple RFC 6838 media type parser + +## Installation + +```sh +$ npm install media-typer +``` + +## API + +```js +var typer = require('media-typer') +``` + +### typer.parse(string) + +```js +var obj = typer.parse('image/svg+xml; charset=utf-8') +``` + +Parse a media type string. This will return an object with the following +properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The type of the media type (always lower case). Example: `'image'` + + - `subtype`: The subtype of the media type (always lower case). Example: `'svg'` + + - `suffix`: The suffix of the media type (always lower case). Example: `'xml'` + + - `parameters`: An object of the parameters in the media type (name of parameter always lower case). Example: `{charset: 'utf-8'}` + +### typer.parse(req) + +```js +var obj = typer.parse(req) +``` + +Parse the `content-type` header from the given `req`. Short-cut for +`typer.parse(req.headers['content-type'])`. + +### typer.parse(res) + +```js +var obj = typer.parse(res) +``` + +Parse the `content-type` header set on the given `res`. Short-cut for +`typer.parse(res.getHeader('content-type'))`. + +### typer.format(obj) + +```js +var obj = typer.format({type: 'image', subtype: 'svg', suffix: 'xml'}) +``` + +Format an object into a media type string. This will return a string of the +mime type for the given object. For the properties of the object, see the +documentation for `typer.parse(string)`. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/media-typer.svg?style=flat +[npm-url]: https://npmjs.org/package/media-typer +[node-version-image]: https://img.shields.io/badge/node.js-%3E%3D_0.6-brightgreen.svg?style=flat +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/media-typer.svg?style=flat +[travis-url]: https://travis-ci.org/jshttp/media-typer +[coveralls-image]: https://img.shields.io/coveralls/jshttp/media-typer.svg?style=flat +[coveralls-url]: https://coveralls.io/r/jshttp/media-typer +[downloads-image]: https://img.shields.io/npm/dm/media-typer.svg?style=flat +[downloads-url]: https://npmjs.org/package/media-typer diff --git a/8 node/node_modules/media-typer/index.js b/8 node/node_modules/media-typer/index.js new file mode 100644 index 000000000..07f7295ee --- /dev/null +++ b/8 node/node_modules/media-typer/index.js @@ -0,0 +1,270 @@ +/*! + * media-typer + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * RegExp to match *( ";" parameter ) in RFC 2616 sec 3.7 + * + * parameter = token "=" ( token | quoted-string ) + * token = 1* + * separators = "(" | ")" | "<" | ">" | "@" + * | "," | ";" | ":" | "\" | <"> + * | "/" | "[" | "]" | "?" | "=" + * | "{" | "}" | SP | HT + * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> ) + * qdtext = > + * quoted-pair = "\" CHAR + * CHAR = + * TEXT = + * LWS = [CRLF] 1*( SP | HT ) + * CRLF = CR LF + * CR = + * LF = + * SP = + * SHT = + * CTL = + * OCTET = + */ +var paramRegExp = /; *([!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+) *= *("(?:[ !\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u0020-\u007e])*"|[!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+) */g; +var textRegExp = /^[\u0020-\u007e\u0080-\u00ff]+$/ +var tokenRegExp = /^[!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+$/ + +/** + * RegExp to match quoted-pair in RFC 2616 + * + * quoted-pair = "\" CHAR + * CHAR = + */ +var qescRegExp = /\\([\u0000-\u007f])/g; + +/** + * RegExp to match chars that must be quoted-pair in RFC 2616 + */ +var quoteRegExp = /([\\"])/g; + +/** + * RegExp to match type in RFC 6838 + * + * type-name = restricted-name + * subtype-name = restricted-name + * restricted-name = restricted-name-first *126restricted-name-chars + * restricted-name-first = ALPHA / DIGIT + * restricted-name-chars = ALPHA / DIGIT / "!" / "#" / + * "$" / "&" / "-" / "^" / "_" + * restricted-name-chars =/ "." ; Characters before first dot always + * ; specify a facet name + * restricted-name-chars =/ "+" ; Characters after last plus always + * ; specify a structured syntax suffix + * ALPHA = %x41-5A / %x61-7A ; A-Z / a-z + * DIGIT = %x30-39 ; 0-9 + */ +var subtypeNameRegExp = /^[A-Za-z0-9][A-Za-z0-9!#$&^_.-]{0,126}$/ +var typeNameRegExp = /^[A-Za-z0-9][A-Za-z0-9!#$&^_-]{0,126}$/ +var typeRegExp = /^ *([A-Za-z0-9][A-Za-z0-9!#$&^_-]{0,126})\/([A-Za-z0-9][A-Za-z0-9!#$&^_.+-]{0,126}) *$/; + +/** + * Module exports. + */ + +exports.format = format +exports.parse = parse + +/** + * Format object to media type. + * + * @param {object} obj + * @return {string} + * @api public + */ + +function format(obj) { + if (!obj || typeof obj !== 'object') { + throw new TypeError('argument obj is required') + } + + var parameters = obj.parameters + var subtype = obj.subtype + var suffix = obj.suffix + var type = obj.type + + if (!type || !typeNameRegExp.test(type)) { + throw new TypeError('invalid type') + } + + if (!subtype || !subtypeNameRegExp.test(subtype)) { + throw new TypeError('invalid subtype') + } + + // format as type/subtype + var string = type + '/' + subtype + + // append +suffix + if (suffix) { + if (!typeNameRegExp.test(suffix)) { + throw new TypeError('invalid suffix') + } + + string += '+' + suffix + } + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + if (!tokenRegExp.test(param)) { + throw new TypeError('invalid parameter name') + } + + string += '; ' + param + '=' + qstring(parameters[param]) + } + } + + return string +} + +/** + * Parse media type to object. + * + * @param {string|object} string + * @return {Object} + * @api public + */ + +function parse(string) { + if (!string) { + throw new TypeError('argument string is required') + } + + // support req/res-like objects as argument + if (typeof string === 'object') { + string = getcontenttype(string) + } + + if (typeof string !== 'string') { + throw new TypeError('argument string is required to be a string') + } + + var index = string.indexOf(';') + var type = index !== -1 + ? string.substr(0, index) + : string + + var key + var match + var obj = splitType(type) + var params = {} + var value + + paramRegExp.lastIndex = index + + while (match = paramRegExp.exec(string)) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(qescRegExp, '$1') + } + + params[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + obj.parameters = params + + return obj +} + +/** + * Get content-type from req/res objects. + * + * @param {object} + * @return {Object} + * @api private + */ + +function getcontenttype(obj) { + if (typeof obj.getHeader === 'function') { + // res-like + return obj.getHeader('content-type') + } + + if (typeof obj.headers === 'object') { + // req-like + return obj.headers && obj.headers['content-type'] + } +} + +/** + * Quote a string if necessary. + * + * @param {string} val + * @return {string} + * @api private + */ + +function qstring(val) { + var str = String(val) + + // no need to quote tokens + if (tokenRegExp.test(str)) { + return str + } + + if (str.length > 0 && !textRegExp.test(str)) { + throw new TypeError('invalid parameter value') + } + + return '"' + str.replace(quoteRegExp, '\\$1') + '"' +} + +/** + * Simply "type/subtype+siffx" into parts. + * + * @param {string} string + * @return {Object} + * @api private + */ + +function splitType(string) { + var match = typeRegExp.exec(string.toLowerCase()) + + if (!match) { + throw new TypeError('invalid media type') + } + + var type = match[1] + var subtype = match[2] + var suffix + + // suffix after last + + var index = subtype.lastIndexOf('+') + if (index !== -1) { + suffix = subtype.substr(index + 1) + subtype = subtype.substr(0, index) + } + + var obj = { + type: type, + subtype: subtype, + suffix: suffix + } + + return obj +} diff --git a/8 node/node_modules/media-typer/package.json b/8 node/node_modules/media-typer/package.json new file mode 100644 index 000000000..057d955c1 --- /dev/null +++ b/8 node/node_modules/media-typer/package.json @@ -0,0 +1,61 @@ +{ + "_from": "media-typer@0.3.0", + "_id": "media-typer@0.3.0", + "_inBundle": false, + "_integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=", + "_location": "/media-typer", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "media-typer@0.3.0", + "name": "media-typer", + "escapedName": "media-typer", + "rawSpec": "0.3.0", + "saveSpec": null, + "fetchSpec": "0.3.0" + }, + "_requiredBy": [ + "/type-is" + ], + "_resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "_shasum": "8710d7af0aa626f8fffa1ce00168545263255748", + "_spec": "media-typer@0.3.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/type-is", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/media-typer/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Simple RFC 6838 media type parser and formatter", + "devDependencies": { + "istanbul": "0.3.2", + "mocha": "~1.21.4", + "should": "~4.0.4" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/media-typer#readme", + "license": "MIT", + "name": "media-typer", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/media-typer.git" + }, + "scripts": { + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.3.0" +} diff --git a/8 node/node_modules/merge-descriptors/HISTORY.md b/8 node/node_modules/merge-descriptors/HISTORY.md new file mode 100644 index 000000000..486771f08 --- /dev/null +++ b/8 node/node_modules/merge-descriptors/HISTORY.md @@ -0,0 +1,21 @@ +1.0.1 / 2016-01-17 +================== + + * perf: enable strict mode + +1.0.0 / 2015-03-01 +================== + + * Add option to only add new descriptors + * Add simple argument validation + * Add jsdoc to source file + +0.0.2 / 2013-12-14 +================== + + * Move repository to `component` organization + +0.0.1 / 2013-10-29 +================== + + * Initial release diff --git a/8 node/node_modules/merge-descriptors/LICENSE b/8 node/node_modules/merge-descriptors/LICENSE new file mode 100644 index 000000000..274bfd82b --- /dev/null +++ b/8 node/node_modules/merge-descriptors/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2013 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/merge-descriptors/README.md b/8 node/node_modules/merge-descriptors/README.md new file mode 100644 index 000000000..d593c0ebd --- /dev/null +++ b/8 node/node_modules/merge-descriptors/README.md @@ -0,0 +1,48 @@ +# Merge Descriptors + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Merge objects using descriptors. + +```js +var thing = { + get name() { + return 'jon' + } +} + +var animal = { + +} + +merge(animal, thing) + +animal.name === 'jon' +``` + +## API + +### merge(destination, source) + +Redefines `destination`'s descriptors with `source`'s. + +### merge(destination, source, false) + +Defines `source`'s descriptors on `destination` if `destination` does not have +a descriptor by the same name. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/merge-descriptors.svg +[npm-url]: https://npmjs.org/package/merge-descriptors +[travis-image]: https://img.shields.io/travis/component/merge-descriptors/master.svg +[travis-url]: https://travis-ci.org/component/merge-descriptors +[coveralls-image]: https://img.shields.io/coveralls/component/merge-descriptors/master.svg +[coveralls-url]: https://coveralls.io/r/component/merge-descriptors?branch=master +[downloads-image]: https://img.shields.io/npm/dm/merge-descriptors.svg +[downloads-url]: https://npmjs.org/package/merge-descriptors diff --git a/8 node/node_modules/merge-descriptors/index.js b/8 node/node_modules/merge-descriptors/index.js new file mode 100644 index 000000000..573b132eb --- /dev/null +++ b/8 node/node_modules/merge-descriptors/index.js @@ -0,0 +1,60 @@ +/*! + * merge-descriptors + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = merge + +/** + * Module variables. + * @private + */ + +var hasOwnProperty = Object.prototype.hasOwnProperty + +/** + * Merge the property descriptors of `src` into `dest` + * + * @param {object} dest Object to add descriptors to + * @param {object} src Object to clone descriptors from + * @param {boolean} [redefine=true] Redefine `dest` properties with `src` properties + * @returns {object} Reference to dest + * @public + */ + +function merge(dest, src, redefine) { + if (!dest) { + throw new TypeError('argument dest is required') + } + + if (!src) { + throw new TypeError('argument src is required') + } + + if (redefine === undefined) { + // Default to true + redefine = true + } + + Object.getOwnPropertyNames(src).forEach(function forEachOwnPropertyName(name) { + if (!redefine && hasOwnProperty.call(dest, name)) { + // Skip desriptor + return + } + + // Copy descriptor + var descriptor = Object.getOwnPropertyDescriptor(src, name) + Object.defineProperty(dest, name, descriptor) + }) + + return dest +} diff --git a/8 node/node_modules/merge-descriptors/package.json b/8 node/node_modules/merge-descriptors/package.json new file mode 100644 index 000000000..cd97e6bdd --- /dev/null +++ b/8 node/node_modules/merge-descriptors/package.json @@ -0,0 +1,69 @@ +{ + "_from": "merge-descriptors@1.0.1", + "_id": "merge-descriptors@1.0.1", + "_inBundle": false, + "_integrity": "sha1-sAqqVW3YtEVoFQ7J0blT8/kMu2E=", + "_location": "/merge-descriptors", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "merge-descriptors@1.0.1", + "name": "merge-descriptors", + "escapedName": "merge-descriptors", + "rawSpec": "1.0.1", + "saveSpec": null, + "fetchSpec": "1.0.1" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", + "_shasum": "b00aaa556dd8b44568150ec9d1b953f3f90cbb61", + "_spec": "merge-descriptors@1.0.1", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/component/merge-descriptors/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Mike Grabowski", + "email": "grabbou@gmail.com" + } + ], + "deprecated": false, + "description": "Merge objects using descriptors", + "devDependencies": { + "istanbul": "0.4.1", + "mocha": "1.21.5" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/component/merge-descriptors#readme", + "license": "MIT", + "name": "merge-descriptors", + "repository": { + "type": "git", + "url": "git+https://github.com/component/merge-descriptors.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "1.0.1" +} diff --git a/8 node/node_modules/methods/HISTORY.md b/8 node/node_modules/methods/HISTORY.md new file mode 100644 index 000000000..c0ecf072d --- /dev/null +++ b/8 node/node_modules/methods/HISTORY.md @@ -0,0 +1,29 @@ +1.1.2 / 2016-01-17 +================== + + * perf: enable strict mode + +1.1.1 / 2014-12-30 +================== + + * Improve `browserify` support + +1.1.0 / 2014-07-05 +================== + + * Add `CONNECT` method + +1.0.1 / 2014-06-02 +================== + + * Fix module to work with harmony transform + +1.0.0 / 2014-05-08 +================== + + * Add `PURGE` method + +0.1.0 / 2013-10-28 +================== + + * Add `http.METHODS` support diff --git a/8 node/node_modules/methods/LICENSE b/8 node/node_modules/methods/LICENSE new file mode 100644 index 000000000..220dc1a24 --- /dev/null +++ b/8 node/node_modules/methods/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2013-2014 TJ Holowaychuk +Copyright (c) 2015-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/8 node/node_modules/methods/README.md b/8 node/node_modules/methods/README.md new file mode 100644 index 000000000..672a32bfe --- /dev/null +++ b/8 node/node_modules/methods/README.md @@ -0,0 +1,51 @@ +# Methods + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP verbs that Node.js core's HTTP parser supports. + +This module provides an export that is just like `http.METHODS` from Node.js core, +with the following differences: + + * All method names are lower-cased. + * Contains a fallback list of methods for Node.js versions that do not have a + `http.METHODS` export (0.10 and lower). + * Provides the fallback list when using tools like `browserify` without pulling + in the `http` shim module. + +## Install + +```bash +$ npm install methods +``` + +## API + +```js +var methods = require('methods') +``` + +### methods + +This is an array of lower-cased method names that Node.js supports. If Node.js +provides the `http.METHODS` export, then this is the same array lower-cased, +otherwise it is a snapshot of the verbs from Node.js 0.10. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/methods.svg?style=flat +[npm-url]: https://npmjs.org/package/methods +[node-version-image]: https://img.shields.io/node/v/methods.svg?style=flat +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/methods.svg?style=flat +[travis-url]: https://travis-ci.org/jshttp/methods +[coveralls-image]: https://img.shields.io/coveralls/jshttp/methods.svg?style=flat +[coveralls-url]: https://coveralls.io/r/jshttp/methods?branch=master +[downloads-image]: https://img.shields.io/npm/dm/methods.svg?style=flat +[downloads-url]: https://npmjs.org/package/methods diff --git a/8 node/node_modules/methods/index.js b/8 node/node_modules/methods/index.js new file mode 100644 index 000000000..667a50bde --- /dev/null +++ b/8 node/node_modules/methods/index.js @@ -0,0 +1,69 @@ +/*! + * methods + * Copyright(c) 2013-2014 TJ Holowaychuk + * Copyright(c) 2015-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var http = require('http'); + +/** + * Module exports. + * @public + */ + +module.exports = getCurrentNodeMethods() || getBasicNodeMethods(); + +/** + * Get the current Node.js methods. + * @private + */ + +function getCurrentNodeMethods() { + return http.METHODS && http.METHODS.map(function lowerCaseMethod(method) { + return method.toLowerCase(); + }); +} + +/** + * Get the "basic" Node.js methods, a snapshot from Node.js 0.10. + * @private + */ + +function getBasicNodeMethods() { + return [ + 'get', + 'post', + 'put', + 'head', + 'delete', + 'options', + 'trace', + 'copy', + 'lock', + 'mkcol', + 'move', + 'purge', + 'propfind', + 'proppatch', + 'unlock', + 'report', + 'mkactivity', + 'checkout', + 'merge', + 'm-search', + 'notify', + 'subscribe', + 'unsubscribe', + 'patch', + 'search', + 'connect' + ]; +} diff --git a/8 node/node_modules/methods/package.json b/8 node/node_modules/methods/package.json new file mode 100644 index 000000000..34ef04076 --- /dev/null +++ b/8 node/node_modules/methods/package.json @@ -0,0 +1,79 @@ +{ + "_from": "methods@~1.1.2", + "_id": "methods@1.1.2", + "_inBundle": false, + "_integrity": "sha1-VSmk1nZUE07cxSZmVoNbD4Ua/O4=", + "_location": "/methods", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "methods@~1.1.2", + "name": "methods", + "escapedName": "methods", + "rawSpec": "~1.1.2", + "saveSpec": null, + "fetchSpec": "~1.1.2" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "_shasum": "5529a4d67654134edcc5266656835b0f851afcee", + "_spec": "methods@~1.1.2", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "browser": { + "http": false + }, + "bugs": { + "url": "https://github.com/jshttp/methods/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + } + ], + "deprecated": false, + "description": "HTTP methods that node supports", + "devDependencies": { + "istanbul": "0.4.1", + "mocha": "1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "index.js", + "HISTORY.md", + "LICENSE" + ], + "homepage": "https://github.com/jshttp/methods#readme", + "keywords": [ + "http", + "methods" + ], + "license": "MIT", + "name": "methods", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/methods.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.2" +} diff --git a/8 node/node_modules/mime-db/HISTORY.md b/8 node/node_modules/mime-db/HISTORY.md new file mode 100644 index 000000000..8e4d41318 --- /dev/null +++ b/8 node/node_modules/mime-db/HISTORY.md @@ -0,0 +1,412 @@ +1.27.0 / 2017-03-16 +=================== + + * Add `application/emergencycalldata.control+xml` + * Add `application/emergencycalldata.ecall.msd` + * Add `application/emergencycalldata.veds+xml` + * Add `application/geo+json-seq` + * Add `application/n-quads` + * Add `application/n-triples` + * Add `application/vnd.apothekende.reservation+json` + * Add `application/vnd.efi.img` + * Add `application/vnd.efi.iso` + * Add `application/vnd.imagemeter.image+zip` + * Add `application/vnd.las.las+json` + * Add `application/vnd.ocf+cbor` + * Add `audio/melp` + * Add `audio/melp1200` + * Add `audio/melp2400` + * Add `audio/melp600` + * Add `image/apng` with extension `.apng` + +1.26.0 / 2017-01-14 +=================== + + * Add `application/coap-payload` + * Add `application/cose` + * Add `application/cose-key` + * Add `application/cose-key-set` + * Add `application/mud+json` + * Add `application/trig` + * Add `application/vnd.dataresource+json` + * Add `application/vnd.hc+json` + * Add `application/vnd.tableschema+json` + * Add `application/yang-patch+json` + * Add `application/yang-patch+xml` + * Add extension `.geojson` to `application/geo+json` + +1.25.0 / 2016-11-11 +=================== + + * Add `application/dicom+json` + * Add `application/dicom+xml` + * Add `application/vnd.openstreetmap.data+xml` + * Add `application/vnd.tri.onesource` + * Add `application/yang-data+json` + * Add `application/yang-data+xml` + +1.24.0 / 2016-09-18 +=================== + + * Add `application/clue_info+xml` + * Add `application/geo+json` + * Add `application/lgr+xml` + * Add `application/vnd.amazon.mobi8-ebook` + * Add `application/vnd.chess-pgn` + * Add `application/vnd.comicbook+zip` + * Add `application/vnd.d2l.coursepackage1p0+zip` + * Add `application/vnd.espass-espass+zip` + * Add `application/vnd.nearst.inv+json` + * Add `application/vnd.oma.lwm2m+json` + * Add `application/vnd.oma.lwm2m+tlv` + * Add `application/vnd.quarantainenet` + * Add `application/vnd.rar` + * Add `audio/mp3` + * Add `image/dicom-rle` + * Add `image/emf` + * Add `image/jls` + * Add `image/wmf` + * Add `model/gltf+json` + * Add `text/vnd.ascii-art` + +1.23.0 / 2016-05-01 +=================== + + * Add `application/efi` + * Add `application/vnd.3gpp.sms+xml` + * Add `application/vnd.3lightssoftware.imagescal` + * Add `application/vnd.coreos.ignition+json` + * Add `application/vnd.desmume.movie` + * Add `application/vnd.onepager` + * Add `application/vnd.vel+json` + * Add `text/prs.prop.logic` + * Add `video/encaprtp` + * Add `video/h265` + * Add `video/iso.segment` + * Add `video/raptorfec` + * Add `video/rtploopback` + * Add `video/vnd.radgamettools.bink` + * Add `video/vnd.radgamettools.smacker` + * Add `video/vp8` + * Add extension `.3gpp` to `audio/3gpp` + +1.22.0 / 2016-02-15 +=================== + + * Add `application/ppsp-tracker+json` + * Add `application/problem+json` + * Add `application/problem+xml` + * Add `application/vnd.hdt` + * Add `application/vnd.ms-printschematicket+xml` + * Add `model/vnd.rosette.annotated-data-model` + * Add `text/slim` + * Add extension `.rng` to `application/xml` + * Fix extension of `application/dash+xml` to be `.mpd` + * Update primary extension to `.m4a` for `audio/mp4` + +1.21.0 / 2016-01-06 +=================== + + * Add `application/emergencycalldata.comment+xml` + * Add `application/emergencycalldata.deviceinfo+xml` + * Add `application/emergencycalldata.providerinfo+xml` + * Add `application/emergencycalldata.serviceinfo+xml` + * Add `application/emergencycalldata.subscriberinfo+xml` + * Add `application/vnd.filmit.zfc` + * Add `application/vnd.google-apps.document` + * Add `application/vnd.google-apps.presentation` + * Add `application/vnd.google-apps.spreadsheet` + * Add `application/vnd.mapbox-vector-tile` + * Add `application/vnd.ms-printdevicecapabilities+xml` + * Add `application/vnd.ms-windows.devicepairing` + * Add `application/vnd.ms-windows.nwprinting.oob` + * Add `application/vnd.tml` + * Add `audio/evs` + +1.20.0 / 2015-11-10 +=================== + + * Add `application/cdni` + * Add `application/csvm+json` + * Add `application/rfc+xml` + * Add `application/vnd.3gpp.access-transfer-events+xml` + * Add `application/vnd.3gpp.srvcc-ext+xml` + * Add `application/vnd.ms-windows.wsd.oob` + * Add `application/vnd.oxli.countgraph` + * Add `application/vnd.pagerduty+json` + * Add `text/x-suse-ymp` + +1.19.0 / 2015-09-17 +=================== + + * Add `application/vnd.3gpp-prose-pc3ch+xml` + * Add `application/vnd.3gpp.srvcc-info+xml` + * Add `application/vnd.apple.pkpass` + * Add `application/vnd.drive+json` + +1.18.0 / 2015-09-03 +=================== + + * Add `application/pkcs12` + * Add `application/vnd.3gpp-prose+xml` + * Add `application/vnd.3gpp.mid-call+xml` + * Add `application/vnd.3gpp.state-and-event-info+xml` + * Add `application/vnd.anki` + * Add `application/vnd.firemonkeys.cloudcell` + * Add `application/vnd.openblox.game+xml` + * Add `application/vnd.openblox.game-binary` + +1.17.0 / 2015-08-13 +=================== + + * Add `application/x-msdos-program` + * Add `audio/g711-0` + * Add `image/vnd.mozilla.apng` + * Add extension `.exe` to `application/x-msdos-program` + +1.16.0 / 2015-07-29 +=================== + + * Add `application/vnd.uri-map` + +1.15.0 / 2015-07-13 +=================== + + * Add `application/x-httpd-php` + +1.14.0 / 2015-06-25 +=================== + + * Add `application/scim+json` + * Add `application/vnd.3gpp.ussd+xml` + * Add `application/vnd.biopax.rdf+xml` + * Add `text/x-processing` + +1.13.0 / 2015-06-07 +=================== + + * Add nginx as a source + * Add `application/x-cocoa` + * Add `application/x-java-archive-diff` + * Add `application/x-makeself` + * Add `application/x-perl` + * Add `application/x-pilot` + * Add `application/x-redhat-package-manager` + * Add `application/x-sea` + * Add `audio/x-m4a` + * Add `audio/x-realaudio` + * Add `image/x-jng` + * Add `text/mathml` + +1.12.0 / 2015-06-05 +=================== + + * Add `application/bdoc` + * Add `application/vnd.hyperdrive+json` + * Add `application/x-bdoc` + * Add extension `.rtf` to `text/rtf` + +1.11.0 / 2015-05-31 +=================== + + * Add `audio/wav` + * Add `audio/wave` + * Add extension `.litcoffee` to `text/coffeescript` + * Add extension `.sfd-hdstx` to `application/vnd.hydrostatix.sof-data` + * Add extension `.n-gage` to `application/vnd.nokia.n-gage.symbian.install` + +1.10.0 / 2015-05-19 +=================== + + * Add `application/vnd.balsamiq.bmpr` + * Add `application/vnd.microsoft.portable-executable` + * Add `application/x-ns-proxy-autoconfig` + +1.9.1 / 2015-04-19 +================== + + * Remove `.json` extension from `application/manifest+json` + - This is causing bugs downstream + +1.9.0 / 2015-04-19 +================== + + * Add `application/manifest+json` + * Add `application/vnd.micro+json` + * Add `image/vnd.zbrush.pcx` + * Add `image/x-ms-bmp` + +1.8.0 / 2015-03-13 +================== + + * Add `application/vnd.citationstyles.style+xml` + * Add `application/vnd.fastcopy-disk-image` + * Add `application/vnd.gov.sk.xmldatacontainer+xml` + * Add extension `.jsonld` to `application/ld+json` + +1.7.0 / 2015-02-08 +================== + + * Add `application/vnd.gerber` + * Add `application/vnd.msa-disk-image` + +1.6.1 / 2015-02-05 +================== + + * Community extensions ownership transferred from `node-mime` + +1.6.0 / 2015-01-29 +================== + + * Add `application/jose` + * Add `application/jose+json` + * Add `application/json-seq` + * Add `application/jwk+json` + * Add `application/jwk-set+json` + * Add `application/jwt` + * Add `application/rdap+json` + * Add `application/vnd.gov.sk.e-form+xml` + * Add `application/vnd.ims.imsccv1p3` + +1.5.0 / 2014-12-30 +================== + + * Add `application/vnd.oracle.resource+json` + * Fix various invalid MIME type entries + - `application/mbox+xml` + - `application/oscp-response` + - `application/vwg-multiplexed` + - `audio/g721` + +1.4.0 / 2014-12-21 +================== + + * Add `application/vnd.ims.imsccv1p2` + * Fix various invalid MIME type entries + - `application/vnd-acucobol` + - `application/vnd-curl` + - `application/vnd-dart` + - `application/vnd-dxr` + - `application/vnd-fdf` + - `application/vnd-mif` + - `application/vnd-sema` + - `application/vnd-wap-wmlc` + - `application/vnd.adobe.flash-movie` + - `application/vnd.dece-zip` + - `application/vnd.dvb_service` + - `application/vnd.micrografx-igx` + - `application/vnd.sealed-doc` + - `application/vnd.sealed-eml` + - `application/vnd.sealed-mht` + - `application/vnd.sealed-ppt` + - `application/vnd.sealed-tiff` + - `application/vnd.sealed-xls` + - `application/vnd.sealedmedia.softseal-html` + - `application/vnd.sealedmedia.softseal-pdf` + - `application/vnd.wap-slc` + - `application/vnd.wap-wbxml` + - `audio/vnd.sealedmedia.softseal-mpeg` + - `image/vnd-djvu` + - `image/vnd-svf` + - `image/vnd-wap-wbmp` + - `image/vnd.sealed-png` + - `image/vnd.sealedmedia.softseal-gif` + - `image/vnd.sealedmedia.softseal-jpg` + - `model/vnd-dwf` + - `model/vnd.parasolid.transmit-binary` + - `model/vnd.parasolid.transmit-text` + - `text/vnd-a` + - `text/vnd-curl` + - `text/vnd.wap-wml` + * Remove example template MIME types + - `application/example` + - `audio/example` + - `image/example` + - `message/example` + - `model/example` + - `multipart/example` + - `text/example` + - `video/example` + +1.3.1 / 2014-12-16 +================== + + * Fix missing extensions + - `application/json5` + - `text/hjson` + +1.3.0 / 2014-12-07 +================== + + * Add `application/a2l` + * Add `application/aml` + * Add `application/atfx` + * Add `application/atxml` + * Add `application/cdfx+xml` + * Add `application/dii` + * Add `application/json5` + * Add `application/lxf` + * Add `application/mf4` + * Add `application/vnd.apache.thrift.compact` + * Add `application/vnd.apache.thrift.json` + * Add `application/vnd.coffeescript` + * Add `application/vnd.enphase.envoy` + * Add `application/vnd.ims.imsccv1p1` + * Add `text/csv-schema` + * Add `text/hjson` + * Add `text/markdown` + * Add `text/yaml` + +1.2.0 / 2014-11-09 +================== + + * Add `application/cea` + * Add `application/dit` + * Add `application/vnd.gov.sk.e-form+zip` + * Add `application/vnd.tmd.mediaflex.api+xml` + * Type `application/epub+zip` is now IANA-registered + +1.1.2 / 2014-10-23 +================== + + * Rebuild database for `application/x-www-form-urlencoded` change + +1.1.1 / 2014-10-20 +================== + + * Mark `application/x-www-form-urlencoded` as compressible. + +1.1.0 / 2014-09-28 +================== + + * Add `application/font-woff2` + +1.0.3 / 2014-09-25 +================== + + * Fix engine requirement in package + +1.0.2 / 2014-09-25 +================== + + * Add `application/coap-group+json` + * Add `application/dcd` + * Add `application/vnd.apache.thrift.binary` + * Add `image/vnd.tencent.tap` + * Mark all JSON-derived types as compressible + * Update `text/vtt` data + +1.0.1 / 2014-08-30 +================== + + * Fix extension ordering + +1.0.0 / 2014-08-30 +================== + + * Add `application/atf` + * Add `application/merge-patch+json` + * Add `multipart/x-mixed-replace` + * Add `source: 'apache'` metadata + * Add `source: 'iana'` metadata + * Remove badly-assumed charset data diff --git a/8 node/node_modules/mime-db/LICENSE b/8 node/node_modules/mime-db/LICENSE new file mode 100644 index 000000000..a7ae8ee9b --- /dev/null +++ b/8 node/node_modules/mime-db/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/8 node/node_modules/mime-db/README.md b/8 node/node_modules/mime-db/README.md new file mode 100644 index 000000000..7662440bb --- /dev/null +++ b/8 node/node_modules/mime-db/README.md @@ -0,0 +1,82 @@ +# mime-db + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +This is a database of all mime types. +It consists of a single, public JSON file and does not include any logic, +allowing it to remain as un-opinionated as possible with an API. +It aggregates data from the following sources: + +- http://www.iana.org/assignments/media-types/media-types.xhtml +- http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types +- http://hg.nginx.org/nginx/raw-file/default/conf/mime.types + +## Installation + +```bash +npm install mime-db +``` + +### Database Download + +If you're crazy enough to use this in the browser, you can just grab the +JSON file using [RawGit](https://rawgit.com/). It is recommended to replace +`master` with [a release tag](https://github.com/jshttp/mime-db/tags) as the +JSON format may change in the future. + +``` +https://cdn.rawgit.com/jshttp/mime-db/master/db.json +``` + +## Usage + +```js +var db = require('mime-db'); + +// grab data on .js files +var data = db['application/javascript']; +``` + +## Data Structure + +The JSON file is a map lookup for lowercased mime types. +Each mime type has the following properties: + +- `.source` - where the mime type is defined. + If not set, it's probably a custom media type. + - `apache` - [Apache common media types](http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types) + - `iana` - [IANA-defined media types](http://www.iana.org/assignments/media-types/media-types.xhtml) + - `nginx` - [nginx media types](http://hg.nginx.org/nginx/raw-file/default/conf/mime.types) +- `.extensions[]` - known extensions associated with this mime type. +- `.compressible` - whether a file of this type can be gzipped. +- `.charset` - the default charset associated with this type, if any. + +If unknown, every property could be `undefined`. + +## Contributing + +To edit the database, only make PRs against `src/custom.json` or +`src/custom-suffix.json`. + +To update the build, run `npm run build`. + +## Adding Custom Media Types + +The best way to get new media types included in this library is to register +them with the IANA. The community registration procedure is outlined in +[RFC 6838 section 5](http://tools.ietf.org/html/rfc6838#section-5). Types +registered with the IANA are automatically pulled into this library. + +[npm-version-image]: https://img.shields.io/npm/v/mime-db.svg +[npm-downloads-image]: https://img.shields.io/npm/dm/mime-db.svg +[npm-url]: https://npmjs.org/package/mime-db +[travis-image]: https://img.shields.io/travis/jshttp/mime-db/master.svg +[travis-url]: https://travis-ci.org/jshttp/mime-db +[coveralls-image]: https://img.shields.io/coveralls/jshttp/mime-db/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/mime-db?branch=master +[node-image]: https://img.shields.io/node/v/mime-db.svg +[node-url]: http://nodejs.org/download/ diff --git a/8 node/node_modules/mime-db/db.json b/8 node/node_modules/mime-db/db.json new file mode 100644 index 000000000..2c5151790 --- /dev/null +++ b/8 node/node_modules/mime-db/db.json @@ -0,0 +1,6805 @@ +{ + "application/1d-interleaved-parityfec": { + "source": "iana" + }, + "application/3gpdash-qoe-report+xml": { + "source": "iana" + }, + "application/3gpp-ims+xml": { + "source": "iana" + }, + "application/a2l": { + "source": "iana" + }, + "application/activemessage": { + "source": "iana" + }, + "application/alto-costmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-costmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/alto-directory+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcost+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcostparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointprop+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointpropparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-error+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/aml": { + "source": "iana" + }, + "application/andrew-inset": { + "source": "iana", + "extensions": ["ez"] + }, + "application/applefile": { + "source": "iana" + }, + "application/applixware": { + "source": "apache", + "extensions": ["aw"] + }, + "application/atf": { + "source": "iana" + }, + "application/atfx": { + "source": "iana" + }, + "application/atom+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atom"] + }, + "application/atomcat+xml": { + "source": "iana", + "extensions": ["atomcat"] + }, + "application/atomdeleted+xml": { + "source": "iana" + }, + "application/atomicmail": { + "source": "iana" + }, + "application/atomsvc+xml": { + "source": "iana", + "extensions": ["atomsvc"] + }, + "application/atxml": { + "source": "iana" + }, + "application/auth-policy+xml": { + "source": "iana" + }, + "application/bacnet-xdd+zip": { + "source": "iana" + }, + "application/batch-smtp": { + "source": "iana" + }, + "application/bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/beep+xml": { + "source": "iana" + }, + "application/calendar+json": { + "source": "iana", + "compressible": true + }, + "application/calendar+xml": { + "source": "iana" + }, + "application/call-completion": { + "source": "iana" + }, + "application/cals-1840": { + "source": "iana" + }, + "application/cbor": { + "source": "iana" + }, + "application/ccmp+xml": { + "source": "iana" + }, + "application/ccxml+xml": { + "source": "iana", + "extensions": ["ccxml"] + }, + "application/cdfx+xml": { + "source": "iana" + }, + "application/cdmi-capability": { + "source": "iana", + "extensions": ["cdmia"] + }, + "application/cdmi-container": { + "source": "iana", + "extensions": ["cdmic"] + }, + "application/cdmi-domain": { + "source": "iana", + "extensions": ["cdmid"] + }, + "application/cdmi-object": { + "source": "iana", + "extensions": ["cdmio"] + }, + "application/cdmi-queue": { + "source": "iana", + "extensions": ["cdmiq"] + }, + "application/cdni": { + "source": "iana" + }, + "application/cea": { + "source": "iana" + }, + "application/cea-2018+xml": { + "source": "iana" + }, + "application/cellml+xml": { + "source": "iana" + }, + "application/cfw": { + "source": "iana" + }, + "application/clue_info+xml": { + "source": "iana" + }, + "application/cms": { + "source": "iana" + }, + "application/cnrp+xml": { + "source": "iana" + }, + "application/coap-group+json": { + "source": "iana", + "compressible": true + }, + "application/coap-payload": { + "source": "iana" + }, + "application/commonground": { + "source": "iana" + }, + "application/conference-info+xml": { + "source": "iana" + }, + "application/cose": { + "source": "iana" + }, + "application/cose-key": { + "source": "iana" + }, + "application/cose-key-set": { + "source": "iana" + }, + "application/cpl+xml": { + "source": "iana" + }, + "application/csrattrs": { + "source": "iana" + }, + "application/csta+xml": { + "source": "iana" + }, + "application/cstadata+xml": { + "source": "iana" + }, + "application/csvm+json": { + "source": "iana", + "compressible": true + }, + "application/cu-seeme": { + "source": "apache", + "extensions": ["cu"] + }, + "application/cybercash": { + "source": "iana" + }, + "application/dart": { + "compressible": true + }, + "application/dash+xml": { + "source": "iana", + "extensions": ["mpd"] + }, + "application/dashdelta": { + "source": "iana" + }, + "application/davmount+xml": { + "source": "iana", + "extensions": ["davmount"] + }, + "application/dca-rft": { + "source": "iana" + }, + "application/dcd": { + "source": "iana" + }, + "application/dec-dx": { + "source": "iana" + }, + "application/dialog-info+xml": { + "source": "iana" + }, + "application/dicom": { + "source": "iana" + }, + "application/dicom+json": { + "source": "iana", + "compressible": true + }, + "application/dicom+xml": { + "source": "iana" + }, + "application/dii": { + "source": "iana" + }, + "application/dit": { + "source": "iana" + }, + "application/dns": { + "source": "iana" + }, + "application/docbook+xml": { + "source": "apache", + "extensions": ["dbk"] + }, + "application/dskpp+xml": { + "source": "iana" + }, + "application/dssc+der": { + "source": "iana", + "extensions": ["dssc"] + }, + "application/dssc+xml": { + "source": "iana", + "extensions": ["xdssc"] + }, + "application/dvcs": { + "source": "iana" + }, + "application/ecmascript": { + "source": "iana", + "compressible": true, + "extensions": ["ecma"] + }, + "application/edi-consent": { + "source": "iana" + }, + "application/edi-x12": { + "source": "iana", + "compressible": false + }, + "application/edifact": { + "source": "iana", + "compressible": false + }, + "application/efi": { + "source": "iana" + }, + "application/emergencycalldata.comment+xml": { + "source": "iana" + }, + "application/emergencycalldata.control+xml": { + "source": "iana" + }, + "application/emergencycalldata.deviceinfo+xml": { + "source": "iana" + }, + "application/emergencycalldata.ecall.msd": { + "source": "iana" + }, + "application/emergencycalldata.providerinfo+xml": { + "source": "iana" + }, + "application/emergencycalldata.serviceinfo+xml": { + "source": "iana" + }, + "application/emergencycalldata.subscriberinfo+xml": { + "source": "iana" + }, + "application/emergencycalldata.veds+xml": { + "source": "iana" + }, + "application/emma+xml": { + "source": "iana", + "extensions": ["emma"] + }, + "application/emotionml+xml": { + "source": "iana" + }, + "application/encaprtp": { + "source": "iana" + }, + "application/epp+xml": { + "source": "iana" + }, + "application/epub+zip": { + "source": "iana", + "extensions": ["epub"] + }, + "application/eshop": { + "source": "iana" + }, + "application/exi": { + "source": "iana", + "extensions": ["exi"] + }, + "application/fastinfoset": { + "source": "iana" + }, + "application/fastsoap": { + "source": "iana" + }, + "application/fdt+xml": { + "source": "iana" + }, + "application/fits": { + "source": "iana" + }, + "application/font-sfnt": { + "source": "iana" + }, + "application/font-tdpfr": { + "source": "iana", + "extensions": ["pfr"] + }, + "application/font-woff": { + "source": "iana", + "compressible": false, + "extensions": ["woff"] + }, + "application/font-woff2": { + "compressible": false, + "extensions": ["woff2"] + }, + "application/framework-attributes+xml": { + "source": "iana" + }, + "application/geo+json": { + "source": "iana", + "compressible": true, + "extensions": ["geojson"] + }, + "application/geo+json-seq": { + "source": "iana" + }, + "application/gml+xml": { + "source": "iana", + "extensions": ["gml"] + }, + "application/gpx+xml": { + "source": "apache", + "extensions": ["gpx"] + }, + "application/gxf": { + "source": "apache", + "extensions": ["gxf"] + }, + "application/gzip": { + "source": "iana", + "compressible": false + }, + "application/h224": { + "source": "iana" + }, + "application/held+xml": { + "source": "iana" + }, + "application/http": { + "source": "iana" + }, + "application/hyperstudio": { + "source": "iana", + "extensions": ["stk"] + }, + "application/ibe-key-request+xml": { + "source": "iana" + }, + "application/ibe-pkg-reply+xml": { + "source": "iana" + }, + "application/ibe-pp-data": { + "source": "iana" + }, + "application/iges": { + "source": "iana" + }, + "application/im-iscomposing+xml": { + "source": "iana" + }, + "application/index": { + "source": "iana" + }, + "application/index.cmd": { + "source": "iana" + }, + "application/index.obj": { + "source": "iana" + }, + "application/index.response": { + "source": "iana" + }, + "application/index.vnd": { + "source": "iana" + }, + "application/inkml+xml": { + "source": "iana", + "extensions": ["ink","inkml"] + }, + "application/iotp": { + "source": "iana" + }, + "application/ipfix": { + "source": "iana", + "extensions": ["ipfix"] + }, + "application/ipp": { + "source": "iana" + }, + "application/isup": { + "source": "iana" + }, + "application/its+xml": { + "source": "iana" + }, + "application/java-archive": { + "source": "apache", + "compressible": false, + "extensions": ["jar","war","ear"] + }, + "application/java-serialized-object": { + "source": "apache", + "compressible": false, + "extensions": ["ser"] + }, + "application/java-vm": { + "source": "apache", + "compressible": false, + "extensions": ["class"] + }, + "application/javascript": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["js"] + }, + "application/jose": { + "source": "iana" + }, + "application/jose+json": { + "source": "iana", + "compressible": true + }, + "application/jrd+json": { + "source": "iana", + "compressible": true + }, + "application/json": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["json","map"] + }, + "application/json-patch+json": { + "source": "iana", + "compressible": true + }, + "application/json-seq": { + "source": "iana" + }, + "application/json5": { + "extensions": ["json5"] + }, + "application/jsonml+json": { + "source": "apache", + "compressible": true, + "extensions": ["jsonml"] + }, + "application/jwk+json": { + "source": "iana", + "compressible": true + }, + "application/jwk-set+json": { + "source": "iana", + "compressible": true + }, + "application/jwt": { + "source": "iana" + }, + "application/kpml-request+xml": { + "source": "iana" + }, + "application/kpml-response+xml": { + "source": "iana" + }, + "application/ld+json": { + "source": "iana", + "compressible": true, + "extensions": ["jsonld"] + }, + "application/lgr+xml": { + "source": "iana" + }, + "application/link-format": { + "source": "iana" + }, + "application/load-control+xml": { + "source": "iana" + }, + "application/lost+xml": { + "source": "iana", + "extensions": ["lostxml"] + }, + "application/lostsync+xml": { + "source": "iana" + }, + "application/lxf": { + "source": "iana" + }, + "application/mac-binhex40": { + "source": "iana", + "extensions": ["hqx"] + }, + "application/mac-compactpro": { + "source": "apache", + "extensions": ["cpt"] + }, + "application/macwriteii": { + "source": "iana" + }, + "application/mads+xml": { + "source": "iana", + "extensions": ["mads"] + }, + "application/manifest+json": { + "charset": "UTF-8", + "compressible": true, + "extensions": ["webmanifest"] + }, + "application/marc": { + "source": "iana", + "extensions": ["mrc"] + }, + "application/marcxml+xml": { + "source": "iana", + "extensions": ["mrcx"] + }, + "application/mathematica": { + "source": "iana", + "extensions": ["ma","nb","mb"] + }, + "application/mathml+xml": { + "source": "iana", + "extensions": ["mathml"] + }, + "application/mathml-content+xml": { + "source": "iana" + }, + "application/mathml-presentation+xml": { + "source": "iana" + }, + "application/mbms-associated-procedure-description+xml": { + "source": "iana" + }, + "application/mbms-deregister+xml": { + "source": "iana" + }, + "application/mbms-envelope+xml": { + "source": "iana" + }, + "application/mbms-msk+xml": { + "source": "iana" + }, + "application/mbms-msk-response+xml": { + "source": "iana" + }, + "application/mbms-protection-description+xml": { + "source": "iana" + }, + "application/mbms-reception-report+xml": { + "source": "iana" + }, + "application/mbms-register+xml": { + "source": "iana" + }, + "application/mbms-register-response+xml": { + "source": "iana" + }, + "application/mbms-schedule+xml": { + "source": "iana" + }, + "application/mbms-user-service-description+xml": { + "source": "iana" + }, + "application/mbox": { + "source": "iana", + "extensions": ["mbox"] + }, + "application/media-policy-dataset+xml": { + "source": "iana" + }, + "application/media_control+xml": { + "source": "iana" + }, + "application/mediaservercontrol+xml": { + "source": "iana", + "extensions": ["mscml"] + }, + "application/merge-patch+json": { + "source": "iana", + "compressible": true + }, + "application/metalink+xml": { + "source": "apache", + "extensions": ["metalink"] + }, + "application/metalink4+xml": { + "source": "iana", + "extensions": ["meta4"] + }, + "application/mets+xml": { + "source": "iana", + "extensions": ["mets"] + }, + "application/mf4": { + "source": "iana" + }, + "application/mikey": { + "source": "iana" + }, + "application/mods+xml": { + "source": "iana", + "extensions": ["mods"] + }, + "application/moss-keys": { + "source": "iana" + }, + "application/moss-signature": { + "source": "iana" + }, + "application/mosskey-data": { + "source": "iana" + }, + "application/mosskey-request": { + "source": "iana" + }, + "application/mp21": { + "source": "iana", + "extensions": ["m21","mp21"] + }, + "application/mp4": { + "source": "iana", + "extensions": ["mp4s","m4p"] + }, + "application/mpeg4-generic": { + "source": "iana" + }, + "application/mpeg4-iod": { + "source": "iana" + }, + "application/mpeg4-iod-xmt": { + "source": "iana" + }, + "application/mrb-consumer+xml": { + "source": "iana" + }, + "application/mrb-publish+xml": { + "source": "iana" + }, + "application/msc-ivr+xml": { + "source": "iana" + }, + "application/msc-mixer+xml": { + "source": "iana" + }, + "application/msword": { + "source": "iana", + "compressible": false, + "extensions": ["doc","dot"] + }, + "application/mud+json": { + "source": "iana", + "compressible": true + }, + "application/mxf": { + "source": "iana", + "extensions": ["mxf"] + }, + "application/n-quads": { + "source": "iana" + }, + "application/n-triples": { + "source": "iana" + }, + "application/nasdata": { + "source": "iana" + }, + "application/news-checkgroups": { + "source": "iana" + }, + "application/news-groupinfo": { + "source": "iana" + }, + "application/news-transmission": { + "source": "iana" + }, + "application/nlsml+xml": { + "source": "iana" + }, + "application/nss": { + "source": "iana" + }, + "application/ocsp-request": { + "source": "iana" + }, + "application/ocsp-response": { + "source": "iana" + }, + "application/octet-stream": { + "source": "iana", + "compressible": false, + "extensions": ["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"] + }, + "application/oda": { + "source": "iana", + "extensions": ["oda"] + }, + "application/odx": { + "source": "iana" + }, + "application/oebps-package+xml": { + "source": "iana", + "extensions": ["opf"] + }, + "application/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["ogx"] + }, + "application/omdoc+xml": { + "source": "apache", + "extensions": ["omdoc"] + }, + "application/onenote": { + "source": "apache", + "extensions": ["onetoc","onetoc2","onetmp","onepkg"] + }, + "application/oxps": { + "source": "iana", + "extensions": ["oxps"] + }, + "application/p2p-overlay+xml": { + "source": "iana" + }, + "application/parityfec": { + "source": "iana" + }, + "application/patch-ops-error+xml": { + "source": "iana", + "extensions": ["xer"] + }, + "application/pdf": { + "source": "iana", + "compressible": false, + "extensions": ["pdf"] + }, + "application/pdx": { + "source": "iana" + }, + "application/pgp-encrypted": { + "source": "iana", + "compressible": false, + "extensions": ["pgp"] + }, + "application/pgp-keys": { + "source": "iana" + }, + "application/pgp-signature": { + "source": "iana", + "extensions": ["asc","sig"] + }, + "application/pics-rules": { + "source": "apache", + "extensions": ["prf"] + }, + "application/pidf+xml": { + "source": "iana" + }, + "application/pidf-diff+xml": { + "source": "iana" + }, + "application/pkcs10": { + "source": "iana", + "extensions": ["p10"] + }, + "application/pkcs12": { + "source": "iana" + }, + "application/pkcs7-mime": { + "source": "iana", + "extensions": ["p7m","p7c"] + }, + "application/pkcs7-signature": { + "source": "iana", + "extensions": ["p7s"] + }, + "application/pkcs8": { + "source": "iana", + "extensions": ["p8"] + }, + "application/pkix-attr-cert": { + "source": "iana", + "extensions": ["ac"] + }, + "application/pkix-cert": { + "source": "iana", + "extensions": ["cer"] + }, + "application/pkix-crl": { + "source": "iana", + "extensions": ["crl"] + }, + "application/pkix-pkipath": { + "source": "iana", + "extensions": ["pkipath"] + }, + "application/pkixcmp": { + "source": "iana", + "extensions": ["pki"] + }, + "application/pls+xml": { + "source": "iana", + "extensions": ["pls"] + }, + "application/poc-settings+xml": { + "source": "iana" + }, + "application/postscript": { + "source": "iana", + "compressible": true, + "extensions": ["ai","eps","ps"] + }, + "application/ppsp-tracker+json": { + "source": "iana", + "compressible": true + }, + "application/problem+json": { + "source": "iana", + "compressible": true + }, + "application/problem+xml": { + "source": "iana" + }, + "application/provenance+xml": { + "source": "iana" + }, + "application/prs.alvestrand.titrax-sheet": { + "source": "iana" + }, + "application/prs.cww": { + "source": "iana", + "extensions": ["cww"] + }, + "application/prs.hpub+zip": { + "source": "iana" + }, + "application/prs.nprend": { + "source": "iana" + }, + "application/prs.plucker": { + "source": "iana" + }, + "application/prs.rdf-xml-crypt": { + "source": "iana" + }, + "application/prs.xsf+xml": { + "source": "iana" + }, + "application/pskc+xml": { + "source": "iana", + "extensions": ["pskcxml"] + }, + "application/qsig": { + "source": "iana" + }, + "application/raptorfec": { + "source": "iana" + }, + "application/rdap+json": { + "source": "iana", + "compressible": true + }, + "application/rdf+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rdf"] + }, + "application/reginfo+xml": { + "source": "iana", + "extensions": ["rif"] + }, + "application/relax-ng-compact-syntax": { + "source": "iana", + "extensions": ["rnc"] + }, + "application/remote-printing": { + "source": "iana" + }, + "application/reputon+json": { + "source": "iana", + "compressible": true + }, + "application/resource-lists+xml": { + "source": "iana", + "extensions": ["rl"] + }, + "application/resource-lists-diff+xml": { + "source": "iana", + "extensions": ["rld"] + }, + "application/rfc+xml": { + "source": "iana" + }, + "application/riscos": { + "source": "iana" + }, + "application/rlmi+xml": { + "source": "iana" + }, + "application/rls-services+xml": { + "source": "iana", + "extensions": ["rs"] + }, + "application/rpki-ghostbusters": { + "source": "iana", + "extensions": ["gbr"] + }, + "application/rpki-manifest": { + "source": "iana", + "extensions": ["mft"] + }, + "application/rpki-roa": { + "source": "iana", + "extensions": ["roa"] + }, + "application/rpki-updown": { + "source": "iana" + }, + "application/rsd+xml": { + "source": "apache", + "extensions": ["rsd"] + }, + "application/rss+xml": { + "source": "apache", + "compressible": true, + "extensions": ["rss"] + }, + "application/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "application/rtploopback": { + "source": "iana" + }, + "application/rtx": { + "source": "iana" + }, + "application/samlassertion+xml": { + "source": "iana" + }, + "application/samlmetadata+xml": { + "source": "iana" + }, + "application/sbml+xml": { + "source": "iana", + "extensions": ["sbml"] + }, + "application/scaip+xml": { + "source": "iana" + }, + "application/scim+json": { + "source": "iana", + "compressible": true + }, + "application/scvp-cv-request": { + "source": "iana", + "extensions": ["scq"] + }, + "application/scvp-cv-response": { + "source": "iana", + "extensions": ["scs"] + }, + "application/scvp-vp-request": { + "source": "iana", + "extensions": ["spq"] + }, + "application/scvp-vp-response": { + "source": "iana", + "extensions": ["spp"] + }, + "application/sdp": { + "source": "iana", + "extensions": ["sdp"] + }, + "application/sep+xml": { + "source": "iana" + }, + "application/sep-exi": { + "source": "iana" + }, + "application/session-info": { + "source": "iana" + }, + "application/set-payment": { + "source": "iana" + }, + "application/set-payment-initiation": { + "source": "iana", + "extensions": ["setpay"] + }, + "application/set-registration": { + "source": "iana" + }, + "application/set-registration-initiation": { + "source": "iana", + "extensions": ["setreg"] + }, + "application/sgml": { + "source": "iana" + }, + "application/sgml-open-catalog": { + "source": "iana" + }, + "application/shf+xml": { + "source": "iana", + "extensions": ["shf"] + }, + "application/sieve": { + "source": "iana" + }, + "application/simple-filter+xml": { + "source": "iana" + }, + "application/simple-message-summary": { + "source": "iana" + }, + "application/simplesymbolcontainer": { + "source": "iana" + }, + "application/slate": { + "source": "iana" + }, + "application/smil": { + "source": "iana" + }, + "application/smil+xml": { + "source": "iana", + "extensions": ["smi","smil"] + }, + "application/smpte336m": { + "source": "iana" + }, + "application/soap+fastinfoset": { + "source": "iana" + }, + "application/soap+xml": { + "source": "iana", + "compressible": true + }, + "application/sparql-query": { + "source": "iana", + "extensions": ["rq"] + }, + "application/sparql-results+xml": { + "source": "iana", + "extensions": ["srx"] + }, + "application/spirits-event+xml": { + "source": "iana" + }, + "application/sql": { + "source": "iana" + }, + "application/srgs": { + "source": "iana", + "extensions": ["gram"] + }, + "application/srgs+xml": { + "source": "iana", + "extensions": ["grxml"] + }, + "application/sru+xml": { + "source": "iana", + "extensions": ["sru"] + }, + "application/ssdl+xml": { + "source": "apache", + "extensions": ["ssdl"] + }, + "application/ssml+xml": { + "source": "iana", + "extensions": ["ssml"] + }, + "application/tamp-apex-update": { + "source": "iana" + }, + "application/tamp-apex-update-confirm": { + "source": "iana" + }, + "application/tamp-community-update": { + "source": "iana" + }, + "application/tamp-community-update-confirm": { + "source": "iana" + }, + "application/tamp-error": { + "source": "iana" + }, + "application/tamp-sequence-adjust": { + "source": "iana" + }, + "application/tamp-sequence-adjust-confirm": { + "source": "iana" + }, + "application/tamp-status-query": { + "source": "iana" + }, + "application/tamp-status-response": { + "source": "iana" + }, + "application/tamp-update": { + "source": "iana" + }, + "application/tamp-update-confirm": { + "source": "iana" + }, + "application/tar": { + "compressible": true + }, + "application/tei+xml": { + "source": "iana", + "extensions": ["tei","teicorpus"] + }, + "application/thraud+xml": { + "source": "iana", + "extensions": ["tfi"] + }, + "application/timestamp-query": { + "source": "iana" + }, + "application/timestamp-reply": { + "source": "iana" + }, + "application/timestamped-data": { + "source": "iana", + "extensions": ["tsd"] + }, + "application/trig": { + "source": "iana" + }, + "application/ttml+xml": { + "source": "iana" + }, + "application/tve-trigger": { + "source": "iana" + }, + "application/ulpfec": { + "source": "iana" + }, + "application/urc-grpsheet+xml": { + "source": "iana" + }, + "application/urc-ressheet+xml": { + "source": "iana" + }, + "application/urc-targetdesc+xml": { + "source": "iana" + }, + "application/urc-uisocketdesc+xml": { + "source": "iana" + }, + "application/vcard+json": { + "source": "iana", + "compressible": true + }, + "application/vcard+xml": { + "source": "iana" + }, + "application/vemmi": { + "source": "iana" + }, + "application/vividence.scriptfile": { + "source": "apache" + }, + "application/vnd.3gpp-prose+xml": { + "source": "iana" + }, + "application/vnd.3gpp-prose-pc3ch+xml": { + "source": "iana" + }, + "application/vnd.3gpp.access-transfer-events+xml": { + "source": "iana" + }, + "application/vnd.3gpp.bsf+xml": { + "source": "iana" + }, + "application/vnd.3gpp.mid-call+xml": { + "source": "iana" + }, + "application/vnd.3gpp.pic-bw-large": { + "source": "iana", + "extensions": ["plb"] + }, + "application/vnd.3gpp.pic-bw-small": { + "source": "iana", + "extensions": ["psb"] + }, + "application/vnd.3gpp.pic-bw-var": { + "source": "iana", + "extensions": ["pvb"] + }, + "application/vnd.3gpp.sms": { + "source": "iana" + }, + "application/vnd.3gpp.sms+xml": { + "source": "iana" + }, + "application/vnd.3gpp.srvcc-ext+xml": { + "source": "iana" + }, + "application/vnd.3gpp.srvcc-info+xml": { + "source": "iana" + }, + "application/vnd.3gpp.state-and-event-info+xml": { + "source": "iana" + }, + "application/vnd.3gpp.ussd+xml": { + "source": "iana" + }, + "application/vnd.3gpp2.bcmcsinfo+xml": { + "source": "iana" + }, + "application/vnd.3gpp2.sms": { + "source": "iana" + }, + "application/vnd.3gpp2.tcap": { + "source": "iana", + "extensions": ["tcap"] + }, + "application/vnd.3lightssoftware.imagescal": { + "source": "iana" + }, + "application/vnd.3m.post-it-notes": { + "source": "iana", + "extensions": ["pwn"] + }, + "application/vnd.accpac.simply.aso": { + "source": "iana", + "extensions": ["aso"] + }, + "application/vnd.accpac.simply.imp": { + "source": "iana", + "extensions": ["imp"] + }, + "application/vnd.acucobol": { + "source": "iana", + "extensions": ["acu"] + }, + "application/vnd.acucorp": { + "source": "iana", + "extensions": ["atc","acutc"] + }, + "application/vnd.adobe.air-application-installer-package+zip": { + "source": "apache", + "extensions": ["air"] + }, + "application/vnd.adobe.flash.movie": { + "source": "iana" + }, + "application/vnd.adobe.formscentral.fcdt": { + "source": "iana", + "extensions": ["fcdt"] + }, + "application/vnd.adobe.fxp": { + "source": "iana", + "extensions": ["fxp","fxpl"] + }, + "application/vnd.adobe.partial-upload": { + "source": "iana" + }, + "application/vnd.adobe.xdp+xml": { + "source": "iana", + "extensions": ["xdp"] + }, + "application/vnd.adobe.xfdf": { + "source": "iana", + "extensions": ["xfdf"] + }, + "application/vnd.aether.imp": { + "source": "iana" + }, + "application/vnd.ah-barcode": { + "source": "iana" + }, + "application/vnd.ahead.space": { + "source": "iana", + "extensions": ["ahead"] + }, + "application/vnd.airzip.filesecure.azf": { + "source": "iana", + "extensions": ["azf"] + }, + "application/vnd.airzip.filesecure.azs": { + "source": "iana", + "extensions": ["azs"] + }, + "application/vnd.amazon.ebook": { + "source": "apache", + "extensions": ["azw"] + }, + "application/vnd.amazon.mobi8-ebook": { + "source": "iana" + }, + "application/vnd.americandynamics.acc": { + "source": "iana", + "extensions": ["acc"] + }, + "application/vnd.amiga.ami": { + "source": "iana", + "extensions": ["ami"] + }, + "application/vnd.amundsen.maze+xml": { + "source": "iana" + }, + "application/vnd.android.package-archive": { + "source": "apache", + "compressible": false, + "extensions": ["apk"] + }, + "application/vnd.anki": { + "source": "iana" + }, + "application/vnd.anser-web-certificate-issue-initiation": { + "source": "iana", + "extensions": ["cii"] + }, + "application/vnd.anser-web-funds-transfer-initiation": { + "source": "apache", + "extensions": ["fti"] + }, + "application/vnd.antix.game-component": { + "source": "iana", + "extensions": ["atx"] + }, + "application/vnd.apache.thrift.binary": { + "source": "iana" + }, + "application/vnd.apache.thrift.compact": { + "source": "iana" + }, + "application/vnd.apache.thrift.json": { + "source": "iana" + }, + "application/vnd.api+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.apothekende.reservation+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.apple.installer+xml": { + "source": "iana", + "extensions": ["mpkg"] + }, + "application/vnd.apple.mpegurl": { + "source": "iana", + "extensions": ["m3u8"] + }, + "application/vnd.apple.pkpass": { + "compressible": false, + "extensions": ["pkpass"] + }, + "application/vnd.arastra.swi": { + "source": "iana" + }, + "application/vnd.aristanetworks.swi": { + "source": "iana", + "extensions": ["swi"] + }, + "application/vnd.artsquare": { + "source": "iana" + }, + "application/vnd.astraea-software.iota": { + "source": "iana", + "extensions": ["iota"] + }, + "application/vnd.audiograph": { + "source": "iana", + "extensions": ["aep"] + }, + "application/vnd.autopackage": { + "source": "iana" + }, + "application/vnd.avistar+xml": { + "source": "iana" + }, + "application/vnd.balsamiq.bmml+xml": { + "source": "iana" + }, + "application/vnd.balsamiq.bmpr": { + "source": "iana" + }, + "application/vnd.bekitzur-stech+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.biopax.rdf+xml": { + "source": "iana" + }, + "application/vnd.blueice.multipass": { + "source": "iana", + "extensions": ["mpm"] + }, + "application/vnd.bluetooth.ep.oob": { + "source": "iana" + }, + "application/vnd.bluetooth.le.oob": { + "source": "iana" + }, + "application/vnd.bmi": { + "source": "iana", + "extensions": ["bmi"] + }, + "application/vnd.businessobjects": { + "source": "iana", + "extensions": ["rep"] + }, + "application/vnd.cab-jscript": { + "source": "iana" + }, + "application/vnd.canon-cpdl": { + "source": "iana" + }, + "application/vnd.canon-lips": { + "source": "iana" + }, + "application/vnd.cendio.thinlinc.clientconf": { + "source": "iana" + }, + "application/vnd.century-systems.tcp_stream": { + "source": "iana" + }, + "application/vnd.chemdraw+xml": { + "source": "iana", + "extensions": ["cdxml"] + }, + "application/vnd.chess-pgn": { + "source": "iana" + }, + "application/vnd.chipnuts.karaoke-mmd": { + "source": "iana", + "extensions": ["mmd"] + }, + "application/vnd.cinderella": { + "source": "iana", + "extensions": ["cdy"] + }, + "application/vnd.cirpack.isdn-ext": { + "source": "iana" + }, + "application/vnd.citationstyles.style+xml": { + "source": "iana" + }, + "application/vnd.claymore": { + "source": "iana", + "extensions": ["cla"] + }, + "application/vnd.cloanto.rp9": { + "source": "iana", + "extensions": ["rp9"] + }, + "application/vnd.clonk.c4group": { + "source": "iana", + "extensions": ["c4g","c4d","c4f","c4p","c4u"] + }, + "application/vnd.cluetrust.cartomobile-config": { + "source": "iana", + "extensions": ["c11amc"] + }, + "application/vnd.cluetrust.cartomobile-config-pkg": { + "source": "iana", + "extensions": ["c11amz"] + }, + "application/vnd.coffeescript": { + "source": "iana" + }, + "application/vnd.collection+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.doc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.next+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.comicbook+zip": { + "source": "iana" + }, + "application/vnd.commerce-battelle": { + "source": "iana" + }, + "application/vnd.commonspace": { + "source": "iana", + "extensions": ["csp"] + }, + "application/vnd.contact.cmsg": { + "source": "iana", + "extensions": ["cdbcmsg"] + }, + "application/vnd.coreos.ignition+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cosmocaller": { + "source": "iana", + "extensions": ["cmc"] + }, + "application/vnd.crick.clicker": { + "source": "iana", + "extensions": ["clkx"] + }, + "application/vnd.crick.clicker.keyboard": { + "source": "iana", + "extensions": ["clkk"] + }, + "application/vnd.crick.clicker.palette": { + "source": "iana", + "extensions": ["clkp"] + }, + "application/vnd.crick.clicker.template": { + "source": "iana", + "extensions": ["clkt"] + }, + "application/vnd.crick.clicker.wordbank": { + "source": "iana", + "extensions": ["clkw"] + }, + "application/vnd.criticaltools.wbs+xml": { + "source": "iana", + "extensions": ["wbs"] + }, + "application/vnd.ctc-posml": { + "source": "iana", + "extensions": ["pml"] + }, + "application/vnd.ctct.ws+xml": { + "source": "iana" + }, + "application/vnd.cups-pdf": { + "source": "iana" + }, + "application/vnd.cups-postscript": { + "source": "iana" + }, + "application/vnd.cups-ppd": { + "source": "iana", + "extensions": ["ppd"] + }, + "application/vnd.cups-raster": { + "source": "iana" + }, + "application/vnd.cups-raw": { + "source": "iana" + }, + "application/vnd.curl": { + "source": "iana" + }, + "application/vnd.curl.car": { + "source": "apache", + "extensions": ["car"] + }, + "application/vnd.curl.pcurl": { + "source": "apache", + "extensions": ["pcurl"] + }, + "application/vnd.cyan.dean.root+xml": { + "source": "iana" + }, + "application/vnd.cybank": { + "source": "iana" + }, + "application/vnd.d2l.coursepackage1p0+zip": { + "source": "iana" + }, + "application/vnd.dart": { + "source": "iana", + "compressible": true, + "extensions": ["dart"] + }, + "application/vnd.data-vision.rdz": { + "source": "iana", + "extensions": ["rdz"] + }, + "application/vnd.dataresource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.debian.binary-package": { + "source": "iana" + }, + "application/vnd.dece.data": { + "source": "iana", + "extensions": ["uvf","uvvf","uvd","uvvd"] + }, + "application/vnd.dece.ttml+xml": { + "source": "iana", + "extensions": ["uvt","uvvt"] + }, + "application/vnd.dece.unspecified": { + "source": "iana", + "extensions": ["uvx","uvvx"] + }, + "application/vnd.dece.zip": { + "source": "iana", + "extensions": ["uvz","uvvz"] + }, + "application/vnd.denovo.fcselayout-link": { + "source": "iana", + "extensions": ["fe_launch"] + }, + "application/vnd.desmume-movie": { + "source": "iana" + }, + "application/vnd.desmume.movie": { + "source": "apache" + }, + "application/vnd.dir-bi.plate-dl-nosuffix": { + "source": "iana" + }, + "application/vnd.dm.delegation+xml": { + "source": "iana" + }, + "application/vnd.dna": { + "source": "iana", + "extensions": ["dna"] + }, + "application/vnd.document+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dolby.mlp": { + "source": "apache", + "extensions": ["mlp"] + }, + "application/vnd.dolby.mobile.1": { + "source": "iana" + }, + "application/vnd.dolby.mobile.2": { + "source": "iana" + }, + "application/vnd.doremir.scorecloud-binary-document": { + "source": "iana" + }, + "application/vnd.dpgraph": { + "source": "iana", + "extensions": ["dpg"] + }, + "application/vnd.dreamfactory": { + "source": "iana", + "extensions": ["dfac"] + }, + "application/vnd.drive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ds-keypoint": { + "source": "apache", + "extensions": ["kpxx"] + }, + "application/vnd.dtg.local": { + "source": "iana" + }, + "application/vnd.dtg.local.flash": { + "source": "iana" + }, + "application/vnd.dtg.local.html": { + "source": "iana" + }, + "application/vnd.dvb.ait": { + "source": "iana", + "extensions": ["ait"] + }, + "application/vnd.dvb.dvbj": { + "source": "iana" + }, + "application/vnd.dvb.esgcontainer": { + "source": "iana" + }, + "application/vnd.dvb.ipdcdftnotifaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess2": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgpdd": { + "source": "iana" + }, + "application/vnd.dvb.ipdcroaming": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-base": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-enhancement": { + "source": "iana" + }, + "application/vnd.dvb.notif-aggregate-root+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-container+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-generic+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-ia-msglist+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-ia-registration-request+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-ia-registration-response+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-init+xml": { + "source": "iana" + }, + "application/vnd.dvb.pfr": { + "source": "iana" + }, + "application/vnd.dvb.service": { + "source": "iana", + "extensions": ["svc"] + }, + "application/vnd.dxr": { + "source": "iana" + }, + "application/vnd.dynageo": { + "source": "iana", + "extensions": ["geo"] + }, + "application/vnd.dzr": { + "source": "iana" + }, + "application/vnd.easykaraoke.cdgdownload": { + "source": "iana" + }, + "application/vnd.ecdis-update": { + "source": "iana" + }, + "application/vnd.ecowin.chart": { + "source": "iana", + "extensions": ["mag"] + }, + "application/vnd.ecowin.filerequest": { + "source": "iana" + }, + "application/vnd.ecowin.fileupdate": { + "source": "iana" + }, + "application/vnd.ecowin.series": { + "source": "iana" + }, + "application/vnd.ecowin.seriesrequest": { + "source": "iana" + }, + "application/vnd.ecowin.seriesupdate": { + "source": "iana" + }, + "application/vnd.efi.img": { + "source": "iana" + }, + "application/vnd.efi.iso": { + "source": "iana" + }, + "application/vnd.emclient.accessrequest+xml": { + "source": "iana" + }, + "application/vnd.enliven": { + "source": "iana", + "extensions": ["nml"] + }, + "application/vnd.enphase.envoy": { + "source": "iana" + }, + "application/vnd.eprints.data+xml": { + "source": "iana" + }, + "application/vnd.epson.esf": { + "source": "iana", + "extensions": ["esf"] + }, + "application/vnd.epson.msf": { + "source": "iana", + "extensions": ["msf"] + }, + "application/vnd.epson.quickanime": { + "source": "iana", + "extensions": ["qam"] + }, + "application/vnd.epson.salt": { + "source": "iana", + "extensions": ["slt"] + }, + "application/vnd.epson.ssf": { + "source": "iana", + "extensions": ["ssf"] + }, + "application/vnd.ericsson.quickcall": { + "source": "iana" + }, + "application/vnd.espass-espass+zip": { + "source": "iana" + }, + "application/vnd.eszigno3+xml": { + "source": "iana", + "extensions": ["es3","et3"] + }, + "application/vnd.etsi.aoc+xml": { + "source": "iana" + }, + "application/vnd.etsi.asic-e+zip": { + "source": "iana" + }, + "application/vnd.etsi.asic-s+zip": { + "source": "iana" + }, + "application/vnd.etsi.cug+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvcommand+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvdiscovery+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvprofile+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvsad-bc+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvsad-cod+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvsad-npvr+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvservice+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvsync+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvueprofile+xml": { + "source": "iana" + }, + "application/vnd.etsi.mcid+xml": { + "source": "iana" + }, + "application/vnd.etsi.mheg5": { + "source": "iana" + }, + "application/vnd.etsi.overload-control-policy-dataset+xml": { + "source": "iana" + }, + "application/vnd.etsi.pstn+xml": { + "source": "iana" + }, + "application/vnd.etsi.sci+xml": { + "source": "iana" + }, + "application/vnd.etsi.simservs+xml": { + "source": "iana" + }, + "application/vnd.etsi.timestamp-token": { + "source": "iana" + }, + "application/vnd.etsi.tsl+xml": { + "source": "iana" + }, + "application/vnd.etsi.tsl.der": { + "source": "iana" + }, + "application/vnd.eudora.data": { + "source": "iana" + }, + "application/vnd.ezpix-album": { + "source": "iana", + "extensions": ["ez2"] + }, + "application/vnd.ezpix-package": { + "source": "iana", + "extensions": ["ez3"] + }, + "application/vnd.f-secure.mobile": { + "source": "iana" + }, + "application/vnd.fastcopy-disk-image": { + "source": "iana" + }, + "application/vnd.fdf": { + "source": "iana", + "extensions": ["fdf"] + }, + "application/vnd.fdsn.mseed": { + "source": "iana", + "extensions": ["mseed"] + }, + "application/vnd.fdsn.seed": { + "source": "iana", + "extensions": ["seed","dataless"] + }, + "application/vnd.ffsns": { + "source": "iana" + }, + "application/vnd.filmit.zfc": { + "source": "iana" + }, + "application/vnd.fints": { + "source": "iana" + }, + "application/vnd.firemonkeys.cloudcell": { + "source": "iana" + }, + "application/vnd.flographit": { + "source": "iana", + "extensions": ["gph"] + }, + "application/vnd.fluxtime.clip": { + "source": "iana", + "extensions": ["ftc"] + }, + "application/vnd.font-fontforge-sfd": { + "source": "iana" + }, + "application/vnd.framemaker": { + "source": "iana", + "extensions": ["fm","frame","maker","book"] + }, + "application/vnd.frogans.fnc": { + "source": "iana", + "extensions": ["fnc"] + }, + "application/vnd.frogans.ltf": { + "source": "iana", + "extensions": ["ltf"] + }, + "application/vnd.fsc.weblaunch": { + "source": "iana", + "extensions": ["fsc"] + }, + "application/vnd.fujitsu.oasys": { + "source": "iana", + "extensions": ["oas"] + }, + "application/vnd.fujitsu.oasys2": { + "source": "iana", + "extensions": ["oa2"] + }, + "application/vnd.fujitsu.oasys3": { + "source": "iana", + "extensions": ["oa3"] + }, + "application/vnd.fujitsu.oasysgp": { + "source": "iana", + "extensions": ["fg5"] + }, + "application/vnd.fujitsu.oasysprs": { + "source": "iana", + "extensions": ["bh2"] + }, + "application/vnd.fujixerox.art-ex": { + "source": "iana" + }, + "application/vnd.fujixerox.art4": { + "source": "iana" + }, + "application/vnd.fujixerox.ddd": { + "source": "iana", + "extensions": ["ddd"] + }, + "application/vnd.fujixerox.docuworks": { + "source": "iana", + "extensions": ["xdw"] + }, + "application/vnd.fujixerox.docuworks.binder": { + "source": "iana", + "extensions": ["xbd"] + }, + "application/vnd.fujixerox.docuworks.container": { + "source": "iana" + }, + "application/vnd.fujixerox.hbpl": { + "source": "iana" + }, + "application/vnd.fut-misnet": { + "source": "iana" + }, + "application/vnd.fuzzysheet": { + "source": "iana", + "extensions": ["fzs"] + }, + "application/vnd.genomatix.tuxedo": { + "source": "iana", + "extensions": ["txd"] + }, + "application/vnd.geo+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.geocube+xml": { + "source": "iana" + }, + "application/vnd.geogebra.file": { + "source": "iana", + "extensions": ["ggb"] + }, + "application/vnd.geogebra.tool": { + "source": "iana", + "extensions": ["ggt"] + }, + "application/vnd.geometry-explorer": { + "source": "iana", + "extensions": ["gex","gre"] + }, + "application/vnd.geonext": { + "source": "iana", + "extensions": ["gxt"] + }, + "application/vnd.geoplan": { + "source": "iana", + "extensions": ["g2w"] + }, + "application/vnd.geospace": { + "source": "iana", + "extensions": ["g3w"] + }, + "application/vnd.gerber": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt-response": { + "source": "iana" + }, + "application/vnd.gmx": { + "source": "iana", + "extensions": ["gmx"] + }, + "application/vnd.google-apps.document": { + "compressible": false, + "extensions": ["gdoc"] + }, + "application/vnd.google-apps.presentation": { + "compressible": false, + "extensions": ["gslides"] + }, + "application/vnd.google-apps.spreadsheet": { + "compressible": false, + "extensions": ["gsheet"] + }, + "application/vnd.google-earth.kml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["kml"] + }, + "application/vnd.google-earth.kmz": { + "source": "iana", + "compressible": false, + "extensions": ["kmz"] + }, + "application/vnd.gov.sk.e-form+xml": { + "source": "iana" + }, + "application/vnd.gov.sk.e-form+zip": { + "source": "iana" + }, + "application/vnd.gov.sk.xmldatacontainer+xml": { + "source": "iana" + }, + "application/vnd.grafeq": { + "source": "iana", + "extensions": ["gqf","gqs"] + }, + "application/vnd.gridmp": { + "source": "iana" + }, + "application/vnd.groove-account": { + "source": "iana", + "extensions": ["gac"] + }, + "application/vnd.groove-help": { + "source": "iana", + "extensions": ["ghf"] + }, + "application/vnd.groove-identity-message": { + "source": "iana", + "extensions": ["gim"] + }, + "application/vnd.groove-injector": { + "source": "iana", + "extensions": ["grv"] + }, + "application/vnd.groove-tool-message": { + "source": "iana", + "extensions": ["gtm"] + }, + "application/vnd.groove-tool-template": { + "source": "iana", + "extensions": ["tpl"] + }, + "application/vnd.groove-vcard": { + "source": "iana", + "extensions": ["vcg"] + }, + "application/vnd.hal+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hal+xml": { + "source": "iana", + "extensions": ["hal"] + }, + "application/vnd.handheld-entertainment+xml": { + "source": "iana", + "extensions": ["zmm"] + }, + "application/vnd.hbci": { + "source": "iana", + "extensions": ["hbci"] + }, + "application/vnd.hc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hcl-bireports": { + "source": "iana" + }, + "application/vnd.hdt": { + "source": "iana" + }, + "application/vnd.heroku+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hhe.lesson-player": { + "source": "iana", + "extensions": ["les"] + }, + "application/vnd.hp-hpgl": { + "source": "iana", + "extensions": ["hpgl"] + }, + "application/vnd.hp-hpid": { + "source": "iana", + "extensions": ["hpid"] + }, + "application/vnd.hp-hps": { + "source": "iana", + "extensions": ["hps"] + }, + "application/vnd.hp-jlyt": { + "source": "iana", + "extensions": ["jlt"] + }, + "application/vnd.hp-pcl": { + "source": "iana", + "extensions": ["pcl"] + }, + "application/vnd.hp-pclxl": { + "source": "iana", + "extensions": ["pclxl"] + }, + "application/vnd.httphone": { + "source": "iana" + }, + "application/vnd.hydrostatix.sof-data": { + "source": "iana", + "extensions": ["sfd-hdstx"] + }, + "application/vnd.hyperdrive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hzn-3d-crossword": { + "source": "iana" + }, + "application/vnd.ibm.afplinedata": { + "source": "iana" + }, + "application/vnd.ibm.electronic-media": { + "source": "iana" + }, + "application/vnd.ibm.minipay": { + "source": "iana", + "extensions": ["mpy"] + }, + "application/vnd.ibm.modcap": { + "source": "iana", + "extensions": ["afp","listafp","list3820"] + }, + "application/vnd.ibm.rights-management": { + "source": "iana", + "extensions": ["irm"] + }, + "application/vnd.ibm.secure-container": { + "source": "iana", + "extensions": ["sc"] + }, + "application/vnd.iccprofile": { + "source": "iana", + "extensions": ["icc","icm"] + }, + "application/vnd.ieee.1905": { + "source": "iana" + }, + "application/vnd.igloader": { + "source": "iana", + "extensions": ["igl"] + }, + "application/vnd.imagemeter.image+zip": { + "source": "iana" + }, + "application/vnd.immervision-ivp": { + "source": "iana", + "extensions": ["ivp"] + }, + "application/vnd.immervision-ivu": { + "source": "iana", + "extensions": ["ivu"] + }, + "application/vnd.ims.imsccv1p1": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p2": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p3": { + "source": "iana" + }, + "application/vnd.ims.lis.v2.result+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolconsumerprofile+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy.id+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings.simple+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.informedcontrol.rms+xml": { + "source": "iana" + }, + "application/vnd.informix-visionary": { + "source": "iana" + }, + "application/vnd.infotech.project": { + "source": "iana" + }, + "application/vnd.infotech.project+xml": { + "source": "iana" + }, + "application/vnd.innopath.wamp.notification": { + "source": "iana" + }, + "application/vnd.insors.igm": { + "source": "iana", + "extensions": ["igm"] + }, + "application/vnd.intercon.formnet": { + "source": "iana", + "extensions": ["xpw","xpx"] + }, + "application/vnd.intergeo": { + "source": "iana", + "extensions": ["i2g"] + }, + "application/vnd.intertrust.digibox": { + "source": "iana" + }, + "application/vnd.intertrust.nncp": { + "source": "iana" + }, + "application/vnd.intu.qbo": { + "source": "iana", + "extensions": ["qbo"] + }, + "application/vnd.intu.qfx": { + "source": "iana", + "extensions": ["qfx"] + }, + "application/vnd.iptc.g2.catalogitem+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.conceptitem+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.knowledgeitem+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.newsitem+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.newsmessage+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.packageitem+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.planningitem+xml": { + "source": "iana" + }, + "application/vnd.ipunplugged.rcprofile": { + "source": "iana", + "extensions": ["rcprofile"] + }, + "application/vnd.irepository.package+xml": { + "source": "iana", + "extensions": ["irp"] + }, + "application/vnd.is-xpr": { + "source": "iana", + "extensions": ["xpr"] + }, + "application/vnd.isac.fcs": { + "source": "iana", + "extensions": ["fcs"] + }, + "application/vnd.jam": { + "source": "iana", + "extensions": ["jam"] + }, + "application/vnd.japannet-directory-service": { + "source": "iana" + }, + "application/vnd.japannet-jpnstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-payment-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-registration": { + "source": "iana" + }, + "application/vnd.japannet-registration-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-setstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-verification": { + "source": "iana" + }, + "application/vnd.japannet-verification-wakeup": { + "source": "iana" + }, + "application/vnd.jcp.javame.midlet-rms": { + "source": "iana", + "extensions": ["rms"] + }, + "application/vnd.jisp": { + "source": "iana", + "extensions": ["jisp"] + }, + "application/vnd.joost.joda-archive": { + "source": "iana", + "extensions": ["joda"] + }, + "application/vnd.jsk.isdn-ngn": { + "source": "iana" + }, + "application/vnd.kahootz": { + "source": "iana", + "extensions": ["ktz","ktr"] + }, + "application/vnd.kde.karbon": { + "source": "iana", + "extensions": ["karbon"] + }, + "application/vnd.kde.kchart": { + "source": "iana", + "extensions": ["chrt"] + }, + "application/vnd.kde.kformula": { + "source": "iana", + "extensions": ["kfo"] + }, + "application/vnd.kde.kivio": { + "source": "iana", + "extensions": ["flw"] + }, + "application/vnd.kde.kontour": { + "source": "iana", + "extensions": ["kon"] + }, + "application/vnd.kde.kpresenter": { + "source": "iana", + "extensions": ["kpr","kpt"] + }, + "application/vnd.kde.kspread": { + "source": "iana", + "extensions": ["ksp"] + }, + "application/vnd.kde.kword": { + "source": "iana", + "extensions": ["kwd","kwt"] + }, + "application/vnd.kenameaapp": { + "source": "iana", + "extensions": ["htke"] + }, + "application/vnd.kidspiration": { + "source": "iana", + "extensions": ["kia"] + }, + "application/vnd.kinar": { + "source": "iana", + "extensions": ["kne","knp"] + }, + "application/vnd.koan": { + "source": "iana", + "extensions": ["skp","skd","skt","skm"] + }, + "application/vnd.kodak-descriptor": { + "source": "iana", + "extensions": ["sse"] + }, + "application/vnd.las.las+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.las.las+xml": { + "source": "iana", + "extensions": ["lasxml"] + }, + "application/vnd.liberty-request+xml": { + "source": "iana" + }, + "application/vnd.llamagraphics.life-balance.desktop": { + "source": "iana", + "extensions": ["lbd"] + }, + "application/vnd.llamagraphics.life-balance.exchange+xml": { + "source": "iana", + "extensions": ["lbe"] + }, + "application/vnd.lotus-1-2-3": { + "source": "iana", + "extensions": ["123"] + }, + "application/vnd.lotus-approach": { + "source": "iana", + "extensions": ["apr"] + }, + "application/vnd.lotus-freelance": { + "source": "iana", + "extensions": ["pre"] + }, + "application/vnd.lotus-notes": { + "source": "iana", + "extensions": ["nsf"] + }, + "application/vnd.lotus-organizer": { + "source": "iana", + "extensions": ["org"] + }, + "application/vnd.lotus-screencam": { + "source": "iana", + "extensions": ["scm"] + }, + "application/vnd.lotus-wordpro": { + "source": "iana", + "extensions": ["lwp"] + }, + "application/vnd.macports.portpkg": { + "source": "iana", + "extensions": ["portpkg"] + }, + "application/vnd.mapbox-vector-tile": { + "source": "iana" + }, + "application/vnd.marlin.drm.actiontoken+xml": { + "source": "iana" + }, + "application/vnd.marlin.drm.conftoken+xml": { + "source": "iana" + }, + "application/vnd.marlin.drm.license+xml": { + "source": "iana" + }, + "application/vnd.marlin.drm.mdcf": { + "source": "iana" + }, + "application/vnd.mason+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.maxmind.maxmind-db": { + "source": "iana" + }, + "application/vnd.mcd": { + "source": "iana", + "extensions": ["mcd"] + }, + "application/vnd.medcalcdata": { + "source": "iana", + "extensions": ["mc1"] + }, + "application/vnd.mediastation.cdkey": { + "source": "iana", + "extensions": ["cdkey"] + }, + "application/vnd.meridian-slingshot": { + "source": "iana" + }, + "application/vnd.mfer": { + "source": "iana", + "extensions": ["mwf"] + }, + "application/vnd.mfmp": { + "source": "iana", + "extensions": ["mfm"] + }, + "application/vnd.micro+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.micrografx.flo": { + "source": "iana", + "extensions": ["flo"] + }, + "application/vnd.micrografx.igx": { + "source": "iana", + "extensions": ["igx"] + }, + "application/vnd.microsoft.portable-executable": { + "source": "iana" + }, + "application/vnd.miele+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.mif": { + "source": "iana", + "extensions": ["mif"] + }, + "application/vnd.minisoft-hp3000-save": { + "source": "iana" + }, + "application/vnd.mitsubishi.misty-guard.trustweb": { + "source": "iana" + }, + "application/vnd.mobius.daf": { + "source": "iana", + "extensions": ["daf"] + }, + "application/vnd.mobius.dis": { + "source": "iana", + "extensions": ["dis"] + }, + "application/vnd.mobius.mbk": { + "source": "iana", + "extensions": ["mbk"] + }, + "application/vnd.mobius.mqy": { + "source": "iana", + "extensions": ["mqy"] + }, + "application/vnd.mobius.msl": { + "source": "iana", + "extensions": ["msl"] + }, + "application/vnd.mobius.plc": { + "source": "iana", + "extensions": ["plc"] + }, + "application/vnd.mobius.txf": { + "source": "iana", + "extensions": ["txf"] + }, + "application/vnd.mophun.application": { + "source": "iana", + "extensions": ["mpn"] + }, + "application/vnd.mophun.certificate": { + "source": "iana", + "extensions": ["mpc"] + }, + "application/vnd.motorola.flexsuite": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.adsi": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.fis": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.gotap": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.kmr": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.ttc": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.wem": { + "source": "iana" + }, + "application/vnd.motorola.iprm": { + "source": "iana" + }, + "application/vnd.mozilla.xul+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xul"] + }, + "application/vnd.ms-3mfdocument": { + "source": "iana" + }, + "application/vnd.ms-artgalry": { + "source": "iana", + "extensions": ["cil"] + }, + "application/vnd.ms-asf": { + "source": "iana" + }, + "application/vnd.ms-cab-compressed": { + "source": "iana", + "extensions": ["cab"] + }, + "application/vnd.ms-color.iccprofile": { + "source": "apache" + }, + "application/vnd.ms-excel": { + "source": "iana", + "compressible": false, + "extensions": ["xls","xlm","xla","xlc","xlt","xlw"] + }, + "application/vnd.ms-excel.addin.macroenabled.12": { + "source": "iana", + "extensions": ["xlam"] + }, + "application/vnd.ms-excel.sheet.binary.macroenabled.12": { + "source": "iana", + "extensions": ["xlsb"] + }, + "application/vnd.ms-excel.sheet.macroenabled.12": { + "source": "iana", + "extensions": ["xlsm"] + }, + "application/vnd.ms-excel.template.macroenabled.12": { + "source": "iana", + "extensions": ["xltm"] + }, + "application/vnd.ms-fontobject": { + "source": "iana", + "compressible": true, + "extensions": ["eot"] + }, + "application/vnd.ms-htmlhelp": { + "source": "iana", + "extensions": ["chm"] + }, + "application/vnd.ms-ims": { + "source": "iana", + "extensions": ["ims"] + }, + "application/vnd.ms-lrm": { + "source": "iana", + "extensions": ["lrm"] + }, + "application/vnd.ms-office.activex+xml": { + "source": "iana" + }, + "application/vnd.ms-officetheme": { + "source": "iana", + "extensions": ["thmx"] + }, + "application/vnd.ms-opentype": { + "source": "apache", + "compressible": true + }, + "application/vnd.ms-package.obfuscated-opentype": { + "source": "apache" + }, + "application/vnd.ms-pki.seccat": { + "source": "apache", + "extensions": ["cat"] + }, + "application/vnd.ms-pki.stl": { + "source": "apache", + "extensions": ["stl"] + }, + "application/vnd.ms-playready.initiator+xml": { + "source": "iana" + }, + "application/vnd.ms-powerpoint": { + "source": "iana", + "compressible": false, + "extensions": ["ppt","pps","pot"] + }, + "application/vnd.ms-powerpoint.addin.macroenabled.12": { + "source": "iana", + "extensions": ["ppam"] + }, + "application/vnd.ms-powerpoint.presentation.macroenabled.12": { + "source": "iana", + "extensions": ["pptm"] + }, + "application/vnd.ms-powerpoint.slide.macroenabled.12": { + "source": "iana", + "extensions": ["sldm"] + }, + "application/vnd.ms-powerpoint.slideshow.macroenabled.12": { + "source": "iana", + "extensions": ["ppsm"] + }, + "application/vnd.ms-powerpoint.template.macroenabled.12": { + "source": "iana", + "extensions": ["potm"] + }, + "application/vnd.ms-printdevicecapabilities+xml": { + "source": "iana" + }, + "application/vnd.ms-printing.printticket+xml": { + "source": "apache" + }, + "application/vnd.ms-printschematicket+xml": { + "source": "iana" + }, + "application/vnd.ms-project": { + "source": "iana", + "extensions": ["mpp","mpt"] + }, + "application/vnd.ms-tnef": { + "source": "iana" + }, + "application/vnd.ms-windows.devicepairing": { + "source": "iana" + }, + "application/vnd.ms-windows.nwprinting.oob": { + "source": "iana" + }, + "application/vnd.ms-windows.printerpairing": { + "source": "iana" + }, + "application/vnd.ms-windows.wsd.oob": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-resp": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-resp": { + "source": "iana" + }, + "application/vnd.ms-word.document.macroenabled.12": { + "source": "iana", + "extensions": ["docm"] + }, + "application/vnd.ms-word.template.macroenabled.12": { + "source": "iana", + "extensions": ["dotm"] + }, + "application/vnd.ms-works": { + "source": "iana", + "extensions": ["wps","wks","wcm","wdb"] + }, + "application/vnd.ms-wpl": { + "source": "iana", + "extensions": ["wpl"] + }, + "application/vnd.ms-xpsdocument": { + "source": "iana", + "compressible": false, + "extensions": ["xps"] + }, + "application/vnd.msa-disk-image": { + "source": "iana" + }, + "application/vnd.mseq": { + "source": "iana", + "extensions": ["mseq"] + }, + "application/vnd.msign": { + "source": "iana" + }, + "application/vnd.multiad.creator": { + "source": "iana" + }, + "application/vnd.multiad.creator.cif": { + "source": "iana" + }, + "application/vnd.music-niff": { + "source": "iana" + }, + "application/vnd.musician": { + "source": "iana", + "extensions": ["mus"] + }, + "application/vnd.muvee.style": { + "source": "iana", + "extensions": ["msty"] + }, + "application/vnd.mynfc": { + "source": "iana", + "extensions": ["taglet"] + }, + "application/vnd.ncd.control": { + "source": "iana" + }, + "application/vnd.ncd.reference": { + "source": "iana" + }, + "application/vnd.nearst.inv+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.nervana": { + "source": "iana" + }, + "application/vnd.netfpx": { + "source": "iana" + }, + "application/vnd.neurolanguage.nlu": { + "source": "iana", + "extensions": ["nlu"] + }, + "application/vnd.nintendo.nitro.rom": { + "source": "iana" + }, + "application/vnd.nintendo.snes.rom": { + "source": "iana" + }, + "application/vnd.nitf": { + "source": "iana", + "extensions": ["ntf","nitf"] + }, + "application/vnd.noblenet-directory": { + "source": "iana", + "extensions": ["nnd"] + }, + "application/vnd.noblenet-sealer": { + "source": "iana", + "extensions": ["nns"] + }, + "application/vnd.noblenet-web": { + "source": "iana", + "extensions": ["nnw"] + }, + "application/vnd.nokia.catalogs": { + "source": "iana" + }, + "application/vnd.nokia.conml+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.conml+xml": { + "source": "iana" + }, + "application/vnd.nokia.iptv.config+xml": { + "source": "iana" + }, + "application/vnd.nokia.isds-radio-presets": { + "source": "iana" + }, + "application/vnd.nokia.landmark+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.landmark+xml": { + "source": "iana" + }, + "application/vnd.nokia.landmarkcollection+xml": { + "source": "iana" + }, + "application/vnd.nokia.n-gage.ac+xml": { + "source": "iana" + }, + "application/vnd.nokia.n-gage.data": { + "source": "iana", + "extensions": ["ngdat"] + }, + "application/vnd.nokia.n-gage.symbian.install": { + "source": "iana", + "extensions": ["n-gage"] + }, + "application/vnd.nokia.ncd": { + "source": "iana" + }, + "application/vnd.nokia.pcd+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.pcd+xml": { + "source": "iana" + }, + "application/vnd.nokia.radio-preset": { + "source": "iana", + "extensions": ["rpst"] + }, + "application/vnd.nokia.radio-presets": { + "source": "iana", + "extensions": ["rpss"] + }, + "application/vnd.novadigm.edm": { + "source": "iana", + "extensions": ["edm"] + }, + "application/vnd.novadigm.edx": { + "source": "iana", + "extensions": ["edx"] + }, + "application/vnd.novadigm.ext": { + "source": "iana", + "extensions": ["ext"] + }, + "application/vnd.ntt-local.content-share": { + "source": "iana" + }, + "application/vnd.ntt-local.file-transfer": { + "source": "iana" + }, + "application/vnd.ntt-local.ogw_remote-access": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_remote": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_tcp_stream": { + "source": "iana" + }, + "application/vnd.oasis.opendocument.chart": { + "source": "iana", + "extensions": ["odc"] + }, + "application/vnd.oasis.opendocument.chart-template": { + "source": "iana", + "extensions": ["otc"] + }, + "application/vnd.oasis.opendocument.database": { + "source": "iana", + "extensions": ["odb"] + }, + "application/vnd.oasis.opendocument.formula": { + "source": "iana", + "extensions": ["odf"] + }, + "application/vnd.oasis.opendocument.formula-template": { + "source": "iana", + "extensions": ["odft"] + }, + "application/vnd.oasis.opendocument.graphics": { + "source": "iana", + "compressible": false, + "extensions": ["odg"] + }, + "application/vnd.oasis.opendocument.graphics-template": { + "source": "iana", + "extensions": ["otg"] + }, + "application/vnd.oasis.opendocument.image": { + "source": "iana", + "extensions": ["odi"] + }, + "application/vnd.oasis.opendocument.image-template": { + "source": "iana", + "extensions": ["oti"] + }, + "application/vnd.oasis.opendocument.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["odp"] + }, + "application/vnd.oasis.opendocument.presentation-template": { + "source": "iana", + "extensions": ["otp"] + }, + "application/vnd.oasis.opendocument.spreadsheet": { + "source": "iana", + "compressible": false, + "extensions": ["ods"] + }, + "application/vnd.oasis.opendocument.spreadsheet-template": { + "source": "iana", + "extensions": ["ots"] + }, + "application/vnd.oasis.opendocument.text": { + "source": "iana", + "compressible": false, + "extensions": ["odt"] + }, + "application/vnd.oasis.opendocument.text-master": { + "source": "iana", + "extensions": ["odm"] + }, + "application/vnd.oasis.opendocument.text-template": { + "source": "iana", + "extensions": ["ott"] + }, + "application/vnd.oasis.opendocument.text-web": { + "source": "iana", + "extensions": ["oth"] + }, + "application/vnd.obn": { + "source": "iana" + }, + "application/vnd.ocf+cbor": { + "source": "iana" + }, + "application/vnd.oftn.l10n+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.contentaccessdownload+xml": { + "source": "iana" + }, + "application/vnd.oipf.contentaccessstreaming+xml": { + "source": "iana" + }, + "application/vnd.oipf.cspg-hexbinary": { + "source": "iana" + }, + "application/vnd.oipf.dae.svg+xml": { + "source": "iana" + }, + "application/vnd.oipf.dae.xhtml+xml": { + "source": "iana" + }, + "application/vnd.oipf.mippvcontrolmessage+xml": { + "source": "iana" + }, + "application/vnd.oipf.pae.gem": { + "source": "iana" + }, + "application/vnd.oipf.spdiscovery+xml": { + "source": "iana" + }, + "application/vnd.oipf.spdlist+xml": { + "source": "iana" + }, + "application/vnd.oipf.ueprofile+xml": { + "source": "iana" + }, + "application/vnd.oipf.userprofile+xml": { + "source": "iana" + }, + "application/vnd.olpc-sugar": { + "source": "iana", + "extensions": ["xo"] + }, + "application/vnd.oma-scws-config": { + "source": "iana" + }, + "application/vnd.oma-scws-http-request": { + "source": "iana" + }, + "application/vnd.oma-scws-http-response": { + "source": "iana" + }, + "application/vnd.oma.bcast.associated-procedure-parameter+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.drm-trigger+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.imd+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.ltkm": { + "source": "iana" + }, + "application/vnd.oma.bcast.notification+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.provisioningtrigger": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgboot": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgdd+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgdu": { + "source": "iana" + }, + "application/vnd.oma.bcast.simple-symbol-container": { + "source": "iana" + }, + "application/vnd.oma.bcast.smartcard-trigger+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.sprov+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.stkm": { + "source": "iana" + }, + "application/vnd.oma.cab-address-book+xml": { + "source": "iana" + }, + "application/vnd.oma.cab-feature-handler+xml": { + "source": "iana" + }, + "application/vnd.oma.cab-pcc+xml": { + "source": "iana" + }, + "application/vnd.oma.cab-subs-invite+xml": { + "source": "iana" + }, + "application/vnd.oma.cab-user-prefs+xml": { + "source": "iana" + }, + "application/vnd.oma.dcd": { + "source": "iana" + }, + "application/vnd.oma.dcdc": { + "source": "iana" + }, + "application/vnd.oma.dd2+xml": { + "source": "iana", + "extensions": ["dd2"] + }, + "application/vnd.oma.drm.risd+xml": { + "source": "iana" + }, + "application/vnd.oma.group-usage-list+xml": { + "source": "iana" + }, + "application/vnd.oma.lwm2m+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.lwm2m+tlv": { + "source": "iana" + }, + "application/vnd.oma.pal+xml": { + "source": "iana" + }, + "application/vnd.oma.poc.detailed-progress-report+xml": { + "source": "iana" + }, + "application/vnd.oma.poc.final-report+xml": { + "source": "iana" + }, + "application/vnd.oma.poc.groups+xml": { + "source": "iana" + }, + "application/vnd.oma.poc.invocation-descriptor+xml": { + "source": "iana" + }, + "application/vnd.oma.poc.optimized-progress-report+xml": { + "source": "iana" + }, + "application/vnd.oma.push": { + "source": "iana" + }, + "application/vnd.oma.scidm.messages+xml": { + "source": "iana" + }, + "application/vnd.oma.xcap-directory+xml": { + "source": "iana" + }, + "application/vnd.omads-email+xml": { + "source": "iana" + }, + "application/vnd.omads-file+xml": { + "source": "iana" + }, + "application/vnd.omads-folder+xml": { + "source": "iana" + }, + "application/vnd.omaloc-supl-init": { + "source": "iana" + }, + "application/vnd.onepager": { + "source": "iana" + }, + "application/vnd.openblox.game+xml": { + "source": "iana" + }, + "application/vnd.openblox.game-binary": { + "source": "iana" + }, + "application/vnd.openeye.oeb": { + "source": "iana" + }, + "application/vnd.openofficeorg.extension": { + "source": "apache", + "extensions": ["oxt"] + }, + "application/vnd.openstreetmap.data+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.custom-properties+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.customxmlproperties+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawing+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.chart+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.extended-properties+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml-template": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.comments+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["pptx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.presprops+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide": { + "source": "iana", + "extensions": ["sldx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow": { + "source": "iana", + "extensions": ["ppsx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.tags+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.template": { + "source": "apache", + "extensions": ["potx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.template.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml-template": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet": { + "source": "iana", + "compressible": false, + "extensions": ["xlsx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template": { + "source": "apache", + "extensions": ["xltx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.theme+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.themeoverride+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.vmldrawing": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml-template": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document": { + "source": "iana", + "compressible": false, + "extensions": ["docx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template": { + "source": "apache", + "extensions": ["dotx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-package.core-properties+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-package.relationships+xml": { + "source": "iana" + }, + "application/vnd.oracle.resource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.orange.indata": { + "source": "iana" + }, + "application/vnd.osa.netdeploy": { + "source": "iana" + }, + "application/vnd.osgeo.mapguide.package": { + "source": "iana", + "extensions": ["mgp"] + }, + "application/vnd.osgi.bundle": { + "source": "iana" + }, + "application/vnd.osgi.dp": { + "source": "iana", + "extensions": ["dp"] + }, + "application/vnd.osgi.subsystem": { + "source": "iana", + "extensions": ["esa"] + }, + "application/vnd.otps.ct-kip+xml": { + "source": "iana" + }, + "application/vnd.oxli.countgraph": { + "source": "iana" + }, + "application/vnd.pagerduty+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.palm": { + "source": "iana", + "extensions": ["pdb","pqa","oprc"] + }, + "application/vnd.panoply": { + "source": "iana" + }, + "application/vnd.paos+xml": { + "source": "iana" + }, + "application/vnd.paos.xml": { + "source": "apache" + }, + "application/vnd.pawaafile": { + "source": "iana", + "extensions": ["paw"] + }, + "application/vnd.pcos": { + "source": "iana" + }, + "application/vnd.pg.format": { + "source": "iana", + "extensions": ["str"] + }, + "application/vnd.pg.osasli": { + "source": "iana", + "extensions": ["ei6"] + }, + "application/vnd.piaccess.application-licence": { + "source": "iana" + }, + "application/vnd.picsel": { + "source": "iana", + "extensions": ["efif"] + }, + "application/vnd.pmi.widget": { + "source": "iana", + "extensions": ["wg"] + }, + "application/vnd.poc.group-advertisement+xml": { + "source": "iana" + }, + "application/vnd.pocketlearn": { + "source": "iana", + "extensions": ["plf"] + }, + "application/vnd.powerbuilder6": { + "source": "iana", + "extensions": ["pbd"] + }, + "application/vnd.powerbuilder6-s": { + "source": "iana" + }, + "application/vnd.powerbuilder7": { + "source": "iana" + }, + "application/vnd.powerbuilder7-s": { + "source": "iana" + }, + "application/vnd.powerbuilder75": { + "source": "iana" + }, + "application/vnd.powerbuilder75-s": { + "source": "iana" + }, + "application/vnd.preminet": { + "source": "iana" + }, + "application/vnd.previewsystems.box": { + "source": "iana", + "extensions": ["box"] + }, + "application/vnd.proteus.magazine": { + "source": "iana", + "extensions": ["mgz"] + }, + "application/vnd.publishare-delta-tree": { + "source": "iana", + "extensions": ["qps"] + }, + "application/vnd.pvi.ptid1": { + "source": "iana", + "extensions": ["ptid"] + }, + "application/vnd.pwg-multiplexed": { + "source": "iana" + }, + "application/vnd.pwg-xhtml-print+xml": { + "source": "iana" + }, + "application/vnd.qualcomm.brew-app-res": { + "source": "iana" + }, + "application/vnd.quarantainenet": { + "source": "iana" + }, + "application/vnd.quark.quarkxpress": { + "source": "iana", + "extensions": ["qxd","qxt","qwd","qwt","qxl","qxb"] + }, + "application/vnd.quobject-quoxdocument": { + "source": "iana" + }, + "application/vnd.radisys.moml+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-audit+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-audit-conf+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-audit-conn+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-audit-dialog+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-audit-stream+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-conf+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-base+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-fax-detect+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-fax-sendrecv+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-group+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-speech+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-transform+xml": { + "source": "iana" + }, + "application/vnd.rainstor.data": { + "source": "iana" + }, + "application/vnd.rapid": { + "source": "iana" + }, + "application/vnd.rar": { + "source": "iana" + }, + "application/vnd.realvnc.bed": { + "source": "iana", + "extensions": ["bed"] + }, + "application/vnd.recordare.musicxml": { + "source": "iana", + "extensions": ["mxl"] + }, + "application/vnd.recordare.musicxml+xml": { + "source": "iana", + "extensions": ["musicxml"] + }, + "application/vnd.renlearn.rlprint": { + "source": "iana" + }, + "application/vnd.rig.cryptonote": { + "source": "iana", + "extensions": ["cryptonote"] + }, + "application/vnd.rim.cod": { + "source": "apache", + "extensions": ["cod"] + }, + "application/vnd.rn-realmedia": { + "source": "apache", + "extensions": ["rm"] + }, + "application/vnd.rn-realmedia-vbr": { + "source": "apache", + "extensions": ["rmvb"] + }, + "application/vnd.route66.link66+xml": { + "source": "iana", + "extensions": ["link66"] + }, + "application/vnd.rs-274x": { + "source": "iana" + }, + "application/vnd.ruckus.download": { + "source": "iana" + }, + "application/vnd.s3sms": { + "source": "iana" + }, + "application/vnd.sailingtracker.track": { + "source": "iana", + "extensions": ["st"] + }, + "application/vnd.sbm.cid": { + "source": "iana" + }, + "application/vnd.sbm.mid2": { + "source": "iana" + }, + "application/vnd.scribus": { + "source": "iana" + }, + "application/vnd.sealed.3df": { + "source": "iana" + }, + "application/vnd.sealed.csf": { + "source": "iana" + }, + "application/vnd.sealed.doc": { + "source": "iana" + }, + "application/vnd.sealed.eml": { + "source": "iana" + }, + "application/vnd.sealed.mht": { + "source": "iana" + }, + "application/vnd.sealed.net": { + "source": "iana" + }, + "application/vnd.sealed.ppt": { + "source": "iana" + }, + "application/vnd.sealed.tiff": { + "source": "iana" + }, + "application/vnd.sealed.xls": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.html": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.pdf": { + "source": "iana" + }, + "application/vnd.seemail": { + "source": "iana", + "extensions": ["see"] + }, + "application/vnd.sema": { + "source": "iana", + "extensions": ["sema"] + }, + "application/vnd.semd": { + "source": "iana", + "extensions": ["semd"] + }, + "application/vnd.semf": { + "source": "iana", + "extensions": ["semf"] + }, + "application/vnd.shana.informed.formdata": { + "source": "iana", + "extensions": ["ifm"] + }, + "application/vnd.shana.informed.formtemplate": { + "source": "iana", + "extensions": ["itp"] + }, + "application/vnd.shana.informed.interchange": { + "source": "iana", + "extensions": ["iif"] + }, + "application/vnd.shana.informed.package": { + "source": "iana", + "extensions": ["ipk"] + }, + "application/vnd.simtech-mindmapper": { + "source": "iana", + "extensions": ["twd","twds"] + }, + "application/vnd.siren+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.smaf": { + "source": "iana", + "extensions": ["mmf"] + }, + "application/vnd.smart.notebook": { + "source": "iana" + }, + "application/vnd.smart.teacher": { + "source": "iana", + "extensions": ["teacher"] + }, + "application/vnd.software602.filler.form+xml": { + "source": "iana" + }, + "application/vnd.software602.filler.form-xml-zip": { + "source": "iana" + }, + "application/vnd.solent.sdkm+xml": { + "source": "iana", + "extensions": ["sdkm","sdkd"] + }, + "application/vnd.spotfire.dxp": { + "source": "iana", + "extensions": ["dxp"] + }, + "application/vnd.spotfire.sfs": { + "source": "iana", + "extensions": ["sfs"] + }, + "application/vnd.sss-cod": { + "source": "iana" + }, + "application/vnd.sss-dtf": { + "source": "iana" + }, + "application/vnd.sss-ntf": { + "source": "iana" + }, + "application/vnd.stardivision.calc": { + "source": "apache", + "extensions": ["sdc"] + }, + "application/vnd.stardivision.draw": { + "source": "apache", + "extensions": ["sda"] + }, + "application/vnd.stardivision.impress": { + "source": "apache", + "extensions": ["sdd"] + }, + "application/vnd.stardivision.math": { + "source": "apache", + "extensions": ["smf"] + }, + "application/vnd.stardivision.writer": { + "source": "apache", + "extensions": ["sdw","vor"] + }, + "application/vnd.stardivision.writer-global": { + "source": "apache", + "extensions": ["sgl"] + }, + "application/vnd.stepmania.package": { + "source": "iana", + "extensions": ["smzip"] + }, + "application/vnd.stepmania.stepchart": { + "source": "iana", + "extensions": ["sm"] + }, + "application/vnd.street-stream": { + "source": "iana" + }, + "application/vnd.sun.wadl+xml": { + "source": "iana" + }, + "application/vnd.sun.xml.calc": { + "source": "apache", + "extensions": ["sxc"] + }, + "application/vnd.sun.xml.calc.template": { + "source": "apache", + "extensions": ["stc"] + }, + "application/vnd.sun.xml.draw": { + "source": "apache", + "extensions": ["sxd"] + }, + "application/vnd.sun.xml.draw.template": { + "source": "apache", + "extensions": ["std"] + }, + "application/vnd.sun.xml.impress": { + "source": "apache", + "extensions": ["sxi"] + }, + "application/vnd.sun.xml.impress.template": { + "source": "apache", + "extensions": ["sti"] + }, + "application/vnd.sun.xml.math": { + "source": "apache", + "extensions": ["sxm"] + }, + "application/vnd.sun.xml.writer": { + "source": "apache", + "extensions": ["sxw"] + }, + "application/vnd.sun.xml.writer.global": { + "source": "apache", + "extensions": ["sxg"] + }, + "application/vnd.sun.xml.writer.template": { + "source": "apache", + "extensions": ["stw"] + }, + "application/vnd.sus-calendar": { + "source": "iana", + "extensions": ["sus","susp"] + }, + "application/vnd.svd": { + "source": "iana", + "extensions": ["svd"] + }, + "application/vnd.swiftview-ics": { + "source": "iana" + }, + "application/vnd.symbian.install": { + "source": "apache", + "extensions": ["sis","sisx"] + }, + "application/vnd.syncml+xml": { + "source": "iana", + "extensions": ["xsm"] + }, + "application/vnd.syncml.dm+wbxml": { + "source": "iana", + "extensions": ["bdm"] + }, + "application/vnd.syncml.dm+xml": { + "source": "iana", + "extensions": ["xdm"] + }, + "application/vnd.syncml.dm.notification": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+xml": { + "source": "iana" + }, + "application/vnd.syncml.dmtnds+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmtnds+xml": { + "source": "iana" + }, + "application/vnd.syncml.ds.notification": { + "source": "iana" + }, + "application/vnd.tableschema+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.tao.intent-module-archive": { + "source": "iana", + "extensions": ["tao"] + }, + "application/vnd.tcpdump.pcap": { + "source": "iana", + "extensions": ["pcap","cap","dmp"] + }, + "application/vnd.tmd.mediaflex.api+xml": { + "source": "iana" + }, + "application/vnd.tml": { + "source": "iana" + }, + "application/vnd.tmobile-livetv": { + "source": "iana", + "extensions": ["tmo"] + }, + "application/vnd.tri.onesource": { + "source": "iana" + }, + "application/vnd.trid.tpt": { + "source": "iana", + "extensions": ["tpt"] + }, + "application/vnd.triscape.mxs": { + "source": "iana", + "extensions": ["mxs"] + }, + "application/vnd.trueapp": { + "source": "iana", + "extensions": ["tra"] + }, + "application/vnd.truedoc": { + "source": "iana" + }, + "application/vnd.ubisoft.webplayer": { + "source": "iana" + }, + "application/vnd.ufdl": { + "source": "iana", + "extensions": ["ufd","ufdl"] + }, + "application/vnd.uiq.theme": { + "source": "iana", + "extensions": ["utz"] + }, + "application/vnd.umajin": { + "source": "iana", + "extensions": ["umj"] + }, + "application/vnd.unity": { + "source": "iana", + "extensions": ["unityweb"] + }, + "application/vnd.uoml+xml": { + "source": "iana", + "extensions": ["uoml"] + }, + "application/vnd.uplanet.alert": { + "source": "iana" + }, + "application/vnd.uplanet.alert-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.channel": { + "source": "iana" + }, + "application/vnd.uplanet.channel-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.list": { + "source": "iana" + }, + "application/vnd.uplanet.list-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.signal": { + "source": "iana" + }, + "application/vnd.uri-map": { + "source": "iana" + }, + "application/vnd.valve.source.material": { + "source": "iana" + }, + "application/vnd.vcx": { + "source": "iana", + "extensions": ["vcx"] + }, + "application/vnd.vd-study": { + "source": "iana" + }, + "application/vnd.vectorworks": { + "source": "iana" + }, + "application/vnd.vel+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.verimatrix.vcas": { + "source": "iana" + }, + "application/vnd.vidsoft.vidconference": { + "source": "iana" + }, + "application/vnd.visio": { + "source": "iana", + "extensions": ["vsd","vst","vss","vsw"] + }, + "application/vnd.visionary": { + "source": "iana", + "extensions": ["vis"] + }, + "application/vnd.vividence.scriptfile": { + "source": "iana" + }, + "application/vnd.vsf": { + "source": "iana", + "extensions": ["vsf"] + }, + "application/vnd.wap.sic": { + "source": "iana" + }, + "application/vnd.wap.slc": { + "source": "iana" + }, + "application/vnd.wap.wbxml": { + "source": "iana", + "extensions": ["wbxml"] + }, + "application/vnd.wap.wmlc": { + "source": "iana", + "extensions": ["wmlc"] + }, + "application/vnd.wap.wmlscriptc": { + "source": "iana", + "extensions": ["wmlsc"] + }, + "application/vnd.webturbo": { + "source": "iana", + "extensions": ["wtb"] + }, + "application/vnd.wfa.p2p": { + "source": "iana" + }, + "application/vnd.wfa.wsc": { + "source": "iana" + }, + "application/vnd.windows.devicepairing": { + "source": "iana" + }, + "application/vnd.wmc": { + "source": "iana" + }, + "application/vnd.wmf.bootstrap": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica.package": { + "source": "iana" + }, + "application/vnd.wolfram.player": { + "source": "iana", + "extensions": ["nbp"] + }, + "application/vnd.wordperfect": { + "source": "iana", + "extensions": ["wpd"] + }, + "application/vnd.wqd": { + "source": "iana", + "extensions": ["wqd"] + }, + "application/vnd.wrq-hp3000-labelled": { + "source": "iana" + }, + "application/vnd.wt.stf": { + "source": "iana", + "extensions": ["stf"] + }, + "application/vnd.wv.csp+wbxml": { + "source": "iana" + }, + "application/vnd.wv.csp+xml": { + "source": "iana" + }, + "application/vnd.wv.ssp+xml": { + "source": "iana" + }, + "application/vnd.xacml+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.xara": { + "source": "iana", + "extensions": ["xar"] + }, + "application/vnd.xfdl": { + "source": "iana", + "extensions": ["xfdl"] + }, + "application/vnd.xfdl.webform": { + "source": "iana" + }, + "application/vnd.xmi+xml": { + "source": "iana" + }, + "application/vnd.xmpie.cpkg": { + "source": "iana" + }, + "application/vnd.xmpie.dpkg": { + "source": "iana" + }, + "application/vnd.xmpie.plan": { + "source": "iana" + }, + "application/vnd.xmpie.ppkg": { + "source": "iana" + }, + "application/vnd.xmpie.xlim": { + "source": "iana" + }, + "application/vnd.yamaha.hv-dic": { + "source": "iana", + "extensions": ["hvd"] + }, + "application/vnd.yamaha.hv-script": { + "source": "iana", + "extensions": ["hvs"] + }, + "application/vnd.yamaha.hv-voice": { + "source": "iana", + "extensions": ["hvp"] + }, + "application/vnd.yamaha.openscoreformat": { + "source": "iana", + "extensions": ["osf"] + }, + "application/vnd.yamaha.openscoreformat.osfpvg+xml": { + "source": "iana", + "extensions": ["osfpvg"] + }, + "application/vnd.yamaha.remote-setup": { + "source": "iana" + }, + "application/vnd.yamaha.smaf-audio": { + "source": "iana", + "extensions": ["saf"] + }, + "application/vnd.yamaha.smaf-phrase": { + "source": "iana", + "extensions": ["spf"] + }, + "application/vnd.yamaha.through-ngn": { + "source": "iana" + }, + "application/vnd.yamaha.tunnel-udpencap": { + "source": "iana" + }, + "application/vnd.yaoweme": { + "source": "iana" + }, + "application/vnd.yellowriver-custom-menu": { + "source": "iana", + "extensions": ["cmp"] + }, + "application/vnd.zul": { + "source": "iana", + "extensions": ["zir","zirz"] + }, + "application/vnd.zzazz.deck+xml": { + "source": "iana", + "extensions": ["zaz"] + }, + "application/voicexml+xml": { + "source": "iana", + "extensions": ["vxml"] + }, + "application/vq-rtcpxr": { + "source": "iana" + }, + "application/watcherinfo+xml": { + "source": "iana" + }, + "application/whoispp-query": { + "source": "iana" + }, + "application/whoispp-response": { + "source": "iana" + }, + "application/widget": { + "source": "iana", + "extensions": ["wgt"] + }, + "application/winhlp": { + "source": "apache", + "extensions": ["hlp"] + }, + "application/wita": { + "source": "iana" + }, + "application/wordperfect5.1": { + "source": "iana" + }, + "application/wsdl+xml": { + "source": "iana", + "extensions": ["wsdl"] + }, + "application/wspolicy+xml": { + "source": "iana", + "extensions": ["wspolicy"] + }, + "application/x-7z-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["7z"] + }, + "application/x-abiword": { + "source": "apache", + "extensions": ["abw"] + }, + "application/x-ace-compressed": { + "source": "apache", + "extensions": ["ace"] + }, + "application/x-amf": { + "source": "apache" + }, + "application/x-apple-diskimage": { + "source": "apache", + "extensions": ["dmg"] + }, + "application/x-authorware-bin": { + "source": "apache", + "extensions": ["aab","x32","u32","vox"] + }, + "application/x-authorware-map": { + "source": "apache", + "extensions": ["aam"] + }, + "application/x-authorware-seg": { + "source": "apache", + "extensions": ["aas"] + }, + "application/x-bcpio": { + "source": "apache", + "extensions": ["bcpio"] + }, + "application/x-bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/x-bittorrent": { + "source": "apache", + "extensions": ["torrent"] + }, + "application/x-blorb": { + "source": "apache", + "extensions": ["blb","blorb"] + }, + "application/x-bzip": { + "source": "apache", + "compressible": false, + "extensions": ["bz"] + }, + "application/x-bzip2": { + "source": "apache", + "compressible": false, + "extensions": ["bz2","boz"] + }, + "application/x-cbr": { + "source": "apache", + "extensions": ["cbr","cba","cbt","cbz","cb7"] + }, + "application/x-cdlink": { + "source": "apache", + "extensions": ["vcd"] + }, + "application/x-cfs-compressed": { + "source": "apache", + "extensions": ["cfs"] + }, + "application/x-chat": { + "source": "apache", + "extensions": ["chat"] + }, + "application/x-chess-pgn": { + "source": "apache", + "extensions": ["pgn"] + }, + "application/x-chrome-extension": { + "extensions": ["crx"] + }, + "application/x-cocoa": { + "source": "nginx", + "extensions": ["cco"] + }, + "application/x-compress": { + "source": "apache" + }, + "application/x-conference": { + "source": "apache", + "extensions": ["nsc"] + }, + "application/x-cpio": { + "source": "apache", + "extensions": ["cpio"] + }, + "application/x-csh": { + "source": "apache", + "extensions": ["csh"] + }, + "application/x-deb": { + "compressible": false + }, + "application/x-debian-package": { + "source": "apache", + "extensions": ["deb","udeb"] + }, + "application/x-dgc-compressed": { + "source": "apache", + "extensions": ["dgc"] + }, + "application/x-director": { + "source": "apache", + "extensions": ["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"] + }, + "application/x-doom": { + "source": "apache", + "extensions": ["wad"] + }, + "application/x-dtbncx+xml": { + "source": "apache", + "extensions": ["ncx"] + }, + "application/x-dtbook+xml": { + "source": "apache", + "extensions": ["dtb"] + }, + "application/x-dtbresource+xml": { + "source": "apache", + "extensions": ["res"] + }, + "application/x-dvi": { + "source": "apache", + "compressible": false, + "extensions": ["dvi"] + }, + "application/x-envoy": { + "source": "apache", + "extensions": ["evy"] + }, + "application/x-eva": { + "source": "apache", + "extensions": ["eva"] + }, + "application/x-font-bdf": { + "source": "apache", + "extensions": ["bdf"] + }, + "application/x-font-dos": { + "source": "apache" + }, + "application/x-font-framemaker": { + "source": "apache" + }, + "application/x-font-ghostscript": { + "source": "apache", + "extensions": ["gsf"] + }, + "application/x-font-libgrx": { + "source": "apache" + }, + "application/x-font-linux-psf": { + "source": "apache", + "extensions": ["psf"] + }, + "application/x-font-otf": { + "source": "apache", + "compressible": true, + "extensions": ["otf"] + }, + "application/x-font-pcf": { + "source": "apache", + "extensions": ["pcf"] + }, + "application/x-font-snf": { + "source": "apache", + "extensions": ["snf"] + }, + "application/x-font-speedo": { + "source": "apache" + }, + "application/x-font-sunos-news": { + "source": "apache" + }, + "application/x-font-ttf": { + "source": "apache", + "compressible": true, + "extensions": ["ttf","ttc"] + }, + "application/x-font-type1": { + "source": "apache", + "extensions": ["pfa","pfb","pfm","afm"] + }, + "application/x-font-vfont": { + "source": "apache" + }, + "application/x-freearc": { + "source": "apache", + "extensions": ["arc"] + }, + "application/x-futuresplash": { + "source": "apache", + "extensions": ["spl"] + }, + "application/x-gca-compressed": { + "source": "apache", + "extensions": ["gca"] + }, + "application/x-glulx": { + "source": "apache", + "extensions": ["ulx"] + }, + "application/x-gnumeric": { + "source": "apache", + "extensions": ["gnumeric"] + }, + "application/x-gramps-xml": { + "source": "apache", + "extensions": ["gramps"] + }, + "application/x-gtar": { + "source": "apache", + "extensions": ["gtar"] + }, + "application/x-gzip": { + "source": "apache" + }, + "application/x-hdf": { + "source": "apache", + "extensions": ["hdf"] + }, + "application/x-httpd-php": { + "compressible": true, + "extensions": ["php"] + }, + "application/x-install-instructions": { + "source": "apache", + "extensions": ["install"] + }, + "application/x-iso9660-image": { + "source": "apache", + "extensions": ["iso"] + }, + "application/x-java-archive-diff": { + "source": "nginx", + "extensions": ["jardiff"] + }, + "application/x-java-jnlp-file": { + "source": "apache", + "compressible": false, + "extensions": ["jnlp"] + }, + "application/x-javascript": { + "compressible": true + }, + "application/x-latex": { + "source": "apache", + "compressible": false, + "extensions": ["latex"] + }, + "application/x-lua-bytecode": { + "extensions": ["luac"] + }, + "application/x-lzh-compressed": { + "source": "apache", + "extensions": ["lzh","lha"] + }, + "application/x-makeself": { + "source": "nginx", + "extensions": ["run"] + }, + "application/x-mie": { + "source": "apache", + "extensions": ["mie"] + }, + "application/x-mobipocket-ebook": { + "source": "apache", + "extensions": ["prc","mobi"] + }, + "application/x-mpegurl": { + "compressible": false + }, + "application/x-ms-application": { + "source": "apache", + "extensions": ["application"] + }, + "application/x-ms-shortcut": { + "source": "apache", + "extensions": ["lnk"] + }, + "application/x-ms-wmd": { + "source": "apache", + "extensions": ["wmd"] + }, + "application/x-ms-wmz": { + "source": "apache", + "extensions": ["wmz"] + }, + "application/x-ms-xbap": { + "source": "apache", + "extensions": ["xbap"] + }, + "application/x-msaccess": { + "source": "apache", + "extensions": ["mdb"] + }, + "application/x-msbinder": { + "source": "apache", + "extensions": ["obd"] + }, + "application/x-mscardfile": { + "source": "apache", + "extensions": ["crd"] + }, + "application/x-msclip": { + "source": "apache", + "extensions": ["clp"] + }, + "application/x-msdos-program": { + "extensions": ["exe"] + }, + "application/x-msdownload": { + "source": "apache", + "extensions": ["exe","dll","com","bat","msi"] + }, + "application/x-msmediaview": { + "source": "apache", + "extensions": ["mvb","m13","m14"] + }, + "application/x-msmetafile": { + "source": "apache", + "extensions": ["wmf","wmz","emf","emz"] + }, + "application/x-msmoney": { + "source": "apache", + "extensions": ["mny"] + }, + "application/x-mspublisher": { + "source": "apache", + "extensions": ["pub"] + }, + "application/x-msschedule": { + "source": "apache", + "extensions": ["scd"] + }, + "application/x-msterminal": { + "source": "apache", + "extensions": ["trm"] + }, + "application/x-mswrite": { + "source": "apache", + "extensions": ["wri"] + }, + "application/x-netcdf": { + "source": "apache", + "extensions": ["nc","cdf"] + }, + "application/x-ns-proxy-autoconfig": { + "compressible": true, + "extensions": ["pac"] + }, + "application/x-nzb": { + "source": "apache", + "extensions": ["nzb"] + }, + "application/x-perl": { + "source": "nginx", + "extensions": ["pl","pm"] + }, + "application/x-pilot": { + "source": "nginx", + "extensions": ["prc","pdb"] + }, + "application/x-pkcs12": { + "source": "apache", + "compressible": false, + "extensions": ["p12","pfx"] + }, + "application/x-pkcs7-certificates": { + "source": "apache", + "extensions": ["p7b","spc"] + }, + "application/x-pkcs7-certreqresp": { + "source": "apache", + "extensions": ["p7r"] + }, + "application/x-rar-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["rar"] + }, + "application/x-redhat-package-manager": { + "source": "nginx", + "extensions": ["rpm"] + }, + "application/x-research-info-systems": { + "source": "apache", + "extensions": ["ris"] + }, + "application/x-sea": { + "source": "nginx", + "extensions": ["sea"] + }, + "application/x-sh": { + "source": "apache", + "compressible": true, + "extensions": ["sh"] + }, + "application/x-shar": { + "source": "apache", + "extensions": ["shar"] + }, + "application/x-shockwave-flash": { + "source": "apache", + "compressible": false, + "extensions": ["swf"] + }, + "application/x-silverlight-app": { + "source": "apache", + "extensions": ["xap"] + }, + "application/x-sql": { + "source": "apache", + "extensions": ["sql"] + }, + "application/x-stuffit": { + "source": "apache", + "compressible": false, + "extensions": ["sit"] + }, + "application/x-stuffitx": { + "source": "apache", + "extensions": ["sitx"] + }, + "application/x-subrip": { + "source": "apache", + "extensions": ["srt"] + }, + "application/x-sv4cpio": { + "source": "apache", + "extensions": ["sv4cpio"] + }, + "application/x-sv4crc": { + "source": "apache", + "extensions": ["sv4crc"] + }, + "application/x-t3vm-image": { + "source": "apache", + "extensions": ["t3"] + }, + "application/x-tads": { + "source": "apache", + "extensions": ["gam"] + }, + "application/x-tar": { + "source": "apache", + "compressible": true, + "extensions": ["tar"] + }, + "application/x-tcl": { + "source": "apache", + "extensions": ["tcl","tk"] + }, + "application/x-tex": { + "source": "apache", + "extensions": ["tex"] + }, + "application/x-tex-tfm": { + "source": "apache", + "extensions": ["tfm"] + }, + "application/x-texinfo": { + "source": "apache", + "extensions": ["texinfo","texi"] + }, + "application/x-tgif": { + "source": "apache", + "extensions": ["obj"] + }, + "application/x-ustar": { + "source": "apache", + "extensions": ["ustar"] + }, + "application/x-wais-source": { + "source": "apache", + "extensions": ["src"] + }, + "application/x-web-app-manifest+json": { + "compressible": true, + "extensions": ["webapp"] + }, + "application/x-www-form-urlencoded": { + "source": "iana", + "compressible": true + }, + "application/x-x509-ca-cert": { + "source": "apache", + "extensions": ["der","crt","pem"] + }, + "application/x-xfig": { + "source": "apache", + "extensions": ["fig"] + }, + "application/x-xliff+xml": { + "source": "apache", + "extensions": ["xlf"] + }, + "application/x-xpinstall": { + "source": "apache", + "compressible": false, + "extensions": ["xpi"] + }, + "application/x-xz": { + "source": "apache", + "extensions": ["xz"] + }, + "application/x-zmachine": { + "source": "apache", + "extensions": ["z1","z2","z3","z4","z5","z6","z7","z8"] + }, + "application/x400-bp": { + "source": "iana" + }, + "application/xacml+xml": { + "source": "iana" + }, + "application/xaml+xml": { + "source": "apache", + "extensions": ["xaml"] + }, + "application/xcap-att+xml": { + "source": "iana" + }, + "application/xcap-caps+xml": { + "source": "iana" + }, + "application/xcap-diff+xml": { + "source": "iana", + "extensions": ["xdf"] + }, + "application/xcap-el+xml": { + "source": "iana" + }, + "application/xcap-error+xml": { + "source": "iana" + }, + "application/xcap-ns+xml": { + "source": "iana" + }, + "application/xcon-conference-info+xml": { + "source": "iana" + }, + "application/xcon-conference-info-diff+xml": { + "source": "iana" + }, + "application/xenc+xml": { + "source": "iana", + "extensions": ["xenc"] + }, + "application/xhtml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xhtml","xht"] + }, + "application/xhtml-voice+xml": { + "source": "apache" + }, + "application/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml","xsl","xsd","rng"] + }, + "application/xml-dtd": { + "source": "iana", + "compressible": true, + "extensions": ["dtd"] + }, + "application/xml-external-parsed-entity": { + "source": "iana" + }, + "application/xml-patch+xml": { + "source": "iana" + }, + "application/xmpp+xml": { + "source": "iana" + }, + "application/xop+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xop"] + }, + "application/xproc+xml": { + "source": "apache", + "extensions": ["xpl"] + }, + "application/xslt+xml": { + "source": "iana", + "extensions": ["xslt"] + }, + "application/xspf+xml": { + "source": "apache", + "extensions": ["xspf"] + }, + "application/xv+xml": { + "source": "iana", + "extensions": ["mxml","xhvml","xvml","xvm"] + }, + "application/yang": { + "source": "iana", + "extensions": ["yang"] + }, + "application/yang-data+json": { + "source": "iana", + "compressible": true + }, + "application/yang-data+xml": { + "source": "iana" + }, + "application/yang-patch+json": { + "source": "iana", + "compressible": true + }, + "application/yang-patch+xml": { + "source": "iana" + }, + "application/yin+xml": { + "source": "iana", + "extensions": ["yin"] + }, + "application/zip": { + "source": "iana", + "compressible": false, + "extensions": ["zip"] + }, + "application/zlib": { + "source": "iana" + }, + "audio/1d-interleaved-parityfec": { + "source": "iana" + }, + "audio/32kadpcm": { + "source": "iana" + }, + "audio/3gpp": { + "source": "iana", + "compressible": false, + "extensions": ["3gpp"] + }, + "audio/3gpp2": { + "source": "iana" + }, + "audio/ac3": { + "source": "iana" + }, + "audio/adpcm": { + "source": "apache", + "extensions": ["adp"] + }, + "audio/amr": { + "source": "iana" + }, + "audio/amr-wb": { + "source": "iana" + }, + "audio/amr-wb+": { + "source": "iana" + }, + "audio/aptx": { + "source": "iana" + }, + "audio/asc": { + "source": "iana" + }, + "audio/atrac-advanced-lossless": { + "source": "iana" + }, + "audio/atrac-x": { + "source": "iana" + }, + "audio/atrac3": { + "source": "iana" + }, + "audio/basic": { + "source": "iana", + "compressible": false, + "extensions": ["au","snd"] + }, + "audio/bv16": { + "source": "iana" + }, + "audio/bv32": { + "source": "iana" + }, + "audio/clearmode": { + "source": "iana" + }, + "audio/cn": { + "source": "iana" + }, + "audio/dat12": { + "source": "iana" + }, + "audio/dls": { + "source": "iana" + }, + "audio/dsr-es201108": { + "source": "iana" + }, + "audio/dsr-es202050": { + "source": "iana" + }, + "audio/dsr-es202211": { + "source": "iana" + }, + "audio/dsr-es202212": { + "source": "iana" + }, + "audio/dv": { + "source": "iana" + }, + "audio/dvi4": { + "source": "iana" + }, + "audio/eac3": { + "source": "iana" + }, + "audio/encaprtp": { + "source": "iana" + }, + "audio/evrc": { + "source": "iana" + }, + "audio/evrc-qcp": { + "source": "iana" + }, + "audio/evrc0": { + "source": "iana" + }, + "audio/evrc1": { + "source": "iana" + }, + "audio/evrcb": { + "source": "iana" + }, + "audio/evrcb0": { + "source": "iana" + }, + "audio/evrcb1": { + "source": "iana" + }, + "audio/evrcnw": { + "source": "iana" + }, + "audio/evrcnw0": { + "source": "iana" + }, + "audio/evrcnw1": { + "source": "iana" + }, + "audio/evrcwb": { + "source": "iana" + }, + "audio/evrcwb0": { + "source": "iana" + }, + "audio/evrcwb1": { + "source": "iana" + }, + "audio/evs": { + "source": "iana" + }, + "audio/fwdred": { + "source": "iana" + }, + "audio/g711-0": { + "source": "iana" + }, + "audio/g719": { + "source": "iana" + }, + "audio/g722": { + "source": "iana" + }, + "audio/g7221": { + "source": "iana" + }, + "audio/g723": { + "source": "iana" + }, + "audio/g726-16": { + "source": "iana" + }, + "audio/g726-24": { + "source": "iana" + }, + "audio/g726-32": { + "source": "iana" + }, + "audio/g726-40": { + "source": "iana" + }, + "audio/g728": { + "source": "iana" + }, + "audio/g729": { + "source": "iana" + }, + "audio/g7291": { + "source": "iana" + }, + "audio/g729d": { + "source": "iana" + }, + "audio/g729e": { + "source": "iana" + }, + "audio/gsm": { + "source": "iana" + }, + "audio/gsm-efr": { + "source": "iana" + }, + "audio/gsm-hr-08": { + "source": "iana" + }, + "audio/ilbc": { + "source": "iana" + }, + "audio/ip-mr_v2.5": { + "source": "iana" + }, + "audio/isac": { + "source": "apache" + }, + "audio/l16": { + "source": "iana" + }, + "audio/l20": { + "source": "iana" + }, + "audio/l24": { + "source": "iana", + "compressible": false + }, + "audio/l8": { + "source": "iana" + }, + "audio/lpc": { + "source": "iana" + }, + "audio/melp": { + "source": "iana" + }, + "audio/melp1200": { + "source": "iana" + }, + "audio/melp2400": { + "source": "iana" + }, + "audio/melp600": { + "source": "iana" + }, + "audio/midi": { + "source": "apache", + "extensions": ["mid","midi","kar","rmi"] + }, + "audio/mobile-xmf": { + "source": "iana" + }, + "audio/mp3": { + "compressible": false, + "extensions": ["mp3"] + }, + "audio/mp4": { + "source": "iana", + "compressible": false, + "extensions": ["m4a","mp4a"] + }, + "audio/mp4a-latm": { + "source": "iana" + }, + "audio/mpa": { + "source": "iana" + }, + "audio/mpa-robust": { + "source": "iana" + }, + "audio/mpeg": { + "source": "iana", + "compressible": false, + "extensions": ["mpga","mp2","mp2a","mp3","m2a","m3a"] + }, + "audio/mpeg4-generic": { + "source": "iana" + }, + "audio/musepack": { + "source": "apache" + }, + "audio/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["oga","ogg","spx"] + }, + "audio/opus": { + "source": "iana" + }, + "audio/parityfec": { + "source": "iana" + }, + "audio/pcma": { + "source": "iana" + }, + "audio/pcma-wb": { + "source": "iana" + }, + "audio/pcmu": { + "source": "iana" + }, + "audio/pcmu-wb": { + "source": "iana" + }, + "audio/prs.sid": { + "source": "iana" + }, + "audio/qcelp": { + "source": "iana" + }, + "audio/raptorfec": { + "source": "iana" + }, + "audio/red": { + "source": "iana" + }, + "audio/rtp-enc-aescm128": { + "source": "iana" + }, + "audio/rtp-midi": { + "source": "iana" + }, + "audio/rtploopback": { + "source": "iana" + }, + "audio/rtx": { + "source": "iana" + }, + "audio/s3m": { + "source": "apache", + "extensions": ["s3m"] + }, + "audio/silk": { + "source": "apache", + "extensions": ["sil"] + }, + "audio/smv": { + "source": "iana" + }, + "audio/smv-qcp": { + "source": "iana" + }, + "audio/smv0": { + "source": "iana" + }, + "audio/sp-midi": { + "source": "iana" + }, + "audio/speex": { + "source": "iana" + }, + "audio/t140c": { + "source": "iana" + }, + "audio/t38": { + "source": "iana" + }, + "audio/telephone-event": { + "source": "iana" + }, + "audio/tone": { + "source": "iana" + }, + "audio/uemclip": { + "source": "iana" + }, + "audio/ulpfec": { + "source": "iana" + }, + "audio/vdvi": { + "source": "iana" + }, + "audio/vmr-wb": { + "source": "iana" + }, + "audio/vnd.3gpp.iufp": { + "source": "iana" + }, + "audio/vnd.4sb": { + "source": "iana" + }, + "audio/vnd.audiokoz": { + "source": "iana" + }, + "audio/vnd.celp": { + "source": "iana" + }, + "audio/vnd.cisco.nse": { + "source": "iana" + }, + "audio/vnd.cmles.radio-events": { + "source": "iana" + }, + "audio/vnd.cns.anp1": { + "source": "iana" + }, + "audio/vnd.cns.inf1": { + "source": "iana" + }, + "audio/vnd.dece.audio": { + "source": "iana", + "extensions": ["uva","uvva"] + }, + "audio/vnd.digital-winds": { + "source": "iana", + "extensions": ["eol"] + }, + "audio/vnd.dlna.adts": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.1": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.2": { + "source": "iana" + }, + "audio/vnd.dolby.mlp": { + "source": "iana" + }, + "audio/vnd.dolby.mps": { + "source": "iana" + }, + "audio/vnd.dolby.pl2": { + "source": "iana" + }, + "audio/vnd.dolby.pl2x": { + "source": "iana" + }, + "audio/vnd.dolby.pl2z": { + "source": "iana" + }, + "audio/vnd.dolby.pulse.1": { + "source": "iana" + }, + "audio/vnd.dra": { + "source": "iana", + "extensions": ["dra"] + }, + "audio/vnd.dts": { + "source": "iana", + "extensions": ["dts"] + }, + "audio/vnd.dts.hd": { + "source": "iana", + "extensions": ["dtshd"] + }, + "audio/vnd.dvb.file": { + "source": "iana" + }, + "audio/vnd.everad.plj": { + "source": "iana" + }, + "audio/vnd.hns.audio": { + "source": "iana" + }, + "audio/vnd.lucent.voice": { + "source": "iana", + "extensions": ["lvp"] + }, + "audio/vnd.ms-playready.media.pya": { + "source": "iana", + "extensions": ["pya"] + }, + "audio/vnd.nokia.mobile-xmf": { + "source": "iana" + }, + "audio/vnd.nortel.vbk": { + "source": "iana" + }, + "audio/vnd.nuera.ecelp4800": { + "source": "iana", + "extensions": ["ecelp4800"] + }, + "audio/vnd.nuera.ecelp7470": { + "source": "iana", + "extensions": ["ecelp7470"] + }, + "audio/vnd.nuera.ecelp9600": { + "source": "iana", + "extensions": ["ecelp9600"] + }, + "audio/vnd.octel.sbc": { + "source": "iana" + }, + "audio/vnd.qcelp": { + "source": "iana" + }, + "audio/vnd.rhetorex.32kadpcm": { + "source": "iana" + }, + "audio/vnd.rip": { + "source": "iana", + "extensions": ["rip"] + }, + "audio/vnd.rn-realaudio": { + "compressible": false + }, + "audio/vnd.sealedmedia.softseal.mpeg": { + "source": "iana" + }, + "audio/vnd.vmx.cvsd": { + "source": "iana" + }, + "audio/vnd.wave": { + "compressible": false + }, + "audio/vorbis": { + "source": "iana", + "compressible": false + }, + "audio/vorbis-config": { + "source": "iana" + }, + "audio/wav": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/wave": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/webm": { + "source": "apache", + "compressible": false, + "extensions": ["weba"] + }, + "audio/x-aac": { + "source": "apache", + "compressible": false, + "extensions": ["aac"] + }, + "audio/x-aiff": { + "source": "apache", + "extensions": ["aif","aiff","aifc"] + }, + "audio/x-caf": { + "source": "apache", + "compressible": false, + "extensions": ["caf"] + }, + "audio/x-flac": { + "source": "apache", + "extensions": ["flac"] + }, + "audio/x-m4a": { + "source": "nginx", + "extensions": ["m4a"] + }, + "audio/x-matroska": { + "source": "apache", + "extensions": ["mka"] + }, + "audio/x-mpegurl": { + "source": "apache", + "extensions": ["m3u"] + }, + "audio/x-ms-wax": { + "source": "apache", + "extensions": ["wax"] + }, + "audio/x-ms-wma": { + "source": "apache", + "extensions": ["wma"] + }, + "audio/x-pn-realaudio": { + "source": "apache", + "extensions": ["ram","ra"] + }, + "audio/x-pn-realaudio-plugin": { + "source": "apache", + "extensions": ["rmp"] + }, + "audio/x-realaudio": { + "source": "nginx", + "extensions": ["ra"] + }, + "audio/x-tta": { + "source": "apache" + }, + "audio/x-wav": { + "source": "apache", + "extensions": ["wav"] + }, + "audio/xm": { + "source": "apache", + "extensions": ["xm"] + }, + "chemical/x-cdx": { + "source": "apache", + "extensions": ["cdx"] + }, + "chemical/x-cif": { + "source": "apache", + "extensions": ["cif"] + }, + "chemical/x-cmdf": { + "source": "apache", + "extensions": ["cmdf"] + }, + "chemical/x-cml": { + "source": "apache", + "extensions": ["cml"] + }, + "chemical/x-csml": { + "source": "apache", + "extensions": ["csml"] + }, + "chemical/x-pdb": { + "source": "apache" + }, + "chemical/x-xyz": { + "source": "apache", + "extensions": ["xyz"] + }, + "font/opentype": { + "compressible": true, + "extensions": ["otf"] + }, + "image/apng": { + "compressible": false, + "extensions": ["apng"] + }, + "image/bmp": { + "source": "iana", + "compressible": true, + "extensions": ["bmp"] + }, + "image/cgm": { + "source": "iana", + "extensions": ["cgm"] + }, + "image/dicom-rle": { + "source": "iana" + }, + "image/emf": { + "source": "iana" + }, + "image/fits": { + "source": "iana" + }, + "image/g3fax": { + "source": "iana", + "extensions": ["g3"] + }, + "image/gif": { + "source": "iana", + "compressible": false, + "extensions": ["gif"] + }, + "image/ief": { + "source": "iana", + "extensions": ["ief"] + }, + "image/jls": { + "source": "iana" + }, + "image/jp2": { + "source": "iana" + }, + "image/jpeg": { + "source": "iana", + "compressible": false, + "extensions": ["jpeg","jpg","jpe"] + }, + "image/jpm": { + "source": "iana" + }, + "image/jpx": { + "source": "iana" + }, + "image/ktx": { + "source": "iana", + "extensions": ["ktx"] + }, + "image/naplps": { + "source": "iana" + }, + "image/pjpeg": { + "compressible": false + }, + "image/png": { + "source": "iana", + "compressible": false, + "extensions": ["png"] + }, + "image/prs.btif": { + "source": "iana", + "extensions": ["btif"] + }, + "image/prs.pti": { + "source": "iana" + }, + "image/pwg-raster": { + "source": "iana" + }, + "image/sgi": { + "source": "apache", + "extensions": ["sgi"] + }, + "image/svg+xml": { + "source": "iana", + "compressible": true, + "extensions": ["svg","svgz"] + }, + "image/t38": { + "source": "iana" + }, + "image/tiff": { + "source": "iana", + "compressible": false, + "extensions": ["tiff","tif"] + }, + "image/tiff-fx": { + "source": "iana" + }, + "image/vnd.adobe.photoshop": { + "source": "iana", + "compressible": true, + "extensions": ["psd"] + }, + "image/vnd.airzip.accelerator.azv": { + "source": "iana" + }, + "image/vnd.cns.inf2": { + "source": "iana" + }, + "image/vnd.dece.graphic": { + "source": "iana", + "extensions": ["uvi","uvvi","uvg","uvvg"] + }, + "image/vnd.djvu": { + "source": "iana", + "extensions": ["djvu","djv"] + }, + "image/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "image/vnd.dwg": { + "source": "iana", + "extensions": ["dwg"] + }, + "image/vnd.dxf": { + "source": "iana", + "extensions": ["dxf"] + }, + "image/vnd.fastbidsheet": { + "source": "iana", + "extensions": ["fbs"] + }, + "image/vnd.fpx": { + "source": "iana", + "extensions": ["fpx"] + }, + "image/vnd.fst": { + "source": "iana", + "extensions": ["fst"] + }, + "image/vnd.fujixerox.edmics-mmr": { + "source": "iana", + "extensions": ["mmr"] + }, + "image/vnd.fujixerox.edmics-rlc": { + "source": "iana", + "extensions": ["rlc"] + }, + "image/vnd.globalgraphics.pgb": { + "source": "iana" + }, + "image/vnd.microsoft.icon": { + "source": "iana" + }, + "image/vnd.mix": { + "source": "iana" + }, + "image/vnd.mozilla.apng": { + "source": "iana" + }, + "image/vnd.ms-modi": { + "source": "iana", + "extensions": ["mdi"] + }, + "image/vnd.ms-photo": { + "source": "apache", + "extensions": ["wdp"] + }, + "image/vnd.net-fpx": { + "source": "iana", + "extensions": ["npx"] + }, + "image/vnd.radiance": { + "source": "iana" + }, + "image/vnd.sealed.png": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.gif": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.jpg": { + "source": "iana" + }, + "image/vnd.svf": { + "source": "iana" + }, + "image/vnd.tencent.tap": { + "source": "iana" + }, + "image/vnd.valve.source.texture": { + "source": "iana" + }, + "image/vnd.wap.wbmp": { + "source": "iana", + "extensions": ["wbmp"] + }, + "image/vnd.xiff": { + "source": "iana", + "extensions": ["xif"] + }, + "image/vnd.zbrush.pcx": { + "source": "iana" + }, + "image/webp": { + "source": "apache", + "extensions": ["webp"] + }, + "image/wmf": { + "source": "iana" + }, + "image/x-3ds": { + "source": "apache", + "extensions": ["3ds"] + }, + "image/x-cmu-raster": { + "source": "apache", + "extensions": ["ras"] + }, + "image/x-cmx": { + "source": "apache", + "extensions": ["cmx"] + }, + "image/x-freehand": { + "source": "apache", + "extensions": ["fh","fhc","fh4","fh5","fh7"] + }, + "image/x-icon": { + "source": "apache", + "compressible": true, + "extensions": ["ico"] + }, + "image/x-jng": { + "source": "nginx", + "extensions": ["jng"] + }, + "image/x-mrsid-image": { + "source": "apache", + "extensions": ["sid"] + }, + "image/x-ms-bmp": { + "source": "nginx", + "compressible": true, + "extensions": ["bmp"] + }, + "image/x-pcx": { + "source": "apache", + "extensions": ["pcx"] + }, + "image/x-pict": { + "source": "apache", + "extensions": ["pic","pct"] + }, + "image/x-portable-anymap": { + "source": "apache", + "extensions": ["pnm"] + }, + "image/x-portable-bitmap": { + "source": "apache", + "extensions": ["pbm"] + }, + "image/x-portable-graymap": { + "source": "apache", + "extensions": ["pgm"] + }, + "image/x-portable-pixmap": { + "source": "apache", + "extensions": ["ppm"] + }, + "image/x-rgb": { + "source": "apache", + "extensions": ["rgb"] + }, + "image/x-tga": { + "source": "apache", + "extensions": ["tga"] + }, + "image/x-xbitmap": { + "source": "apache", + "extensions": ["xbm"] + }, + "image/x-xcf": { + "compressible": false + }, + "image/x-xpixmap": { + "source": "apache", + "extensions": ["xpm"] + }, + "image/x-xwindowdump": { + "source": "apache", + "extensions": ["xwd"] + }, + "message/cpim": { + "source": "iana" + }, + "message/delivery-status": { + "source": "iana" + }, + "message/disposition-notification": { + "source": "iana" + }, + "message/external-body": { + "source": "iana" + }, + "message/feedback-report": { + "source": "iana" + }, + "message/global": { + "source": "iana" + }, + "message/global-delivery-status": { + "source": "iana" + }, + "message/global-disposition-notification": { + "source": "iana" + }, + "message/global-headers": { + "source": "iana" + }, + "message/http": { + "source": "iana", + "compressible": false + }, + "message/imdn+xml": { + "source": "iana", + "compressible": true + }, + "message/news": { + "source": "iana" + }, + "message/partial": { + "source": "iana", + "compressible": false + }, + "message/rfc822": { + "source": "iana", + "compressible": true, + "extensions": ["eml","mime"] + }, + "message/s-http": { + "source": "iana" + }, + "message/sip": { + "source": "iana" + }, + "message/sipfrag": { + "source": "iana" + }, + "message/tracking-status": { + "source": "iana" + }, + "message/vnd.si.simp": { + "source": "iana" + }, + "message/vnd.wfa.wsc": { + "source": "iana" + }, + "model/gltf+json": { + "source": "iana", + "compressible": true + }, + "model/iges": { + "source": "iana", + "compressible": false, + "extensions": ["igs","iges"] + }, + "model/mesh": { + "source": "iana", + "compressible": false, + "extensions": ["msh","mesh","silo"] + }, + "model/vnd.collada+xml": { + "source": "iana", + "extensions": ["dae"] + }, + "model/vnd.dwf": { + "source": "iana", + "extensions": ["dwf"] + }, + "model/vnd.flatland.3dml": { + "source": "iana" + }, + "model/vnd.gdl": { + "source": "iana", + "extensions": ["gdl"] + }, + "model/vnd.gs-gdl": { + "source": "apache" + }, + "model/vnd.gs.gdl": { + "source": "iana" + }, + "model/vnd.gtw": { + "source": "iana", + "extensions": ["gtw"] + }, + "model/vnd.moml+xml": { + "source": "iana" + }, + "model/vnd.mts": { + "source": "iana", + "extensions": ["mts"] + }, + "model/vnd.opengex": { + "source": "iana" + }, + "model/vnd.parasolid.transmit.binary": { + "source": "iana" + }, + "model/vnd.parasolid.transmit.text": { + "source": "iana" + }, + "model/vnd.rosette.annotated-data-model": { + "source": "iana" + }, + "model/vnd.valve.source.compiled-map": { + "source": "iana" + }, + "model/vnd.vtu": { + "source": "iana", + "extensions": ["vtu"] + }, + "model/vrml": { + "source": "iana", + "compressible": false, + "extensions": ["wrl","vrml"] + }, + "model/x3d+binary": { + "source": "apache", + "compressible": false, + "extensions": ["x3db","x3dbz"] + }, + "model/x3d+fastinfoset": { + "source": "iana" + }, + "model/x3d+vrml": { + "source": "apache", + "compressible": false, + "extensions": ["x3dv","x3dvz"] + }, + "model/x3d+xml": { + "source": "iana", + "compressible": true, + "extensions": ["x3d","x3dz"] + }, + "model/x3d-vrml": { + "source": "iana" + }, + "multipart/alternative": { + "source": "iana", + "compressible": false + }, + "multipart/appledouble": { + "source": "iana" + }, + "multipart/byteranges": { + "source": "iana" + }, + "multipart/digest": { + "source": "iana" + }, + "multipart/encrypted": { + "source": "iana", + "compressible": false + }, + "multipart/form-data": { + "source": "iana", + "compressible": false + }, + "multipart/header-set": { + "source": "iana" + }, + "multipart/mixed": { + "source": "iana", + "compressible": false + }, + "multipart/parallel": { + "source": "iana" + }, + "multipart/related": { + "source": "iana", + "compressible": false + }, + "multipart/report": { + "source": "iana" + }, + "multipart/signed": { + "source": "iana", + "compressible": false + }, + "multipart/voice-message": { + "source": "iana" + }, + "multipart/x-mixed-replace": { + "source": "iana" + }, + "text/1d-interleaved-parityfec": { + "source": "iana" + }, + "text/cache-manifest": { + "source": "iana", + "compressible": true, + "extensions": ["appcache","manifest"] + }, + "text/calendar": { + "source": "iana", + "extensions": ["ics","ifb"] + }, + "text/calender": { + "compressible": true + }, + "text/cmd": { + "compressible": true + }, + "text/coffeescript": { + "extensions": ["coffee","litcoffee"] + }, + "text/css": { + "source": "iana", + "compressible": true, + "extensions": ["css"] + }, + "text/csv": { + "source": "iana", + "compressible": true, + "extensions": ["csv"] + }, + "text/csv-schema": { + "source": "iana" + }, + "text/directory": { + "source": "iana" + }, + "text/dns": { + "source": "iana" + }, + "text/ecmascript": { + "source": "iana" + }, + "text/encaprtp": { + "source": "iana" + }, + "text/enriched": { + "source": "iana" + }, + "text/fwdred": { + "source": "iana" + }, + "text/grammar-ref-list": { + "source": "iana" + }, + "text/hjson": { + "extensions": ["hjson"] + }, + "text/html": { + "source": "iana", + "compressible": true, + "extensions": ["html","htm","shtml"] + }, + "text/jade": { + "extensions": ["jade"] + }, + "text/javascript": { + "source": "iana", + "compressible": true + }, + "text/jcr-cnd": { + "source": "iana" + }, + "text/jsx": { + "compressible": true, + "extensions": ["jsx"] + }, + "text/less": { + "extensions": ["less"] + }, + "text/markdown": { + "source": "iana" + }, + "text/mathml": { + "source": "nginx", + "extensions": ["mml"] + }, + "text/mizar": { + "source": "iana" + }, + "text/n3": { + "source": "iana", + "compressible": true, + "extensions": ["n3"] + }, + "text/parameters": { + "source": "iana" + }, + "text/parityfec": { + "source": "iana" + }, + "text/plain": { + "source": "iana", + "compressible": true, + "extensions": ["txt","text","conf","def","list","log","in","ini"] + }, + "text/provenance-notation": { + "source": "iana" + }, + "text/prs.fallenstein.rst": { + "source": "iana" + }, + "text/prs.lines.tag": { + "source": "iana", + "extensions": ["dsc"] + }, + "text/prs.prop.logic": { + "source": "iana" + }, + "text/raptorfec": { + "source": "iana" + }, + "text/red": { + "source": "iana" + }, + "text/rfc822-headers": { + "source": "iana" + }, + "text/richtext": { + "source": "iana", + "compressible": true, + "extensions": ["rtx"] + }, + "text/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "text/rtp-enc-aescm128": { + "source": "iana" + }, + "text/rtploopback": { + "source": "iana" + }, + "text/rtx": { + "source": "iana" + }, + "text/sgml": { + "source": "iana", + "extensions": ["sgml","sgm"] + }, + "text/slim": { + "extensions": ["slim","slm"] + }, + "text/stylus": { + "extensions": ["stylus","styl"] + }, + "text/t140": { + "source": "iana" + }, + "text/tab-separated-values": { + "source": "iana", + "compressible": true, + "extensions": ["tsv"] + }, + "text/troff": { + "source": "iana", + "extensions": ["t","tr","roff","man","me","ms"] + }, + "text/turtle": { + "source": "iana", + "extensions": ["ttl"] + }, + "text/ulpfec": { + "source": "iana" + }, + "text/uri-list": { + "source": "iana", + "compressible": true, + "extensions": ["uri","uris","urls"] + }, + "text/vcard": { + "source": "iana", + "compressible": true, + "extensions": ["vcard"] + }, + "text/vnd.a": { + "source": "iana" + }, + "text/vnd.abc": { + "source": "iana" + }, + "text/vnd.ascii-art": { + "source": "iana" + }, + "text/vnd.curl": { + "source": "iana", + "extensions": ["curl"] + }, + "text/vnd.curl.dcurl": { + "source": "apache", + "extensions": ["dcurl"] + }, + "text/vnd.curl.mcurl": { + "source": "apache", + "extensions": ["mcurl"] + }, + "text/vnd.curl.scurl": { + "source": "apache", + "extensions": ["scurl"] + }, + "text/vnd.debian.copyright": { + "source": "iana" + }, + "text/vnd.dmclientscript": { + "source": "iana" + }, + "text/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "text/vnd.esmertec.theme-descriptor": { + "source": "iana" + }, + "text/vnd.fly": { + "source": "iana", + "extensions": ["fly"] + }, + "text/vnd.fmi.flexstor": { + "source": "iana", + "extensions": ["flx"] + }, + "text/vnd.graphviz": { + "source": "iana", + "extensions": ["gv"] + }, + "text/vnd.in3d.3dml": { + "source": "iana", + "extensions": ["3dml"] + }, + "text/vnd.in3d.spot": { + "source": "iana", + "extensions": ["spot"] + }, + "text/vnd.iptc.newsml": { + "source": "iana" + }, + "text/vnd.iptc.nitf": { + "source": "iana" + }, + "text/vnd.latex-z": { + "source": "iana" + }, + "text/vnd.motorola.reflex": { + "source": "iana" + }, + "text/vnd.ms-mediapackage": { + "source": "iana" + }, + "text/vnd.net2phone.commcenter.command": { + "source": "iana" + }, + "text/vnd.radisys.msml-basic-layout": { + "source": "iana" + }, + "text/vnd.si.uricatalogue": { + "source": "iana" + }, + "text/vnd.sun.j2me.app-descriptor": { + "source": "iana", + "extensions": ["jad"] + }, + "text/vnd.trolltech.linguist": { + "source": "iana" + }, + "text/vnd.wap.si": { + "source": "iana" + }, + "text/vnd.wap.sl": { + "source": "iana" + }, + "text/vnd.wap.wml": { + "source": "iana", + "extensions": ["wml"] + }, + "text/vnd.wap.wmlscript": { + "source": "iana", + "extensions": ["wmls"] + }, + "text/vtt": { + "charset": "UTF-8", + "compressible": true, + "extensions": ["vtt"] + }, + "text/x-asm": { + "source": "apache", + "extensions": ["s","asm"] + }, + "text/x-c": { + "source": "apache", + "extensions": ["c","cc","cxx","cpp","h","hh","dic"] + }, + "text/x-component": { + "source": "nginx", + "extensions": ["htc"] + }, + "text/x-fortran": { + "source": "apache", + "extensions": ["f","for","f77","f90"] + }, + "text/x-gwt-rpc": { + "compressible": true + }, + "text/x-handlebars-template": { + "extensions": ["hbs"] + }, + "text/x-java-source": { + "source": "apache", + "extensions": ["java"] + }, + "text/x-jquery-tmpl": { + "compressible": true + }, + "text/x-lua": { + "extensions": ["lua"] + }, + "text/x-markdown": { + "compressible": true, + "extensions": ["markdown","md","mkd"] + }, + "text/x-nfo": { + "source": "apache", + "extensions": ["nfo"] + }, + "text/x-opml": { + "source": "apache", + "extensions": ["opml"] + }, + "text/x-pascal": { + "source": "apache", + "extensions": ["p","pas"] + }, + "text/x-processing": { + "compressible": true, + "extensions": ["pde"] + }, + "text/x-sass": { + "extensions": ["sass"] + }, + "text/x-scss": { + "extensions": ["scss"] + }, + "text/x-setext": { + "source": "apache", + "extensions": ["etx"] + }, + "text/x-sfv": { + "source": "apache", + "extensions": ["sfv"] + }, + "text/x-suse-ymp": { + "compressible": true, + "extensions": ["ymp"] + }, + "text/x-uuencode": { + "source": "apache", + "extensions": ["uu"] + }, + "text/x-vcalendar": { + "source": "apache", + "extensions": ["vcs"] + }, + "text/x-vcard": { + "source": "apache", + "extensions": ["vcf"] + }, + "text/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml"] + }, + "text/xml-external-parsed-entity": { + "source": "iana" + }, + "text/yaml": { + "extensions": ["yaml","yml"] + }, + "video/1d-interleaved-parityfec": { + "source": "apache" + }, + "video/3gpp": { + "source": "apache", + "extensions": ["3gp","3gpp"] + }, + "video/3gpp-tt": { + "source": "apache" + }, + "video/3gpp2": { + "source": "apache", + "extensions": ["3g2"] + }, + "video/bmpeg": { + "source": "apache" + }, + "video/bt656": { + "source": "apache" + }, + "video/celb": { + "source": "apache" + }, + "video/dv": { + "source": "apache" + }, + "video/encaprtp": { + "source": "apache" + }, + "video/h261": { + "source": "apache", + "extensions": ["h261"] + }, + "video/h263": { + "source": "apache", + "extensions": ["h263"] + }, + "video/h263-1998": { + "source": "apache" + }, + "video/h263-2000": { + "source": "apache" + }, + "video/h264": { + "source": "apache", + "extensions": ["h264"] + }, + "video/h264-rcdo": { + "source": "apache" + }, + "video/h264-svc": { + "source": "apache" + }, + "video/h265": { + "source": "apache" + }, + "video/iso.segment": { + "source": "apache" + }, + "video/jpeg": { + "source": "apache", + "extensions": ["jpgv"] + }, + "video/jpeg2000": { + "source": "apache" + }, + "video/jpm": { + "source": "apache", + "extensions": ["jpm","jpgm"] + }, + "video/mj2": { + "source": "apache", + "extensions": ["mj2","mjp2"] + }, + "video/mp1s": { + "source": "apache" + }, + "video/mp2p": { + "source": "apache" + }, + "video/mp2t": { + "source": "apache", + "extensions": ["ts"] + }, + "video/mp4": { + "source": "apache", + "compressible": false, + "extensions": ["mp4","mp4v","mpg4"] + }, + "video/mp4v-es": { + "source": "apache" + }, + "video/mpeg": { + "source": "apache", + "compressible": false, + "extensions": ["mpeg","mpg","mpe","m1v","m2v"] + }, + "video/mpeg4-generic": { + "source": "apache" + }, + "video/mpv": { + "source": "apache" + }, + "video/nv": { + "source": "apache" + }, + "video/ogg": { + "source": "apache", + "compressible": false, + "extensions": ["ogv"] + }, + "video/parityfec": { + "source": "apache" + }, + "video/pointer": { + "source": "apache" + }, + "video/quicktime": { + "source": "apache", + "compressible": false, + "extensions": ["qt","mov"] + }, + "video/raptorfec": { + "source": "apache" + }, + "video/raw": { + "source": "apache" + }, + "video/rtp-enc-aescm128": { + "source": "apache" + }, + "video/rtploopback": { + "source": "apache" + }, + "video/rtx": { + "source": "apache" + }, + "video/smpte292m": { + "source": "apache" + }, + "video/ulpfec": { + "source": "apache" + }, + "video/vc1": { + "source": "apache" + }, + "video/vnd.cctv": { + "source": "apache" + }, + "video/vnd.dece.hd": { + "source": "apache", + "extensions": ["uvh","uvvh"] + }, + "video/vnd.dece.mobile": { + "source": "apache", + "extensions": ["uvm","uvvm"] + }, + "video/vnd.dece.mp4": { + "source": "apache" + }, + "video/vnd.dece.pd": { + "source": "apache", + "extensions": ["uvp","uvvp"] + }, + "video/vnd.dece.sd": { + "source": "apache", + "extensions": ["uvs","uvvs"] + }, + "video/vnd.dece.video": { + "source": "apache", + "extensions": ["uvv","uvvv"] + }, + "video/vnd.directv.mpeg": { + "source": "apache" + }, + "video/vnd.directv.mpeg-tts": { + "source": "apache" + }, + "video/vnd.dlna.mpeg-tts": { + "source": "apache" + }, + "video/vnd.dvb.file": { + "source": "apache", + "extensions": ["dvb"] + }, + "video/vnd.fvt": { + "source": "apache", + "extensions": ["fvt"] + }, + "video/vnd.hns.video": { + "source": "apache" + }, + "video/vnd.iptvforum.1dparityfec-1010": { + "source": "apache" + }, + "video/vnd.iptvforum.1dparityfec-2005": { + "source": "apache" + }, + "video/vnd.iptvforum.2dparityfec-1010": { + "source": "apache" + }, + "video/vnd.iptvforum.2dparityfec-2005": { + "source": "apache" + }, + "video/vnd.iptvforum.ttsavc": { + "source": "apache" + }, + "video/vnd.iptvforum.ttsmpeg2": { + "source": "apache" + }, + "video/vnd.motorola.video": { + "source": "apache" + }, + "video/vnd.motorola.videop": { + "source": "apache" + }, + "video/vnd.mpegurl": { + "source": "apache", + "extensions": ["mxu","m4u"] + }, + "video/vnd.ms-playready.media.pyv": { + "source": "apache", + "extensions": ["pyv"] + }, + "video/vnd.nokia.interleaved-multimedia": { + "source": "apache" + }, + "video/vnd.nokia.videovoip": { + "source": "apache" + }, + "video/vnd.objectvideo": { + "source": "apache" + }, + "video/vnd.radgamettools.bink": { + "source": "apache" + }, + "video/vnd.radgamettools.smacker": { + "source": "apache" + }, + "video/vnd.sealed.mpeg1": { + "source": "apache" + }, + "video/vnd.sealed.mpeg4": { + "source": "apache" + }, + "video/vnd.sealed.swf": { + "source": "apache" + }, + "video/vnd.sealedmedia.softseal.mov": { + "source": "apache" + }, + "video/vnd.uvvu.mp4": { + "source": "apache", + "extensions": ["uvu","uvvu"] + }, + "video/vnd.vivo": { + "source": "apache", + "extensions": ["viv"] + }, + "video/vp8": { + "source": "apache" + }, + "video/webm": { + "source": "apache", + "compressible": false, + "extensions": ["webm"] + }, + "video/x-f4v": { + "source": "apache", + "extensions": ["f4v"] + }, + "video/x-fli": { + "source": "apache", + "extensions": ["fli"] + }, + "video/x-flv": { + "source": "apache", + "compressible": false, + "extensions": ["flv"] + }, + "video/x-m4v": { + "source": "apache", + "extensions": ["m4v"] + }, + "video/x-matroska": { + "source": "apache", + "compressible": false, + "extensions": ["mkv","mk3d","mks"] + }, + "video/x-mng": { + "source": "apache", + "extensions": ["mng"] + }, + "video/x-ms-asf": { + "source": "apache", + "extensions": ["asf","asx"] + }, + "video/x-ms-vob": { + "source": "apache", + "extensions": ["vob"] + }, + "video/x-ms-wm": { + "source": "apache", + "extensions": ["wm"] + }, + "video/x-ms-wmv": { + "source": "apache", + "compressible": false, + "extensions": ["wmv"] + }, + "video/x-ms-wmx": { + "source": "apache", + "extensions": ["wmx"] + }, + "video/x-ms-wvx": { + "source": "apache", + "extensions": ["wvx"] + }, + "video/x-msvideo": { + "source": "apache", + "extensions": ["avi"] + }, + "video/x-sgi-movie": { + "source": "apache", + "extensions": ["movie"] + }, + "video/x-smv": { + "source": "apache", + "extensions": ["smv"] + }, + "x-conference/x-cooltalk": { + "source": "apache", + "extensions": ["ice"] + }, + "x-shader/x-fragment": { + "compressible": true + }, + "x-shader/x-vertex": { + "compressible": true + } +} diff --git a/8 node/node_modules/mime-db/index.js b/8 node/node_modules/mime-db/index.js new file mode 100644 index 000000000..551031f69 --- /dev/null +++ b/8 node/node_modules/mime-db/index.js @@ -0,0 +1,11 @@ +/*! + * mime-db + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = require('./db.json') diff --git a/8 node/node_modules/mime-db/package.json b/8 node/node_modules/mime-db/package.json new file mode 100644 index 000000000..d8f931680 --- /dev/null +++ b/8 node/node_modules/mime-db/package.json @@ -0,0 +1,98 @@ +{ + "_from": "mime-db@~1.27.0", + "_id": "mime-db@1.27.0", + "_inBundle": false, + "_integrity": "sha1-gg9XIpa70g7CXtVeW13oaeVDbrE=", + "_location": "/mime-db", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "mime-db@~1.27.0", + "name": "mime-db", + "escapedName": "mime-db", + "rawSpec": "~1.27.0", + "saveSpec": null, + "fetchSpec": "~1.27.0" + }, + "_requiredBy": [ + "/mime-types" + ], + "_resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.27.0.tgz", + "_shasum": "820f572296bbd20ec25ed55e5b5de869e5436eb1", + "_spec": "mime-db@~1.27.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/mime-types", + "bugs": { + "url": "https://github.com/jshttp/mime-db/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + { + "name": "Robert Kieffer", + "email": "robert@broofa.com", + "url": "http://github.com/broofa" + } + ], + "deprecated": false, + "description": "Media Type Database", + "devDependencies": { + "bluebird": "3.5.0", + "co": "4.6.0", + "cogent": "1.0.1", + "csv-parse": "1.2.0", + "eslint": "3.17.1", + "eslint-config-standard": "7.0.1", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "2.1.1", + "gnode": "0.1.2", + "istanbul": "0.4.5", + "mocha": "1.21.5", + "raw-body": "2.2.0", + "stream-to-array": "2.3.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "db.json", + "index.js" + ], + "homepage": "https://github.com/jshttp/mime-db#readme", + "keywords": [ + "mime", + "db", + "type", + "types", + "database", + "charset", + "charsets" + ], + "license": "MIT", + "name": "mime-db", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/mime-db.git" + }, + "scripts": { + "build": "node scripts/build", + "fetch": "gnode scripts/fetch-apache && gnode scripts/fetch-iana && gnode scripts/fetch-nginx", + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "update": "npm run fetch && npm run build" + }, + "version": "1.27.0" +} diff --git a/8 node/node_modules/mime-types/HISTORY.md b/8 node/node_modules/mime-types/HISTORY.md new file mode 100644 index 000000000..b8008bc52 --- /dev/null +++ b/8 node/node_modules/mime-types/HISTORY.md @@ -0,0 +1,223 @@ +2.1.15 / 2017-03-23 +=================== + + * deps: mime-db@~1.27.0 + - Add new mime types + - Add `image/apng` + +2.1.14 / 2017-01-14 +=================== + + * deps: mime-db@~1.26.0 + - Add new mime types + +2.1.13 / 2016-11-18 +=================== + + * deps: mime-db@~1.25.0 + - Add new mime types + +2.1.12 / 2016-09-18 +=================== + + * deps: mime-db@~1.24.0 + - Add new mime types + - Add `audio/mp3` + +2.1.11 / 2016-05-01 +=================== + + * deps: mime-db@~1.23.0 + - Add new mime types + +2.1.10 / 2016-02-15 +=================== + + * deps: mime-db@~1.22.0 + - Add new mime types + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + +2.1.9 / 2016-01-06 +================== + + * deps: mime-db@~1.21.0 + - Add new mime types + +2.1.8 / 2015-11-30 +================== + + * deps: mime-db@~1.20.0 + - Add new mime types + +2.1.7 / 2015-09-20 +================== + + * deps: mime-db@~1.19.0 + - Add new mime types + +2.1.6 / 2015-09-03 +================== + + * deps: mime-db@~1.18.0 + - Add new mime types + +2.1.5 / 2015-08-20 +================== + + * deps: mime-db@~1.17.0 + - Add new mime types + +2.1.4 / 2015-07-30 +================== + + * deps: mime-db@~1.16.0 + - Add new mime types + +2.1.3 / 2015-07-13 +================== + + * deps: mime-db@~1.15.0 + - Add new mime types + +2.1.2 / 2015-06-25 +================== + + * deps: mime-db@~1.14.0 + - Add new mime types + +2.1.1 / 2015-06-08 +================== + + * perf: fix deopt during mapping + +2.1.0 / 2015-06-07 +================== + + * Fix incorrectly treating extension-less file name as extension + - i.e. `'path/to/json'` will no longer return `application/json` + * Fix `.charset(type)` to accept parameters + * Fix `.charset(type)` to match case-insensitive + * Improve generation of extension to MIME mapping + * Refactor internals for readability and no argument reassignment + * Prefer `application/*` MIME types from the same source + * Prefer any type over `application/octet-stream` + * deps: mime-db@~1.13.0 + - Add nginx as a source + - Add new mime types + +2.0.14 / 2015-06-06 +=================== + + * deps: mime-db@~1.12.0 + - Add new mime types + +2.0.13 / 2015-05-31 +=================== + + * deps: mime-db@~1.11.0 + - Add new mime types + +2.0.12 / 2015-05-19 +=================== + + * deps: mime-db@~1.10.0 + - Add new mime types + +2.0.11 / 2015-05-05 +=================== + + * deps: mime-db@~1.9.1 + - Add new mime types + +2.0.10 / 2015-03-13 +=================== + + * deps: mime-db@~1.8.0 + - Add new mime types + +2.0.9 / 2015-02-09 +================== + + * deps: mime-db@~1.7.0 + - Add new mime types + - Community extensions ownership transferred from `node-mime` + +2.0.8 / 2015-01-29 +================== + + * deps: mime-db@~1.6.0 + - Add new mime types + +2.0.7 / 2014-12-30 +================== + + * deps: mime-db@~1.5.0 + - Add new mime types + - Fix various invalid MIME type entries + +2.0.6 / 2014-12-30 +================== + + * deps: mime-db@~1.4.0 + - Add new mime types + - Fix various invalid MIME type entries + - Remove example template MIME types + +2.0.5 / 2014-12-29 +================== + + * deps: mime-db@~1.3.1 + - Fix missing extensions + +2.0.4 / 2014-12-10 +================== + + * deps: mime-db@~1.3.0 + - Add new mime types + +2.0.3 / 2014-11-09 +================== + + * deps: mime-db@~1.2.0 + - Add new mime types + +2.0.2 / 2014-09-28 +================== + + * deps: mime-db@~1.1.0 + - Add new mime types + - Add additional compressible + - Update charsets + +2.0.1 / 2014-09-07 +================== + + * Support Node.js 0.6 + +2.0.0 / 2014-09-02 +================== + + * Use `mime-db` + * Remove `.define()` + +1.0.2 / 2014-08-04 +================== + + * Set charset=utf-8 for `text/javascript` + +1.0.1 / 2014-06-24 +================== + + * Add `text/jsx` type + +1.0.0 / 2014-05-12 +================== + + * Return `false` for unknown types + * Set charset=utf-8 for `application/json` + +0.1.0 / 2014-05-02 +================== + + * Initial release diff --git a/8 node/node_modules/mime-types/LICENSE b/8 node/node_modules/mime-types/LICENSE new file mode 100644 index 000000000..06166077b --- /dev/null +++ b/8 node/node_modules/mime-types/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/mime-types/README.md b/8 node/node_modules/mime-types/README.md new file mode 100644 index 000000000..4579db6e0 --- /dev/null +++ b/8 node/node_modules/mime-types/README.md @@ -0,0 +1,108 @@ +# mime-types + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +The ultimate javascript content-type utility. + +Similar to [the `mime` module](https://www.npmjs.com/package/mime), except: + +- __No fallbacks.__ Instead of naively returning the first available type, + `mime-types` simply returns `false`, so do + `var type = mime.lookup('unrecognized') || 'application/octet-stream'`. +- No `new Mime()` business, so you could do `var lookup = require('mime-types').lookup`. +- No `.define()` functionality +- Bug fixes for `.lookup(path)` + +Otherwise, the API is compatible. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install mime-types +``` + +## Adding Types + +All mime types are based on [mime-db](https://www.npmjs.com/package/mime-db), +so open a PR there if you'd like to add mime types. + +## API + +```js +var mime = require('mime-types') +``` + +All functions return `false` if input is invalid or not found. + +### mime.lookup(path) + +Lookup the content-type associated with a file. + +```js +mime.lookup('json') // 'application/json' +mime.lookup('.md') // 'text/x-markdown' +mime.lookup('file.html') // 'text/html' +mime.lookup('folder/file.js') // 'application/javascript' +mime.lookup('folder/.htaccess') // false + +mime.lookup('cats') // false +``` + +### mime.contentType(type) + +Create a full content-type header given a content-type or extension. + +```js +mime.contentType('markdown') // 'text/x-markdown; charset=utf-8' +mime.contentType('file.json') // 'application/json; charset=utf-8' + +// from a full path +mime.contentType(path.extname('/path/to/file.json')) // 'application/json; charset=utf-8' +``` + +### mime.extension(type) + +Get the default extension for a content-type. + +```js +mime.extension('application/octet-stream') // 'bin' +``` + +### mime.charset(type) + +Lookup the implied default charset of a content-type. + +```js +mime.charset('text/x-markdown') // 'UTF-8' +``` + +### var type = mime.types[extension] + +A map of content-types by extension. + +### [extensions...] = mime.extensions[type] + +A map of extensions by content-type. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/mime-types.svg +[npm-url]: https://npmjs.org/package/mime-types +[node-version-image]: https://img.shields.io/node/v/mime-types.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/mime-types/master.svg +[travis-url]: https://travis-ci.org/jshttp/mime-types +[coveralls-image]: https://img.shields.io/coveralls/jshttp/mime-types/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/mime-types +[downloads-image]: https://img.shields.io/npm/dm/mime-types.svg +[downloads-url]: https://npmjs.org/package/mime-types diff --git a/8 node/node_modules/mime-types/index.js b/8 node/node_modules/mime-types/index.js new file mode 100644 index 000000000..6e0ea4375 --- /dev/null +++ b/8 node/node_modules/mime-types/index.js @@ -0,0 +1,188 @@ +/*! + * mime-types + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var db = require('mime-db') +var extname = require('path').extname + +/** + * Module variables. + * @private + */ + +var extractTypeRegExp = /^\s*([^;\s]*)(?:;|\s|$)/ +var textTypeRegExp = /^text\//i + +/** + * Module exports. + * @public + */ + +exports.charset = charset +exports.charsets = { lookup: charset } +exports.contentType = contentType +exports.extension = extension +exports.extensions = Object.create(null) +exports.lookup = lookup +exports.types = Object.create(null) + +// Populate the extensions/types maps +populateMaps(exports.extensions, exports.types) + +/** + * Get the default charset for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function charset (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = extractTypeRegExp.exec(type) + var mime = match && db[match[1].toLowerCase()] + + if (mime && mime.charset) { + return mime.charset + } + + // default text/* to utf-8 + if (match && textTypeRegExp.test(match[1])) { + return 'UTF-8' + } + + return false +} + +/** + * Create a full Content-Type header given a MIME type or extension. + * + * @param {string} str + * @return {boolean|string} + */ + +function contentType (str) { + // TODO: should this even be in this module? + if (!str || typeof str !== 'string') { + return false + } + + var mime = str.indexOf('/') === -1 + ? exports.lookup(str) + : str + + if (!mime) { + return false + } + + // TODO: use content-type or other module + if (mime.indexOf('charset') === -1) { + var charset = exports.charset(mime) + if (charset) mime += '; charset=' + charset.toLowerCase() + } + + return mime +} + +/** + * Get the default extension for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function extension (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = extractTypeRegExp.exec(type) + + // get extensions + var exts = match && exports.extensions[match[1].toLowerCase()] + + if (!exts || !exts.length) { + return false + } + + return exts[0] +} + +/** + * Lookup the MIME type for a file path/extension. + * + * @param {string} path + * @return {boolean|string} + */ + +function lookup (path) { + if (!path || typeof path !== 'string') { + return false + } + + // get the extension ("ext" or ".ext" or full path) + var extension = extname('x.' + path) + .toLowerCase() + .substr(1) + + if (!extension) { + return false + } + + return exports.types[extension] || false +} + +/** + * Populate the extensions and types maps. + * @private + */ + +function populateMaps (extensions, types) { + // source preference (least -> most) + var preference = ['nginx', 'apache', undefined, 'iana'] + + Object.keys(db).forEach(function forEachMimeType (type) { + var mime = db[type] + var exts = mime.extensions + + if (!exts || !exts.length) { + return + } + + // mime -> extensions + extensions[type] = exts + + // extension -> mime + for (var i = 0; i < exts.length; i++) { + var extension = exts[i] + + if (types[extension]) { + var from = preference.indexOf(db[types[extension]].source) + var to = preference.indexOf(mime.source) + + if (types[extension] !== 'application/octet-stream' && + (from > to || (from === to && types[extension].substr(0, 12) === 'application/'))) { + // skip the remapping + continue + } + } + + // set the extension -> mime + types[extension] = type + } + }) +} diff --git a/8 node/node_modules/mime-types/package.json b/8 node/node_modules/mime-types/package.json new file mode 100644 index 000000000..0de309b40 --- /dev/null +++ b/8 node/node_modules/mime-types/package.json @@ -0,0 +1,85 @@ +{ + "_from": "mime-types@~2.1.11", + "_id": "mime-types@2.1.15", + "_inBundle": false, + "_integrity": "sha1-pOv1BkCUVpI3uM9wBGd20J/JKu0=", + "_location": "/mime-types", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "mime-types@~2.1.11", + "name": "mime-types", + "escapedName": "mime-types", + "rawSpec": "~2.1.11", + "saveSpec": null, + "fetchSpec": "~2.1.11" + }, + "_requiredBy": [ + "/accepts", + "/type-is" + ], + "_resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.15.tgz", + "_shasum": "a4ebf5064094569237b8cf70046776d09fc92aed", + "_spec": "mime-types@~2.1.11", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/accepts", + "bugs": { + "url": "https://github.com/jshttp/mime-types/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jeremiah Senkpiel", + "email": "fishrock123@rocketmail.com", + "url": "https://searchbeam.jit.su" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "mime-db": "~1.27.0" + }, + "deprecated": false, + "description": "The ultimate javascript content-type utility.", + "devDependencies": { + "eslint": "3.18.0", + "eslint-config-standard": "7.1.0", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "2.1.1", + "istanbul": "0.4.5", + "mocha": "1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "homepage": "https://github.com/jshttp/mime-types#readme", + "keywords": [ + "mime", + "types" + ], + "license": "MIT", + "name": "mime-types", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/mime-types.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec test/test.js", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/test.js", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot test/test.js" + }, + "version": "2.1.15" +} diff --git a/8 node/node_modules/mime/.npmignore b/8 node/node_modules/mime/.npmignore new file mode 100644 index 000000000..e69de29bb diff --git a/8 node/node_modules/mime/LICENSE b/8 node/node_modules/mime/LICENSE new file mode 100644 index 000000000..451fc4550 --- /dev/null +++ b/8 node/node_modules/mime/LICENSE @@ -0,0 +1,19 @@ +Copyright (c) 2010 Benjamin Thomas, Robert Kieffer + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/8 node/node_modules/mime/README.md b/8 node/node_modules/mime/README.md new file mode 100644 index 000000000..506fbe550 --- /dev/null +++ b/8 node/node_modules/mime/README.md @@ -0,0 +1,90 @@ +# mime + +Comprehensive MIME type mapping API based on mime-db module. + +## Install + +Install with [npm](http://github.com/isaacs/npm): + + npm install mime + +## Contributing / Testing + + npm run test + +## Command Line + + mime [path_string] + +E.g. + + > mime scripts/jquery.js + application/javascript + +## API - Queries + +### mime.lookup(path) +Get the mime type associated with a file, if no mime type is found `application/octet-stream` is returned. Performs a case-insensitive lookup using the extension in `path` (the substring after the last '/' or '.'). E.g. + +```js +var mime = require('mime'); + +mime.lookup('/path/to/file.txt'); // => 'text/plain' +mime.lookup('file.txt'); // => 'text/plain' +mime.lookup('.TXT'); // => 'text/plain' +mime.lookup('htm'); // => 'text/html' +``` + +### mime.default_type +Sets the mime type returned when `mime.lookup` fails to find the extension searched for. (Default is `application/octet-stream`.) + +### mime.extension(type) +Get the default extension for `type` + +```js +mime.extension('text/html'); // => 'html' +mime.extension('application/octet-stream'); // => 'bin' +``` + +### mime.charsets.lookup() + +Map mime-type to charset + +```js +mime.charsets.lookup('text/plain'); // => 'UTF-8' +``` + +(The logic for charset lookups is pretty rudimentary. Feel free to suggest improvements.) + +## API - Defining Custom Types + +Custom type mappings can be added on a per-project basis via the following APIs. + +### mime.define() + +Add custom mime/extension mappings + +```js +mime.define({ + 'text/x-some-format': ['x-sf', 'x-sft', 'x-sfml'], + 'application/x-my-type': ['x-mt', 'x-mtt'], + // etc ... +}); + +mime.lookup('x-sft'); // => 'text/x-some-format' +``` + +The first entry in the extensions array is returned by `mime.extension()`. E.g. + +```js +mime.extension('text/x-some-format'); // => 'x-sf' +``` + +### mime.load(filepath) + +Load mappings from an Apache ".types" format file + +```js +mime.load('./my_project.types'); +``` +The .types file format is simple - See the `types` dir for examples. diff --git a/8 node/node_modules/mime/build/build.js b/8 node/node_modules/mime/build/build.js new file mode 100644 index 000000000..ed5313e3c --- /dev/null +++ b/8 node/node_modules/mime/build/build.js @@ -0,0 +1,11 @@ +var db = require('mime-db'); + +var mapByType = {}; +Object.keys(db).forEach(function(key) { + var extensions = db[key].extensions; + if (extensions) { + mapByType[key] = extensions; + } +}); + +console.log(JSON.stringify(mapByType)); diff --git a/8 node/node_modules/mime/build/test.js b/8 node/node_modules/mime/build/test.js new file mode 100644 index 000000000..58b9ba7c8 --- /dev/null +++ b/8 node/node_modules/mime/build/test.js @@ -0,0 +1,57 @@ +/** + * Usage: node test.js + */ + +var mime = require('../mime'); +var assert = require('assert'); +var path = require('path'); + +// +// Test mime lookups +// + +assert.equal('text/plain', mime.lookup('text.txt')); // normal file +assert.equal('text/plain', mime.lookup('TEXT.TXT')); // uppercase +assert.equal('text/plain', mime.lookup('dir/text.txt')); // dir + file +assert.equal('text/plain', mime.lookup('.text.txt')); // hidden file +assert.equal('text/plain', mime.lookup('.txt')); // nameless +assert.equal('text/plain', mime.lookup('txt')); // extension-only +assert.equal('text/plain', mime.lookup('/txt')); // extension-less () +assert.equal('text/plain', mime.lookup('\\txt')); // Windows, extension-less +assert.equal('application/octet-stream', mime.lookup('text.nope')); // unrecognized +assert.equal('fallback', mime.lookup('text.fallback', 'fallback')); // alternate default + +// +// Test extensions +// + +assert.equal('txt', mime.extension(mime.types.text)); +assert.equal('html', mime.extension(mime.types.htm)); +assert.equal('bin', mime.extension('application/octet-stream')); +assert.equal('bin', mime.extension('application/octet-stream ')); +assert.equal('html', mime.extension(' text/html; charset=UTF-8')); +assert.equal('html', mime.extension('text/html; charset=UTF-8 ')); +assert.equal('html', mime.extension('text/html; charset=UTF-8')); +assert.equal('html', mime.extension('text/html ; charset=UTF-8')); +assert.equal('html', mime.extension('text/html;charset=UTF-8')); +assert.equal('html', mime.extension('text/Html;charset=UTF-8')); +assert.equal(undefined, mime.extension('unrecognized')); + +// +// Test node.types lookups +// + +assert.equal('application/font-woff', mime.lookup('file.woff')); +assert.equal('application/octet-stream', mime.lookup('file.buffer')); +assert.equal('audio/mp4', mime.lookup('file.m4a')); +assert.equal('font/opentype', mime.lookup('file.otf')); + +// +// Test charsets +// + +assert.equal('UTF-8', mime.charsets.lookup('text/plain')); +assert.equal(undefined, mime.charsets.lookup(mime.types.js)); +assert.equal('fallback', mime.charsets.lookup('application/octet-stream', 'fallback')); + +console.log('\nAll tests passed'); diff --git a/8 node/node_modules/mime/cli.js b/8 node/node_modules/mime/cli.js new file mode 100755 index 000000000..20b1ffeb2 --- /dev/null +++ b/8 node/node_modules/mime/cli.js @@ -0,0 +1,8 @@ +#!/usr/bin/env node + +var mime = require('./mime.js'); +var file = process.argv[2]; +var type = mime.lookup(file); + +process.stdout.write(type + '\n'); + diff --git a/8 node/node_modules/mime/mime.js b/8 node/node_modules/mime/mime.js new file mode 100644 index 000000000..341b6a5c4 --- /dev/null +++ b/8 node/node_modules/mime/mime.js @@ -0,0 +1,108 @@ +var path = require('path'); +var fs = require('fs'); + +function Mime() { + // Map of extension -> mime type + this.types = Object.create(null); + + // Map of mime type -> extension + this.extensions = Object.create(null); +} + +/** + * Define mimetype -> extension mappings. Each key is a mime-type that maps + * to an array of extensions associated with the type. The first extension is + * used as the default extension for the type. + * + * e.g. mime.define({'audio/ogg', ['oga', 'ogg', 'spx']}); + * + * @param map (Object) type definitions + */ +Mime.prototype.define = function (map) { + for (var type in map) { + var exts = map[type]; + for (var i = 0; i < exts.length; i++) { + if (process.env.DEBUG_MIME && this.types[exts]) { + console.warn(this._loading.replace(/.*\//, ''), 'changes "' + exts[i] + '" extension type from ' + + this.types[exts] + ' to ' + type); + } + + this.types[exts[i]] = type; + } + + // Default extension is the first one we encounter + if (!this.extensions[type]) { + this.extensions[type] = exts[0]; + } + } +}; + +/** + * Load an Apache2-style ".types" file + * + * This may be called multiple times (it's expected). Where files declare + * overlapping types/extensions, the last file wins. + * + * @param file (String) path of file to load. + */ +Mime.prototype.load = function(file) { + this._loading = file; + // Read file and split into lines + var map = {}, + content = fs.readFileSync(file, 'ascii'), + lines = content.split(/[\r\n]+/); + + lines.forEach(function(line) { + // Clean up whitespace/comments, and split into fields + var fields = line.replace(/\s*#.*|^\s*|\s*$/g, '').split(/\s+/); + map[fields.shift()] = fields; + }); + + this.define(map); + + this._loading = null; +}; + +/** + * Lookup a mime type based on extension + */ +Mime.prototype.lookup = function(path, fallback) { + var ext = path.replace(/.*[\.\/\\]/, '').toLowerCase(); + + return this.types[ext] || fallback || this.default_type; +}; + +/** + * Return file extension associated with a mime type + */ +Mime.prototype.extension = function(mimeType) { + var type = mimeType.match(/^\s*([^;\s]*)(?:;|\s|$)/)[1].toLowerCase(); + return this.extensions[type]; +}; + +// Default instance +var mime = new Mime(); + +// Define built-in types +mime.define(require('./types.json')); + +// Default type +mime.default_type = mime.lookup('bin'); + +// +// Additional API specific to the default instance +// + +mime.Mime = Mime; + +/** + * Lookup a charset based on mime type. + */ +mime.charsets = { + lookup: function(mimeType, fallback) { + // Assume text types are utf8 + return (/^text\//).test(mimeType) ? 'UTF-8' : fallback; + } +}; + +module.exports = mime; diff --git a/8 node/node_modules/mime/package.json b/8 node/node_modules/mime/package.json new file mode 100644 index 000000000..8b67084d7 --- /dev/null +++ b/8 node/node_modules/mime/package.json @@ -0,0 +1,72 @@ +{ + "_from": "mime@1.3.4", + "_id": "mime@1.3.4", + "_inBundle": false, + "_integrity": "sha1-EV+eO2s9rylZmDyzjxSaLUDrXVM=", + "_location": "/mime", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "mime@1.3.4", + "name": "mime", + "escapedName": "mime", + "rawSpec": "1.3.4", + "saveSpec": null, + "fetchSpec": "1.3.4" + }, + "_requiredBy": [ + "/send" + ], + "_resolved": "https://registry.npmjs.org/mime/-/mime-1.3.4.tgz", + "_shasum": "115f9e3b6b3daf2959983cb38f149a2d40eb5d53", + "_spec": "mime@1.3.4", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/send", + "author": { + "name": "Robert Kieffer", + "email": "robert@broofa.com", + "url": "http://github.com/broofa" + }, + "bin": { + "mime": "cli.js" + }, + "bugs": { + "url": "https://github.com/broofa/node-mime/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Benjamin Thomas", + "email": "benjamin@benjaminthomas.org", + "url": "http://github.com/bentomas" + } + ], + "dependencies": {}, + "deprecated": false, + "description": "A comprehensive library for mime-type mapping", + "devDependencies": { + "mime-db": "^1.2.0" + }, + "homepage": "https://github.com/broofa/node-mime#readme", + "keywords": [ + "util", + "mime" + ], + "licenses": [ + { + "type": "MIT", + "url": "https://raw.github.com/broofa/node-mime/master/LICENSE" + } + ], + "main": "mime.js", + "name": "mime", + "repository": { + "url": "git+https://github.com/broofa/node-mime.git", + "type": "git" + }, + "scripts": { + "prepublish": "node build/build.js > types.json", + "test": "node build/test.js" + }, + "version": "1.3.4" +} diff --git a/8 node/node_modules/mime/types.json b/8 node/node_modules/mime/types.json new file mode 100644 index 000000000..c674b1c8f --- /dev/null +++ b/8 node/node_modules/mime/types.json @@ -0,0 +1 @@ +{"application/andrew-inset":["ez"],"application/applixware":["aw"],"application/atom+xml":["atom"],"application/atomcat+xml":["atomcat"],"application/atomsvc+xml":["atomsvc"],"application/ccxml+xml":["ccxml"],"application/cdmi-capability":["cdmia"],"application/cdmi-container":["cdmic"],"application/cdmi-domain":["cdmid"],"application/cdmi-object":["cdmio"],"application/cdmi-queue":["cdmiq"],"application/cu-seeme":["cu"],"application/dash+xml":["mdp"],"application/davmount+xml":["davmount"],"application/docbook+xml":["dbk"],"application/dssc+der":["dssc"],"application/dssc+xml":["xdssc"],"application/ecmascript":["ecma"],"application/emma+xml":["emma"],"application/epub+zip":["epub"],"application/exi":["exi"],"application/font-tdpfr":["pfr"],"application/font-woff":["woff"],"application/font-woff2":["woff2"],"application/gml+xml":["gml"],"application/gpx+xml":["gpx"],"application/gxf":["gxf"],"application/hyperstudio":["stk"],"application/inkml+xml":["ink","inkml"],"application/ipfix":["ipfix"],"application/java-archive":["jar"],"application/java-serialized-object":["ser"],"application/java-vm":["class"],"application/javascript":["js"],"application/json":["json","map"],"application/json5":["json5"],"application/jsonml+json":["jsonml"],"application/lost+xml":["lostxml"],"application/mac-binhex40":["hqx"],"application/mac-compactpro":["cpt"],"application/mads+xml":["mads"],"application/marc":["mrc"],"application/marcxml+xml":["mrcx"],"application/mathematica":["ma","nb","mb"],"application/mathml+xml":["mathml"],"application/mbox":["mbox"],"application/mediaservercontrol+xml":["mscml"],"application/metalink+xml":["metalink"],"application/metalink4+xml":["meta4"],"application/mets+xml":["mets"],"application/mods+xml":["mods"],"application/mp21":["m21","mp21"],"application/mp4":["mp4s","m4p"],"application/msword":["doc","dot"],"application/mxf":["mxf"],"application/octet-stream":["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","buffer"],"application/oda":["oda"],"application/oebps-package+xml":["opf"],"application/ogg":["ogx"],"application/omdoc+xml":["omdoc"],"application/onenote":["onetoc","onetoc2","onetmp","onepkg"],"application/oxps":["oxps"],"application/patch-ops-error+xml":["xer"],"application/pdf":["pdf"],"application/pgp-encrypted":["pgp"],"application/pgp-signature":["asc","sig"],"application/pics-rules":["prf"],"application/pkcs10":["p10"],"application/pkcs7-mime":["p7m","p7c"],"application/pkcs7-signature":["p7s"],"application/pkcs8":["p8"],"application/pkix-attr-cert":["ac"],"application/pkix-cert":["cer"],"application/pkix-crl":["crl"],"application/pkix-pkipath":["pkipath"],"application/pkixcmp":["pki"],"application/pls+xml":["pls"],"application/postscript":["ai","eps","ps"],"application/prs.cww":["cww"],"application/pskc+xml":["pskcxml"],"application/rdf+xml":["rdf"],"application/reginfo+xml":["rif"],"application/relax-ng-compact-syntax":["rnc"],"application/resource-lists+xml":["rl"],"application/resource-lists-diff+xml":["rld"],"application/rls-services+xml":["rs"],"application/rpki-ghostbusters":["gbr"],"application/rpki-manifest":["mft"],"application/rpki-roa":["roa"],"application/rsd+xml":["rsd"],"application/rss+xml":["rss"],"application/rtf":["rtf"],"application/sbml+xml":["sbml"],"application/scvp-cv-request":["scq"],"application/scvp-cv-response":["scs"],"application/scvp-vp-request":["spq"],"application/scvp-vp-response":["spp"],"application/sdp":["sdp"],"application/set-payment-initiation":["setpay"],"application/set-registration-initiation":["setreg"],"application/shf+xml":["shf"],"application/smil+xml":["smi","smil"],"application/sparql-query":["rq"],"application/sparql-results+xml":["srx"],"application/srgs":["gram"],"application/srgs+xml":["grxml"],"application/sru+xml":["sru"],"application/ssdl+xml":["ssdl"],"application/ssml+xml":["ssml"],"application/tei+xml":["tei","teicorpus"],"application/thraud+xml":["tfi"],"application/timestamped-data":["tsd"],"application/vnd.3gpp.pic-bw-large":["plb"],"application/vnd.3gpp.pic-bw-small":["psb"],"application/vnd.3gpp.pic-bw-var":["pvb"],"application/vnd.3gpp2.tcap":["tcap"],"application/vnd.3m.post-it-notes":["pwn"],"application/vnd.accpac.simply.aso":["aso"],"application/vnd.accpac.simply.imp":["imp"],"application/vnd.acucobol":["acu"],"application/vnd.acucorp":["atc","acutc"],"application/vnd.adobe.air-application-installer-package+zip":["air"],"application/vnd.adobe.formscentral.fcdt":["fcdt"],"application/vnd.adobe.fxp":["fxp","fxpl"],"application/vnd.adobe.xdp+xml":["xdp"],"application/vnd.adobe.xfdf":["xfdf"],"application/vnd.ahead.space":["ahead"],"application/vnd.airzip.filesecure.azf":["azf"],"application/vnd.airzip.filesecure.azs":["azs"],"application/vnd.amazon.ebook":["azw"],"application/vnd.americandynamics.acc":["acc"],"application/vnd.amiga.ami":["ami"],"application/vnd.android.package-archive":["apk"],"application/vnd.anser-web-certificate-issue-initiation":["cii"],"application/vnd.anser-web-funds-transfer-initiation":["fti"],"application/vnd.antix.game-component":["atx"],"application/vnd.apple.installer+xml":["mpkg"],"application/vnd.apple.mpegurl":["m3u8"],"application/vnd.aristanetworks.swi":["swi"],"application/vnd.astraea-software.iota":["iota"],"application/vnd.audiograph":["aep"],"application/vnd.blueice.multipass":["mpm"],"application/vnd.bmi":["bmi"],"application/vnd.businessobjects":["rep"],"application/vnd.chemdraw+xml":["cdxml"],"application/vnd.chipnuts.karaoke-mmd":["mmd"],"application/vnd.cinderella":["cdy"],"application/vnd.claymore":["cla"],"application/vnd.cloanto.rp9":["rp9"],"application/vnd.clonk.c4group":["c4g","c4d","c4f","c4p","c4u"],"application/vnd.cluetrust.cartomobile-config":["c11amc"],"application/vnd.cluetrust.cartomobile-config-pkg":["c11amz"],"application/vnd.commonspace":["csp"],"application/vnd.contact.cmsg":["cdbcmsg"],"application/vnd.cosmocaller":["cmc"],"application/vnd.crick.clicker":["clkx"],"application/vnd.crick.clicker.keyboard":["clkk"],"application/vnd.crick.clicker.palette":["clkp"],"application/vnd.crick.clicker.template":["clkt"],"application/vnd.crick.clicker.wordbank":["clkw"],"application/vnd.criticaltools.wbs+xml":["wbs"],"application/vnd.ctc-posml":["pml"],"application/vnd.cups-ppd":["ppd"],"application/vnd.curl.car":["car"],"application/vnd.curl.pcurl":["pcurl"],"application/vnd.dart":["dart"],"application/vnd.data-vision.rdz":["rdz"],"application/vnd.dece.data":["uvf","uvvf","uvd","uvvd"],"application/vnd.dece.ttml+xml":["uvt","uvvt"],"application/vnd.dece.unspecified":["uvx","uvvx"],"application/vnd.dece.zip":["uvz","uvvz"],"application/vnd.denovo.fcselayout-link":["fe_launch"],"application/vnd.dna":["dna"],"application/vnd.dolby.mlp":["mlp"],"application/vnd.dpgraph":["dpg"],"application/vnd.dreamfactory":["dfac"],"application/vnd.ds-keypoint":["kpxx"],"application/vnd.dvb.ait":["ait"],"application/vnd.dvb.service":["svc"],"application/vnd.dynageo":["geo"],"application/vnd.ecowin.chart":["mag"],"application/vnd.enliven":["nml"],"application/vnd.epson.esf":["esf"],"application/vnd.epson.msf":["msf"],"application/vnd.epson.quickanime":["qam"],"application/vnd.epson.salt":["slt"],"application/vnd.epson.ssf":["ssf"],"application/vnd.eszigno3+xml":["es3","et3"],"application/vnd.ezpix-album":["ez2"],"application/vnd.ezpix-package":["ez3"],"application/vnd.fdf":["fdf"],"application/vnd.fdsn.mseed":["mseed"],"application/vnd.fdsn.seed":["seed","dataless"],"application/vnd.flographit":["gph"],"application/vnd.fluxtime.clip":["ftc"],"application/vnd.framemaker":["fm","frame","maker","book"],"application/vnd.frogans.fnc":["fnc"],"application/vnd.frogans.ltf":["ltf"],"application/vnd.fsc.weblaunch":["fsc"],"application/vnd.fujitsu.oasys":["oas"],"application/vnd.fujitsu.oasys2":["oa2"],"application/vnd.fujitsu.oasys3":["oa3"],"application/vnd.fujitsu.oasysgp":["fg5"],"application/vnd.fujitsu.oasysprs":["bh2"],"application/vnd.fujixerox.ddd":["ddd"],"application/vnd.fujixerox.docuworks":["xdw"],"application/vnd.fujixerox.docuworks.binder":["xbd"],"application/vnd.fuzzysheet":["fzs"],"application/vnd.genomatix.tuxedo":["txd"],"application/vnd.geogebra.file":["ggb"],"application/vnd.geogebra.tool":["ggt"],"application/vnd.geometry-explorer":["gex","gre"],"application/vnd.geonext":["gxt"],"application/vnd.geoplan":["g2w"],"application/vnd.geospace":["g3w"],"application/vnd.gmx":["gmx"],"application/vnd.google-earth.kml+xml":["kml"],"application/vnd.google-earth.kmz":["kmz"],"application/vnd.grafeq":["gqf","gqs"],"application/vnd.groove-account":["gac"],"application/vnd.groove-help":["ghf"],"application/vnd.groove-identity-message":["gim"],"application/vnd.groove-injector":["grv"],"application/vnd.groove-tool-message":["gtm"],"application/vnd.groove-tool-template":["tpl"],"application/vnd.groove-vcard":["vcg"],"application/vnd.hal+xml":["hal"],"application/vnd.handheld-entertainment+xml":["zmm"],"application/vnd.hbci":["hbci"],"application/vnd.hhe.lesson-player":["les"],"application/vnd.hp-hpgl":["hpgl"],"application/vnd.hp-hpid":["hpid"],"application/vnd.hp-hps":["hps"],"application/vnd.hp-jlyt":["jlt"],"application/vnd.hp-pcl":["pcl"],"application/vnd.hp-pclxl":["pclxl"],"application/vnd.ibm.minipay":["mpy"],"application/vnd.ibm.modcap":["afp","listafp","list3820"],"application/vnd.ibm.rights-management":["irm"],"application/vnd.ibm.secure-container":["sc"],"application/vnd.iccprofile":["icc","icm"],"application/vnd.igloader":["igl"],"application/vnd.immervision-ivp":["ivp"],"application/vnd.immervision-ivu":["ivu"],"application/vnd.insors.igm":["igm"],"application/vnd.intercon.formnet":["xpw","xpx"],"application/vnd.intergeo":["i2g"],"application/vnd.intu.qbo":["qbo"],"application/vnd.intu.qfx":["qfx"],"application/vnd.ipunplugged.rcprofile":["rcprofile"],"application/vnd.irepository.package+xml":["irp"],"application/vnd.is-xpr":["xpr"],"application/vnd.isac.fcs":["fcs"],"application/vnd.jam":["jam"],"application/vnd.jcp.javame.midlet-rms":["rms"],"application/vnd.jisp":["jisp"],"application/vnd.joost.joda-archive":["joda"],"application/vnd.kahootz":["ktz","ktr"],"application/vnd.kde.karbon":["karbon"],"application/vnd.kde.kchart":["chrt"],"application/vnd.kde.kformula":["kfo"],"application/vnd.kde.kivio":["flw"],"application/vnd.kde.kontour":["kon"],"application/vnd.kde.kpresenter":["kpr","kpt"],"application/vnd.kde.kspread":["ksp"],"application/vnd.kde.kword":["kwd","kwt"],"application/vnd.kenameaapp":["htke"],"application/vnd.kidspiration":["kia"],"application/vnd.kinar":["kne","knp"],"application/vnd.koan":["skp","skd","skt","skm"],"application/vnd.kodak-descriptor":["sse"],"application/vnd.las.las+xml":["lasxml"],"application/vnd.llamagraphics.life-balance.desktop":["lbd"],"application/vnd.llamagraphics.life-balance.exchange+xml":["lbe"],"application/vnd.lotus-1-2-3":["123"],"application/vnd.lotus-approach":["apr"],"application/vnd.lotus-freelance":["pre"],"application/vnd.lotus-notes":["nsf"],"application/vnd.lotus-organizer":["org"],"application/vnd.lotus-screencam":["scm"],"application/vnd.lotus-wordpro":["lwp"],"application/vnd.macports.portpkg":["portpkg"],"application/vnd.mcd":["mcd"],"application/vnd.medcalcdata":["mc1"],"application/vnd.mediastation.cdkey":["cdkey"],"application/vnd.mfer":["mwf"],"application/vnd.mfmp":["mfm"],"application/vnd.micrografx.flo":["flo"],"application/vnd.micrografx.igx":["igx"],"application/vnd.mif":["mif"],"application/vnd.mobius.daf":["daf"],"application/vnd.mobius.dis":["dis"],"application/vnd.mobius.mbk":["mbk"],"application/vnd.mobius.mqy":["mqy"],"application/vnd.mobius.msl":["msl"],"application/vnd.mobius.plc":["plc"],"application/vnd.mobius.txf":["txf"],"application/vnd.mophun.application":["mpn"],"application/vnd.mophun.certificate":["mpc"],"application/vnd.mozilla.xul+xml":["xul"],"application/vnd.ms-artgalry":["cil"],"application/vnd.ms-cab-compressed":["cab"],"application/vnd.ms-excel":["xls","xlm","xla","xlc","xlt","xlw"],"application/vnd.ms-excel.addin.macroenabled.12":["xlam"],"application/vnd.ms-excel.sheet.binary.macroenabled.12":["xlsb"],"application/vnd.ms-excel.sheet.macroenabled.12":["xlsm"],"application/vnd.ms-excel.template.macroenabled.12":["xltm"],"application/vnd.ms-fontobject":["eot"],"application/vnd.ms-htmlhelp":["chm"],"application/vnd.ms-ims":["ims"],"application/vnd.ms-lrm":["lrm"],"application/vnd.ms-officetheme":["thmx"],"application/vnd.ms-pki.seccat":["cat"],"application/vnd.ms-pki.stl":["stl"],"application/vnd.ms-powerpoint":["ppt","pps","pot"],"application/vnd.ms-powerpoint.addin.macroenabled.12":["ppam"],"application/vnd.ms-powerpoint.presentation.macroenabled.12":["pptm"],"application/vnd.ms-powerpoint.slide.macroenabled.12":["sldm"],"application/vnd.ms-powerpoint.slideshow.macroenabled.12":["ppsm"],"application/vnd.ms-powerpoint.template.macroenabled.12":["potm"],"application/vnd.ms-project":["mpp","mpt"],"application/vnd.ms-word.document.macroenabled.12":["docm"],"application/vnd.ms-word.template.macroenabled.12":["dotm"],"application/vnd.ms-works":["wps","wks","wcm","wdb"],"application/vnd.ms-wpl":["wpl"],"application/vnd.ms-xpsdocument":["xps"],"application/vnd.mseq":["mseq"],"application/vnd.musician":["mus"],"application/vnd.muvee.style":["msty"],"application/vnd.mynfc":["taglet"],"application/vnd.neurolanguage.nlu":["nlu"],"application/vnd.nitf":["ntf","nitf"],"application/vnd.noblenet-directory":["nnd"],"application/vnd.noblenet-sealer":["nns"],"application/vnd.noblenet-web":["nnw"],"application/vnd.nokia.n-gage.data":["ngdat"],"application/vnd.nokia.radio-preset":["rpst"],"application/vnd.nokia.radio-presets":["rpss"],"application/vnd.novadigm.edm":["edm"],"application/vnd.novadigm.edx":["edx"],"application/vnd.novadigm.ext":["ext"],"application/vnd.oasis.opendocument.chart":["odc"],"application/vnd.oasis.opendocument.chart-template":["otc"],"application/vnd.oasis.opendocument.database":["odb"],"application/vnd.oasis.opendocument.formula":["odf"],"application/vnd.oasis.opendocument.formula-template":["odft"],"application/vnd.oasis.opendocument.graphics":["odg"],"application/vnd.oasis.opendocument.graphics-template":["otg"],"application/vnd.oasis.opendocument.image":["odi"],"application/vnd.oasis.opendocument.image-template":["oti"],"application/vnd.oasis.opendocument.presentation":["odp"],"application/vnd.oasis.opendocument.presentation-template":["otp"],"application/vnd.oasis.opendocument.spreadsheet":["ods"],"application/vnd.oasis.opendocument.spreadsheet-template":["ots"],"application/vnd.oasis.opendocument.text":["odt"],"application/vnd.oasis.opendocument.text-master":["odm"],"application/vnd.oasis.opendocument.text-template":["ott"],"application/vnd.oasis.opendocument.text-web":["oth"],"application/vnd.olpc-sugar":["xo"],"application/vnd.oma.dd2+xml":["dd2"],"application/vnd.openofficeorg.extension":["oxt"],"application/vnd.openxmlformats-officedocument.presentationml.presentation":["pptx"],"application/vnd.openxmlformats-officedocument.presentationml.slide":["sldx"],"application/vnd.openxmlformats-officedocument.presentationml.slideshow":["ppsx"],"application/vnd.openxmlformats-officedocument.presentationml.template":["potx"],"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet":["xlsx"],"application/vnd.openxmlformats-officedocument.spreadsheetml.template":["xltx"],"application/vnd.openxmlformats-officedocument.wordprocessingml.document":["docx"],"application/vnd.openxmlformats-officedocument.wordprocessingml.template":["dotx"],"application/vnd.osgeo.mapguide.package":["mgp"],"application/vnd.osgi.dp":["dp"],"application/vnd.osgi.subsystem":["esa"],"application/vnd.palm":["pdb","pqa","oprc"],"application/vnd.pawaafile":["paw"],"application/vnd.pg.format":["str"],"application/vnd.pg.osasli":["ei6"],"application/vnd.picsel":["efif"],"application/vnd.pmi.widget":["wg"],"application/vnd.pocketlearn":["plf"],"application/vnd.powerbuilder6":["pbd"],"application/vnd.previewsystems.box":["box"],"application/vnd.proteus.magazine":["mgz"],"application/vnd.publishare-delta-tree":["qps"],"application/vnd.pvi.ptid1":["ptid"],"application/vnd.quark.quarkxpress":["qxd","qxt","qwd","qwt","qxl","qxb"],"application/vnd.realvnc.bed":["bed"],"application/vnd.recordare.musicxml":["mxl"],"application/vnd.recordare.musicxml+xml":["musicxml"],"application/vnd.rig.cryptonote":["cryptonote"],"application/vnd.rim.cod":["cod"],"application/vnd.rn-realmedia":["rm"],"application/vnd.rn-realmedia-vbr":["rmvb"],"application/vnd.route66.link66+xml":["link66"],"application/vnd.sailingtracker.track":["st"],"application/vnd.seemail":["see"],"application/vnd.sema":["sema"],"application/vnd.semd":["semd"],"application/vnd.semf":["semf"],"application/vnd.shana.informed.formdata":["ifm"],"application/vnd.shana.informed.formtemplate":["itp"],"application/vnd.shana.informed.interchange":["iif"],"application/vnd.shana.informed.package":["ipk"],"application/vnd.simtech-mindmapper":["twd","twds"],"application/vnd.smaf":["mmf"],"application/vnd.smart.teacher":["teacher"],"application/vnd.solent.sdkm+xml":["sdkm","sdkd"],"application/vnd.spotfire.dxp":["dxp"],"application/vnd.spotfire.sfs":["sfs"],"application/vnd.stardivision.calc":["sdc"],"application/vnd.stardivision.draw":["sda"],"application/vnd.stardivision.impress":["sdd"],"application/vnd.stardivision.math":["smf"],"application/vnd.stardivision.writer":["sdw","vor"],"application/vnd.stardivision.writer-global":["sgl"],"application/vnd.stepmania.package":["smzip"],"application/vnd.stepmania.stepchart":["sm"],"application/vnd.sun.xml.calc":["sxc"],"application/vnd.sun.xml.calc.template":["stc"],"application/vnd.sun.xml.draw":["sxd"],"application/vnd.sun.xml.draw.template":["std"],"application/vnd.sun.xml.impress":["sxi"],"application/vnd.sun.xml.impress.template":["sti"],"application/vnd.sun.xml.math":["sxm"],"application/vnd.sun.xml.writer":["sxw"],"application/vnd.sun.xml.writer.global":["sxg"],"application/vnd.sun.xml.writer.template":["stw"],"application/vnd.sus-calendar":["sus","susp"],"application/vnd.svd":["svd"],"application/vnd.symbian.install":["sis","sisx"],"application/vnd.syncml+xml":["xsm"],"application/vnd.syncml.dm+wbxml":["bdm"],"application/vnd.syncml.dm+xml":["xdm"],"application/vnd.tao.intent-module-archive":["tao"],"application/vnd.tcpdump.pcap":["pcap","cap","dmp"],"application/vnd.tmobile-livetv":["tmo"],"application/vnd.trid.tpt":["tpt"],"application/vnd.triscape.mxs":["mxs"],"application/vnd.trueapp":["tra"],"application/vnd.ufdl":["ufd","ufdl"],"application/vnd.uiq.theme":["utz"],"application/vnd.umajin":["umj"],"application/vnd.unity":["unityweb"],"application/vnd.uoml+xml":["uoml"],"application/vnd.vcx":["vcx"],"application/vnd.visio":["vsd","vst","vss","vsw"],"application/vnd.visionary":["vis"],"application/vnd.vsf":["vsf"],"application/vnd.wap.wbxml":["wbxml"],"application/vnd.wap.wmlc":["wmlc"],"application/vnd.wap.wmlscriptc":["wmlsc"],"application/vnd.webturbo":["wtb"],"application/vnd.wolfram.player":["nbp"],"application/vnd.wordperfect":["wpd"],"application/vnd.wqd":["wqd"],"application/vnd.wt.stf":["stf"],"application/vnd.xara":["xar"],"application/vnd.xfdl":["xfdl"],"application/vnd.yamaha.hv-dic":["hvd"],"application/vnd.yamaha.hv-script":["hvs"],"application/vnd.yamaha.hv-voice":["hvp"],"application/vnd.yamaha.openscoreformat":["osf"],"application/vnd.yamaha.openscoreformat.osfpvg+xml":["osfpvg"],"application/vnd.yamaha.smaf-audio":["saf"],"application/vnd.yamaha.smaf-phrase":["spf"],"application/vnd.yellowriver-custom-menu":["cmp"],"application/vnd.zul":["zir","zirz"],"application/vnd.zzazz.deck+xml":["zaz"],"application/voicexml+xml":["vxml"],"application/widget":["wgt"],"application/winhlp":["hlp"],"application/wsdl+xml":["wsdl"],"application/wspolicy+xml":["wspolicy"],"application/x-7z-compressed":["7z"],"application/x-abiword":["abw"],"application/x-ace-compressed":["ace"],"application/x-apple-diskimage":["dmg"],"application/x-authorware-bin":["aab","x32","u32","vox"],"application/x-authorware-map":["aam"],"application/x-authorware-seg":["aas"],"application/x-bcpio":["bcpio"],"application/x-bittorrent":["torrent"],"application/x-blorb":["blb","blorb"],"application/x-bzip":["bz"],"application/x-bzip2":["bz2","boz"],"application/x-cbr":["cbr","cba","cbt","cbz","cb7"],"application/x-cdlink":["vcd"],"application/x-cfs-compressed":["cfs"],"application/x-chat":["chat"],"application/x-chess-pgn":["pgn"],"application/x-chrome-extension":["crx"],"application/x-conference":["nsc"],"application/x-cpio":["cpio"],"application/x-csh":["csh"],"application/x-debian-package":["deb","udeb"],"application/x-dgc-compressed":["dgc"],"application/x-director":["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"],"application/x-doom":["wad"],"application/x-dtbncx+xml":["ncx"],"application/x-dtbook+xml":["dtb"],"application/x-dtbresource+xml":["res"],"application/x-dvi":["dvi"],"application/x-envoy":["evy"],"application/x-eva":["eva"],"application/x-font-bdf":["bdf"],"application/x-font-ghostscript":["gsf"],"application/x-font-linux-psf":["psf"],"application/x-font-otf":["otf"],"application/x-font-pcf":["pcf"],"application/x-font-snf":["snf"],"application/x-font-ttf":["ttf","ttc"],"application/x-font-type1":["pfa","pfb","pfm","afm"],"application/x-freearc":["arc"],"application/x-futuresplash":["spl"],"application/x-gca-compressed":["gca"],"application/x-glulx":["ulx"],"application/x-gnumeric":["gnumeric"],"application/x-gramps-xml":["gramps"],"application/x-gtar":["gtar"],"application/x-hdf":["hdf"],"application/x-install-instructions":["install"],"application/x-iso9660-image":["iso"],"application/x-java-jnlp-file":["jnlp"],"application/x-latex":["latex"],"application/x-lua-bytecode":["luac"],"application/x-lzh-compressed":["lzh","lha"],"application/x-mie":["mie"],"application/x-mobipocket-ebook":["prc","mobi"],"application/x-ms-application":["application"],"application/x-ms-shortcut":["lnk"],"application/x-ms-wmd":["wmd"],"application/x-ms-wmz":["wmz"],"application/x-ms-xbap":["xbap"],"application/x-msaccess":["mdb"],"application/x-msbinder":["obd"],"application/x-mscardfile":["crd"],"application/x-msclip":["clp"],"application/x-msdownload":["exe","dll","com","bat","msi"],"application/x-msmediaview":["mvb","m13","m14"],"application/x-msmetafile":["wmf","wmz","emf","emz"],"application/x-msmoney":["mny"],"application/x-mspublisher":["pub"],"application/x-msschedule":["scd"],"application/x-msterminal":["trm"],"application/x-mswrite":["wri"],"application/x-netcdf":["nc","cdf"],"application/x-nzb":["nzb"],"application/x-pkcs12":["p12","pfx"],"application/x-pkcs7-certificates":["p7b","spc"],"application/x-pkcs7-certreqresp":["p7r"],"application/x-rar-compressed":["rar"],"application/x-research-info-systems":["ris"],"application/x-sh":["sh"],"application/x-shar":["shar"],"application/x-shockwave-flash":["swf"],"application/x-silverlight-app":["xap"],"application/x-sql":["sql"],"application/x-stuffit":["sit"],"application/x-stuffitx":["sitx"],"application/x-subrip":["srt"],"application/x-sv4cpio":["sv4cpio"],"application/x-sv4crc":["sv4crc"],"application/x-t3vm-image":["t3"],"application/x-tads":["gam"],"application/x-tar":["tar"],"application/x-tcl":["tcl"],"application/x-tex":["tex"],"application/x-tex-tfm":["tfm"],"application/x-texinfo":["texinfo","texi"],"application/x-tgif":["obj"],"application/x-ustar":["ustar"],"application/x-wais-source":["src"],"application/x-web-app-manifest+json":["webapp"],"application/x-x509-ca-cert":["der","crt"],"application/x-xfig":["fig"],"application/x-xliff+xml":["xlf"],"application/x-xpinstall":["xpi"],"application/x-xz":["xz"],"application/x-zmachine":["z1","z2","z3","z4","z5","z6","z7","z8"],"application/xaml+xml":["xaml"],"application/xcap-diff+xml":["xdf"],"application/xenc+xml":["xenc"],"application/xhtml+xml":["xhtml","xht"],"application/xml":["xml","xsl","xsd"],"application/xml-dtd":["dtd"],"application/xop+xml":["xop"],"application/xproc+xml":["xpl"],"application/xslt+xml":["xslt"],"application/xspf+xml":["xspf"],"application/xv+xml":["mxml","xhvml","xvml","xvm"],"application/yang":["yang"],"application/yin+xml":["yin"],"application/zip":["zip"],"audio/adpcm":["adp"],"audio/basic":["au","snd"],"audio/midi":["mid","midi","kar","rmi"],"audio/mp4":["mp4a","m4a"],"audio/mpeg":["mpga","mp2","mp2a","mp3","m2a","m3a"],"audio/ogg":["oga","ogg","spx"],"audio/s3m":["s3m"],"audio/silk":["sil"],"audio/vnd.dece.audio":["uva","uvva"],"audio/vnd.digital-winds":["eol"],"audio/vnd.dra":["dra"],"audio/vnd.dts":["dts"],"audio/vnd.dts.hd":["dtshd"],"audio/vnd.lucent.voice":["lvp"],"audio/vnd.ms-playready.media.pya":["pya"],"audio/vnd.nuera.ecelp4800":["ecelp4800"],"audio/vnd.nuera.ecelp7470":["ecelp7470"],"audio/vnd.nuera.ecelp9600":["ecelp9600"],"audio/vnd.rip":["rip"],"audio/webm":["weba"],"audio/x-aac":["aac"],"audio/x-aiff":["aif","aiff","aifc"],"audio/x-caf":["caf"],"audio/x-flac":["flac"],"audio/x-matroska":["mka"],"audio/x-mpegurl":["m3u"],"audio/x-ms-wax":["wax"],"audio/x-ms-wma":["wma"],"audio/x-pn-realaudio":["ram","ra"],"audio/x-pn-realaudio-plugin":["rmp"],"audio/x-wav":["wav"],"audio/xm":["xm"],"chemical/x-cdx":["cdx"],"chemical/x-cif":["cif"],"chemical/x-cmdf":["cmdf"],"chemical/x-cml":["cml"],"chemical/x-csml":["csml"],"chemical/x-xyz":["xyz"],"font/opentype":["otf"],"image/bmp":["bmp"],"image/cgm":["cgm"],"image/g3fax":["g3"],"image/gif":["gif"],"image/ief":["ief"],"image/jpeg":["jpeg","jpg","jpe"],"image/ktx":["ktx"],"image/png":["png"],"image/prs.btif":["btif"],"image/sgi":["sgi"],"image/svg+xml":["svg","svgz"],"image/tiff":["tiff","tif"],"image/vnd.adobe.photoshop":["psd"],"image/vnd.dece.graphic":["uvi","uvvi","uvg","uvvg"],"image/vnd.djvu":["djvu","djv"],"image/vnd.dvb.subtitle":["sub"],"image/vnd.dwg":["dwg"],"image/vnd.dxf":["dxf"],"image/vnd.fastbidsheet":["fbs"],"image/vnd.fpx":["fpx"],"image/vnd.fst":["fst"],"image/vnd.fujixerox.edmics-mmr":["mmr"],"image/vnd.fujixerox.edmics-rlc":["rlc"],"image/vnd.ms-modi":["mdi"],"image/vnd.ms-photo":["wdp"],"image/vnd.net-fpx":["npx"],"image/vnd.wap.wbmp":["wbmp"],"image/vnd.xiff":["xif"],"image/webp":["webp"],"image/x-3ds":["3ds"],"image/x-cmu-raster":["ras"],"image/x-cmx":["cmx"],"image/x-freehand":["fh","fhc","fh4","fh5","fh7"],"image/x-icon":["ico"],"image/x-mrsid-image":["sid"],"image/x-pcx":["pcx"],"image/x-pict":["pic","pct"],"image/x-portable-anymap":["pnm"],"image/x-portable-bitmap":["pbm"],"image/x-portable-graymap":["pgm"],"image/x-portable-pixmap":["ppm"],"image/x-rgb":["rgb"],"image/x-tga":["tga"],"image/x-xbitmap":["xbm"],"image/x-xpixmap":["xpm"],"image/x-xwindowdump":["xwd"],"message/rfc822":["eml","mime"],"model/iges":["igs","iges"],"model/mesh":["msh","mesh","silo"],"model/vnd.collada+xml":["dae"],"model/vnd.dwf":["dwf"],"model/vnd.gdl":["gdl"],"model/vnd.gtw":["gtw"],"model/vnd.mts":["mts"],"model/vnd.vtu":["vtu"],"model/vrml":["wrl","vrml"],"model/x3d+binary":["x3db","x3dbz"],"model/x3d+vrml":["x3dv","x3dvz"],"model/x3d+xml":["x3d","x3dz"],"text/cache-manifest":["appcache","manifest"],"text/calendar":["ics","ifb"],"text/coffeescript":["coffee"],"text/css":["css"],"text/csv":["csv"],"text/hjson":["hjson"],"text/html":["html","htm"],"text/jade":["jade"],"text/jsx":["jsx"],"text/less":["less"],"text/n3":["n3"],"text/plain":["txt","text","conf","def","list","log","in","ini"],"text/prs.lines.tag":["dsc"],"text/richtext":["rtx"],"text/sgml":["sgml","sgm"],"text/stylus":["stylus","styl"],"text/tab-separated-values":["tsv"],"text/troff":["t","tr","roff","man","me","ms"],"text/turtle":["ttl"],"text/uri-list":["uri","uris","urls"],"text/vcard":["vcard"],"text/vnd.curl":["curl"],"text/vnd.curl.dcurl":["dcurl"],"text/vnd.curl.mcurl":["mcurl"],"text/vnd.curl.scurl":["scurl"],"text/vnd.dvb.subtitle":["sub"],"text/vnd.fly":["fly"],"text/vnd.fmi.flexstor":["flx"],"text/vnd.graphviz":["gv"],"text/vnd.in3d.3dml":["3dml"],"text/vnd.in3d.spot":["spot"],"text/vnd.sun.j2me.app-descriptor":["jad"],"text/vnd.wap.wml":["wml"],"text/vnd.wap.wmlscript":["wmls"],"text/vtt":["vtt"],"text/x-asm":["s","asm"],"text/x-c":["c","cc","cxx","cpp","h","hh","dic"],"text/x-component":["htc"],"text/x-fortran":["f","for","f77","f90"],"text/x-handlebars-template":["hbs"],"text/x-java-source":["java"],"text/x-lua":["lua"],"text/x-markdown":["markdown","md","mkd"],"text/x-nfo":["nfo"],"text/x-opml":["opml"],"text/x-pascal":["p","pas"],"text/x-sass":["sass"],"text/x-scss":["scss"],"text/x-setext":["etx"],"text/x-sfv":["sfv"],"text/x-uuencode":["uu"],"text/x-vcalendar":["vcs"],"text/x-vcard":["vcf"],"text/yaml":["yaml","yml"],"video/3gpp":["3gp"],"video/3gpp2":["3g2"],"video/h261":["h261"],"video/h263":["h263"],"video/h264":["h264"],"video/jpeg":["jpgv"],"video/jpm":["jpm","jpgm"],"video/mj2":["mj2","mjp2"],"video/mp2t":["ts"],"video/mp4":["mp4","mp4v","mpg4"],"video/mpeg":["mpeg","mpg","mpe","m1v","m2v"],"video/ogg":["ogv"],"video/quicktime":["qt","mov"],"video/vnd.dece.hd":["uvh","uvvh"],"video/vnd.dece.mobile":["uvm","uvvm"],"video/vnd.dece.pd":["uvp","uvvp"],"video/vnd.dece.sd":["uvs","uvvs"],"video/vnd.dece.video":["uvv","uvvv"],"video/vnd.dvb.file":["dvb"],"video/vnd.fvt":["fvt"],"video/vnd.mpegurl":["mxu","m4u"],"video/vnd.ms-playready.media.pyv":["pyv"],"video/vnd.uvvu.mp4":["uvu","uvvu"],"video/vnd.vivo":["viv"],"video/webm":["webm"],"video/x-f4v":["f4v"],"video/x-fli":["fli"],"video/x-flv":["flv"],"video/x-m4v":["m4v"],"video/x-matroska":["mkv","mk3d","mks"],"video/x-mng":["mng"],"video/x-ms-asf":["asf","asx"],"video/x-ms-vob":["vob"],"video/x-ms-wm":["wm"],"video/x-ms-wmv":["wmv"],"video/x-ms-wmx":["wmx"],"video/x-ms-wvx":["wvx"],"video/x-msvideo":["avi"],"video/x-sgi-movie":["movie"],"video/x-smv":["smv"],"x-conference/x-cooltalk":["ice"]} diff --git a/8 node/node_modules/ms/index.js b/8 node/node_modules/ms/index.js new file mode 100644 index 000000000..6a522b16b --- /dev/null +++ b/8 node/node_modules/ms/index.js @@ -0,0 +1,152 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + if (ms >= d) { + return Math.round(ms / d) + 'd'; + } + if (ms >= h) { + return Math.round(ms / h) + 'h'; + } + if (ms >= m) { + return Math.round(ms / m) + 'm'; + } + if (ms >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + return plural(ms, d, 'day') || + plural(ms, h, 'hour') || + plural(ms, m, 'minute') || + plural(ms, s, 'second') || + ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) { + return; + } + if (ms < n * 1.5) { + return Math.floor(ms / n) + ' ' + name; + } + return Math.ceil(ms / n) + ' ' + name + 's'; +} diff --git a/8 node/node_modules/ms/license.md b/8 node/node_modules/ms/license.md new file mode 100644 index 000000000..69b61253a --- /dev/null +++ b/8 node/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/8 node/node_modules/ms/package.json b/8 node/node_modules/ms/package.json new file mode 100644 index 000000000..4c253cd20 --- /dev/null +++ b/8 node/node_modules/ms/package.json @@ -0,0 +1,70 @@ +{ + "_from": "ms@2.0.0", + "_id": "ms@2.0.0", + "_inBundle": false, + "_integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=", + "_location": "/ms", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ms@2.0.0", + "name": "ms", + "escapedName": "ms", + "rawSpec": "2.0.0", + "saveSpec": null, + "fetchSpec": "2.0.0" + }, + "_requiredBy": [ + "/debug", + "/send" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "_shasum": "5608aeadfc00be6c2901df5f9861788de0d597c8", + "_spec": "ms@2.0.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/debug", + "bugs": { + "url": "https://github.com/zeit/ms/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Tiny milisecond conversion utility", + "devDependencies": { + "eslint": "3.19.0", + "expect.js": "0.3.1", + "husky": "0.13.3", + "lint-staged": "3.4.1", + "mocha": "3.4.1" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/zeit/ms#readme", + "license": "MIT", + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "main": "./index", + "name": "ms", + "repository": { + "type": "git", + "url": "git+https://github.com/zeit/ms.git" + }, + "scripts": { + "lint": "eslint lib/* bin/*", + "precommit": "lint-staged", + "test": "mocha tests.js" + }, + "version": "2.0.0" +} diff --git a/8 node/node_modules/ms/readme.md b/8 node/node_modules/ms/readme.md new file mode 100644 index 000000000..84a9974cc --- /dev/null +++ b/8 node/node_modules/ms/readme.md @@ -0,0 +1,51 @@ +# ms + +[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms) +[![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +``` + +### Convert from milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +### Time format written-out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [node](https://nodejs.org) and in the browser. +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of equivalent ms is returned. + +## Caught a bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/8 node/node_modules/negotiator/HISTORY.md b/8 node/node_modules/negotiator/HISTORY.md new file mode 100644 index 000000000..10b69179d --- /dev/null +++ b/8 node/node_modules/negotiator/HISTORY.md @@ -0,0 +1,98 @@ +0.6.1 / 2016-05-02 +================== + + * perf: improve `Accept` parsing speed + * perf: improve `Accept-Charset` parsing speed + * perf: improve `Accept-Encoding` parsing speed + * perf: improve `Accept-Language` parsing speed + +0.6.0 / 2015-09-29 +================== + + * Fix including type extensions in parameters in `Accept` parsing + * Fix parsing `Accept` parameters with quoted equals + * Fix parsing `Accept` parameters with quoted semicolons + * Lazy-load modules from main entry point + * perf: delay type concatenation until needed + * perf: enable strict mode + * perf: hoist regular expressions + * perf: remove closures getting spec properties + * perf: remove a closure from media type parsing + * perf: remove property delete from media type parsing + +0.5.3 / 2015-05-10 +================== + + * Fix media type parameter matching to be case-insensitive + +0.5.2 / 2015-05-06 +================== + + * Fix comparing media types with quoted values + * Fix splitting media types with quoted commas + +0.5.1 / 2015-02-14 +================== + + * Fix preference sorting to be stable for long acceptable lists + +0.5.0 / 2014-12-18 +================== + + * Fix list return order when large accepted list + * Fix missing identity encoding when q=0 exists + * Remove dynamic building of Negotiator class + +0.4.9 / 2014-10-14 +================== + + * Fix error when media type has invalid parameter + +0.4.8 / 2014-09-28 +================== + + * Fix all negotiations to be case-insensitive + * Stable sort preferences of same quality according to client order + * Support Node.js 0.6 + +0.4.7 / 2014-06-24 +================== + + * Handle invalid provided languages + * Handle invalid provided media types + +0.4.6 / 2014-06-11 +================== + + * Order by specificity when quality is the same + +0.4.5 / 2014-05-29 +================== + + * Fix regression in empty header handling + +0.4.4 / 2014-05-29 +================== + + * Fix behaviors when headers are not present + +0.4.3 / 2014-04-16 +================== + + * Handle slashes on media params correctly + +0.4.2 / 2014-02-28 +================== + + * Fix media type sorting + * Handle media types params strictly + +0.4.1 / 2014-01-16 +================== + + * Use most specific matches + +0.4.0 / 2014-01-09 +================== + + * Remove preferred prefix from methods diff --git a/8 node/node_modules/negotiator/LICENSE b/8 node/node_modules/negotiator/LICENSE new file mode 100644 index 000000000..ea6b9e2e9 --- /dev/null +++ b/8 node/node_modules/negotiator/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Federico Romero +Copyright (c) 2012-2014 Isaac Z. Schlueter +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/negotiator/README.md b/8 node/node_modules/negotiator/README.md new file mode 100644 index 000000000..04a67ff76 --- /dev/null +++ b/8 node/node_modules/negotiator/README.md @@ -0,0 +1,203 @@ +# negotiator + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +An HTTP content negotiator for Node.js + +## Installation + +```sh +$ npm install negotiator +``` + +## API + +```js +var Negotiator = require('negotiator') +``` + +### Accept Negotiation + +```js +availableMediaTypes = ['text/html', 'text/plain', 'application/json'] + +// The negotiator constructor receives a request object +negotiator = new Negotiator(request) + +// Let's say Accept header is 'text/html, application/*;q=0.2, image/jpeg;q=0.8' + +negotiator.mediaTypes() +// -> ['text/html', 'image/jpeg', 'application/*'] + +negotiator.mediaTypes(availableMediaTypes) +// -> ['text/html', 'application/json'] + +negotiator.mediaType(availableMediaTypes) +// -> 'text/html' +``` + +You can check a working example at `examples/accept.js`. + +#### Methods + +##### mediaType() + +Returns the most preferred media type from the client. + +##### mediaType(availableMediaType) + +Returns the most preferred media type from a list of available media types. + +##### mediaTypes() + +Returns an array of preferred media types ordered by the client preference. + +##### mediaTypes(availableMediaTypes) + +Returns an array of preferred media types ordered by priority from a list of +available media types. + +### Accept-Language Negotiation + +```js +negotiator = new Negotiator(request) + +availableLanguages = ['en', 'es', 'fr'] + +// Let's say Accept-Language header is 'en;q=0.8, es, pt' + +negotiator.languages() +// -> ['es', 'pt', 'en'] + +negotiator.languages(availableLanguages) +// -> ['es', 'en'] + +language = negotiator.language(availableLanguages) +// -> 'es' +``` + +You can check a working example at `examples/language.js`. + +#### Methods + +##### language() + +Returns the most preferred language from the client. + +##### language(availableLanguages) + +Returns the most preferred language from a list of available languages. + +##### languages() + +Returns an array of preferred languages ordered by the client preference. + +##### languages(availableLanguages) + +Returns an array of preferred languages ordered by priority from a list of +available languages. + +### Accept-Charset Negotiation + +```js +availableCharsets = ['utf-8', 'iso-8859-1', 'iso-8859-5'] + +negotiator = new Negotiator(request) + +// Let's say Accept-Charset header is 'utf-8, iso-8859-1;q=0.8, utf-7;q=0.2' + +negotiator.charsets() +// -> ['utf-8', 'iso-8859-1', 'utf-7'] + +negotiator.charsets(availableCharsets) +// -> ['utf-8', 'iso-8859-1'] + +negotiator.charset(availableCharsets) +// -> 'utf-8' +``` + +You can check a working example at `examples/charset.js`. + +#### Methods + +##### charset() + +Returns the most preferred charset from the client. + +##### charset(availableCharsets) + +Returns the most preferred charset from a list of available charsets. + +##### charsets() + +Returns an array of preferred charsets ordered by the client preference. + +##### charsets(availableCharsets) + +Returns an array of preferred charsets ordered by priority from a list of +available charsets. + +### Accept-Encoding Negotiation + +```js +availableEncodings = ['identity', 'gzip'] + +negotiator = new Negotiator(request) + +// Let's say Accept-Encoding header is 'gzip, compress;q=0.2, identity;q=0.5' + +negotiator.encodings() +// -> ['gzip', 'identity', 'compress'] + +negotiator.encodings(availableEncodings) +// -> ['gzip', 'identity'] + +negotiator.encoding(availableEncodings) +// -> 'gzip' +``` + +You can check a working example at `examples/encoding.js`. + +#### Methods + +##### encoding() + +Returns the most preferred encoding from the client. + +##### encoding(availableEncodings) + +Returns the most preferred encoding from a list of available encodings. + +##### encodings() + +Returns an array of preferred encodings ordered by the client preference. + +##### encodings(availableEncodings) + +Returns an array of preferred encodings ordered by priority from a list of +available encodings. + +## See Also + +The [accepts](https://npmjs.org/package/accepts#readme) module builds on +this module and provides an alternative interface, mime type validation, +and more. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/negotiator.svg +[npm-url]: https://npmjs.org/package/negotiator +[node-version-image]: https://img.shields.io/node/v/negotiator.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/negotiator/master.svg +[travis-url]: https://travis-ci.org/jshttp/negotiator +[coveralls-image]: https://img.shields.io/coveralls/jshttp/negotiator/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/negotiator?branch=master +[downloads-image]: https://img.shields.io/npm/dm/negotiator.svg +[downloads-url]: https://npmjs.org/package/negotiator diff --git a/8 node/node_modules/negotiator/index.js b/8 node/node_modules/negotiator/index.js new file mode 100644 index 000000000..8d4f6a226 --- /dev/null +++ b/8 node/node_modules/negotiator/index.js @@ -0,0 +1,124 @@ +/*! + * negotiator + * Copyright(c) 2012 Federico Romero + * Copyright(c) 2012-2014 Isaac Z. Schlueter + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Cached loaded submodules. + * @private + */ + +var modules = Object.create(null); + +/** + * Module exports. + * @public + */ + +module.exports = Negotiator; +module.exports.Negotiator = Negotiator; + +/** + * Create a Negotiator instance from a request. + * @param {object} request + * @public + */ + +function Negotiator(request) { + if (!(this instanceof Negotiator)) { + return new Negotiator(request); + } + + this.request = request; +} + +Negotiator.prototype.charset = function charset(available) { + var set = this.charsets(available); + return set && set[0]; +}; + +Negotiator.prototype.charsets = function charsets(available) { + var preferredCharsets = loadModule('charset').preferredCharsets; + return preferredCharsets(this.request.headers['accept-charset'], available); +}; + +Negotiator.prototype.encoding = function encoding(available) { + var set = this.encodings(available); + return set && set[0]; +}; + +Negotiator.prototype.encodings = function encodings(available) { + var preferredEncodings = loadModule('encoding').preferredEncodings; + return preferredEncodings(this.request.headers['accept-encoding'], available); +}; + +Negotiator.prototype.language = function language(available) { + var set = this.languages(available); + return set && set[0]; +}; + +Negotiator.prototype.languages = function languages(available) { + var preferredLanguages = loadModule('language').preferredLanguages; + return preferredLanguages(this.request.headers['accept-language'], available); +}; + +Negotiator.prototype.mediaType = function mediaType(available) { + var set = this.mediaTypes(available); + return set && set[0]; +}; + +Negotiator.prototype.mediaTypes = function mediaTypes(available) { + var preferredMediaTypes = loadModule('mediaType').preferredMediaTypes; + return preferredMediaTypes(this.request.headers.accept, available); +}; + +// Backwards compatibility +Negotiator.prototype.preferredCharset = Negotiator.prototype.charset; +Negotiator.prototype.preferredCharsets = Negotiator.prototype.charsets; +Negotiator.prototype.preferredEncoding = Negotiator.prototype.encoding; +Negotiator.prototype.preferredEncodings = Negotiator.prototype.encodings; +Negotiator.prototype.preferredLanguage = Negotiator.prototype.language; +Negotiator.prototype.preferredLanguages = Negotiator.prototype.languages; +Negotiator.prototype.preferredMediaType = Negotiator.prototype.mediaType; +Negotiator.prototype.preferredMediaTypes = Negotiator.prototype.mediaTypes; + +/** + * Load the given module. + * @private + */ + +function loadModule(moduleName) { + var module = modules[moduleName]; + + if (module !== undefined) { + return module; + } + + // This uses a switch for static require analysis + switch (moduleName) { + case 'charset': + module = require('./lib/charset'); + break; + case 'encoding': + module = require('./lib/encoding'); + break; + case 'language': + module = require('./lib/language'); + break; + case 'mediaType': + module = require('./lib/mediaType'); + break; + default: + throw new Error('Cannot find module \'' + moduleName + '\''); + } + + // Store to prevent invoking require() + modules[moduleName] = module; + + return module; +} diff --git a/8 node/node_modules/negotiator/lib/charset.js b/8 node/node_modules/negotiator/lib/charset.js new file mode 100644 index 000000000..ac4217b4c --- /dev/null +++ b/8 node/node_modules/negotiator/lib/charset.js @@ -0,0 +1,169 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredCharsets; +module.exports.preferredCharsets = preferredCharsets; + +/** + * Module variables. + * @private + */ + +var simpleCharsetRegExp = /^\s*([^\s;]+)\s*(?:;(.*))?$/; + +/** + * Parse the Accept-Charset header. + * @private + */ + +function parseAcceptCharset(accept) { + var accepts = accept.split(','); + + for (var i = 0, j = 0; i < accepts.length; i++) { + var charset = parseCharset(accepts[i].trim(), i); + + if (charset) { + accepts[j++] = charset; + } + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse a charset from the Accept-Charset header. + * @private + */ + +function parseCharset(str, i) { + var match = simpleCharsetRegExp.exec(str); + if (!match) return null; + + var charset = match[1]; + var q = 1; + if (match[2]) { + var params = match[2].split(';') + for (var i = 0; i < params.length; i ++) { + var p = params[i].trim().split('='); + if (p[0] === 'q') { + q = parseFloat(p[1]); + break; + } + } + } + + return { + charset: charset, + q: q, + i: i + }; +} + +/** + * Get the priority of a charset. + * @private + */ + +function getCharsetPriority(charset, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(charset, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the charset. + * @private + */ + +function specify(charset, spec, index) { + var s = 0; + if(spec.charset.toLowerCase() === charset.toLowerCase()){ + s |= 1; + } else if (spec.charset !== '*' ) { + return null + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s + } +} + +/** + * Get the preferred charsets from an Accept-Charset header. + * @public + */ + +function preferredCharsets(accept, provided) { + // RFC 2616 sec 14.2: no header = * + var accepts = parseAcceptCharset(accept === undefined ? '*' : accept || ''); + + if (!provided) { + // sorted list of all charsets + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullCharset); + } + + var priorities = provided.map(function getPriority(type, index) { + return getCharsetPriority(type, accepts, index); + }); + + // sorted list of accepted charsets + return priorities.filter(isQuality).sort(compareSpecs).map(function getCharset(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full charset string. + * @private + */ + +function getFullCharset(spec) { + return spec.charset; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} diff --git a/8 node/node_modules/negotiator/lib/encoding.js b/8 node/node_modules/negotiator/lib/encoding.js new file mode 100644 index 000000000..70ac3de67 --- /dev/null +++ b/8 node/node_modules/negotiator/lib/encoding.js @@ -0,0 +1,184 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredEncodings; +module.exports.preferredEncodings = preferredEncodings; + +/** + * Module variables. + * @private + */ + +var simpleEncodingRegExp = /^\s*([^\s;]+)\s*(?:;(.*))?$/; + +/** + * Parse the Accept-Encoding header. + * @private + */ + +function parseAcceptEncoding(accept) { + var accepts = accept.split(','); + var hasIdentity = false; + var minQuality = 1; + + for (var i = 0, j = 0; i < accepts.length; i++) { + var encoding = parseEncoding(accepts[i].trim(), i); + + if (encoding) { + accepts[j++] = encoding; + hasIdentity = hasIdentity || specify('identity', encoding); + minQuality = Math.min(minQuality, encoding.q || 1); + } + } + + if (!hasIdentity) { + /* + * If identity doesn't explicitly appear in the accept-encoding header, + * it's added to the list of acceptable encoding with the lowest q + */ + accepts[j++] = { + encoding: 'identity', + q: minQuality, + i: i + }; + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse an encoding from the Accept-Encoding header. + * @private + */ + +function parseEncoding(str, i) { + var match = simpleEncodingRegExp.exec(str); + if (!match) return null; + + var encoding = match[1]; + var q = 1; + if (match[2]) { + var params = match[2].split(';'); + for (var i = 0; i < params.length; i ++) { + var p = params[i].trim().split('='); + if (p[0] === 'q') { + q = parseFloat(p[1]); + break; + } + } + } + + return { + encoding: encoding, + q: q, + i: i + }; +} + +/** + * Get the priority of an encoding. + * @private + */ + +function getEncodingPriority(encoding, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(encoding, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the encoding. + * @private + */ + +function specify(encoding, spec, index) { + var s = 0; + if(spec.encoding.toLowerCase() === encoding.toLowerCase()){ + s |= 1; + } else if (spec.encoding !== '*' ) { + return null + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s + } +}; + +/** + * Get the preferred encodings from an Accept-Encoding header. + * @public + */ + +function preferredEncodings(accept, provided) { + var accepts = parseAcceptEncoding(accept || ''); + + if (!provided) { + // sorted list of all encodings + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullEncoding); + } + + var priorities = provided.map(function getPriority(type, index) { + return getEncodingPriority(type, accepts, index); + }); + + // sorted list of accepted encodings + return priorities.filter(isQuality).sort(compareSpecs).map(function getEncoding(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full encoding string. + * @private + */ + +function getFullEncoding(spec) { + return spec.encoding; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} diff --git a/8 node/node_modules/negotiator/lib/language.js b/8 node/node_modules/negotiator/lib/language.js new file mode 100644 index 000000000..1bd2d0e1d --- /dev/null +++ b/8 node/node_modules/negotiator/lib/language.js @@ -0,0 +1,179 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredLanguages; +module.exports.preferredLanguages = preferredLanguages; + +/** + * Module variables. + * @private + */ + +var simpleLanguageRegExp = /^\s*([^\s\-;]+)(?:-([^\s;]+))?\s*(?:;(.*))?$/; + +/** + * Parse the Accept-Language header. + * @private + */ + +function parseAcceptLanguage(accept) { + var accepts = accept.split(','); + + for (var i = 0, j = 0; i < accepts.length; i++) { + var langauge = parseLanguage(accepts[i].trim(), i); + + if (langauge) { + accepts[j++] = langauge; + } + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse a language from the Accept-Language header. + * @private + */ + +function parseLanguage(str, i) { + var match = simpleLanguageRegExp.exec(str); + if (!match) return null; + + var prefix = match[1], + suffix = match[2], + full = prefix; + + if (suffix) full += "-" + suffix; + + var q = 1; + if (match[3]) { + var params = match[3].split(';') + for (var i = 0; i < params.length; i ++) { + var p = params[i].split('='); + if (p[0] === 'q') q = parseFloat(p[1]); + } + } + + return { + prefix: prefix, + suffix: suffix, + q: q, + i: i, + full: full + }; +} + +/** + * Get the priority of a language. + * @private + */ + +function getLanguagePriority(language, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(language, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the language. + * @private + */ + +function specify(language, spec, index) { + var p = parseLanguage(language) + if (!p) return null; + var s = 0; + if(spec.full.toLowerCase() === p.full.toLowerCase()){ + s |= 4; + } else if (spec.prefix.toLowerCase() === p.full.toLowerCase()) { + s |= 2; + } else if (spec.full.toLowerCase() === p.prefix.toLowerCase()) { + s |= 1; + } else if (spec.full !== '*' ) { + return null + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s + } +}; + +/** + * Get the preferred languages from an Accept-Language header. + * @public + */ + +function preferredLanguages(accept, provided) { + // RFC 2616 sec 14.4: no header = * + var accepts = parseAcceptLanguage(accept === undefined ? '*' : accept || ''); + + if (!provided) { + // sorted list of all languages + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullLanguage); + } + + var priorities = provided.map(function getPriority(type, index) { + return getLanguagePriority(type, accepts, index); + }); + + // sorted list of accepted languages + return priorities.filter(isQuality).sort(compareSpecs).map(function getLanguage(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full language string. + * @private + */ + +function getFullLanguage(spec) { + return spec.full; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} diff --git a/8 node/node_modules/negotiator/lib/mediaType.js b/8 node/node_modules/negotiator/lib/mediaType.js new file mode 100644 index 000000000..67309dd75 --- /dev/null +++ b/8 node/node_modules/negotiator/lib/mediaType.js @@ -0,0 +1,294 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredMediaTypes; +module.exports.preferredMediaTypes = preferredMediaTypes; + +/** + * Module variables. + * @private + */ + +var simpleMediaTypeRegExp = /^\s*([^\s\/;]+)\/([^;\s]+)\s*(?:;(.*))?$/; + +/** + * Parse the Accept header. + * @private + */ + +function parseAccept(accept) { + var accepts = splitMediaTypes(accept); + + for (var i = 0, j = 0; i < accepts.length; i++) { + var mediaType = parseMediaType(accepts[i].trim(), i); + + if (mediaType) { + accepts[j++] = mediaType; + } + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse a media type from the Accept header. + * @private + */ + +function parseMediaType(str, i) { + var match = simpleMediaTypeRegExp.exec(str); + if (!match) return null; + + var params = Object.create(null); + var q = 1; + var subtype = match[2]; + var type = match[1]; + + if (match[3]) { + var kvps = splitParameters(match[3]).map(splitKeyValuePair); + + for (var j = 0; j < kvps.length; j++) { + var pair = kvps[j]; + var key = pair[0].toLowerCase(); + var val = pair[1]; + + // get the value, unwrapping quotes + var value = val && val[0] === '"' && val[val.length - 1] === '"' + ? val.substr(1, val.length - 2) + : val; + + if (key === 'q') { + q = parseFloat(value); + break; + } + + // store parameter + params[key] = value; + } + } + + return { + type: type, + subtype: subtype, + params: params, + q: q, + i: i + }; +} + +/** + * Get the priority of a media type. + * @private + */ + +function getMediaTypePriority(type, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(type, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the media type. + * @private + */ + +function specify(type, spec, index) { + var p = parseMediaType(type); + var s = 0; + + if (!p) { + return null; + } + + if(spec.type.toLowerCase() == p.type.toLowerCase()) { + s |= 4 + } else if(spec.type != '*') { + return null; + } + + if(spec.subtype.toLowerCase() == p.subtype.toLowerCase()) { + s |= 2 + } else if(spec.subtype != '*') { + return null; + } + + var keys = Object.keys(spec.params); + if (keys.length > 0) { + if (keys.every(function (k) { + return spec.params[k] == '*' || (spec.params[k] || '').toLowerCase() == (p.params[k] || '').toLowerCase(); + })) { + s |= 1 + } else { + return null + } + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s, + } +} + +/** + * Get the preferred media types from an Accept header. + * @public + */ + +function preferredMediaTypes(accept, provided) { + // RFC 2616 sec 14.2: no header = */* + var accepts = parseAccept(accept === undefined ? '*/*' : accept || ''); + + if (!provided) { + // sorted list of all types + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullType); + } + + var priorities = provided.map(function getPriority(type, index) { + return getMediaTypePriority(type, accepts, index); + }); + + // sorted list of accepted types + return priorities.filter(isQuality).sort(compareSpecs).map(function getType(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full type string. + * @private + */ + +function getFullType(spec) { + return spec.type + '/' + spec.subtype; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} + +/** + * Count the number of quotes in a string. + * @private + */ + +function quoteCount(string) { + var count = 0; + var index = 0; + + while ((index = string.indexOf('"', index)) !== -1) { + count++; + index++; + } + + return count; +} + +/** + * Split a key value pair. + * @private + */ + +function splitKeyValuePair(str) { + var index = str.indexOf('='); + var key; + var val; + + if (index === -1) { + key = str; + } else { + key = str.substr(0, index); + val = str.substr(index + 1); + } + + return [key, val]; +} + +/** + * Split an Accept header into media types. + * @private + */ + +function splitMediaTypes(accept) { + var accepts = accept.split(','); + + for (var i = 1, j = 0; i < accepts.length; i++) { + if (quoteCount(accepts[j]) % 2 == 0) { + accepts[++j] = accepts[i]; + } else { + accepts[j] += ',' + accepts[i]; + } + } + + // trim accepts + accepts.length = j + 1; + + return accepts; +} + +/** + * Split a string of parameters. + * @private + */ + +function splitParameters(str) { + var parameters = str.split(';'); + + for (var i = 1, j = 0; i < parameters.length; i++) { + if (quoteCount(parameters[j]) % 2 == 0) { + parameters[++j] = parameters[i]; + } else { + parameters[j] += ';' + parameters[i]; + } + } + + // trim parameters + parameters.length = j + 1; + + for (var i = 0; i < parameters.length; i++) { + parameters[i] = parameters[i].trim(); + } + + return parameters; +} diff --git a/8 node/node_modules/negotiator/package.json b/8 node/node_modules/negotiator/package.json new file mode 100644 index 000000000..ace6dc3d6 --- /dev/null +++ b/8 node/node_modules/negotiator/package.json @@ -0,0 +1,81 @@ +{ + "_from": "negotiator@0.6.1", + "_id": "negotiator@0.6.1", + "_inBundle": false, + "_integrity": "sha1-KzJxhOiZIQEXeyhWP7XnECrNDKk=", + "_location": "/negotiator", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "negotiator@0.6.1", + "name": "negotiator", + "escapedName": "negotiator", + "rawSpec": "0.6.1", + "saveSpec": null, + "fetchSpec": "0.6.1" + }, + "_requiredBy": [ + "/accepts" + ], + "_resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.1.tgz", + "_shasum": "2b327184e8992101177b28563fb5e7102acd0ca9", + "_spec": "negotiator@0.6.1", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/accepts", + "bugs": { + "url": "https://github.com/jshttp/negotiator/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Federico Romero", + "email": "federico.romero@outboxlabs.com" + }, + { + "name": "Isaac Z. Schlueter", + "email": "i@izs.me", + "url": "http://blog.izs.me/" + } + ], + "deprecated": false, + "description": "HTTP content negotiation", + "devDependencies": { + "istanbul": "0.4.3", + "mocha": "~1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "lib/", + "HISTORY.md", + "LICENSE", + "index.js", + "README.md" + ], + "homepage": "https://github.com/jshttp/negotiator#readme", + "keywords": [ + "http", + "content negotiation", + "accept", + "accept-language", + "accept-encoding", + "accept-charset" + ], + "license": "MIT", + "name": "negotiator", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/negotiator.git" + }, + "scripts": { + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.6.1" +} diff --git a/8 node/node_modules/on-finished/HISTORY.md b/8 node/node_modules/on-finished/HISTORY.md new file mode 100644 index 000000000..98ff0e992 --- /dev/null +++ b/8 node/node_modules/on-finished/HISTORY.md @@ -0,0 +1,88 @@ +2.3.0 / 2015-05-26 +================== + + * Add defined behavior for HTTP `CONNECT` requests + * Add defined behavior for HTTP `Upgrade` requests + * deps: ee-first@1.1.1 + +2.2.1 / 2015-04-22 +================== + + * Fix `isFinished(req)` when data buffered + +2.2.0 / 2014-12-22 +================== + + * Add message object to callback arguments + +2.1.1 / 2014-10-22 +================== + + * Fix handling of pipelined requests + +2.1.0 / 2014-08-16 +================== + + * Check if `socket` is detached + * Return `undefined` for `isFinished` if state unknown + +2.0.0 / 2014-08-16 +================== + + * Add `isFinished` function + * Move to `jshttp` organization + * Remove support for plain socket argument + * Rename to `on-finished` + * Support both `req` and `res` as arguments + * deps: ee-first@1.0.5 + +1.2.2 / 2014-06-10 +================== + + * Reduce listeners added to emitters + - avoids "event emitter leak" warnings when used multiple times on same request + +1.2.1 / 2014-06-08 +================== + + * Fix returned value when already finished + +1.2.0 / 2014-06-05 +================== + + * Call callback when called on already-finished socket + +1.1.4 / 2014-05-27 +================== + + * Support node.js 0.8 + +1.1.3 / 2014-04-30 +================== + + * Make sure errors passed as instanceof `Error` + +1.1.2 / 2014-04-18 +================== + + * Default the `socket` to passed-in object + +1.1.1 / 2014-01-16 +================== + + * Rename module to `finished` + +1.1.0 / 2013-12-25 +================== + + * Call callback when called on already-errored socket + +1.0.1 / 2013-12-20 +================== + + * Actually pass the error to the callback + +1.0.0 / 2013-12-20 +================== + + * Initial release diff --git a/8 node/node_modules/on-finished/LICENSE b/8 node/node_modules/on-finished/LICENSE new file mode 100644 index 000000000..5931fd23e --- /dev/null +++ b/8 node/node_modules/on-finished/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2013 Jonathan Ong +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/on-finished/README.md b/8 node/node_modules/on-finished/README.md new file mode 100644 index 000000000..a0e115744 --- /dev/null +++ b/8 node/node_modules/on-finished/README.md @@ -0,0 +1,154 @@ +# on-finished + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Execute a callback when a HTTP request closes, finishes, or errors. + +## Install + +```sh +$ npm install on-finished +``` + +## API + +```js +var onFinished = require('on-finished') +``` + +### onFinished(res, listener) + +Attach a listener to listen for the response to finish. The listener will +be invoked only once when the response finished. If the response finished +to an error, the first argument will contain the error. If the response +has already finished, the listener will be invoked. + +Listening to the end of a response would be used to close things associated +with the response, like open files. + +Listener is invoked as `listener(err, res)`. + +```js +onFinished(res, function (err, res) { + // clean up open fds, etc. + // err contains the error is request error'd +}) +``` + +### onFinished(req, listener) + +Attach a listener to listen for the request to finish. The listener will +be invoked only once when the request finished. If the request finished +to an error, the first argument will contain the error. If the request +has already finished, the listener will be invoked. + +Listening to the end of a request would be used to know when to continue +after reading the data. + +Listener is invoked as `listener(err, req)`. + +```js +var data = '' + +req.setEncoding('utf8') +res.on('data', function (str) { + data += str +}) + +onFinished(req, function (err, req) { + // data is read unless there is err +}) +``` + +### onFinished.isFinished(res) + +Determine if `res` is already finished. This would be useful to check and +not even start certain operations if the response has already finished. + +### onFinished.isFinished(req) + +Determine if `req` is already finished. This would be useful to check and +not even start certain operations if the request has already finished. + +## Special Node.js requests + +### HTTP CONNECT method + +The meaning of the `CONNECT` method from RFC 7231, section 4.3.6: + +> The CONNECT method requests that the recipient establish a tunnel to +> the destination origin server identified by the request-target and, +> if successful, thereafter restrict its behavior to blind forwarding +> of packets, in both directions, until the tunnel is closed. Tunnels +> are commonly used to create an end-to-end virtual connection, through +> one or more proxies, which can then be secured using TLS (Transport +> Layer Security, [RFC5246]). + +In Node.js, these request objects come from the `'connect'` event on +the HTTP server. + +When this module is used on a HTTP `CONNECT` request, the request is +considered "finished" immediately, **due to limitations in the Node.js +interface**. This means if the `CONNECT` request contains a request entity, +the request will be considered "finished" even before it has been read. + +There is no such thing as a response object to a `CONNECT` request in +Node.js, so there is no support for for one. + +### HTTP Upgrade request + +The meaning of the `Upgrade` header from RFC 7230, section 6.1: + +> The "Upgrade" header field is intended to provide a simple mechanism +> for transitioning from HTTP/1.1 to some other protocol on the same +> connection. + +In Node.js, these request objects come from the `'upgrade'` event on +the HTTP server. + +When this module is used on a HTTP request with an `Upgrade` header, the +request is considered "finished" immediately, **due to limitations in the +Node.js interface**. This means if the `Upgrade` request contains a request +entity, the request will be considered "finished" even before it has been +read. + +There is no such thing as a response object to a `Upgrade` request in +Node.js, so there is no support for for one. + +## Example + +The following code ensures that file descriptors are always closed +once the response finishes. + +```js +var destroy = require('destroy') +var http = require('http') +var onFinished = require('on-finished') + +http.createServer(function onRequest(req, res) { + var stream = fs.createReadStream('package.json') + stream.pipe(res) + onFinished(res, function (err) { + destroy(stream) + }) +}) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/on-finished.svg +[npm-url]: https://npmjs.org/package/on-finished +[node-version-image]: https://img.shields.io/node/v/on-finished.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/on-finished/master.svg +[travis-url]: https://travis-ci.org/jshttp/on-finished +[coveralls-image]: https://img.shields.io/coveralls/jshttp/on-finished/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/on-finished?branch=master +[downloads-image]: https://img.shields.io/npm/dm/on-finished.svg +[downloads-url]: https://npmjs.org/package/on-finished diff --git a/8 node/node_modules/on-finished/index.js b/8 node/node_modules/on-finished/index.js new file mode 100644 index 000000000..9abd98f9d --- /dev/null +++ b/8 node/node_modules/on-finished/index.js @@ -0,0 +1,196 @@ +/*! + * on-finished + * Copyright(c) 2013 Jonathan Ong + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = onFinished +module.exports.isFinished = isFinished + +/** + * Module dependencies. + * @private + */ + +var first = require('ee-first') + +/** + * Variables. + * @private + */ + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) } + +/** + * Invoke callback when the response has finished, useful for + * cleaning up resources afterwards. + * + * @param {object} msg + * @param {function} listener + * @return {object} + * @public + */ + +function onFinished(msg, listener) { + if (isFinished(msg) !== false) { + defer(listener, null, msg) + return msg + } + + // attach the listener to the message + attachListener(msg, listener) + + return msg +} + +/** + * Determine if message is already finished. + * + * @param {object} msg + * @return {boolean} + * @public + */ + +function isFinished(msg) { + var socket = msg.socket + + if (typeof msg.finished === 'boolean') { + // OutgoingMessage + return Boolean(msg.finished || (socket && !socket.writable)) + } + + if (typeof msg.complete === 'boolean') { + // IncomingMessage + return Boolean(msg.upgrade || !socket || !socket.readable || (msg.complete && !msg.readable)) + } + + // don't know + return undefined +} + +/** + * Attach a finished listener to the message. + * + * @param {object} msg + * @param {function} callback + * @private + */ + +function attachFinishedListener(msg, callback) { + var eeMsg + var eeSocket + var finished = false + + function onFinish(error) { + eeMsg.cancel() + eeSocket.cancel() + + finished = true + callback(error) + } + + // finished on first message event + eeMsg = eeSocket = first([[msg, 'end', 'finish']], onFinish) + + function onSocket(socket) { + // remove listener + msg.removeListener('socket', onSocket) + + if (finished) return + if (eeMsg !== eeSocket) return + + // finished on first socket event + eeSocket = first([[socket, 'error', 'close']], onFinish) + } + + if (msg.socket) { + // socket already assigned + onSocket(msg.socket) + return + } + + // wait for socket to be assigned + msg.on('socket', onSocket) + + if (msg.socket === undefined) { + // node.js 0.8 patch + patchAssignSocket(msg, onSocket) + } +} + +/** + * Attach the listener to the message. + * + * @param {object} msg + * @return {function} + * @private + */ + +function attachListener(msg, listener) { + var attached = msg.__onFinished + + // create a private single listener with queue + if (!attached || !attached.queue) { + attached = msg.__onFinished = createListener(msg) + attachFinishedListener(msg, attached) + } + + attached.queue.push(listener) +} + +/** + * Create listener on message. + * + * @param {object} msg + * @return {function} + * @private + */ + +function createListener(msg) { + function listener(err) { + if (msg.__onFinished === listener) msg.__onFinished = null + if (!listener.queue) return + + var queue = listener.queue + listener.queue = null + + for (var i = 0; i < queue.length; i++) { + queue[i](err, msg) + } + } + + listener.queue = [] + + return listener +} + +/** + * Patch ServerResponse.prototype.assignSocket for node.js 0.8. + * + * @param {ServerResponse} res + * @param {function} callback + * @private + */ + +function patchAssignSocket(res, callback) { + var assignSocket = res.assignSocket + + if (typeof assignSocket !== 'function') return + + // res.on('socket', callback) is broken in 0.8 + res.assignSocket = function _assignSocket(socket) { + assignSocket.call(this, socket) + callback(socket) + } +} diff --git a/8 node/node_modules/on-finished/package.json b/8 node/node_modules/on-finished/package.json new file mode 100644 index 000000000..eb916d4b0 --- /dev/null +++ b/8 node/node_modules/on-finished/package.json @@ -0,0 +1,72 @@ +{ + "_from": "on-finished@~2.3.0", + "_id": "on-finished@2.3.0", + "_inBundle": false, + "_integrity": "sha1-IPEzZIGwg811M3mSoWlxqi2QaUc=", + "_location": "/on-finished", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "on-finished@~2.3.0", + "name": "on-finished", + "escapedName": "on-finished", + "rawSpec": "~2.3.0", + "saveSpec": null, + "fetchSpec": "~2.3.0" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/send" + ], + "_resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz", + "_shasum": "20f1336481b083cd75337992a16971aa2d906947", + "_spec": "on-finished@~2.3.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/on-finished/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "ee-first": "1.1.1" + }, + "deprecated": false, + "description": "Execute a callback when a request closes, finishes, or errors", + "devDependencies": { + "istanbul": "0.3.9", + "mocha": "2.2.5" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "homepage": "https://github.com/jshttp/on-finished#readme", + "license": "MIT", + "name": "on-finished", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/on-finished.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "2.3.0" +} diff --git a/8 node/node_modules/parseurl/HISTORY.md b/8 node/node_modules/parseurl/HISTORY.md new file mode 100644 index 000000000..395041ee6 --- /dev/null +++ b/8 node/node_modules/parseurl/HISTORY.md @@ -0,0 +1,47 @@ +1.3.1 / 2016-01-17 +================== + + * perf: enable strict mode + +1.3.0 / 2014-08-09 +================== + + * Add `parseurl.original` for parsing `req.originalUrl` with fallback + * Return `undefined` if `req.url` is `undefined` + +1.2.0 / 2014-07-21 +================== + + * Cache URLs based on original value + * Remove no-longer-needed URL mis-parse work-around + * Simplify the "fast-path" `RegExp` + +1.1.3 / 2014-07-08 +================== + + * Fix typo + +1.1.2 / 2014-07-08 +================== + + * Seriously fix Node.js 0.8 compatibility + +1.1.1 / 2014-07-08 +================== + + * Fix Node.js 0.8 compatibility + +1.1.0 / 2014-07-08 +================== + + * Incorporate URL href-only parse fast-path + +1.0.1 / 2014-03-08 +================== + + * Add missing `require` + +1.0.0 / 2014-03-08 +================== + + * Genesis from `connect` diff --git a/8 node/node_modules/parseurl/LICENSE b/8 node/node_modules/parseurl/LICENSE new file mode 100644 index 000000000..ec7dfe7be --- /dev/null +++ b/8 node/node_modules/parseurl/LICENSE @@ -0,0 +1,24 @@ + +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/parseurl/README.md b/8 node/node_modules/parseurl/README.md new file mode 100644 index 000000000..f4796ebbc --- /dev/null +++ b/8 node/node_modules/parseurl/README.md @@ -0,0 +1,120 @@ +# parseurl + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Parse a URL with memoization. + +## Install + +```bash +$ npm install parseurl +``` + +## API + +```js +var parseurl = require('parseurl') +``` + +### parseurl(req) + +Parse the URL of the given request object (looks at the `req.url` property) +and return the result. The result is the same as `url.parse` in Node.js core. +Calling this function multiple times on the same `req` where `req.url` does +not change will return a cached parsed object, rather than parsing again. + +### parseurl.original(req) + +Parse the original URL of the given request object and return the result. +This works by trying to parse `req.originalUrl` if it is a string, otherwise +parses `req.url`. The result is the same as `url.parse` in Node.js core. +Calling this function multiple times on the same `req` where `req.originalUrl` +does not change will return a cached parsed object, rather than parsing again. + +## Benchmark + +```bash +$ npm run-script bench + +> parseurl@1.3.1 bench nodejs-parseurl +> node benchmark/index.js + +> node benchmark/fullurl.js + + Parsing URL "http://localhost:8888/foo/bar?user=tj&pet=fluffy" + + 1 test completed. + 2 tests completed. + 3 tests completed. + + fasturl x 1,290,780 ops/sec ±0.46% (195 runs sampled) + nativeurl x 56,401 ops/sec ±0.22% (196 runs sampled) + parseurl x 55,231 ops/sec ±0.22% (194 runs sampled) + +> node benchmark/pathquery.js + + Parsing URL "/foo/bar?user=tj&pet=fluffy" + + 1 test completed. + 2 tests completed. + 3 tests completed. + + fasturl x 1,986,668 ops/sec ±0.27% (190 runs sampled) + nativeurl x 98,740 ops/sec ±0.21% (195 runs sampled) + parseurl x 2,628,171 ops/sec ±0.36% (195 runs sampled) + +> node benchmark/samerequest.js + + Parsing URL "/foo/bar?user=tj&pet=fluffy" on same request object + + 1 test completed. + 2 tests completed. + 3 tests completed. + + fasturl x 2,184,468 ops/sec ±0.40% (194 runs sampled) + nativeurl x 99,437 ops/sec ±0.71% (194 runs sampled) + parseurl x 10,498,005 ops/sec ±0.61% (186 runs sampled) + +> node benchmark/simplepath.js + + Parsing URL "/foo/bar" + + 1 test completed. + 2 tests completed. + 3 tests completed. + + fasturl x 4,535,825 ops/sec ±0.27% (191 runs sampled) + nativeurl x 98,769 ops/sec ±0.54% (191 runs sampled) + parseurl x 4,164,865 ops/sec ±0.34% (192 runs sampled) + +> node benchmark/slash.js + + Parsing URL "/" + + 1 test completed. + 2 tests completed. + 3 tests completed. + + fasturl x 4,908,405 ops/sec ±0.42% (191 runs sampled) + nativeurl x 100,945 ops/sec ±0.59% (188 runs sampled) + parseurl x 4,333,208 ops/sec ±0.27% (194 runs sampled) +``` + +## License + + [MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/parseurl.svg +[npm-url]: https://npmjs.org/package/parseurl +[node-version-image]: https://img.shields.io/node/v/parseurl.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/pillarjs/parseurl/master.svg +[travis-url]: https://travis-ci.org/pillarjs/parseurl +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/parseurl/master.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/parseurl?branch=master +[downloads-image]: https://img.shields.io/npm/dm/parseurl.svg +[downloads-url]: https://npmjs.org/package/parseurl diff --git a/8 node/node_modules/parseurl/index.js b/8 node/node_modules/parseurl/index.js new file mode 100644 index 000000000..56cc6ec7e --- /dev/null +++ b/8 node/node_modules/parseurl/index.js @@ -0,0 +1,138 @@ +/*! + * parseurl + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var url = require('url') +var parse = url.parse +var Url = url.Url + +/** + * Pattern for a simple path case. + * See: https://github.com/joyent/node/pull/7878 + */ + +var simplePathRegExp = /^(\/\/?(?!\/)[^\?#\s]*)(\?[^#\s]*)?$/ + +/** + * Exports. + */ + +module.exports = parseurl +module.exports.original = originalurl + +/** + * Parse the `req` url with memoization. + * + * @param {ServerRequest} req + * @return {Object} + * @api public + */ + +function parseurl(req) { + var url = req.url + + if (url === undefined) { + // URL is undefined + return undefined + } + + var parsed = req._parsedUrl + + if (fresh(url, parsed)) { + // Return cached URL parse + return parsed + } + + // Parse the URL + parsed = fastparse(url) + parsed._raw = url + + return req._parsedUrl = parsed +}; + +/** + * Parse the `req` original url with fallback and memoization. + * + * @param {ServerRequest} req + * @return {Object} + * @api public + */ + +function originalurl(req) { + var url = req.originalUrl + + if (typeof url !== 'string') { + // Fallback + return parseurl(req) + } + + var parsed = req._parsedOriginalUrl + + if (fresh(url, parsed)) { + // Return cached URL parse + return parsed + } + + // Parse the URL + parsed = fastparse(url) + parsed._raw = url + + return req._parsedOriginalUrl = parsed +}; + +/** + * Parse the `str` url with fast-path short-cut. + * + * @param {string} str + * @return {Object} + * @api private + */ + +function fastparse(str) { + // Try fast path regexp + // See: https://github.com/joyent/node/pull/7878 + var simplePath = typeof str === 'string' && simplePathRegExp.exec(str) + + // Construct simple URL + if (simplePath) { + var pathname = simplePath[1] + var search = simplePath[2] || null + var url = Url !== undefined + ? new Url() + : {} + url.path = str + url.href = str + url.pathname = pathname + url.search = search + url.query = search && search.substr(1) + + return url + } + + return parse(str) +} + +/** + * Determine if parsed is still fresh for url. + * + * @param {string} url + * @param {object} parsedUrl + * @return {boolean} + * @api private + */ + +function fresh(url, parsedUrl) { + return typeof parsedUrl === 'object' + && parsedUrl !== null + && (Url === undefined || parsedUrl instanceof Url) + && parsedUrl._raw === url +} diff --git a/8 node/node_modules/parseurl/package.json b/8 node/node_modules/parseurl/package.json new file mode 100644 index 000000000..e09ae7aaa --- /dev/null +++ b/8 node/node_modules/parseurl/package.json @@ -0,0 +1,74 @@ +{ + "_from": "parseurl@~1.3.1", + "_id": "parseurl@1.3.1", + "_inBundle": false, + "_integrity": "sha1-yKuMkiO6NIiKpkopeyiFO+wY2lY=", + "_location": "/parseurl", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "parseurl@~1.3.1", + "name": "parseurl", + "escapedName": "parseurl", + "rawSpec": "~1.3.1", + "saveSpec": null, + "fetchSpec": "~1.3.1" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.1.tgz", + "_shasum": "c8ab8c9223ba34888aa64a297b28853bec18da56", + "_spec": "parseurl@~1.3.1", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/pillarjs/parseurl/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "parse a url with memoization", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.0.0", + "fast-url-parser": "1.1.3", + "istanbul": "0.4.2", + "mocha": "~1.21.5" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/pillarjs/parseurl#readme", + "license": "MIT", + "name": "parseurl", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/parseurl.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "test": "mocha --check-leaks --bail --reporter spec test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec test/" + }, + "version": "1.3.1" +} diff --git a/8 node/node_modules/path-to-regexp/History.md b/8 node/node_modules/path-to-regexp/History.md new file mode 100644 index 000000000..7f6587846 --- /dev/null +++ b/8 node/node_modules/path-to-regexp/History.md @@ -0,0 +1,36 @@ +0.1.7 / 2015-07-28 +================== + + * Fixed regression with escaped round brackets and matching groups. + +0.1.6 / 2015-06-19 +================== + + * Replace `index` feature by outputting all parameters, unnamed and named. + +0.1.5 / 2015-05-08 +================== + + * Add an index property for position in match result. + +0.1.4 / 2015-03-05 +================== + + * Add license information + +0.1.3 / 2014-07-06 +================== + + * Better array support + * Improved support for trailing slash in non-ending mode + +0.1.0 / 2014-03-06 +================== + + * add options.end + +0.0.2 / 2013-02-10 +================== + + * Update to match current express + * add .license property to component.json diff --git a/8 node/node_modules/path-to-regexp/LICENSE b/8 node/node_modules/path-to-regexp/LICENSE new file mode 100644 index 000000000..983fbe8ae --- /dev/null +++ b/8 node/node_modules/path-to-regexp/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/8 node/node_modules/path-to-regexp/Readme.md b/8 node/node_modules/path-to-regexp/Readme.md new file mode 100644 index 000000000..95452a6e9 --- /dev/null +++ b/8 node/node_modules/path-to-regexp/Readme.md @@ -0,0 +1,35 @@ +# Path-to-RegExp + +Turn an Express-style path string such as `/user/:name` into a regular expression. + +**Note:** This is a legacy branch. You should upgrade to `1.x`. + +## Usage + +```javascript +var pathToRegexp = require('path-to-regexp'); +``` + +### pathToRegexp(path, keys, options) + + - **path** A string in the express format, an array of such strings, or a regular expression + - **keys** An array to be populated with the keys present in the url. Once the function completes, this will be an array of strings. + - **options** + - **options.sensitive** Defaults to false, set this to true to make routes case sensitive + - **options.strict** Defaults to false, set this to true to make the trailing slash matter. + - **options.end** Defaults to true, set this to false to only match the prefix of the URL. + +```javascript +var keys = []; +var exp = pathToRegexp('/foo/:bar', keys); +//keys = ['bar'] +//exp = /^\/foo\/(?:([^\/]+?))\/?$/i +``` + +## Live Demo + +You can see a live demo of this library in use at [express-route-tester](http://forbeslindesay.github.com/express-route-tester/). + +## License + + MIT diff --git a/8 node/node_modules/path-to-regexp/index.js b/8 node/node_modules/path-to-regexp/index.js new file mode 100644 index 000000000..500d1dad0 --- /dev/null +++ b/8 node/node_modules/path-to-regexp/index.js @@ -0,0 +1,129 @@ +/** + * Expose `pathtoRegexp`. + */ + +module.exports = pathtoRegexp; + +/** + * Match matching groups in a regular expression. + */ +var MATCHING_GROUP_REGEXP = /\((?!\?)/g; + +/** + * Normalize the given path string, + * returning a regular expression. + * + * An empty array should be passed, + * which will contain the placeholder + * key names. For example "/user/:id" will + * then contain ["id"]. + * + * @param {String|RegExp|Array} path + * @param {Array} keys + * @param {Object} options + * @return {RegExp} + * @api private + */ + +function pathtoRegexp(path, keys, options) { + options = options || {}; + keys = keys || []; + var strict = options.strict; + var end = options.end !== false; + var flags = options.sensitive ? '' : 'i'; + var extraOffset = 0; + var keysOffset = keys.length; + var i = 0; + var name = 0; + var m; + + if (path instanceof RegExp) { + while (m = MATCHING_GROUP_REGEXP.exec(path.source)) { + keys.push({ + name: name++, + optional: false, + offset: m.index + }); + } + + return path; + } + + if (Array.isArray(path)) { + // Map array parts into regexps and return their source. We also pass + // the same keys and options instance into every generation to get + // consistent matching groups before we join the sources together. + path = path.map(function (value) { + return pathtoRegexp(value, keys, options).source; + }); + + return new RegExp('(?:' + path.join('|') + ')', flags); + } + + path = ('^' + path + (strict ? '' : path[path.length - 1] === '/' ? '?' : '/?')) + .replace(/\/\(/g, '/(?:') + .replace(/([\/\.])/g, '\\$1') + .replace(/(\\\/)?(\\\.)?:(\w+)(\(.*?\))?(\*)?(\?)?/g, function (match, slash, format, key, capture, star, optional, offset) { + slash = slash || ''; + format = format || ''; + capture = capture || '([^\\/' + format + ']+?)'; + optional = optional || ''; + + keys.push({ + name: key, + optional: !!optional, + offset: offset + extraOffset + }); + + var result = '' + + (optional ? '' : slash) + + '(?:' + + format + (optional ? slash : '') + capture + + (star ? '((?:[\\/' + format + '].+?)?)' : '') + + ')' + + optional; + + extraOffset += result.length - match.length; + + return result; + }) + .replace(/\*/g, function (star, index) { + var len = keys.length + + while (len-- > keysOffset && keys[len].offset > index) { + keys[len].offset += 3; // Replacement length minus asterisk length. + } + + return '(.*)'; + }); + + // This is a workaround for handling unnamed matching groups. + while (m = MATCHING_GROUP_REGEXP.exec(path)) { + var escapeCount = 0; + var index = m.index; + + while (path.charAt(--index) === '\\') { + escapeCount++; + } + + // It's possible to escape the bracket. + if (escapeCount % 2 === 1) { + continue; + } + + if (keysOffset + i === keys.length || keys[keysOffset + i].offset > m.index) { + keys.splice(keysOffset + i, 0, { + name: name++, // Unnamed matching groups must be consistently linear. + optional: false, + offset: m.index + }); + } + + i++; + } + + // If the path is non-ending, match until the end or a slash. + path += (end ? '$' : (path[path.length - 1] === '/' ? '' : '(?=\\/|$)')); + + return new RegExp(path, flags); +}; diff --git a/8 node/node_modules/path-to-regexp/package.json b/8 node/node_modules/path-to-regexp/package.json new file mode 100644 index 000000000..4b39f815d --- /dev/null +++ b/8 node/node_modules/path-to-regexp/package.json @@ -0,0 +1,59 @@ +{ + "_from": "path-to-regexp@0.1.7", + "_id": "path-to-regexp@0.1.7", + "_inBundle": false, + "_integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=", + "_location": "/path-to-regexp", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "path-to-regexp@0.1.7", + "name": "path-to-regexp", + "escapedName": "path-to-regexp", + "rawSpec": "0.1.7", + "saveSpec": null, + "fetchSpec": "0.1.7" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", + "_shasum": "df604178005f522f15eb4490e7247a1bfaa67f8c", + "_spec": "path-to-regexp@0.1.7", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "bugs": { + "url": "https://github.com/component/path-to-regexp/issues" + }, + "bundleDependencies": false, + "component": { + "scripts": { + "path-to-regexp": "index.js" + } + }, + "deprecated": false, + "description": "Express style path to RegExp utility", + "devDependencies": { + "istanbul": "^0.2.6", + "mocha": "^1.17.1" + }, + "files": [ + "index.js", + "LICENSE" + ], + "homepage": "https://github.com/component/path-to-regexp#readme", + "keywords": [ + "express", + "regexp" + ], + "license": "MIT", + "name": "path-to-regexp", + "repository": { + "type": "git", + "url": "git+https://github.com/component/path-to-regexp.git" + }, + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "version": "0.1.7" +} diff --git a/8 node/node_modules/proxy-addr/HISTORY.md b/8 node/node_modules/proxy-addr/HISTORY.md new file mode 100644 index 000000000..9a62abc9a --- /dev/null +++ b/8 node/node_modules/proxy-addr/HISTORY.md @@ -0,0 +1,109 @@ +1.1.4 / 2017-03-24 +================== + + * deps: ipaddr.js@1.3.0 + +1.1.3 / 2017-01-14 +================== + + * deps: ipaddr.js@1.2.0 + +1.1.2 / 2016-05-29 +================== + + * deps: ipaddr.js@1.1.1 + - Fix IPv6-mapped IPv4 validation edge cases + +1.1.1 / 2016-05-03 +================== + + * Fix regression matching mixed versions against multiple subnets + +1.1.0 / 2016-05-01 +================== + + * Fix accepting various invalid netmasks + - IPv4 netmasks must be contingous + - IPv6 addresses cannot be used as a netmask + * deps: ipaddr.js@1.1.0 + +1.0.10 / 2015-12-09 +=================== + + * deps: ipaddr.js@1.0.5 + - Fix regression in `isValid` with non-string arguments + +1.0.9 / 2015-12-01 +================== + + * deps: ipaddr.js@1.0.4 + - Fix accepting some invalid IPv6 addresses + - Reject CIDRs with negative or overlong masks + * perf: enable strict mode + +1.0.8 / 2015-05-10 +================== + + * deps: ipaddr.js@1.0.1 + +1.0.7 / 2015-03-16 +================== + + * deps: ipaddr.js@0.1.9 + - Fix OOM on certain inputs to `isValid` + +1.0.6 / 2015-02-01 +================== + + * deps: ipaddr.js@0.1.8 + +1.0.5 / 2015-01-08 +================== + + * deps: ipaddr.js@0.1.6 + +1.0.4 / 2014-11-23 +================== + + * deps: ipaddr.js@0.1.5 + - Fix edge cases with `isValid` + +1.0.3 / 2014-09-21 +================== + + * Use `forwarded` npm module + +1.0.2 / 2014-09-18 +================== + + * Fix a global leak when multiple subnets are trusted + * Support Node.js 0.6 + * deps: ipaddr.js@0.1.3 + +1.0.1 / 2014-06-03 +================== + + * Fix links in npm package + +1.0.0 / 2014-05-08 +================== + + * Add `trust` argument to determine proxy trust on + * Accepts custom function + * Accepts IPv4/IPv6 address(es) + * Accepts subnets + * Accepts pre-defined names + * Add optional `trust` argument to `proxyaddr.all` to + stop at first untrusted + * Add `proxyaddr.compile` to pre-compile `trust` function + to make subsequent calls faster + +0.0.1 / 2014-05-04 +================== + + * Fix bad npm publish + +0.0.0 / 2014-05-04 +================== + + * Initial release diff --git a/8 node/node_modules/proxy-addr/LICENSE b/8 node/node_modules/proxy-addr/LICENSE new file mode 100644 index 000000000..cab251c2b --- /dev/null +++ b/8 node/node_modules/proxy-addr/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/proxy-addr/README.md b/8 node/node_modules/proxy-addr/README.md new file mode 100644 index 000000000..6b1075aaf --- /dev/null +++ b/8 node/node_modules/proxy-addr/README.md @@ -0,0 +1,140 @@ +# proxy-addr + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Determine address of proxied request + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install proxy-addr +``` + +## API + +```js +var proxyaddr = require('proxy-addr') +``` + +### proxyaddr(req, trust) + +Return the address of the request, using the given `trust` parameter. + +The `trust` argument is a function that returns `true` if you trust +the address, `false` if you don't. The closest untrusted address is +returned. + +```js +proxyaddr(req, function(addr){ return addr === '127.0.0.1' }) +proxyaddr(req, function(addr, i){ return i < 1 }) +``` + +The `trust` arugment may also be a single IP address string or an +array of trusted addresses, as plain IP addresses, CIDR-formatted +strings, or IP/netmask strings. + +```js +proxyaddr(req, '127.0.0.1') +proxyaddr(req, ['127.0.0.0/8', '10.0.0.0/8']) +proxyaddr(req, ['127.0.0.0/255.0.0.0', '192.168.0.0/255.255.0.0']) +``` + +This module also supports IPv6. Your IPv6 addresses will be normalized +automatically (i.e. `fe80::00ed:1` equals `fe80:0:0:0:0:0:ed:1`). + +```js +proxyaddr(req, '::1') +proxyaddr(req, ['::1/128', 'fe80::/10']) +``` + +This module will automatically work with IPv4-mapped IPv6 addresses +as well to support node.js in IPv6-only mode. This means that you do +not have to specify both `::ffff:a00:1` and `10.0.0.1`. + +As a convenience, this module also takes certain pre-defined names +in addition to IP addresses, which expand into IP addresses: + +```js +proxyaddr(req, 'loopback') +proxyaddr(req, ['loopback', 'fc00:ac:1ab5:fff::1/64']) +``` + + * `loopback`: IPv4 and IPv6 loopback addresses (like `::1` and + `127.0.0.1`). + * `linklocal`: IPv4 and IPv6 link-local addresses (like + `fe80::1:1:1:1` and `169.254.0.1`). + * `uniquelocal`: IPv4 private addresses and IPv6 unique-local + addresses (like `fc00:ac:1ab5:fff::1` and `192.168.0.1`). + +When `trust` is specified as a function, it will be called for each +address to determine if it is a trusted address. The function is +given two arguments: `addr` and `i`, where `addr` is a string of +the address to check and `i` is a number that represents the distance +from the socket address. + +### proxyaddr.all(req, [trust]) + +Return all the addresses of the request, optionally stopping at the +first untrusted. This array is ordered from closest to furthest +(i.e. `arr[0] === req.connection.remoteAddress`). + +```js +proxyaddr.all(req) +``` + +The optional `trust` argument takes the same arguments as `trust` +does in `proxyaddr(req, trust)`. + +```js +proxyaddr.all(req, 'loopback') +``` + +### proxyaddr.compile(val) + +Compiles argument `val` into a `trust` function. This function takes +the same arguments as `trust` does in `proxyaddr(req, trust)` and +returns a function suitable for `proxyaddr(req, trust)`. + +```js +var trust = proxyaddr.compile('localhost') +var addr = proxyaddr(req, trust) +``` + +This function is meant to be optimized for use against every request. +It is recommend to compile a trust function up-front for the trusted +configuration and pass that to `proxyaddr(req, trust)` for each request. + +## Testing + +```sh +$ npm test +``` + +## Benchmarks + +```sh +$ npm run-script bench +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/proxy-addr.svg +[npm-url]: https://npmjs.org/package/proxy-addr +[node-version-image]: https://img.shields.io/node/v/proxy-addr.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/proxy-addr/master.svg +[travis-url]: https://travis-ci.org/jshttp/proxy-addr +[coveralls-image]: https://img.shields.io/coveralls/jshttp/proxy-addr/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/proxy-addr?branch=master +[downloads-image]: https://img.shields.io/npm/dm/proxy-addr.svg +[downloads-url]: https://npmjs.org/package/proxy-addr diff --git a/8 node/node_modules/proxy-addr/index.js b/8 node/node_modules/proxy-addr/index.js new file mode 100644 index 000000000..2dad636eb --- /dev/null +++ b/8 node/node_modules/proxy-addr/index.js @@ -0,0 +1,325 @@ +/*! + * proxy-addr + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = proxyaddr; +module.exports.all = alladdrs; +module.exports.compile = compile; + +/** + * Module dependencies. + * @private + */ + +var forwarded = require('forwarded'); +var ipaddr = require('ipaddr.js'); + +/** + * Variables. + * @private + */ + +var digitre = /^[0-9]+$/; +var isip = ipaddr.isValid; +var parseip = ipaddr.parse; + +/** + * Pre-defined IP ranges. + * @private + */ + +var ipranges = { + linklocal: ['169.254.0.0/16', 'fe80::/10'], + loopback: ['127.0.0.1/8', '::1/128'], + uniquelocal: ['10.0.0.0/8', '172.16.0.0/12', '192.168.0.0/16', 'fc00::/7'] +}; + +/** + * Get all addresses in the request, optionally stopping + * at the first untrusted. + * + * @param {Object} request + * @param {Function|Array|String} [trust] + * @public + */ + +function alladdrs(req, trust) { + // get addresses + var addrs = forwarded(req); + + if (!trust) { + // Return all addresses + return addrs; + } + + if (typeof trust !== 'function') { + trust = compile(trust); + } + + for (var i = 0; i < addrs.length - 1; i++) { + if (trust(addrs[i], i)) continue; + + addrs.length = i + 1; + } + + return addrs; +} + +/** + * Compile argument into trust function. + * + * @param {Array|String} val + * @private + */ + +function compile(val) { + if (!val) { + throw new TypeError('argument is required'); + } + + var trust = typeof val === 'string' + ? [val] + : val; + + if (!Array.isArray(trust)) { + throw new TypeError('unsupported trust argument'); + } + + for (var i = 0; i < trust.length; i++) { + val = trust[i]; + + if (!ipranges.hasOwnProperty(val)) { + continue; + } + + // Splice in pre-defined range + val = ipranges[val]; + trust.splice.apply(trust, [i, 1].concat(val)); + i += val.length - 1; + } + + return compileTrust(compileRangeSubnets(trust)); +} + +/** + * Compile `arr` elements into range subnets. + * + * @param {Array} arr + * @private + */ + +function compileRangeSubnets(arr) { + var rangeSubnets = new Array(arr.length); + + for (var i = 0; i < arr.length; i++) { + rangeSubnets[i] = parseipNotation(arr[i]); + } + + return rangeSubnets; +} + +/** + * Compile range subnet array into trust function. + * + * @param {Array} rangeSubnets + * @private + */ + +function compileTrust(rangeSubnets) { + // Return optimized function based on length + var len = rangeSubnets.length; + return len === 0 + ? trustNone + : len === 1 + ? trustSingle(rangeSubnets[0]) + : trustMulti(rangeSubnets); +} + +/** + * Parse IP notation string into range subnet. + * + * @param {String} note + * @private + */ + +function parseipNotation(note) { + var pos = note.lastIndexOf('/'); + var str = pos !== -1 + ? note.substring(0, pos) + : note; + + if (!isip(str)) { + throw new TypeError('invalid IP address: ' + str); + } + + var ip = parseip(str); + + if (pos === -1 && ip.kind() === 'ipv6' && ip.isIPv4MappedAddress()) { + // Store as IPv4 + ip = ip.toIPv4Address(); + } + + var max = ip.kind() === 'ipv6' + ? 128 + : 32; + + var range = pos !== -1 + ? note.substring(pos + 1, note.length) + : null; + + if (range === null) { + range = max; + } else if (digitre.test(range)) { + range = parseInt(range, 10); + } else if (ip.kind() === 'ipv4' && isip(range)) { + range = parseNetmask(range); + } else { + range = null; + } + + if (range <= 0 || range > max) { + throw new TypeError('invalid range on address: ' + note); + } + + return [ip, range]; +} + +/** + * Parse netmask string into CIDR range. + * + * @param {String} netmask + * @private + */ + +function parseNetmask(netmask) { + var ip = parseip(netmask); + var kind = ip.kind(); + + return kind === 'ipv4' + ? ip.prefixLengthFromSubnetMask() + : null; +} + +/** + * Determine address of proxied request. + * + * @param {Object} request + * @param {Function|Array|String} trust + * @public + */ + +function proxyaddr(req, trust) { + if (!req) { + throw new TypeError('req argument is required'); + } + + if (!trust) { + throw new TypeError('trust argument is required'); + } + + var addrs = alladdrs(req, trust); + var addr = addrs[addrs.length - 1]; + + return addr; +} + +/** + * Static trust function to trust nothing. + * + * @private + */ + +function trustNone() { + return false; +} + +/** + * Compile trust function for multiple subnets. + * + * @param {Array} subnets + * @private + */ + +function trustMulti(subnets) { + return function trust(addr) { + if (!isip(addr)) return false; + + var ip = parseip(addr); + var ipconv; + var kind = ip.kind(); + + for (var i = 0; i < subnets.length; i++) { + var subnet = subnets[i]; + var subnetip = subnet[0]; + var subnetkind = subnetip.kind(); + var subnetrange = subnet[1]; + var trusted = ip; + + if (kind !== subnetkind) { + if (subnetkind === 'ipv4' && !ip.isIPv4MappedAddress()) { + // Incompatible IP addresses + continue; + } + + if (!ipconv) { + // Convert IP to match subnet IP kind + ipconv = subnetkind === 'ipv4' + ? ip.toIPv4Address() + : ip.toIPv4MappedAddress(); + } + + trusted = ipconv; + } + + if (trusted.match(subnetip, subnetrange)) { + return true; + } + } + + return false; + }; +} + +/** + * Compile trust function for single subnet. + * + * @param {Object} subnet + * @private + */ + +function trustSingle(subnet) { + var subnetip = subnet[0]; + var subnetkind = subnetip.kind(); + var subnetisipv4 = subnetkind === 'ipv4'; + var subnetrange = subnet[1]; + + return function trust(addr) { + if (!isip(addr)) return false; + + var ip = parseip(addr); + var kind = ip.kind(); + + if (kind !== subnetkind) { + if (subnetisipv4 && !ip.isIPv4MappedAddress()) { + // Incompatible IP addresses + return false; + } + + // Convert IP to match subnet IP kind + ip = subnetisipv4 + ? ip.toIPv4Address() + : ip.toIPv4MappedAddress(); + } + + return ip.match(subnetip, subnetrange); + }; +} diff --git a/8 node/node_modules/proxy-addr/package.json b/8 node/node_modules/proxy-addr/package.json new file mode 100644 index 000000000..d98ab1b6b --- /dev/null +++ b/8 node/node_modules/proxy-addr/package.json @@ -0,0 +1,73 @@ +{ + "_from": "proxy-addr@~1.1.4", + "_id": "proxy-addr@1.1.4", + "_inBundle": false, + "_integrity": "sha1-J+VF9pYKRKYn2bREZ+NcG2tM4vM=", + "_location": "/proxy-addr", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "proxy-addr@~1.1.4", + "name": "proxy-addr", + "escapedName": "proxy-addr", + "rawSpec": "~1.1.4", + "saveSpec": null, + "fetchSpec": "~1.1.4" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-1.1.4.tgz", + "_shasum": "27e545f6960a44a627d9b44467e35c1b6b4ce2f3", + "_spec": "proxy-addr@~1.1.4", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/proxy-addr/issues" + }, + "bundleDependencies": false, + "dependencies": { + "forwarded": "~0.1.0", + "ipaddr.js": "1.3.0" + }, + "deprecated": false, + "description": "Determine address of proxied request", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.3", + "istanbul": "0.4.5", + "mocha": "~1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/proxy-addr#readme", + "keywords": [ + "ip", + "proxy", + "x-forwarded-for" + ], + "license": "MIT", + "name": "proxy-addr", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/proxy-addr.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.4" +} diff --git a/8 node/node_modules/qs/.eslintignore b/8 node/node_modules/qs/.eslintignore new file mode 100644 index 000000000..1521c8b76 --- /dev/null +++ b/8 node/node_modules/qs/.eslintignore @@ -0,0 +1 @@ +dist diff --git a/8 node/node_modules/qs/.eslintrc b/8 node/node_modules/qs/.eslintrc new file mode 100644 index 000000000..e2cade5ee --- /dev/null +++ b/8 node/node_modules/qs/.eslintrc @@ -0,0 +1,18 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "complexity": [2, 26], + "consistent-return": 1, + "id-length": [2, { "min": 1, "max": 25, "properties": "never" }], + "indent": [2, 4], + "max-params": [2, 12], + "max-statements": [2, 43], + "no-continue": 1, + "no-magic-numbers": 0, + "no-restricted-syntax": [2, "BreakStatement", "DebuggerStatement", "ForInStatement", "LabeledStatement", "WithStatement"], + "operator-linebreak": [2, "after"], + } +} diff --git a/8 node/node_modules/qs/.jscs.json b/8 node/node_modules/qs/.jscs.json new file mode 100644 index 000000000..3d099c4b1 --- /dev/null +++ b/8 node/node_modules/qs/.jscs.json @@ -0,0 +1,176 @@ +{ + "es3": true, + + "additionalRules": [], + + "requireSemicolons": true, + + "disallowMultipleSpaces": true, + + "disallowIdentifierNames": [], + + "requireCurlyBraces": { + "allExcept": [], + "keywords": ["if", "else", "for", "while", "do", "try", "catch"] + }, + + "requireSpaceAfterKeywords": ["if", "else", "for", "while", "do", "switch", "return", "try", "catch", "function"], + + "disallowSpaceAfterKeywords": [], + + "disallowSpaceBeforeComma": true, + "disallowSpaceAfterComma": false, + "disallowSpaceBeforeSemicolon": true, + + "disallowNodeTypes": [ + "DebuggerStatement", + "ForInStatement", + "LabeledStatement", + "SwitchCase", + "SwitchStatement", + "WithStatement" + ], + + "requireObjectKeysOnNewLine": { "allExcept": ["sameLine"] }, + + "requireSpacesInAnonymousFunctionExpression": { "beforeOpeningRoundBrace": true, "beforeOpeningCurlyBrace": true }, + "requireSpacesInNamedFunctionExpression": { "beforeOpeningCurlyBrace": true }, + "disallowSpacesInNamedFunctionExpression": { "beforeOpeningRoundBrace": true }, + "requireSpacesInFunctionDeclaration": { "beforeOpeningCurlyBrace": true }, + "disallowSpacesInFunctionDeclaration": { "beforeOpeningRoundBrace": true }, + + "requireSpaceBetweenArguments": true, + + "disallowSpacesInsideParentheses": true, + + "disallowSpacesInsideArrayBrackets": true, + + "disallowQuotedKeysInObjects": { "allExcept": ["reserved"] }, + + "disallowSpaceAfterObjectKeys": true, + + "requireCommaBeforeLineBreak": true, + + "disallowSpaceAfterPrefixUnaryOperators": ["++", "--", "+", "-", "~", "!"], + "requireSpaceAfterPrefixUnaryOperators": [], + + "disallowSpaceBeforePostfixUnaryOperators": ["++", "--"], + "requireSpaceBeforePostfixUnaryOperators": [], + + "disallowSpaceBeforeBinaryOperators": [], + "requireSpaceBeforeBinaryOperators": ["+", "-", "/", "*", "=", "==", "===", "!=", "!=="], + + "requireSpaceAfterBinaryOperators": ["+", "-", "/", "*", "=", "==", "===", "!=", "!=="], + "disallowSpaceAfterBinaryOperators": [], + + "disallowImplicitTypeConversion": ["binary", "string"], + + "disallowKeywords": ["with", "eval"], + + "requireKeywordsOnNewLine": [], + "disallowKeywordsOnNewLine": ["else"], + + "requireLineFeedAtFileEnd": true, + + "disallowTrailingWhitespace": true, + + "disallowTrailingComma": true, + + "excludeFiles": ["node_modules/**", "vendor/**"], + + "disallowMultipleLineStrings": true, + + "requireDotNotation": { "allExcept": ["keywords"] }, + + "requireParenthesesAroundIIFE": true, + + "validateLineBreaks": "LF", + + "validateQuoteMarks": { + "escape": true, + "mark": "'" + }, + + "disallowOperatorBeforeLineBreak": [], + + "requireSpaceBeforeKeywords": [ + "do", + "for", + "if", + "else", + "switch", + "case", + "try", + "catch", + "finally", + "while", + "with", + "return" + ], + + "validateAlignedFunctionParameters": { + "lineBreakAfterOpeningBraces": true, + "lineBreakBeforeClosingBraces": true + }, + + "requirePaddingNewLinesBeforeExport": true, + + "validateNewlineAfterArrayElements": { + "maximum": 1 + }, + + "requirePaddingNewLinesAfterUseStrict": true, + + "disallowArrowFunctions": true, + + "disallowMultiLineTernary": true, + + "validateOrderInObjectKeys": "asc-insensitive", + + "disallowIdenticalDestructuringNames": true, + + "disallowNestedTernaries": { "maxLevel": 1 }, + + "requireSpaceAfterComma": { "allExcept": ["trailing"] }, + "requireAlignedMultilineParams": false, + + "requireSpacesInGenerator": { + "afterStar": true + }, + + "disallowSpacesInGenerator": { + "beforeStar": true + }, + + "disallowVar": false, + + "requireArrayDestructuring": false, + + "requireEnhancedObjectLiterals": false, + + "requireObjectDestructuring": false, + + "requireEarlyReturn": false, + + "requireCapitalizedConstructorsNew": { + "allExcept": ["Function", "String", "Object", "Symbol", "Number", "Date", "RegExp", "Error", "Boolean", "Array"] + }, + + "requireImportAlphabetized": false, + + "requireSpaceBeforeObjectValues": true, + "requireSpaceBeforeDestructuredValues": true, + + "disallowSpacesInsideTemplateStringPlaceholders": true, + + "disallowArrayDestructuringReturn": false, + + "requireNewlineBeforeSingleStatementsInIf": false, + + "disallowUnusedVariables": true, + + "requireSpacesInsideImportedObjectBraces": true, + + "requireUseStrict": true +} + diff --git a/8 node/node_modules/qs/CHANGELOG.md b/8 node/node_modules/qs/CHANGELOG.md new file mode 100644 index 000000000..85e69b0a2 --- /dev/null +++ b/8 node/node_modules/qs/CHANGELOG.md @@ -0,0 +1,175 @@ +## **6.4.0** +- [New] `qs.stringify`: add `encodeValuesOnly` option +- [Fix] follow `allowPrototypes` option during merge (#201, #201) +- [Fix] support keys starting with brackets (#202, #200) +- [Fix] chmod a-x +- [Dev Deps] update `eslint` +- [Tests] up to `node` `v7.7`, `v6.10`,` v4.8`; disable osx builds since they block linux builds +- [eslint] reduce warnings + +## **6.3.1** +- [Fix] ensure that `allowPrototypes: false` does not ever shadow Object.prototype properties (thanks, @snyk!) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `browserify`, `iconv-lite`, `qs-iconv`, `tape` +- [Tests] on all node minors; improve test matrix +- [Docs] document stringify option `allowDots` (#195) +- [Docs] add empty object and array values example (#195) +- [Docs] Fix minor inconsistency/typo (#192) +- [Docs] document stringify option `sort` (#191) +- [Refactor] `stringify`: throw faster with an invalid encoder +- [Refactor] remove unnecessary escapes (#184) +- Remove contributing.md, since `qs` is no longer part of `hapi` (#183) + +## **6.3.0** +- [New] Add support for RFC 1738 (#174, #173) +- [New] `stringify`: Add `serializeDate` option to customize Date serialization (#159) +- [Fix] ensure `utils.merge` handles merging two arrays +- [Refactor] only constructors should be capitalized +- [Refactor] capitalized var names are for constructors only +- [Refactor] avoid using a sparse array +- [Robustness] `formats`: cache `String#replace` +- [Dev Deps] update `browserify`, `eslint`, `@ljharb/eslint-config`; add `safe-publish-latest` +- [Tests] up to `node` `v6.8`, `v4.6`; improve test matrix +- [Tests] flesh out arrayLimit/arrayFormat tests (#107) +- [Tests] skip Object.create tests when null objects are not available +- [Tests] Turn on eslint for test files (#175) + +## **6.2.2** +- [Fix] ensure that `allowPrototypes: false` does not ever shadow Object.prototype properties + +## **6.2.1** +- [Fix] ensure `key[]=x&key[]&key[]=y` results in 3, not 2, values +- [Refactor] Be explicit and use `Object.prototype.hasOwnProperty.call` +- [Tests] remove `parallelshell` since it does not reliably report failures +- [Tests] up to `node` `v6.3`, `v5.12` +- [Dev Deps] update `tape`, `eslint`, `@ljharb/eslint-config`, `qs-iconv` + +## [**6.2.0**](https://github.com/ljharb/qs/issues?milestone=36&state=closed) +- [New] pass Buffers to the encoder/decoder directly (#161) +- [New] add "encoder" and "decoder" options, for custom param encoding/decoding (#160) +- [Fix] fix compacting of nested sparse arrays (#150) + +## **6.1.1** +- [Fix] ensure that `allowPrototypes: false` does not ever shadow Object.prototype properties + +## [**6.1.0**](https://github.com/ljharb/qs/issues?milestone=35&state=closed) +- [New] allowDots option for `stringify` (#151) +- [Fix] "sort" option should work at a depth of 3 or more (#151) +- [Fix] Restore `dist` directory; will be removed in v7 (#148) + +## **6.0.3** +- [Fix] ensure that `allowPrototypes: false` does not ever shadow Object.prototype properties +- [Fix] Restore `dist` directory; will be removed in v7 (#148) + +## [**6.0.2**](https://github.com/ljharb/qs/issues?milestone=33&state=closed) +- Revert ES6 requirement and restore support for node down to v0.8. + +## [**6.0.1**](https://github.com/ljharb/qs/issues?milestone=32&state=closed) +- [**#127**](https://github.com/ljharb/qs/pull/127) Fix engines definition in package.json + +## [**6.0.0**](https://github.com/ljharb/qs/issues?milestone=31&state=closed) +- [**#124**](https://github.com/ljharb/qs/issues/124) Use ES6 and drop support for node < v4 + +## **5.2.1** +- [Fix] ensure `key[]=x&key[]&key[]=y` results in 3, not 2, values + +## [**5.2.0**](https://github.com/ljharb/qs/issues?milestone=30&state=closed) +- [**#64**](https://github.com/ljharb/qs/issues/64) Add option to sort object keys in the query string + +## [**5.1.0**](https://github.com/ljharb/qs/issues?milestone=29&state=closed) +- [**#117**](https://github.com/ljharb/qs/issues/117) make URI encoding stringified results optional +- [**#106**](https://github.com/ljharb/qs/issues/106) Add flag `skipNulls` to optionally skip null values in stringify + +## [**5.0.0**](https://github.com/ljharb/qs/issues?milestone=28&state=closed) +- [**#114**](https://github.com/ljharb/qs/issues/114) default allowDots to false +- [**#100**](https://github.com/ljharb/qs/issues/100) include dist to npm + +## [**4.0.0**](https://github.com/ljharb/qs/issues?milestone=26&state=closed) +- [**#98**](https://github.com/ljharb/qs/issues/98) make returning plain objects and allowing prototype overwriting properties optional + +## [**3.1.0**](https://github.com/ljharb/qs/issues?milestone=24&state=closed) +- [**#89**](https://github.com/ljharb/qs/issues/89) Add option to disable "Transform dot notation to bracket notation" + +## [**3.0.0**](https://github.com/ljharb/qs/issues?milestone=23&state=closed) +- [**#80**](https://github.com/ljharb/qs/issues/80) qs.parse silently drops properties +- [**#77**](https://github.com/ljharb/qs/issues/77) Perf boost +- [**#60**](https://github.com/ljharb/qs/issues/60) Add explicit option to disable array parsing +- [**#74**](https://github.com/ljharb/qs/issues/74) Bad parse when turning array into object +- [**#81**](https://github.com/ljharb/qs/issues/81) Add a `filter` option +- [**#68**](https://github.com/ljharb/qs/issues/68) Fixed issue with recursion and passing strings into objects. +- [**#66**](https://github.com/ljharb/qs/issues/66) Add mixed array and object dot notation support Closes: #47 +- [**#76**](https://github.com/ljharb/qs/issues/76) RFC 3986 +- [**#85**](https://github.com/ljharb/qs/issues/85) No equal sign +- [**#84**](https://github.com/ljharb/qs/issues/84) update license attribute + +## [**2.4.1**](https://github.com/ljharb/qs/issues?milestone=20&state=closed) +- [**#73**](https://github.com/ljharb/qs/issues/73) Property 'hasOwnProperty' of object # is not a function + +## [**2.4.0**](https://github.com/ljharb/qs/issues?milestone=19&state=closed) +- [**#70**](https://github.com/ljharb/qs/issues/70) Add arrayFormat option + +## [**2.3.3**](https://github.com/ljharb/qs/issues?milestone=18&state=closed) +- [**#59**](https://github.com/ljharb/qs/issues/59) make sure array indexes are >= 0, closes #57 +- [**#58**](https://github.com/ljharb/qs/issues/58) make qs usable for browser loader + +## [**2.3.2**](https://github.com/ljharb/qs/issues?milestone=17&state=closed) +- [**#55**](https://github.com/ljharb/qs/issues/55) allow merging a string into an object + +## [**2.3.1**](https://github.com/ljharb/qs/issues?milestone=16&state=closed) +- [**#52**](https://github.com/ljharb/qs/issues/52) Return "undefined" and "false" instead of throwing "TypeError". + +## [**2.3.0**](https://github.com/ljharb/qs/issues?milestone=15&state=closed) +- [**#50**](https://github.com/ljharb/qs/issues/50) add option to omit array indices, closes #46 + +## [**2.2.5**](https://github.com/ljharb/qs/issues?milestone=14&state=closed) +- [**#39**](https://github.com/ljharb/qs/issues/39) Is there an alternative to Buffer.isBuffer? +- [**#49**](https://github.com/ljharb/qs/issues/49) refactor utils.merge, fixes #45 +- [**#41**](https://github.com/ljharb/qs/issues/41) avoid browserifying Buffer, for #39 + +## [**2.2.4**](https://github.com/ljharb/qs/issues?milestone=13&state=closed) +- [**#38**](https://github.com/ljharb/qs/issues/38) how to handle object keys beginning with a number + +## [**2.2.3**](https://github.com/ljharb/qs/issues?milestone=12&state=closed) +- [**#37**](https://github.com/ljharb/qs/issues/37) parser discards first empty value in array +- [**#36**](https://github.com/ljharb/qs/issues/36) Update to lab 4.x + +## [**2.2.2**](https://github.com/ljharb/qs/issues?milestone=11&state=closed) +- [**#33**](https://github.com/ljharb/qs/issues/33) Error when plain object in a value +- [**#34**](https://github.com/ljharb/qs/issues/34) use Object.prototype.hasOwnProperty.call instead of obj.hasOwnProperty +- [**#24**](https://github.com/ljharb/qs/issues/24) Changelog? Semver? + +## [**2.2.1**](https://github.com/ljharb/qs/issues?milestone=10&state=closed) +- [**#32**](https://github.com/ljharb/qs/issues/32) account for circular references properly, closes #31 +- [**#31**](https://github.com/ljharb/qs/issues/31) qs.parse stackoverflow on circular objects + +## [**2.2.0**](https://github.com/ljharb/qs/issues?milestone=9&state=closed) +- [**#26**](https://github.com/ljharb/qs/issues/26) Don't use Buffer global if it's not present +- [**#30**](https://github.com/ljharb/qs/issues/30) Bug when merging non-object values into arrays +- [**#29**](https://github.com/ljharb/qs/issues/29) Don't call Utils.clone at the top of Utils.merge +- [**#23**](https://github.com/ljharb/qs/issues/23) Ability to not limit parameters? + +## [**2.1.0**](https://github.com/ljharb/qs/issues?milestone=8&state=closed) +- [**#22**](https://github.com/ljharb/qs/issues/22) Enable using a RegExp as delimiter + +## [**2.0.0**](https://github.com/ljharb/qs/issues?milestone=7&state=closed) +- [**#18**](https://github.com/ljharb/qs/issues/18) Why is there arrayLimit? +- [**#20**](https://github.com/ljharb/qs/issues/20) Configurable parametersLimit +- [**#21**](https://github.com/ljharb/qs/issues/21) make all limits optional, for #18, for #20 + +## [**1.2.2**](https://github.com/ljharb/qs/issues?milestone=6&state=closed) +- [**#19**](https://github.com/ljharb/qs/issues/19) Don't overwrite null values + +## [**1.2.1**](https://github.com/ljharb/qs/issues?milestone=5&state=closed) +- [**#16**](https://github.com/ljharb/qs/issues/16) ignore non-string delimiters +- [**#15**](https://github.com/ljharb/qs/issues/15) Close code block + +## [**1.2.0**](https://github.com/ljharb/qs/issues?milestone=4&state=closed) +- [**#12**](https://github.com/ljharb/qs/issues/12) Add optional delim argument +- [**#13**](https://github.com/ljharb/qs/issues/13) fix #11: flattened keys in array are now correctly parsed + +## [**1.1.0**](https://github.com/ljharb/qs/issues?milestone=3&state=closed) +- [**#7**](https://github.com/ljharb/qs/issues/7) Empty values of a POST array disappear after being submitted +- [**#9**](https://github.com/ljharb/qs/issues/9) Should not omit equals signs (=) when value is null +- [**#6**](https://github.com/ljharb/qs/issues/6) Minor grammar fix in README + +## [**1.0.2**](https://github.com/ljharb/qs/issues?milestone=2&state=closed) +- [**#5**](https://github.com/ljharb/qs/issues/5) array holes incorrectly copied into object on large index diff --git a/8 node/node_modules/qs/LICENSE b/8 node/node_modules/qs/LICENSE new file mode 100644 index 000000000..d4569487a --- /dev/null +++ b/8 node/node_modules/qs/LICENSE @@ -0,0 +1,28 @@ +Copyright (c) 2014 Nathan LaFreniere and other contributors. +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + * The names of any contributors may not be used to endorse or promote + products derived from this software without specific prior written + permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND +ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDERS AND CONTRIBUTORS BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + * * * + +The complete list of contributors can be found at: https://github.com/hapijs/qs/graphs/contributors diff --git a/8 node/node_modules/qs/README.md b/8 node/node_modules/qs/README.md new file mode 100644 index 000000000..32fc3123f --- /dev/null +++ b/8 node/node_modules/qs/README.md @@ -0,0 +1,440 @@ +# qs + +A querystring parsing and stringifying library with some added security. + +[![Build Status](https://api.travis-ci.org/ljharb/qs.svg)](http://travis-ci.org/ljharb/qs) + +Lead Maintainer: [Jordan Harband](https://github.com/ljharb) + +The **qs** module was originally created and maintained by [TJ Holowaychuk](https://github.com/visionmedia/node-querystring). + +## Usage + +```javascript +var qs = require('qs'); +var assert = require('assert'); + +var obj = qs.parse('a=c'); +assert.deepEqual(obj, { a: 'c' }); + +var str = qs.stringify(obj); +assert.equal(str, 'a=c'); +``` + +### Parsing Objects + +[](#preventEval) +```javascript +qs.parse(string, [options]); +``` + +**qs** allows you to create nested objects within your query strings, by surrounding the name of sub-keys with square brackets `[]`. +For example, the string `'foo[bar]=baz'` converts to: + +```javascript +assert.deepEqual(qs.parse('foo[bar]=baz'), { + foo: { + bar: 'baz' + } +}); +``` + +When using the `plainObjects` option the parsed value is returned as a null object, created via `Object.create(null)` and as such you should be aware that prototype methods will not exist on it and a user may set those names to whatever value they like: + +```javascript +var nullObject = qs.parse('a[hasOwnProperty]=b', { plainObjects: true }); +assert.deepEqual(nullObject, { a: { hasOwnProperty: 'b' } }); +``` + +By default parameters that would overwrite properties on the object prototype are ignored, if you wish to keep the data from those fields either use `plainObjects` as mentioned above, or set `allowPrototypes` to `true` which will allow user input to overwrite those properties. *WARNING* It is generally a bad idea to enable this option as it can cause problems when attempting to use the properties that have been overwritten. Always be careful with this option. + +```javascript +var protoObject = qs.parse('a[hasOwnProperty]=b', { allowPrototypes: true }); +assert.deepEqual(protoObject, { a: { hasOwnProperty: 'b' } }); +``` + +URI encoded strings work too: + +```javascript +assert.deepEqual(qs.parse('a%5Bb%5D=c'), { + a: { b: 'c' } +}); +``` + +You can also nest your objects, like `'foo[bar][baz]=foobarbaz'`: + +```javascript +assert.deepEqual(qs.parse('foo[bar][baz]=foobarbaz'), { + foo: { + bar: { + baz: 'foobarbaz' + } + } +}); +``` + +By default, when nesting objects **qs** will only parse up to 5 children deep. This means if you attempt to parse a string like +`'a[b][c][d][e][f][g][h][i]=j'` your resulting object will be: + +```javascript +var expected = { + a: { + b: { + c: { + d: { + e: { + f: { + '[g][h][i]': 'j' + } + } + } + } + } + } +}; +var string = 'a[b][c][d][e][f][g][h][i]=j'; +assert.deepEqual(qs.parse(string), expected); +``` + +This depth can be overridden by passing a `depth` option to `qs.parse(string, [options])`: + +```javascript +var deep = qs.parse('a[b][c][d][e][f][g][h][i]=j', { depth: 1 }); +assert.deepEqual(deep, { a: { b: { '[c][d][e][f][g][h][i]': 'j' } } }); +``` + +The depth limit helps mitigate abuse when **qs** is used to parse user input, and it is recommended to keep it a reasonably small number. + +For similar reasons, by default **qs** will only parse up to 1000 parameters. This can be overridden by passing a `parameterLimit` option: + +```javascript +var limited = qs.parse('a=b&c=d', { parameterLimit: 1 }); +assert.deepEqual(limited, { a: 'b' }); +``` + +An optional delimiter can also be passed: + +```javascript +var delimited = qs.parse('a=b;c=d', { delimiter: ';' }); +assert.deepEqual(delimited, { a: 'b', c: 'd' }); +``` + +Delimiters can be a regular expression too: + +```javascript +var regexed = qs.parse('a=b;c=d,e=f', { delimiter: /[;,]/ }); +assert.deepEqual(regexed, { a: 'b', c: 'd', e: 'f' }); +``` + +Option `allowDots` can be used to enable dot notation: + +```javascript +var withDots = qs.parse('a.b=c', { allowDots: true }); +assert.deepEqual(withDots, { a: { b: 'c' } }); +``` + +### Parsing Arrays + +**qs** can also parse arrays using a similar `[]` notation: + +```javascript +var withArray = qs.parse('a[]=b&a[]=c'); +assert.deepEqual(withArray, { a: ['b', 'c'] }); +``` + +You may specify an index as well: + +```javascript +var withIndexes = qs.parse('a[1]=c&a[0]=b'); +assert.deepEqual(withIndexes, { a: ['b', 'c'] }); +``` + +Note that the only difference between an index in an array and a key in an object is that the value between the brackets must be a number +to create an array. When creating arrays with specific indices, **qs** will compact a sparse array to only the existing values preserving +their order: + +```javascript +var noSparse = qs.parse('a[1]=b&a[15]=c'); +assert.deepEqual(noSparse, { a: ['b', 'c'] }); +``` + +Note that an empty string is also a value, and will be preserved: + +```javascript +var withEmptyString = qs.parse('a[]=&a[]=b'); +assert.deepEqual(withEmptyString, { a: ['', 'b'] }); + +var withIndexedEmptyString = qs.parse('a[0]=b&a[1]=&a[2]=c'); +assert.deepEqual(withIndexedEmptyString, { a: ['b', '', 'c'] }); +``` + +**qs** will also limit specifying indices in an array to a maximum index of `20`. Any array members with an index of greater than `20` will +instead be converted to an object with the index as the key: + +```javascript +var withMaxIndex = qs.parse('a[100]=b'); +assert.deepEqual(withMaxIndex, { a: { '100': 'b' } }); +``` + +This limit can be overridden by passing an `arrayLimit` option: + +```javascript +var withArrayLimit = qs.parse('a[1]=b', { arrayLimit: 0 }); +assert.deepEqual(withArrayLimit, { a: { '1': 'b' } }); +``` + +To disable array parsing entirely, set `parseArrays` to `false`. + +```javascript +var noParsingArrays = qs.parse('a[]=b', { parseArrays: false }); +assert.deepEqual(noParsingArrays, { a: { '0': 'b' } }); +``` + +If you mix notations, **qs** will merge the two items into an object: + +```javascript +var mixedNotation = qs.parse('a[0]=b&a[b]=c'); +assert.deepEqual(mixedNotation, { a: { '0': 'b', b: 'c' } }); +``` + +You can also create arrays of objects: + +```javascript +var arraysOfObjects = qs.parse('a[][b]=c'); +assert.deepEqual(arraysOfObjects, { a: [{ b: 'c' }] }); +``` + +### Stringifying + +[](#preventEval) +```javascript +qs.stringify(object, [options]); +``` + +When stringifying, **qs** by default URI encodes output. Objects are stringified as you would expect: + +```javascript +assert.equal(qs.stringify({ a: 'b' }), 'a=b'); +assert.equal(qs.stringify({ a: { b: 'c' } }), 'a%5Bb%5D=c'); +``` + +This encoding can be disabled by setting the `encode` option to `false`: + +```javascript +var unencoded = qs.stringify({ a: { b: 'c' } }, { encode: false }); +assert.equal(unencoded, 'a[b]=c'); +``` + +Encoding can be disabled for keys by setting the `encodeValuesOnly` option to `true`: +```javascript +var encodedValues = qs.stringify( + { a: 'b', c: ['d', 'e=f'], f: [['g'], ['h']] }, + { encodeValuesOnly: true } +) +assert.equal(encodedValues,'a=b&c[0]=d&c[1]=e%3Df&f[0][0]=g&f[1][0]=h'); +``` + +This encoding can also be replaced by a custom encoding method set as `encoder` option: + +```javascript +var encoded = qs.stringify({ a: { b: 'c' } }, { encoder: function (str) { + // Passed in values `a`, `b`, `c` + return // Return encoded string +}}) +``` + +_(Note: the `encoder` option does not apply if `encode` is `false`)_ + +Analogue to the `encoder` there is a `decoder` option for `parse` to override decoding of properties and values: + +```javascript +var decoded = qs.parse('x=z', { decoder: function (str) { + // Passed in values `x`, `z` + return // Return decoded string +}}) +``` + +Examples beyond this point will be shown as though the output is not URI encoded for clarity. Please note that the return values in these cases *will* be URI encoded during real usage. + +When arrays are stringified, by default they are given explicit indices: + +```javascript +qs.stringify({ a: ['b', 'c', 'd'] }); +// 'a[0]=b&a[1]=c&a[2]=d' +``` + +You may override this by setting the `indices` option to `false`: + +```javascript +qs.stringify({ a: ['b', 'c', 'd'] }, { indices: false }); +// 'a=b&a=c&a=d' +``` + +You may use the `arrayFormat` option to specify the format of the output array: + +```javascript +qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'indices' }) +// 'a[0]=b&a[1]=c' +qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'brackets' }) +// 'a[]=b&a[]=c' +qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'repeat' }) +// 'a=b&a=c' +``` + +When objects are stringified, by default they use bracket notation: + +```javascript +qs.stringify({ a: { b: { c: 'd', e: 'f' } } }); +// 'a[b][c]=d&a[b][e]=f' +``` + +You may override this to use dot notation by setting the `allowDots` option to `true`: + +```javascript +qs.stringify({ a: { b: { c: 'd', e: 'f' } } }, { allowDots: true }); +// 'a.b.c=d&a.b.e=f' +``` + +Empty strings and null values will omit the value, but the equals sign (=) remains in place: + +```javascript +assert.equal(qs.stringify({ a: '' }), 'a='); +``` + +Key with no values (such as an empty object or array) will return nothing: + +```javascript +assert.equal(qs.stringify({ a: [] }), ''); +assert.equal(qs.stringify({ a: {} }), ''); +assert.equal(qs.stringify({ a: [{}] }), ''); +assert.equal(qs.stringify({ a: { b: []} }), ''); +assert.equal(qs.stringify({ a: { b: {}} }), ''); +``` + +Properties that are set to `undefined` will be omitted entirely: + +```javascript +assert.equal(qs.stringify({ a: null, b: undefined }), 'a='); +``` + +The delimiter may be overridden with stringify as well: + +```javascript +assert.equal(qs.stringify({ a: 'b', c: 'd' }, { delimiter: ';' }), 'a=b;c=d'); +``` + +If you only want to override the serialization of `Date` objects, you can provide a `serializeDate` option: + +```javascript +var date = new Date(7); +assert.equal(qs.stringify({ a: date }), 'a=1970-01-01T00:00:00.007Z'.replace(/:/g, '%3A')); +assert.equal( + qs.stringify({ a: date }, { serializeDate: function (d) { return d.getTime(); } }), + 'a=7' +); +``` + +You may use the `sort` option to affect the order of parameter keys: + +```javascript +function alphabeticalSort(a, b) { + return a.localeCompare(b); +} +assert.equal(qs.stringify({ a: 'c', z: 'y', b : 'f' }, { sort: alphabeticalSort }), 'a=c&b=f&z=y'); +``` + +Finally, you can use the `filter` option to restrict which keys will be included in the stringified output. +If you pass a function, it will be called for each key to obtain the replacement value. Otherwise, if you +pass an array, it will be used to select properties and array indices for stringification: + +```javascript +function filterFunc(prefix, value) { + if (prefix == 'b') { + // Return an `undefined` value to omit a property. + return; + } + if (prefix == 'e[f]') { + return value.getTime(); + } + if (prefix == 'e[g][0]') { + return value * 2; + } + return value; +} +qs.stringify({ a: 'b', c: 'd', e: { f: new Date(123), g: [2] } }, { filter: filterFunc }); +// 'a=b&c=d&e[f]=123&e[g][0]=4' +qs.stringify({ a: 'b', c: 'd', e: 'f' }, { filter: ['a', 'e'] }); +// 'a=b&e=f' +qs.stringify({ a: ['b', 'c', 'd'], e: 'f' }, { filter: ['a', 0, 2] }); +// 'a[0]=b&a[2]=d' +``` + +### Handling of `null` values + +By default, `null` values are treated like empty strings: + +```javascript +var withNull = qs.stringify({ a: null, b: '' }); +assert.equal(withNull, 'a=&b='); +``` + +Parsing does not distinguish between parameters with and without equal signs. Both are converted to empty strings. + +```javascript +var equalsInsensitive = qs.parse('a&b='); +assert.deepEqual(equalsInsensitive, { a: '', b: '' }); +``` + +To distinguish between `null` values and empty strings use the `strictNullHandling` flag. In the result string the `null` +values have no `=` sign: + +```javascript +var strictNull = qs.stringify({ a: null, b: '' }, { strictNullHandling: true }); +assert.equal(strictNull, 'a&b='); +``` + +To parse values without `=` back to `null` use the `strictNullHandling` flag: + +```javascript +var parsedStrictNull = qs.parse('a&b=', { strictNullHandling: true }); +assert.deepEqual(parsedStrictNull, { a: null, b: '' }); +``` + +To completely skip rendering keys with `null` values, use the `skipNulls` flag: + +```javascript +var nullsSkipped = qs.stringify({ a: 'b', c: null}, { skipNulls: true }); +assert.equal(nullsSkipped, 'a=b'); +``` + +### Dealing with special character sets + +By default the encoding and decoding of characters is done in `utf-8`. If you +wish to encode querystrings to a different character set (i.e. +[Shift JIS](https://en.wikipedia.org/wiki/Shift_JIS)) you can use the +[`qs-iconv`](https://github.com/martinheidegger/qs-iconv) library: + +```javascript +var encoder = require('qs-iconv/encoder')('shift_jis'); +var shiftJISEncoded = qs.stringify({ a: 'こんにちは!' }, { encoder: encoder }); +assert.equal(shiftJISEncoded, 'a=%82%B1%82%F1%82%C9%82%BF%82%CD%81I'); +``` + +This also works for decoding of query strings: + +```javascript +var decoder = require('qs-iconv/decoder')('shift_jis'); +var obj = qs.parse('a=%82%B1%82%F1%82%C9%82%BF%82%CD%81I', { decoder: decoder }); +assert.deepEqual(obj, { a: 'こんにちは!' }); +``` + +### RFC 3986 and RFC 1738 space encoding + +RFC3986 used as default option and encodes ' ' to *%20* which is backward compatible. +In the same time, output can be stringified as per RFC1738 with ' ' equal to '+'. + +``` +assert.equal(qs.stringify({ a: 'b c' }), 'a=b%20c'); +assert.equal(qs.stringify({ a: 'b c' }, { format : 'RFC3986' }), 'a=b%20c'); +assert.equal(qs.stringify({ a: 'b c' }, { format : 'RFC1738' }), 'a=b+c'); +``` diff --git a/8 node/node_modules/qs/dist/qs.js b/8 node/node_modules/qs/dist/qs.js new file mode 100644 index 000000000..2d0d63ff2 --- /dev/null +++ b/8 node/node_modules/qs/dist/qs.js @@ -0,0 +1,597 @@ +(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.Qs = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o= 0 && + (options.parseArrays && index <= options.arrayLimit) + ) { + obj = []; + obj[index] = parseObject(chain, val, options); + } else { + obj[cleanRoot] = parseObject(chain, val, options); + } + } + + return obj; +}; + +var parseKeys = function parseQueryStringKeys(givenKey, val, options) { + if (!givenKey) { + return; + } + + // Transform dot notation to bracket notation + var key = options.allowDots ? givenKey.replace(/\.([^.[]+)/g, '[$1]') : givenKey; + + // The regex chunks + + var brackets = /(\[[^[\]]*])/; + var child = /(\[[^[\]]*])/g; + + // Get the parent + + var segment = brackets.exec(key); + var parent = segment ? key.slice(0, segment.index) : key; + + // Stash the parent if it exists + + var keys = []; + if (parent) { + // If we aren't using plain objects, optionally prefix keys + // that would overwrite object prototype properties + if (!options.plainObjects && has.call(Object.prototype, parent)) { + if (!options.allowPrototypes) { + return; + } + } + + keys.push(parent); + } + + // Loop through children appending to the array until we hit depth + + var i = 0; + while ((segment = child.exec(key)) !== null && i < options.depth) { + i += 1; + if (!options.plainObjects && has.call(Object.prototype, segment[1].slice(1, -1))) { + if (!options.allowPrototypes) { + return; + } + } + keys.push(segment[1]); + } + + // If there's a remainder, just add whatever is left + + if (segment) { + keys.push('[' + key.slice(segment.index) + ']'); + } + + return parseObject(keys, val, options); +}; + +module.exports = function (str, opts) { + var options = opts || {}; + + if (options.decoder !== null && options.decoder !== undefined && typeof options.decoder !== 'function') { + throw new TypeError('Decoder has to be a function.'); + } + + options.delimiter = typeof options.delimiter === 'string' || utils.isRegExp(options.delimiter) ? options.delimiter : defaults.delimiter; + options.depth = typeof options.depth === 'number' ? options.depth : defaults.depth; + options.arrayLimit = typeof options.arrayLimit === 'number' ? options.arrayLimit : defaults.arrayLimit; + options.parseArrays = options.parseArrays !== false; + options.decoder = typeof options.decoder === 'function' ? options.decoder : defaults.decoder; + options.allowDots = typeof options.allowDots === 'boolean' ? options.allowDots : defaults.allowDots; + options.plainObjects = typeof options.plainObjects === 'boolean' ? options.plainObjects : defaults.plainObjects; + options.allowPrototypes = typeof options.allowPrototypes === 'boolean' ? options.allowPrototypes : defaults.allowPrototypes; + options.parameterLimit = typeof options.parameterLimit === 'number' ? options.parameterLimit : defaults.parameterLimit; + options.strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; + + if (str === '' || str === null || typeof str === 'undefined') { + return options.plainObjects ? Object.create(null) : {}; + } + + var tempObj = typeof str === 'string' ? parseValues(str, options) : str; + var obj = options.plainObjects ? Object.create(null) : {}; + + // Iterate over the keys and setup the new object + + var keys = Object.keys(tempObj); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + var newObj = parseKeys(key, tempObj[key], options); + obj = utils.merge(obj, newObj, options); + } + + return utils.compact(obj); +}; + +},{"./utils":5}],4:[function(require,module,exports){ +'use strict'; + +var utils = require('./utils'); +var formats = require('./formats'); + +var arrayPrefixGenerators = { + brackets: function brackets(prefix) { // eslint-disable-line func-name-matching + return prefix + '[]'; + }, + indices: function indices(prefix, key) { // eslint-disable-line func-name-matching + return prefix + '[' + key + ']'; + }, + repeat: function repeat(prefix) { // eslint-disable-line func-name-matching + return prefix; + } +}; + +var toISO = Date.prototype.toISOString; + +var defaults = { + delimiter: '&', + encode: true, + encoder: utils.encode, + encodeValuesOnly: false, + serializeDate: function serializeDate(date) { // eslint-disable-line func-name-matching + return toISO.call(date); + }, + skipNulls: false, + strictNullHandling: false +}; + +var stringify = function stringify( // eslint-disable-line func-name-matching + object, + prefix, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly +) { + var obj = object; + if (typeof filter === 'function') { + obj = filter(prefix, obj); + } else if (obj instanceof Date) { + obj = serializeDate(obj); + } else if (obj === null) { + if (strictNullHandling) { + return encoder && !encodeValuesOnly ? encoder(prefix) : prefix; + } + + obj = ''; + } + + if (typeof obj === 'string' || typeof obj === 'number' || typeof obj === 'boolean' || utils.isBuffer(obj)) { + if (encoder) { + var keyValue = encodeValuesOnly ? prefix : encoder(prefix); + return [formatter(keyValue) + '=' + formatter(encoder(obj))]; + } + return [formatter(prefix) + '=' + formatter(String(obj))]; + } + + var values = []; + + if (typeof obj === 'undefined') { + return values; + } + + var objKeys; + if (Array.isArray(filter)) { + objKeys = filter; + } else { + var keys = Object.keys(obj); + objKeys = sort ? keys.sort(sort) : keys; + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + if (Array.isArray(obj)) { + values = values.concat(stringify( + obj[key], + generateArrayPrefix(prefix, key), + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly + )); + } else { + values = values.concat(stringify( + obj[key], + prefix + (allowDots ? '.' + key : '[' + key + ']'), + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly + )); + } + } + + return values; +}; + +module.exports = function (object, opts) { + var obj = object; + var options = opts || {}; + + if (options.encoder !== null && options.encoder !== undefined && typeof options.encoder !== 'function') { + throw new TypeError('Encoder has to be a function.'); + } + + var delimiter = typeof options.delimiter === 'undefined' ? defaults.delimiter : options.delimiter; + var strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; + var skipNulls = typeof options.skipNulls === 'boolean' ? options.skipNulls : defaults.skipNulls; + var encode = typeof options.encode === 'boolean' ? options.encode : defaults.encode; + var encoder = typeof options.encoder === 'function' ? options.encoder : defaults.encoder; + var sort = typeof options.sort === 'function' ? options.sort : null; + var allowDots = typeof options.allowDots === 'undefined' ? false : options.allowDots; + var serializeDate = typeof options.serializeDate === 'function' ? options.serializeDate : defaults.serializeDate; + var encodeValuesOnly = typeof options.encodeValuesOnly === 'boolean' ? options.encodeValuesOnly : defaults.encodeValuesOnly; + if (typeof options.format === 'undefined') { + options.format = formats.default; + } else if (!Object.prototype.hasOwnProperty.call(formats.formatters, options.format)) { + throw new TypeError('Unknown format option provided.'); + } + var formatter = formats.formatters[options.format]; + var objKeys; + var filter; + + if (typeof options.filter === 'function') { + filter = options.filter; + obj = filter('', obj); + } else if (Array.isArray(options.filter)) { + filter = options.filter; + objKeys = filter; + } + + var keys = []; + + if (typeof obj !== 'object' || obj === null) { + return ''; + } + + var arrayFormat; + if (options.arrayFormat in arrayPrefixGenerators) { + arrayFormat = options.arrayFormat; + } else if ('indices' in options) { + arrayFormat = options.indices ? 'indices' : 'repeat'; + } else { + arrayFormat = 'indices'; + } + + var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; + + if (!objKeys) { + objKeys = Object.keys(obj); + } + + if (sort) { + objKeys.sort(sort); + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + keys = keys.concat(stringify( + obj[key], + key, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encode ? encoder : null, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly + )); + } + + return keys.join(delimiter); +}; + +},{"./formats":1,"./utils":5}],5:[function(require,module,exports){ +'use strict'; + +var has = Object.prototype.hasOwnProperty; + +var hexTable = (function () { + var array = []; + for (var i = 0; i < 256; ++i) { + array.push('%' + ((i < 16 ? '0' : '') + i.toString(16)).toUpperCase()); + } + + return array; +}()); + +exports.arrayToObject = function (source, options) { + var obj = options && options.plainObjects ? Object.create(null) : {}; + for (var i = 0; i < source.length; ++i) { + if (typeof source[i] !== 'undefined') { + obj[i] = source[i]; + } + } + + return obj; +}; + +exports.merge = function (target, source, options) { + if (!source) { + return target; + } + + if (typeof source !== 'object') { + if (Array.isArray(target)) { + target.push(source); + } else if (typeof target === 'object') { + if (options.plainObjects || options.allowPrototypes || !has.call(Object.prototype, source)) { + target[source] = true; + } + } else { + return [target, source]; + } + + return target; + } + + if (typeof target !== 'object') { + return [target].concat(source); + } + + var mergeTarget = target; + if (Array.isArray(target) && !Array.isArray(source)) { + mergeTarget = exports.arrayToObject(target, options); + } + + if (Array.isArray(target) && Array.isArray(source)) { + source.forEach(function (item, i) { + if (has.call(target, i)) { + if (target[i] && typeof target[i] === 'object') { + target[i] = exports.merge(target[i], item, options); + } else { + target.push(item); + } + } else { + target[i] = item; + } + }); + return target; + } + + return Object.keys(source).reduce(function (acc, key) { + var value = source[key]; + + if (Object.prototype.hasOwnProperty.call(acc, key)) { + acc[key] = exports.merge(acc[key], value, options); + } else { + acc[key] = value; + } + return acc; + }, mergeTarget); +}; + +exports.decode = function (str) { + try { + return decodeURIComponent(str.replace(/\+/g, ' ')); + } catch (e) { + return str; + } +}; + +exports.encode = function (str) { + // This code was originally written by Brian White (mscdex) for the io.js core querystring library. + // It has been adapted here for stricter adherence to RFC 3986 + if (str.length === 0) { + return str; + } + + var string = typeof str === 'string' ? str : String(str); + + var out = ''; + for (var i = 0; i < string.length; ++i) { + var c = string.charCodeAt(i); + + if ( + c === 0x2D || // - + c === 0x2E || // . + c === 0x5F || // _ + c === 0x7E || // ~ + (c >= 0x30 && c <= 0x39) || // 0-9 + (c >= 0x41 && c <= 0x5A) || // a-z + (c >= 0x61 && c <= 0x7A) // A-Z + ) { + out += string.charAt(i); + continue; + } + + if (c < 0x80) { + out = out + hexTable[c]; + continue; + } + + if (c < 0x800) { + out = out + (hexTable[0xC0 | (c >> 6)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + if (c < 0xD800 || c >= 0xE000) { + out = out + (hexTable[0xE0 | (c >> 12)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + i += 1; + c = 0x10000 + (((c & 0x3FF) << 10) | (string.charCodeAt(i) & 0x3FF)); + out += hexTable[0xF0 | (c >> 18)] + hexTable[0x80 | ((c >> 12) & 0x3F)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]; // eslint-disable-line max-len + } + + return out; +}; + +exports.compact = function (obj, references) { + if (typeof obj !== 'object' || obj === null) { + return obj; + } + + var refs = references || []; + var lookup = refs.indexOf(obj); + if (lookup !== -1) { + return refs[lookup]; + } + + refs.push(obj); + + if (Array.isArray(obj)) { + var compacted = []; + + for (var i = 0; i < obj.length; ++i) { + if (obj[i] && typeof obj[i] === 'object') { + compacted.push(exports.compact(obj[i], refs)); + } else if (typeof obj[i] !== 'undefined') { + compacted.push(obj[i]); + } + } + + return compacted; + } + + var keys = Object.keys(obj); + keys.forEach(function (key) { + obj[key] = exports.compact(obj[key], refs); + }); + + return obj; +}; + +exports.isRegExp = function (obj) { + return Object.prototype.toString.call(obj) === '[object RegExp]'; +}; + +exports.isBuffer = function (obj) { + if (obj === null || typeof obj === 'undefined') { + return false; + } + + return !!(obj.constructor && obj.constructor.isBuffer && obj.constructor.isBuffer(obj)); +}; + +},{}]},{},[2])(2) +}); \ No newline at end of file diff --git a/8 node/node_modules/qs/lib/formats.js b/8 node/node_modules/qs/lib/formats.js new file mode 100644 index 000000000..df4599752 --- /dev/null +++ b/8 node/node_modules/qs/lib/formats.js @@ -0,0 +1,18 @@ +'use strict'; + +var replace = String.prototype.replace; +var percentTwenties = /%20/g; + +module.exports = { + 'default': 'RFC3986', + formatters: { + RFC1738: function (value) { + return replace.call(value, percentTwenties, '+'); + }, + RFC3986: function (value) { + return value; + } + }, + RFC1738: 'RFC1738', + RFC3986: 'RFC3986' +}; diff --git a/8 node/node_modules/qs/lib/index.js b/8 node/node_modules/qs/lib/index.js new file mode 100644 index 000000000..0d6a97dcf --- /dev/null +++ b/8 node/node_modules/qs/lib/index.js @@ -0,0 +1,11 @@ +'use strict'; + +var stringify = require('./stringify'); +var parse = require('./parse'); +var formats = require('./formats'); + +module.exports = { + formats: formats, + parse: parse, + stringify: stringify +}; diff --git a/8 node/node_modules/qs/lib/parse.js b/8 node/node_modules/qs/lib/parse.js new file mode 100644 index 000000000..1307e9d79 --- /dev/null +++ b/8 node/node_modules/qs/lib/parse.js @@ -0,0 +1,167 @@ +'use strict'; + +var utils = require('./utils'); + +var has = Object.prototype.hasOwnProperty; + +var defaults = { + allowDots: false, + allowPrototypes: false, + arrayLimit: 20, + decoder: utils.decode, + delimiter: '&', + depth: 5, + parameterLimit: 1000, + plainObjects: false, + strictNullHandling: false +}; + +var parseValues = function parseQueryStringValues(str, options) { + var obj = {}; + var parts = str.split(options.delimiter, options.parameterLimit === Infinity ? undefined : options.parameterLimit); + + for (var i = 0; i < parts.length; ++i) { + var part = parts[i]; + var pos = part.indexOf(']=') === -1 ? part.indexOf('=') : part.indexOf(']=') + 1; + + var key, val; + if (pos === -1) { + key = options.decoder(part); + val = options.strictNullHandling ? null : ''; + } else { + key = options.decoder(part.slice(0, pos)); + val = options.decoder(part.slice(pos + 1)); + } + if (has.call(obj, key)) { + obj[key] = [].concat(obj[key]).concat(val); + } else { + obj[key] = val; + } + } + + return obj; +}; + +var parseObject = function parseObjectRecursive(chain, val, options) { + if (!chain.length) { + return val; + } + + var root = chain.shift(); + + var obj; + if (root === '[]') { + obj = []; + obj = obj.concat(parseObject(chain, val, options)); + } else { + obj = options.plainObjects ? Object.create(null) : {}; + var cleanRoot = root.charAt(0) === '[' && root.charAt(root.length - 1) === ']' ? root.slice(1, -1) : root; + var index = parseInt(cleanRoot, 10); + if ( + !isNaN(index) && + root !== cleanRoot && + String(index) === cleanRoot && + index >= 0 && + (options.parseArrays && index <= options.arrayLimit) + ) { + obj = []; + obj[index] = parseObject(chain, val, options); + } else { + obj[cleanRoot] = parseObject(chain, val, options); + } + } + + return obj; +}; + +var parseKeys = function parseQueryStringKeys(givenKey, val, options) { + if (!givenKey) { + return; + } + + // Transform dot notation to bracket notation + var key = options.allowDots ? givenKey.replace(/\.([^.[]+)/g, '[$1]') : givenKey; + + // The regex chunks + + var brackets = /(\[[^[\]]*])/; + var child = /(\[[^[\]]*])/g; + + // Get the parent + + var segment = brackets.exec(key); + var parent = segment ? key.slice(0, segment.index) : key; + + // Stash the parent if it exists + + var keys = []; + if (parent) { + // If we aren't using plain objects, optionally prefix keys + // that would overwrite object prototype properties + if (!options.plainObjects && has.call(Object.prototype, parent)) { + if (!options.allowPrototypes) { + return; + } + } + + keys.push(parent); + } + + // Loop through children appending to the array until we hit depth + + var i = 0; + while ((segment = child.exec(key)) !== null && i < options.depth) { + i += 1; + if (!options.plainObjects && has.call(Object.prototype, segment[1].slice(1, -1))) { + if (!options.allowPrototypes) { + return; + } + } + keys.push(segment[1]); + } + + // If there's a remainder, just add whatever is left + + if (segment) { + keys.push('[' + key.slice(segment.index) + ']'); + } + + return parseObject(keys, val, options); +}; + +module.exports = function (str, opts) { + var options = opts || {}; + + if (options.decoder !== null && options.decoder !== undefined && typeof options.decoder !== 'function') { + throw new TypeError('Decoder has to be a function.'); + } + + options.delimiter = typeof options.delimiter === 'string' || utils.isRegExp(options.delimiter) ? options.delimiter : defaults.delimiter; + options.depth = typeof options.depth === 'number' ? options.depth : defaults.depth; + options.arrayLimit = typeof options.arrayLimit === 'number' ? options.arrayLimit : defaults.arrayLimit; + options.parseArrays = options.parseArrays !== false; + options.decoder = typeof options.decoder === 'function' ? options.decoder : defaults.decoder; + options.allowDots = typeof options.allowDots === 'boolean' ? options.allowDots : defaults.allowDots; + options.plainObjects = typeof options.plainObjects === 'boolean' ? options.plainObjects : defaults.plainObjects; + options.allowPrototypes = typeof options.allowPrototypes === 'boolean' ? options.allowPrototypes : defaults.allowPrototypes; + options.parameterLimit = typeof options.parameterLimit === 'number' ? options.parameterLimit : defaults.parameterLimit; + options.strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; + + if (str === '' || str === null || typeof str === 'undefined') { + return options.plainObjects ? Object.create(null) : {}; + } + + var tempObj = typeof str === 'string' ? parseValues(str, options) : str; + var obj = options.plainObjects ? Object.create(null) : {}; + + // Iterate over the keys and setup the new object + + var keys = Object.keys(tempObj); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + var newObj = parseKeys(key, tempObj[key], options); + obj = utils.merge(obj, newObj, options); + } + + return utils.compact(obj); +}; diff --git a/8 node/node_modules/qs/lib/stringify.js b/8 node/node_modules/qs/lib/stringify.js new file mode 100644 index 000000000..7694988c0 --- /dev/null +++ b/8 node/node_modules/qs/lib/stringify.js @@ -0,0 +1,207 @@ +'use strict'; + +var utils = require('./utils'); +var formats = require('./formats'); + +var arrayPrefixGenerators = { + brackets: function brackets(prefix) { // eslint-disable-line func-name-matching + return prefix + '[]'; + }, + indices: function indices(prefix, key) { // eslint-disable-line func-name-matching + return prefix + '[' + key + ']'; + }, + repeat: function repeat(prefix) { // eslint-disable-line func-name-matching + return prefix; + } +}; + +var toISO = Date.prototype.toISOString; + +var defaults = { + delimiter: '&', + encode: true, + encoder: utils.encode, + encodeValuesOnly: false, + serializeDate: function serializeDate(date) { // eslint-disable-line func-name-matching + return toISO.call(date); + }, + skipNulls: false, + strictNullHandling: false +}; + +var stringify = function stringify( // eslint-disable-line func-name-matching + object, + prefix, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly +) { + var obj = object; + if (typeof filter === 'function') { + obj = filter(prefix, obj); + } else if (obj instanceof Date) { + obj = serializeDate(obj); + } else if (obj === null) { + if (strictNullHandling) { + return encoder && !encodeValuesOnly ? encoder(prefix) : prefix; + } + + obj = ''; + } + + if (typeof obj === 'string' || typeof obj === 'number' || typeof obj === 'boolean' || utils.isBuffer(obj)) { + if (encoder) { + var keyValue = encodeValuesOnly ? prefix : encoder(prefix); + return [formatter(keyValue) + '=' + formatter(encoder(obj))]; + } + return [formatter(prefix) + '=' + formatter(String(obj))]; + } + + var values = []; + + if (typeof obj === 'undefined') { + return values; + } + + var objKeys; + if (Array.isArray(filter)) { + objKeys = filter; + } else { + var keys = Object.keys(obj); + objKeys = sort ? keys.sort(sort) : keys; + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + if (Array.isArray(obj)) { + values = values.concat(stringify( + obj[key], + generateArrayPrefix(prefix, key), + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly + )); + } else { + values = values.concat(stringify( + obj[key], + prefix + (allowDots ? '.' + key : '[' + key + ']'), + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly + )); + } + } + + return values; +}; + +module.exports = function (object, opts) { + var obj = object; + var options = opts || {}; + + if (options.encoder !== null && options.encoder !== undefined && typeof options.encoder !== 'function') { + throw new TypeError('Encoder has to be a function.'); + } + + var delimiter = typeof options.delimiter === 'undefined' ? defaults.delimiter : options.delimiter; + var strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; + var skipNulls = typeof options.skipNulls === 'boolean' ? options.skipNulls : defaults.skipNulls; + var encode = typeof options.encode === 'boolean' ? options.encode : defaults.encode; + var encoder = typeof options.encoder === 'function' ? options.encoder : defaults.encoder; + var sort = typeof options.sort === 'function' ? options.sort : null; + var allowDots = typeof options.allowDots === 'undefined' ? false : options.allowDots; + var serializeDate = typeof options.serializeDate === 'function' ? options.serializeDate : defaults.serializeDate; + var encodeValuesOnly = typeof options.encodeValuesOnly === 'boolean' ? options.encodeValuesOnly : defaults.encodeValuesOnly; + if (typeof options.format === 'undefined') { + options.format = formats.default; + } else if (!Object.prototype.hasOwnProperty.call(formats.formatters, options.format)) { + throw new TypeError('Unknown format option provided.'); + } + var formatter = formats.formatters[options.format]; + var objKeys; + var filter; + + if (typeof options.filter === 'function') { + filter = options.filter; + obj = filter('', obj); + } else if (Array.isArray(options.filter)) { + filter = options.filter; + objKeys = filter; + } + + var keys = []; + + if (typeof obj !== 'object' || obj === null) { + return ''; + } + + var arrayFormat; + if (options.arrayFormat in arrayPrefixGenerators) { + arrayFormat = options.arrayFormat; + } else if ('indices' in options) { + arrayFormat = options.indices ? 'indices' : 'repeat'; + } else { + arrayFormat = 'indices'; + } + + var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; + + if (!objKeys) { + objKeys = Object.keys(obj); + } + + if (sort) { + objKeys.sort(sort); + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + keys = keys.concat(stringify( + obj[key], + key, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encode ? encoder : null, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly + )); + } + + return keys.join(delimiter); +}; diff --git a/8 node/node_modules/qs/lib/utils.js b/8 node/node_modules/qs/lib/utils.js new file mode 100644 index 000000000..b21433237 --- /dev/null +++ b/8 node/node_modules/qs/lib/utils.js @@ -0,0 +1,182 @@ +'use strict'; + +var has = Object.prototype.hasOwnProperty; + +var hexTable = (function () { + var array = []; + for (var i = 0; i < 256; ++i) { + array.push('%' + ((i < 16 ? '0' : '') + i.toString(16)).toUpperCase()); + } + + return array; +}()); + +exports.arrayToObject = function (source, options) { + var obj = options && options.plainObjects ? Object.create(null) : {}; + for (var i = 0; i < source.length; ++i) { + if (typeof source[i] !== 'undefined') { + obj[i] = source[i]; + } + } + + return obj; +}; + +exports.merge = function (target, source, options) { + if (!source) { + return target; + } + + if (typeof source !== 'object') { + if (Array.isArray(target)) { + target.push(source); + } else if (typeof target === 'object') { + if (options.plainObjects || options.allowPrototypes || !has.call(Object.prototype, source)) { + target[source] = true; + } + } else { + return [target, source]; + } + + return target; + } + + if (typeof target !== 'object') { + return [target].concat(source); + } + + var mergeTarget = target; + if (Array.isArray(target) && !Array.isArray(source)) { + mergeTarget = exports.arrayToObject(target, options); + } + + if (Array.isArray(target) && Array.isArray(source)) { + source.forEach(function (item, i) { + if (has.call(target, i)) { + if (target[i] && typeof target[i] === 'object') { + target[i] = exports.merge(target[i], item, options); + } else { + target.push(item); + } + } else { + target[i] = item; + } + }); + return target; + } + + return Object.keys(source).reduce(function (acc, key) { + var value = source[key]; + + if (Object.prototype.hasOwnProperty.call(acc, key)) { + acc[key] = exports.merge(acc[key], value, options); + } else { + acc[key] = value; + } + return acc; + }, mergeTarget); +}; + +exports.decode = function (str) { + try { + return decodeURIComponent(str.replace(/\+/g, ' ')); + } catch (e) { + return str; + } +}; + +exports.encode = function (str) { + // This code was originally written by Brian White (mscdex) for the io.js core querystring library. + // It has been adapted here for stricter adherence to RFC 3986 + if (str.length === 0) { + return str; + } + + var string = typeof str === 'string' ? str : String(str); + + var out = ''; + for (var i = 0; i < string.length; ++i) { + var c = string.charCodeAt(i); + + if ( + c === 0x2D || // - + c === 0x2E || // . + c === 0x5F || // _ + c === 0x7E || // ~ + (c >= 0x30 && c <= 0x39) || // 0-9 + (c >= 0x41 && c <= 0x5A) || // a-z + (c >= 0x61 && c <= 0x7A) // A-Z + ) { + out += string.charAt(i); + continue; + } + + if (c < 0x80) { + out = out + hexTable[c]; + continue; + } + + if (c < 0x800) { + out = out + (hexTable[0xC0 | (c >> 6)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + if (c < 0xD800 || c >= 0xE000) { + out = out + (hexTable[0xE0 | (c >> 12)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + i += 1; + c = 0x10000 + (((c & 0x3FF) << 10) | (string.charCodeAt(i) & 0x3FF)); + out += hexTable[0xF0 | (c >> 18)] + hexTable[0x80 | ((c >> 12) & 0x3F)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]; // eslint-disable-line max-len + } + + return out; +}; + +exports.compact = function (obj, references) { + if (typeof obj !== 'object' || obj === null) { + return obj; + } + + var refs = references || []; + var lookup = refs.indexOf(obj); + if (lookup !== -1) { + return refs[lookup]; + } + + refs.push(obj); + + if (Array.isArray(obj)) { + var compacted = []; + + for (var i = 0; i < obj.length; ++i) { + if (obj[i] && typeof obj[i] === 'object') { + compacted.push(exports.compact(obj[i], refs)); + } else if (typeof obj[i] !== 'undefined') { + compacted.push(obj[i]); + } + } + + return compacted; + } + + var keys = Object.keys(obj); + keys.forEach(function (key) { + obj[key] = exports.compact(obj[key], refs); + }); + + return obj; +}; + +exports.isRegExp = function (obj) { + return Object.prototype.toString.call(obj) === '[object RegExp]'; +}; + +exports.isBuffer = function (obj) { + if (obj === null || typeof obj === 'undefined') { + return false; + } + + return !!(obj.constructor && obj.constructor.isBuffer && obj.constructor.isBuffer(obj)); +}; diff --git a/8 node/node_modules/qs/package.json b/8 node/node_modules/qs/package.json new file mode 100644 index 000000000..6077621fa --- /dev/null +++ b/8 node/node_modules/qs/package.json @@ -0,0 +1,78 @@ +{ + "_from": "qs@6.4.0", + "_id": "qs@6.4.0", + "_inBundle": false, + "_integrity": "sha1-E+JtKK1rD/qpExLNO/cI7TUecjM=", + "_location": "/qs", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "qs@6.4.0", + "name": "qs", + "escapedName": "qs", + "rawSpec": "6.4.0", + "saveSpec": null, + "fetchSpec": "6.4.0" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/qs/-/qs-6.4.0.tgz", + "_shasum": "13e26d28ad6b0ffaa91312cd3bf708ed351e7233", + "_spec": "qs@6.4.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "bugs": { + "url": "https://github.com/ljharb/qs/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Jordan Harband", + "email": "ljharb@gmail.com", + "url": "http://ljharb.codes" + } + ], + "dependencies": {}, + "deprecated": false, + "description": "A querystring parser that supports nesting and arrays, with a depth limit", + "devDependencies": { + "@ljharb/eslint-config": "^11.0.0", + "browserify": "^14.1.0", + "covert": "^1.1.0", + "eslint": "^3.17.0", + "evalmd": "^0.0.17", + "iconv-lite": "^0.4.15", + "mkdirp": "^0.5.1", + "parallelshell": "^2.0.0", + "qs-iconv": "^1.0.4", + "safe-publish-latest": "^1.1.1", + "tape": "^4.6.3" + }, + "engines": { + "node": ">=0.6" + }, + "homepage": "https://github.com/ljharb/qs", + "keywords": [ + "querystring", + "qs" + ], + "license": "BSD-3-Clause", + "main": "lib/index.js", + "name": "qs", + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/qs.git" + }, + "scripts": { + "coverage": "covert test", + "dist": "mkdirp dist && browserify --standalone Qs lib/index.js > dist/qs.js", + "lint": "eslint lib/*.js test/*.js", + "prepublish": "safe-publish-latest && npm run dist", + "pretest": "npm run --silent readme && npm run --silent lint", + "readme": "evalmd README.md", + "test": "npm run --silent coverage", + "tests-only": "node test" + }, + "version": "6.4.0" +} diff --git a/8 node/node_modules/qs/test/.eslintrc b/8 node/node_modules/qs/test/.eslintrc new file mode 100644 index 000000000..c4f52d029 --- /dev/null +++ b/8 node/node_modules/qs/test/.eslintrc @@ -0,0 +1,11 @@ +{ + "rules": { + "consistent-return": 2, + "max-lines": 0, + "max-nested-callbacks": [2, 3], + "max-statements": 0, + "no-extend-native": 0, + "no-magic-numbers": 0, + "sort-keys": 0 + } +} diff --git a/8 node/node_modules/qs/test/index.js b/8 node/node_modules/qs/test/index.js new file mode 100644 index 000000000..5e6bc8fbd --- /dev/null +++ b/8 node/node_modules/qs/test/index.js @@ -0,0 +1,7 @@ +'use strict'; + +require('./parse'); + +require('./stringify'); + +require('./utils'); diff --git a/8 node/node_modules/qs/test/parse.js b/8 node/node_modules/qs/test/parse.js new file mode 100644 index 000000000..e451e91fe --- /dev/null +++ b/8 node/node_modules/qs/test/parse.js @@ -0,0 +1,519 @@ +'use strict'; + +var test = require('tape'); +var qs = require('../'); +var iconv = require('iconv-lite'); + +test('parse()', function (t) { + t.test('parses a simple string', function (st) { + st.deepEqual(qs.parse('0=foo'), { 0: 'foo' }); + st.deepEqual(qs.parse('foo=c++'), { foo: 'c ' }); + st.deepEqual(qs.parse('a[>=]=23'), { a: { '>=': '23' } }); + st.deepEqual(qs.parse('a[<=>]==23'), { a: { '<=>': '=23' } }); + st.deepEqual(qs.parse('a[==]=23'), { a: { '==': '23' } }); + st.deepEqual(qs.parse('foo', { strictNullHandling: true }), { foo: null }); + st.deepEqual(qs.parse('foo'), { foo: '' }); + st.deepEqual(qs.parse('foo='), { foo: '' }); + st.deepEqual(qs.parse('foo=bar'), { foo: 'bar' }); + st.deepEqual(qs.parse(' foo = bar = baz '), { ' foo ': ' bar = baz ' }); + st.deepEqual(qs.parse('foo=bar=baz'), { foo: 'bar=baz' }); + st.deepEqual(qs.parse('foo=bar&bar=baz'), { foo: 'bar', bar: 'baz' }); + st.deepEqual(qs.parse('foo2=bar2&baz2='), { foo2: 'bar2', baz2: '' }); + st.deepEqual(qs.parse('foo=bar&baz', { strictNullHandling: true }), { foo: 'bar', baz: null }); + st.deepEqual(qs.parse('foo=bar&baz'), { foo: 'bar', baz: '' }); + st.deepEqual(qs.parse('cht=p3&chd=t:60,40&chs=250x100&chl=Hello|World'), { + cht: 'p3', + chd: 't:60,40', + chs: '250x100', + chl: 'Hello|World' + }); + st.end(); + }); + + t.test('allows enabling dot notation', function (st) { + st.deepEqual(qs.parse('a.b=c'), { 'a.b': 'c' }); + st.deepEqual(qs.parse('a.b=c', { allowDots: true }), { a: { b: 'c' } }); + st.end(); + }); + + t.deepEqual(qs.parse('a[b]=c'), { a: { b: 'c' } }, 'parses a single nested string'); + t.deepEqual(qs.parse('a[b][c]=d'), { a: { b: { c: 'd' } } }, 'parses a double nested string'); + t.deepEqual( + qs.parse('a[b][c][d][e][f][g][h]=i'), + { a: { b: { c: { d: { e: { f: { '[g][h]': 'i' } } } } } } }, + 'defaults to a depth of 5' + ); + + t.test('only parses one level when depth = 1', function (st) { + st.deepEqual(qs.parse('a[b][c]=d', { depth: 1 }), { a: { b: { '[c]': 'd' } } }); + st.deepEqual(qs.parse('a[b][c][d]=e', { depth: 1 }), { a: { b: { '[c][d]': 'e' } } }); + st.end(); + }); + + t.deepEqual(qs.parse('a=b&a=c'), { a: ['b', 'c'] }, 'parses a simple array'); + + t.test('parses an explicit array', function (st) { + st.deepEqual(qs.parse('a[]=b'), { a: ['b'] }); + st.deepEqual(qs.parse('a[]=b&a[]=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[]=b&a[]=c&a[]=d'), { a: ['b', 'c', 'd'] }); + st.end(); + }); + + t.test('parses a mix of simple and explicit arrays', function (st) { + st.deepEqual(qs.parse('a=b&a[]=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[]=b&a=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[0]=b&a=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a=b&a[0]=c'), { a: ['b', 'c'] }); + + st.deepEqual(qs.parse('a[1]=b&a=c', { arrayLimit: 20 }), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[]=b&a=c', { arrayLimit: 0 }), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[]=b&a=c'), { a: ['b', 'c'] }); + + st.deepEqual(qs.parse('a=b&a[1]=c', { arrayLimit: 20 }), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a=b&a[]=c', { arrayLimit: 0 }), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a=b&a[]=c'), { a: ['b', 'c'] }); + + st.end(); + }); + + t.test('parses a nested array', function (st) { + st.deepEqual(qs.parse('a[b][]=c&a[b][]=d'), { a: { b: ['c', 'd'] } }); + st.deepEqual(qs.parse('a[>=]=25'), { a: { '>=': '25' } }); + st.end(); + }); + + t.test('allows to specify array indices', function (st) { + st.deepEqual(qs.parse('a[1]=c&a[0]=b&a[2]=d'), { a: ['b', 'c', 'd'] }); + st.deepEqual(qs.parse('a[1]=c&a[0]=b'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[1]=c', { arrayLimit: 20 }), { a: ['c'] }); + st.deepEqual(qs.parse('a[1]=c', { arrayLimit: 0 }), { a: { 1: 'c' } }); + st.deepEqual(qs.parse('a[1]=c'), { a: ['c'] }); + st.end(); + }); + + t.test('limits specific array indices to arrayLimit', function (st) { + st.deepEqual(qs.parse('a[20]=a', { arrayLimit: 20 }), { a: ['a'] }); + st.deepEqual(qs.parse('a[21]=a', { arrayLimit: 20 }), { a: { 21: 'a' } }); + st.end(); + }); + + t.deepEqual(qs.parse('a[12b]=c'), { a: { '12b': 'c' } }, 'supports keys that begin with a number'); + + t.test('supports encoded = signs', function (st) { + st.deepEqual(qs.parse('he%3Dllo=th%3Dere'), { 'he=llo': 'th=ere' }); + st.end(); + }); + + t.test('is ok with url encoded strings', function (st) { + st.deepEqual(qs.parse('a[b%20c]=d'), { a: { 'b c': 'd' } }); + st.deepEqual(qs.parse('a[b]=c%20d'), { a: { b: 'c d' } }); + st.end(); + }); + + t.test('allows brackets in the value', function (st) { + st.deepEqual(qs.parse('pets=["tobi"]'), { pets: '["tobi"]' }); + st.deepEqual(qs.parse('operators=[">=", "<="]'), { operators: '[">=", "<="]' }); + st.end(); + }); + + t.test('allows empty values', function (st) { + st.deepEqual(qs.parse(''), {}); + st.deepEqual(qs.parse(null), {}); + st.deepEqual(qs.parse(undefined), {}); + st.end(); + }); + + t.test('transforms arrays to objects', function (st) { + st.deepEqual(qs.parse('foo[0]=bar&foo[bad]=baz'), { foo: { 0: 'bar', bad: 'baz' } }); + st.deepEqual(qs.parse('foo[bad]=baz&foo[0]=bar'), { foo: { bad: 'baz', 0: 'bar' } }); + st.deepEqual(qs.parse('foo[bad]=baz&foo[]=bar'), { foo: { bad: 'baz', 0: 'bar' } }); + st.deepEqual(qs.parse('foo[]=bar&foo[bad]=baz'), { foo: { 0: 'bar', bad: 'baz' } }); + st.deepEqual(qs.parse('foo[bad]=baz&foo[]=bar&foo[]=foo'), { foo: { bad: 'baz', 0: 'bar', 1: 'foo' } }); + st.deepEqual(qs.parse('foo[0][a]=a&foo[0][b]=b&foo[1][a]=aa&foo[1][b]=bb'), { foo: [{ a: 'a', b: 'b' }, { a: 'aa', b: 'bb' }] }); + + st.deepEqual(qs.parse('a[]=b&a[t]=u&a[hasOwnProperty]=c', { allowPrototypes: false }), { a: { 0: 'b', t: 'u' } }); + st.deepEqual(qs.parse('a[]=b&a[t]=u&a[hasOwnProperty]=c', { allowPrototypes: true }), { a: { 0: 'b', t: 'u', hasOwnProperty: 'c' } }); + st.deepEqual(qs.parse('a[]=b&a[hasOwnProperty]=c&a[x]=y', { allowPrototypes: false }), { a: { 0: 'b', x: 'y' } }); + st.deepEqual(qs.parse('a[]=b&a[hasOwnProperty]=c&a[x]=y', { allowPrototypes: true }), { a: { 0: 'b', hasOwnProperty: 'c', x: 'y' } }); + st.end(); + }); + + t.test('transforms arrays to objects (dot notation)', function (st) { + st.deepEqual(qs.parse('foo[0].baz=bar&fool.bad=baz', { allowDots: true }), { foo: [{ baz: 'bar' }], fool: { bad: 'baz' } }); + st.deepEqual(qs.parse('foo[0].baz=bar&fool.bad.boo=baz', { allowDots: true }), { foo: [{ baz: 'bar' }], fool: { bad: { boo: 'baz' } } }); + st.deepEqual(qs.parse('foo[0][0].baz=bar&fool.bad=baz', { allowDots: true }), { foo: [[{ baz: 'bar' }]], fool: { bad: 'baz' } }); + st.deepEqual(qs.parse('foo[0].baz[0]=15&foo[0].bar=2', { allowDots: true }), { foo: [{ baz: ['15'], bar: '2' }] }); + st.deepEqual(qs.parse('foo[0].baz[0]=15&foo[0].baz[1]=16&foo[0].bar=2', { allowDots: true }), { foo: [{ baz: ['15', '16'], bar: '2' }] }); + st.deepEqual(qs.parse('foo.bad=baz&foo[0]=bar', { allowDots: true }), { foo: { bad: 'baz', 0: 'bar' } }); + st.deepEqual(qs.parse('foo.bad=baz&foo[]=bar', { allowDots: true }), { foo: { bad: 'baz', 0: 'bar' } }); + st.deepEqual(qs.parse('foo[]=bar&foo.bad=baz', { allowDots: true }), { foo: { 0: 'bar', bad: 'baz' } }); + st.deepEqual(qs.parse('foo.bad=baz&foo[]=bar&foo[]=foo', { allowDots: true }), { foo: { bad: 'baz', 0: 'bar', 1: 'foo' } }); + st.deepEqual(qs.parse('foo[0].a=a&foo[0].b=b&foo[1].a=aa&foo[1].b=bb', { allowDots: true }), { foo: [{ a: 'a', b: 'b' }, { a: 'aa', b: 'bb' }] }); + st.end(); + }); + + t.test('correctly prunes undefined values when converting an array to an object', function (st) { + st.deepEqual(qs.parse('a[2]=b&a[99999999]=c'), { a: { 2: 'b', 99999999: 'c' } }); + st.end(); + }); + + t.test('supports malformed uri characters', function (st) { + st.deepEqual(qs.parse('{%:%}', { strictNullHandling: true }), { '{%:%}': null }); + st.deepEqual(qs.parse('{%:%}='), { '{%:%}': '' }); + st.deepEqual(qs.parse('foo=%:%}'), { foo: '%:%}' }); + st.end(); + }); + + t.test('doesn\'t produce empty keys', function (st) { + st.deepEqual(qs.parse('_r=1&'), { _r: '1' }); + st.end(); + }); + + t.test('cannot access Object prototype', function (st) { + qs.parse('constructor[prototype][bad]=bad'); + qs.parse('bad[constructor][prototype][bad]=bad'); + st.equal(typeof Object.prototype.bad, 'undefined'); + st.end(); + }); + + t.test('parses arrays of objects', function (st) { + st.deepEqual(qs.parse('a[][b]=c'), { a: [{ b: 'c' }] }); + st.deepEqual(qs.parse('a[0][b]=c'), { a: [{ b: 'c' }] }); + st.end(); + }); + + t.test('allows for empty strings in arrays', function (st) { + st.deepEqual(qs.parse('a[]=b&a[]=&a[]=c'), { a: ['b', '', 'c'] }); + + st.deepEqual( + qs.parse('a[0]=b&a[1]&a[2]=c&a[19]=', { strictNullHandling: true, arrayLimit: 20 }), + { a: ['b', null, 'c', ''] }, + 'with arrayLimit 20 + array indices: null then empty string works' + ); + st.deepEqual( + qs.parse('a[]=b&a[]&a[]=c&a[]=', { strictNullHandling: true, arrayLimit: 0 }), + { a: ['b', null, 'c', ''] }, + 'with arrayLimit 0 + array brackets: null then empty string works' + ); + + st.deepEqual( + qs.parse('a[0]=b&a[1]=&a[2]=c&a[19]', { strictNullHandling: true, arrayLimit: 20 }), + { a: ['b', '', 'c', null] }, + 'with arrayLimit 20 + array indices: empty string then null works' + ); + st.deepEqual( + qs.parse('a[]=b&a[]=&a[]=c&a[]', { strictNullHandling: true, arrayLimit: 0 }), + { a: ['b', '', 'c', null] }, + 'with arrayLimit 0 + array brackets: empty string then null works' + ); + + st.deepEqual( + qs.parse('a[]=&a[]=b&a[]=c'), + { a: ['', 'b', 'c'] }, + 'array brackets: empty strings work' + ); + st.end(); + }); + + t.test('compacts sparse arrays', function (st) { + st.deepEqual(qs.parse('a[10]=1&a[2]=2', { arrayLimit: 20 }), { a: ['2', '1'] }); + st.deepEqual(qs.parse('a[1][b][2][c]=1', { arrayLimit: 20 }), { a: [{ b: [{ c: '1' }] }] }); + st.deepEqual(qs.parse('a[1][2][3][c]=1', { arrayLimit: 20 }), { a: [[[{ c: '1' }]]] }); + st.deepEqual(qs.parse('a[1][2][3][c][1]=1', { arrayLimit: 20 }), { a: [[[{ c: ['1'] }]]] }); + st.end(); + }); + + t.test('parses semi-parsed strings', function (st) { + st.deepEqual(qs.parse({ 'a[b]': 'c' }), { a: { b: 'c' } }); + st.deepEqual(qs.parse({ 'a[b]': 'c', 'a[d]': 'e' }), { a: { b: 'c', d: 'e' } }); + st.end(); + }); + + t.test('parses buffers correctly', function (st) { + var b = new Buffer('test'); + st.deepEqual(qs.parse({ a: b }), { a: b }); + st.end(); + }); + + t.test('continues parsing when no parent is found', function (st) { + st.deepEqual(qs.parse('[]=&a=b'), { 0: '', a: 'b' }); + st.deepEqual(qs.parse('[]&a=b', { strictNullHandling: true }), { 0: null, a: 'b' }); + st.deepEqual(qs.parse('[foo]=bar'), { foo: 'bar' }); + st.end(); + }); + + t.test('does not error when parsing a very long array', function (st) { + var str = 'a[]=a'; + while (Buffer.byteLength(str) < 128 * 1024) { + str = str + '&' + str; + } + + st.doesNotThrow(function () { + qs.parse(str); + }); + + st.end(); + }); + + t.test('should not throw when a native prototype has an enumerable property', { parallel: false }, function (st) { + Object.prototype.crash = ''; + Array.prototype.crash = ''; + st.doesNotThrow(qs.parse.bind(null, 'a=b')); + st.deepEqual(qs.parse('a=b'), { a: 'b' }); + st.doesNotThrow(qs.parse.bind(null, 'a[][b]=c')); + st.deepEqual(qs.parse('a[][b]=c'), { a: [{ b: 'c' }] }); + delete Object.prototype.crash; + delete Array.prototype.crash; + st.end(); + }); + + t.test('parses a string with an alternative string delimiter', function (st) { + st.deepEqual(qs.parse('a=b;c=d', { delimiter: ';' }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('parses a string with an alternative RegExp delimiter', function (st) { + st.deepEqual(qs.parse('a=b; c=d', { delimiter: /[;,] */ }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('does not use non-splittable objects as delimiters', function (st) { + st.deepEqual(qs.parse('a=b&c=d', { delimiter: true }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('allows overriding parameter limit', function (st) { + st.deepEqual(qs.parse('a=b&c=d', { parameterLimit: 1 }), { a: 'b' }); + st.end(); + }); + + t.test('allows setting the parameter limit to Infinity', function (st) { + st.deepEqual(qs.parse('a=b&c=d', { parameterLimit: Infinity }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('allows overriding array limit', function (st) { + st.deepEqual(qs.parse('a[0]=b', { arrayLimit: -1 }), { a: { 0: 'b' } }); + st.deepEqual(qs.parse('a[-1]=b', { arrayLimit: -1 }), { a: { '-1': 'b' } }); + st.deepEqual(qs.parse('a[0]=b&a[1]=c', { arrayLimit: 0 }), { a: { 0: 'b', 1: 'c' } }); + st.end(); + }); + + t.test('allows disabling array parsing', function (st) { + st.deepEqual(qs.parse('a[0]=b&a[1]=c', { parseArrays: false }), { a: { 0: 'b', 1: 'c' } }); + st.end(); + }); + + t.test('parses an object', function (st) { + var input = { + 'user[name]': { 'pop[bob]': 3 }, + 'user[email]': null + }; + + var expected = { + user: { + name: { 'pop[bob]': 3 }, + email: null + } + }; + + var result = qs.parse(input); + + st.deepEqual(result, expected); + st.end(); + }); + + t.test('parses an object in dot notation', function (st) { + var input = { + 'user.name': { 'pop[bob]': 3 }, + 'user.email.': null + }; + + var expected = { + user: { + name: { 'pop[bob]': 3 }, + email: null + } + }; + + var result = qs.parse(input, { allowDots: true }); + + st.deepEqual(result, expected); + st.end(); + }); + + t.test('parses an object and not child values', function (st) { + var input = { + 'user[name]': { 'pop[bob]': { test: 3 } }, + 'user[email]': null + }; + + var expected = { + user: { + name: { 'pop[bob]': { test: 3 } }, + email: null + } + }; + + var result = qs.parse(input); + + st.deepEqual(result, expected); + st.end(); + }); + + t.test('does not blow up when Buffer global is missing', function (st) { + var tempBuffer = global.Buffer; + delete global.Buffer; + var result = qs.parse('a=b&c=d'); + global.Buffer = tempBuffer; + st.deepEqual(result, { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('does not crash when parsing circular references', function (st) { + var a = {}; + a.b = a; + + var parsed; + + st.doesNotThrow(function () { + parsed = qs.parse({ 'foo[bar]': 'baz', 'foo[baz]': a }); + }); + + st.equal('foo' in parsed, true, 'parsed has "foo" property'); + st.equal('bar' in parsed.foo, true); + st.equal('baz' in parsed.foo, true); + st.equal(parsed.foo.bar, 'baz'); + st.deepEqual(parsed.foo.baz, a); + st.end(); + }); + + t.test('parses null objects correctly', { skip: !Object.create }, function (st) { + var a = Object.create(null); + a.b = 'c'; + + st.deepEqual(qs.parse(a), { b: 'c' }); + var result = qs.parse({ a: a }); + st.equal('a' in result, true, 'result has "a" property'); + st.deepEqual(result.a, a); + st.end(); + }); + + t.test('parses dates correctly', function (st) { + var now = new Date(); + st.deepEqual(qs.parse({ a: now }), { a: now }); + st.end(); + }); + + t.test('parses regular expressions correctly', function (st) { + var re = /^test$/; + st.deepEqual(qs.parse({ a: re }), { a: re }); + st.end(); + }); + + t.test('does not allow overwriting prototype properties', function (st) { + st.deepEqual(qs.parse('a[hasOwnProperty]=b', { allowPrototypes: false }), {}); + st.deepEqual(qs.parse('hasOwnProperty=b', { allowPrototypes: false }), {}); + + st.deepEqual( + qs.parse('toString', { allowPrototypes: false }), + {}, + 'bare "toString" results in {}' + ); + + st.end(); + }); + + t.test('can allow overwriting prototype properties', function (st) { + st.deepEqual(qs.parse('a[hasOwnProperty]=b', { allowPrototypes: true }), { a: { hasOwnProperty: 'b' } }); + st.deepEqual(qs.parse('hasOwnProperty=b', { allowPrototypes: true }), { hasOwnProperty: 'b' }); + + st.deepEqual( + qs.parse('toString', { allowPrototypes: true }), + { toString: '' }, + 'bare "toString" results in { toString: "" }' + ); + + st.end(); + }); + + t.test('params starting with a closing bracket', function (st) { + st.deepEqual(qs.parse(']=toString'), { ']': 'toString' }); + st.deepEqual(qs.parse(']]=toString'), { ']]': 'toString' }); + st.deepEqual(qs.parse(']hello]=toString'), { ']hello]': 'toString' }); + st.end(); + }); + + t.test('params starting with a starting bracket', function (st) { + st.deepEqual(qs.parse('[=toString'), { '[': 'toString' }); + st.deepEqual(qs.parse('[[=toString'), { '[[': 'toString' }); + st.deepEqual(qs.parse('[hello[=toString'), { '[hello[': 'toString' }); + st.end(); + }); + + t.test('add keys to objects', function (st) { + st.deepEqual( + qs.parse('a[b]=c&a=d'), + { a: { b: 'c', d: true } }, + 'can add keys to objects' + ); + + st.deepEqual( + qs.parse('a[b]=c&a=toString'), + { a: { b: 'c' } }, + 'can not overwrite prototype' + ); + + st.deepEqual( + qs.parse('a[b]=c&a=toString', { allowPrototypes: true }), + { a: { b: 'c', toString: true } }, + 'can overwrite prototype with allowPrototypes true' + ); + + st.deepEqual( + qs.parse('a[b]=c&a=toString', { plainObjects: true }), + { a: { b: 'c', toString: true } }, + 'can overwrite prototype with plainObjects true' + ); + + st.end(); + }); + + t.test('can return null objects', { skip: !Object.create }, function (st) { + var expected = Object.create(null); + expected.a = Object.create(null); + expected.a.b = 'c'; + expected.a.hasOwnProperty = 'd'; + st.deepEqual(qs.parse('a[b]=c&a[hasOwnProperty]=d', { plainObjects: true }), expected); + st.deepEqual(qs.parse(null, { plainObjects: true }), Object.create(null)); + var expectedArray = Object.create(null); + expectedArray.a = Object.create(null); + expectedArray.a[0] = 'b'; + expectedArray.a.c = 'd'; + st.deepEqual(qs.parse('a[]=b&a[c]=d', { plainObjects: true }), expectedArray); + st.end(); + }); + + t.test('can parse with custom encoding', function (st) { + st.deepEqual(qs.parse('%8c%a7=%91%e5%8d%e3%95%7b', { + decoder: function (str) { + var reg = /%([0-9A-F]{2})/ig; + var result = []; + var parts = reg.exec(str); + while (parts) { + result.push(parseInt(parts[1], 16)); + parts = reg.exec(str); + } + return iconv.decode(new Buffer(result), 'shift_jis').toString(); + } + }), { 県: '大阪府' }); + st.end(); + }); + + t.test('throws error with wrong decoder', function (st) { + st.throws(function () { + qs.parse({}, { decoder: 'string' }); + }, new TypeError('Decoder has to be a function.')); + st.end(); + }); +}); diff --git a/8 node/node_modules/qs/test/stringify.js b/8 node/node_modules/qs/test/stringify.js new file mode 100644 index 000000000..711dae507 --- /dev/null +++ b/8 node/node_modules/qs/test/stringify.js @@ -0,0 +1,567 @@ +'use strict'; + +var test = require('tape'); +var qs = require('../'); +var iconv = require('iconv-lite'); + +test('stringify()', function (t) { + t.test('stringifies a querystring object', function (st) { + st.equal(qs.stringify({ a: 'b' }), 'a=b'); + st.equal(qs.stringify({ a: 1 }), 'a=1'); + st.equal(qs.stringify({ a: 1, b: 2 }), 'a=1&b=2'); + st.equal(qs.stringify({ a: 'A_Z' }), 'a=A_Z'); + st.equal(qs.stringify({ a: '€' }), 'a=%E2%82%AC'); + st.equal(qs.stringify({ a: '' }), 'a=%EE%80%80'); + st.equal(qs.stringify({ a: 'א' }), 'a=%D7%90'); + st.equal(qs.stringify({ a: '𐐷' }), 'a=%F0%90%90%B7'); + st.end(); + }); + + t.test('stringifies a nested object', function (st) { + st.equal(qs.stringify({ a: { b: 'c' } }), 'a%5Bb%5D=c'); + st.equal(qs.stringify({ a: { b: { c: { d: 'e' } } } }), 'a%5Bb%5D%5Bc%5D%5Bd%5D=e'); + st.end(); + }); + + t.test('stringifies a nested object with dots notation', function (st) { + st.equal(qs.stringify({ a: { b: 'c' } }, { allowDots: true }), 'a.b=c'); + st.equal(qs.stringify({ a: { b: { c: { d: 'e' } } } }, { allowDots: true }), 'a.b.c.d=e'); + st.end(); + }); + + t.test('stringifies an array value', function (st) { + st.equal( + qs.stringify({ a: ['b', 'c', 'd'] }, { arrayFormat: 'indices' }), + 'a%5B0%5D=b&a%5B1%5D=c&a%5B2%5D=d', + 'indices => indices' + ); + st.equal( + qs.stringify({ a: ['b', 'c', 'd'] }, { arrayFormat: 'brackets' }), + 'a%5B%5D=b&a%5B%5D=c&a%5B%5D=d', + 'brackets => brackets' + ); + st.equal( + qs.stringify({ a: ['b', 'c', 'd'] }), + 'a%5B0%5D=b&a%5B1%5D=c&a%5B2%5D=d', + 'default => indices' + ); + st.end(); + }); + + t.test('omits nulls when asked', function (st) { + st.equal(qs.stringify({ a: 'b', c: null }, { skipNulls: true }), 'a=b'); + st.end(); + }); + + t.test('omits nested nulls when asked', function (st) { + st.equal(qs.stringify({ a: { b: 'c', d: null } }, { skipNulls: true }), 'a%5Bb%5D=c'); + st.end(); + }); + + t.test('omits array indices when asked', function (st) { + st.equal(qs.stringify({ a: ['b', 'c', 'd'] }, { indices: false }), 'a=b&a=c&a=d'); + st.end(); + }); + + t.test('stringifies a nested array value', function (st) { + st.equal(qs.stringify({ a: { b: ['c', 'd'] } }, { arrayFormat: 'indices' }), 'a%5Bb%5D%5B0%5D=c&a%5Bb%5D%5B1%5D=d'); + st.equal(qs.stringify({ a: { b: ['c', 'd'] } }, { arrayFormat: 'brackets' }), 'a%5Bb%5D%5B%5D=c&a%5Bb%5D%5B%5D=d'); + st.equal(qs.stringify({ a: { b: ['c', 'd'] } }), 'a%5Bb%5D%5B0%5D=c&a%5Bb%5D%5B1%5D=d'); + st.end(); + }); + + t.test('stringifies a nested array value with dots notation', function (st) { + st.equal( + qs.stringify( + { a: { b: ['c', 'd'] } }, + { allowDots: true, encode: false, arrayFormat: 'indices' } + ), + 'a.b[0]=c&a.b[1]=d', + 'indices: stringifies with dots + indices' + ); + st.equal( + qs.stringify( + { a: { b: ['c', 'd'] } }, + { allowDots: true, encode: false, arrayFormat: 'brackets' } + ), + 'a.b[]=c&a.b[]=d', + 'brackets: stringifies with dots + brackets' + ); + st.equal( + qs.stringify( + { a: { b: ['c', 'd'] } }, + { allowDots: true, encode: false } + ), + 'a.b[0]=c&a.b[1]=d', + 'default: stringifies with dots + indices' + ); + st.end(); + }); + + t.test('stringifies an object inside an array', function (st) { + st.equal( + qs.stringify({ a: [{ b: 'c' }] }, { arrayFormat: 'indices' }), + 'a%5B0%5D%5Bb%5D=c', + 'indices => brackets' + ); + st.equal( + qs.stringify({ a: [{ b: 'c' }] }, { arrayFormat: 'brackets' }), + 'a%5B%5D%5Bb%5D=c', + 'brackets => brackets' + ); + st.equal( + qs.stringify({ a: [{ b: 'c' }] }), + 'a%5B0%5D%5Bb%5D=c', + 'default => indices' + ); + + st.equal( + qs.stringify({ a: [{ b: { c: [1] } }] }, { arrayFormat: 'indices' }), + 'a%5B0%5D%5Bb%5D%5Bc%5D%5B0%5D=1', + 'indices => indices' + ); + + st.equal( + qs.stringify({ a: [{ b: { c: [1] } }] }, { arrayFormat: 'brackets' }), + 'a%5B%5D%5Bb%5D%5Bc%5D%5B%5D=1', + 'brackets => brackets' + ); + + st.equal( + qs.stringify({ a: [{ b: { c: [1] } }] }), + 'a%5B0%5D%5Bb%5D%5Bc%5D%5B0%5D=1', + 'default => indices' + ); + + st.end(); + }); + + t.test('stringifies an array with mixed objects and primitives', function (st) { + st.equal( + qs.stringify({ a: [{ b: 1 }, 2, 3] }, { encode: false, arrayFormat: 'indices' }), + 'a[0][b]=1&a[1]=2&a[2]=3', + 'indices => indices' + ); + st.equal( + qs.stringify({ a: [{ b: 1 }, 2, 3] }, { encode: false, arrayFormat: 'brackets' }), + 'a[][b]=1&a[]=2&a[]=3', + 'brackets => brackets' + ); + st.equal( + qs.stringify({ a: [{ b: 1 }, 2, 3] }, { encode: false }), + 'a[0][b]=1&a[1]=2&a[2]=3', + 'default => indices' + ); + + st.end(); + }); + + t.test('stringifies an object inside an array with dots notation', function (st) { + st.equal( + qs.stringify( + { a: [{ b: 'c' }] }, + { allowDots: true, encode: false, arrayFormat: 'indices' } + ), + 'a[0].b=c', + 'indices => indices' + ); + st.equal( + qs.stringify( + { a: [{ b: 'c' }] }, + { allowDots: true, encode: false, arrayFormat: 'brackets' } + ), + 'a[].b=c', + 'brackets => brackets' + ); + st.equal( + qs.stringify( + { a: [{ b: 'c' }] }, + { allowDots: true, encode: false } + ), + 'a[0].b=c', + 'default => indices' + ); + + st.equal( + qs.stringify( + { a: [{ b: { c: [1] } }] }, + { allowDots: true, encode: false, arrayFormat: 'indices' } + ), + 'a[0].b.c[0]=1', + 'indices => indices' + ); + st.equal( + qs.stringify( + { a: [{ b: { c: [1] } }] }, + { allowDots: true, encode: false, arrayFormat: 'brackets' } + ), + 'a[].b.c[]=1', + 'brackets => brackets' + ); + st.equal( + qs.stringify( + { a: [{ b: { c: [1] } }] }, + { allowDots: true, encode: false } + ), + 'a[0].b.c[0]=1', + 'default => indices' + ); + + st.end(); + }); + + t.test('does not omit object keys when indices = false', function (st) { + st.equal(qs.stringify({ a: [{ b: 'c' }] }, { indices: false }), 'a%5Bb%5D=c'); + st.end(); + }); + + t.test('uses indices notation for arrays when indices=true', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { indices: true }), 'a%5B0%5D=b&a%5B1%5D=c'); + st.end(); + }); + + t.test('uses indices notation for arrays when no arrayFormat is specified', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }), 'a%5B0%5D=b&a%5B1%5D=c'); + st.end(); + }); + + t.test('uses indices notation for arrays when no arrayFormat=indices', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'indices' }), 'a%5B0%5D=b&a%5B1%5D=c'); + st.end(); + }); + + t.test('uses repeat notation for arrays when no arrayFormat=repeat', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'repeat' }), 'a=b&a=c'); + st.end(); + }); + + t.test('uses brackets notation for arrays when no arrayFormat=brackets', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'brackets' }), 'a%5B%5D=b&a%5B%5D=c'); + st.end(); + }); + + t.test('stringifies a complicated object', function (st) { + st.equal(qs.stringify({ a: { b: 'c', d: 'e' } }), 'a%5Bb%5D=c&a%5Bd%5D=e'); + st.end(); + }); + + t.test('stringifies an empty value', function (st) { + st.equal(qs.stringify({ a: '' }), 'a='); + st.equal(qs.stringify({ a: null }, { strictNullHandling: true }), 'a'); + + st.equal(qs.stringify({ a: '', b: '' }), 'a=&b='); + st.equal(qs.stringify({ a: null, b: '' }, { strictNullHandling: true }), 'a&b='); + + st.equal(qs.stringify({ a: { b: '' } }), 'a%5Bb%5D='); + st.equal(qs.stringify({ a: { b: null } }, { strictNullHandling: true }), 'a%5Bb%5D'); + st.equal(qs.stringify({ a: { b: null } }, { strictNullHandling: false }), 'a%5Bb%5D='); + + st.end(); + }); + + t.test('stringifies a null object', { skip: !Object.create }, function (st) { + var obj = Object.create(null); + obj.a = 'b'; + st.equal(qs.stringify(obj), 'a=b'); + st.end(); + }); + + t.test('returns an empty string for invalid input', function (st) { + st.equal(qs.stringify(undefined), ''); + st.equal(qs.stringify(false), ''); + st.equal(qs.stringify(null), ''); + st.equal(qs.stringify(''), ''); + st.end(); + }); + + t.test('stringifies an object with a null object as a child', { skip: !Object.create }, function (st) { + var obj = { a: Object.create(null) }; + + obj.a.b = 'c'; + st.equal(qs.stringify(obj), 'a%5Bb%5D=c'); + st.end(); + }); + + t.test('drops keys with a value of undefined', function (st) { + st.equal(qs.stringify({ a: undefined }), ''); + + st.equal(qs.stringify({ a: { b: undefined, c: null } }, { strictNullHandling: true }), 'a%5Bc%5D'); + st.equal(qs.stringify({ a: { b: undefined, c: null } }, { strictNullHandling: false }), 'a%5Bc%5D='); + st.equal(qs.stringify({ a: { b: undefined, c: '' } }), 'a%5Bc%5D='); + st.end(); + }); + + t.test('url encodes values', function (st) { + st.equal(qs.stringify({ a: 'b c' }), 'a=b%20c'); + st.end(); + }); + + t.test('stringifies a date', function (st) { + var now = new Date(); + var str = 'a=' + encodeURIComponent(now.toISOString()); + st.equal(qs.stringify({ a: now }), str); + st.end(); + }); + + t.test('stringifies the weird object from qs', function (st) { + st.equal(qs.stringify({ 'my weird field': '~q1!2"\'w$5&7/z8)?' }), 'my%20weird%20field=~q1%212%22%27w%245%267%2Fz8%29%3F'); + st.end(); + }); + + t.test('skips properties that are part of the object prototype', function (st) { + Object.prototype.crash = 'test'; + st.equal(qs.stringify({ a: 'b' }), 'a=b'); + st.equal(qs.stringify({ a: { b: 'c' } }), 'a%5Bb%5D=c'); + delete Object.prototype.crash; + st.end(); + }); + + t.test('stringifies boolean values', function (st) { + st.equal(qs.stringify({ a: true }), 'a=true'); + st.equal(qs.stringify({ a: { b: true } }), 'a%5Bb%5D=true'); + st.equal(qs.stringify({ b: false }), 'b=false'); + st.equal(qs.stringify({ b: { c: false } }), 'b%5Bc%5D=false'); + st.end(); + }); + + t.test('stringifies buffer values', function (st) { + st.equal(qs.stringify({ a: new Buffer('test') }), 'a=test'); + st.equal(qs.stringify({ a: { b: new Buffer('test') } }), 'a%5Bb%5D=test'); + st.end(); + }); + + t.test('stringifies an object using an alternative delimiter', function (st) { + st.equal(qs.stringify({ a: 'b', c: 'd' }, { delimiter: ';' }), 'a=b;c=d'); + st.end(); + }); + + t.test('doesn\'t blow up when Buffer global is missing', function (st) { + var tempBuffer = global.Buffer; + delete global.Buffer; + var result = qs.stringify({ a: 'b', c: 'd' }); + global.Buffer = tempBuffer; + st.equal(result, 'a=b&c=d'); + st.end(); + }); + + t.test('selects properties when filter=array', function (st) { + st.equal(qs.stringify({ a: 'b' }, { filter: ['a'] }), 'a=b'); + st.equal(qs.stringify({ a: 1 }, { filter: [] }), ''); + + st.equal( + qs.stringify( + { a: { b: [1, 2, 3, 4], c: 'd' }, c: 'f' }, + { filter: ['a', 'b', 0, 2], arrayFormat: 'indices' } + ), + 'a%5Bb%5D%5B0%5D=1&a%5Bb%5D%5B2%5D=3', + 'indices => indices' + ); + st.equal( + qs.stringify( + { a: { b: [1, 2, 3, 4], c: 'd' }, c: 'f' }, + { filter: ['a', 'b', 0, 2], arrayFormat: 'brackets' } + ), + 'a%5Bb%5D%5B%5D=1&a%5Bb%5D%5B%5D=3', + 'brackets => brackets' + ); + st.equal( + qs.stringify( + { a: { b: [1, 2, 3, 4], c: 'd' }, c: 'f' }, + { filter: ['a', 'b', 0, 2] } + ), + 'a%5Bb%5D%5B0%5D=1&a%5Bb%5D%5B2%5D=3', + 'default => indices' + ); + + st.end(); + }); + + t.test('supports custom representations when filter=function', function (st) { + var calls = 0; + var obj = { a: 'b', c: 'd', e: { f: new Date(1257894000000) } }; + var filterFunc = function (prefix, value) { + calls += 1; + if (calls === 1) { + st.equal(prefix, '', 'prefix is empty'); + st.equal(value, obj); + } else if (prefix === 'c') { + return void 0; + } else if (value instanceof Date) { + st.equal(prefix, 'e[f]'); + return value.getTime(); + } + return value; + }; + + st.equal(qs.stringify(obj, { filter: filterFunc }), 'a=b&e%5Bf%5D=1257894000000'); + st.equal(calls, 5); + st.end(); + }); + + t.test('can disable uri encoding', function (st) { + st.equal(qs.stringify({ a: 'b' }, { encode: false }), 'a=b'); + st.equal(qs.stringify({ a: { b: 'c' } }, { encode: false }), 'a[b]=c'); + st.equal(qs.stringify({ a: 'b', c: null }, { strictNullHandling: true, encode: false }), 'a=b&c'); + st.end(); + }); + + t.test('can sort the keys', function (st) { + var sort = function (a, b) { + return a.localeCompare(b); + }; + st.equal(qs.stringify({ a: 'c', z: 'y', b: 'f' }, { sort: sort }), 'a=c&b=f&z=y'); + st.equal(qs.stringify({ a: 'c', z: { j: 'a', i: 'b' }, b: 'f' }, { sort: sort }), 'a=c&b=f&z%5Bi%5D=b&z%5Bj%5D=a'); + st.end(); + }); + + t.test('can sort the keys at depth 3 or more too', function (st) { + var sort = function (a, b) { + return a.localeCompare(b); + }; + st.equal( + qs.stringify( + { a: 'a', z: { zj: { zjb: 'zjb', zja: 'zja' }, zi: { zib: 'zib', zia: 'zia' } }, b: 'b' }, + { sort: sort, encode: false } + ), + 'a=a&b=b&z[zi][zia]=zia&z[zi][zib]=zib&z[zj][zja]=zja&z[zj][zjb]=zjb' + ); + st.equal( + qs.stringify( + { a: 'a', z: { zj: { zjb: 'zjb', zja: 'zja' }, zi: { zib: 'zib', zia: 'zia' } }, b: 'b' }, + { sort: null, encode: false } + ), + 'a=a&z[zj][zjb]=zjb&z[zj][zja]=zja&z[zi][zib]=zib&z[zi][zia]=zia&b=b' + ); + st.end(); + }); + + t.test('can stringify with custom encoding', function (st) { + st.equal(qs.stringify({ 県: '大阪府', '': '' }, { + encoder: function (str) { + if (str.length === 0) { + return ''; + } + var buf = iconv.encode(str, 'shiftjis'); + var result = []; + for (var i = 0; i < buf.length; ++i) { + result.push(buf.readUInt8(i).toString(16)); + } + return '%' + result.join('%'); + } + }), '%8c%a7=%91%e5%8d%e3%95%7b&='); + st.end(); + }); + + t.test('throws error with wrong encoder', function (st) { + st.throws(function () { + qs.stringify({}, { encoder: 'string' }); + }, new TypeError('Encoder has to be a function.')); + st.end(); + }); + + t.test('can use custom encoder for a buffer object', { skip: typeof Buffer === 'undefined' }, function (st) { + st.equal(qs.stringify({ a: new Buffer([1]) }, { + encoder: function (buffer) { + if (typeof buffer === 'string') { + return buffer; + } + return String.fromCharCode(buffer.readUInt8(0) + 97); + } + }), 'a=b'); + st.end(); + }); + + t.test('serializeDate option', function (st) { + var date = new Date(); + st.equal( + qs.stringify({ a: date }), + 'a=' + date.toISOString().replace(/:/g, '%3A'), + 'default is toISOString' + ); + + var mutatedDate = new Date(); + mutatedDate.toISOString = function () { + throw new SyntaxError(); + }; + st.throws(function () { + mutatedDate.toISOString(); + }, SyntaxError); + st.equal( + qs.stringify({ a: mutatedDate }), + 'a=' + Date.prototype.toISOString.call(mutatedDate).replace(/:/g, '%3A'), + 'toISOString works even when method is not locally present' + ); + + var specificDate = new Date(6); + st.equal( + qs.stringify( + { a: specificDate }, + { serializeDate: function (d) { return d.getTime() * 7; } } + ), + 'a=42', + 'custom serializeDate function called' + ); + + st.end(); + }); + + t.test('RFC 1738 spaces serialization', function (st) { + st.equal(qs.stringify({ a: 'b c' }, { format: qs.formats.RFC1738 }), 'a=b+c'); + st.equal(qs.stringify({ 'a b': 'c d' }, { format: qs.formats.RFC1738 }), 'a+b=c+d'); + st.end(); + }); + + t.test('RFC 3986 spaces serialization', function (st) { + st.equal(qs.stringify({ a: 'b c' }, { format: qs.formats.RFC3986 }), 'a=b%20c'); + st.equal(qs.stringify({ 'a b': 'c d' }, { format: qs.formats.RFC3986 }), 'a%20b=c%20d'); + st.end(); + }); + + t.test('Backward compatibility to RFC 3986', function (st) { + st.equal(qs.stringify({ a: 'b c' }), 'a=b%20c'); + st.end(); + }); + + t.test('Edge cases and unknown formats', function (st) { + ['UFO1234', false, 1234, null, {}, []].forEach( + function (format) { + st.throws( + function () { + qs.stringify({ a: 'b c' }, { format: format }); + }, + new TypeError('Unknown format option provided.') + ); + } + ); + st.end(); + }); + + t.test('encodeValuesOnly', function (st) { + st.equal( + qs.stringify( + { a: 'b', c: ['d', 'e=f'], f: [['g'], ['h']] }, + { encodeValuesOnly: true } + ), + 'a=b&c[0]=d&c[1]=e%3Df&f[0][0]=g&f[1][0]=h' + ); + st.equal( + qs.stringify( + { a: 'b', c: ['d', 'e'], f: [['g'], ['h']] } + ), + 'a=b&c%5B0%5D=d&c%5B1%5D=e&f%5B0%5D%5B0%5D=g&f%5B1%5D%5B0%5D=h' + ); + st.end(); + }); + + t.test('encodeValuesOnly - strictNullHandling', function (st) { + st.equal( + qs.stringify( + { a: { b: null } }, + { encodeValuesOnly: true, strictNullHandling: true } + ), + 'a[b]' + ); + st.end(); + }); + +}); diff --git a/8 node/node_modules/qs/test/utils.js b/8 node/node_modules/qs/test/utils.js new file mode 100644 index 000000000..0721dd8ec --- /dev/null +++ b/8 node/node_modules/qs/test/utils.js @@ -0,0 +1,22 @@ +'use strict'; + +var test = require('tape'); +var utils = require('../lib/utils'); + +test('merge()', function (t) { + t.deepEqual(utils.merge({ a: 'b' }, { a: 'c' }), { a: ['b', 'c'] }, 'merges two objects with the same key'); + + var oneMerged = utils.merge({ foo: 'bar' }, { foo: { first: '123' } }); + t.deepEqual(oneMerged, { foo: ['bar', { first: '123' }] }, 'merges a standalone and an object into an array'); + + var twoMerged = utils.merge({ foo: ['bar', { first: '123' }] }, { foo: { second: '456' } }); + t.deepEqual(twoMerged, { foo: { 0: 'bar', 1: { first: '123' }, second: '456' } }, 'merges a standalone and two objects into an array'); + + var sandwiched = utils.merge({ foo: ['bar', { first: '123', second: '456' }] }, { foo: 'baz' }); + t.deepEqual(sandwiched, { foo: ['bar', { first: '123', second: '456' }, 'baz'] }, 'merges an object sandwiched by two standalones into an array'); + + var nestedArrays = utils.merge({ foo: ['baz'] }, { foo: ['bar', 'xyzzy'] }); + t.deepEqual(nestedArrays, { foo: ['baz', 'bar', 'xyzzy'] }); + + t.end(); +}); diff --git a/8 node/node_modules/range-parser/HISTORY.md b/8 node/node_modules/range-parser/HISTORY.md new file mode 100644 index 000000000..5e01eef46 --- /dev/null +++ b/8 node/node_modules/range-parser/HISTORY.md @@ -0,0 +1,51 @@ +1.2.0 / 2016-06-01 +================== + + * Add `combine` option to combine overlapping ranges + +1.1.0 / 2016-05-13 +================== + + * Fix incorrectly returning -1 when there is at least one valid range + * perf: remove internal function + +1.0.3 / 2015-10-29 +================== + + * perf: enable strict mode + +1.0.2 / 2014-09-08 +================== + + * Support Node.js 0.6 + +1.0.1 / 2014-09-07 +================== + + * Move repository to jshttp + +1.0.0 / 2013-12-11 +================== + + * Add repository to package.json + * Add MIT license + +0.0.4 / 2012-06-17 +================== + + * Change ret -1 for unsatisfiable and -2 when invalid + +0.0.3 / 2012-06-17 +================== + + * Fix last-byte-pos default to len - 1 + +0.0.2 / 2012-06-14 +================== + + * Add `.type` + +0.0.1 / 2012-06-11 +================== + + * Initial release diff --git a/8 node/node_modules/range-parser/LICENSE b/8 node/node_modules/range-parser/LICENSE new file mode 100644 index 000000000..359995436 --- /dev/null +++ b/8 node/node_modules/range-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk +Copyright (c) 2015-2016 Douglas Christopher Wilson [ +// { start: 0, end: 10 }, +// { start: 50, end: 60 } +// ] +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/range-parser.svg +[npm-url]: https://npmjs.org/package/range-parser +[node-version-image]: https://img.shields.io/node/v/range-parser.svg +[node-version-url]: https://nodejs.org/endownload +[travis-image]: https://img.shields.io/travis/jshttp/range-parser.svg +[travis-url]: https://travis-ci.org/jshttp/range-parser +[coveralls-image]: https://img.shields.io/coveralls/jshttp/range-parser.svg +[coveralls-url]: https://coveralls.io/r/jshttp/range-parser +[downloads-image]: https://img.shields.io/npm/dm/range-parser.svg +[downloads-url]: https://npmjs.org/package/range-parser diff --git a/8 node/node_modules/range-parser/index.js b/8 node/node_modules/range-parser/index.js new file mode 100644 index 000000000..83b2eb6b3 --- /dev/null +++ b/8 node/node_modules/range-parser/index.js @@ -0,0 +1,158 @@ +/*! + * range-parser + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = rangeParser + +/** + * Parse "Range" header `str` relative to the given file `size`. + * + * @param {Number} size + * @param {String} str + * @param {Object} [options] + * @return {Array} + * @public + */ + +function rangeParser (size, str, options) { + var index = str.indexOf('=') + + if (index === -1) { + return -2 + } + + // split the range string + var arr = str.slice(index + 1).split(',') + var ranges = [] + + // add ranges type + ranges.type = str.slice(0, index) + + // parse all ranges + for (var i = 0; i < arr.length; i++) { + var range = arr[i].split('-') + var start = parseInt(range[0], 10) + var end = parseInt(range[1], 10) + + // -nnn + if (isNaN(start)) { + start = size - end + end = size - 1 + // nnn- + } else if (isNaN(end)) { + end = size - 1 + } + + // limit last-byte-pos to current length + if (end > size - 1) { + end = size - 1 + } + + // invalid or unsatisifiable + if (isNaN(start) || isNaN(end) || start > end || start < 0) { + continue + } + + // add range + ranges.push({ + start: start, + end: end + }) + } + + if (ranges.length < 1) { + // unsatisifiable + return -1 + } + + return options && options.combine + ? combineRanges(ranges) + : ranges +} + +/** + * Combine overlapping & adjacent ranges. + * @private + */ + +function combineRanges (ranges) { + var ordered = ranges.map(mapWithIndex).sort(sortByRangeStart) + + for (var j = 0, i = 1; i < ordered.length; i++) { + var range = ordered[i] + var current = ordered[j] + + if (range.start > current.end + 1) { + // next range + ordered[++j] = range + } else if (range.end > current.end) { + // extend range + current.end = range.end + current.index = Math.min(current.index, range.index) + } + } + + // trim ordered array + ordered.length = j + 1 + + // generate combined range + var combined = ordered.sort(sortByRangeIndex).map(mapWithoutIndex) + + // copy ranges type + combined.type = ranges.type + + return combined +} + +/** + * Map function to add index value to ranges. + * @private + */ + +function mapWithIndex (range, index) { + return { + start: range.start, + end: range.end, + index: index + } +} + +/** + * Map function to remove index value from ranges. + * @private + */ + +function mapWithoutIndex (range) { + return { + start: range.start, + end: range.end + } +} + +/** + * Sort function to sort ranges by index. + * @private + */ + +function sortByRangeIndex (a, b) { + return a.index - b.index +} + +/** + * Sort function to sort ranges by start position. + * @private + */ + +function sortByRangeStart (a, b) { + return a.start - b.start +} diff --git a/8 node/node_modules/range-parser/package.json b/8 node/node_modules/range-parser/package.json new file mode 100644 index 000000000..a3add8573 --- /dev/null +++ b/8 node/node_modules/range-parser/package.json @@ -0,0 +1,87 @@ +{ + "_from": "range-parser@~1.2.0", + "_id": "range-parser@1.2.0", + "_inBundle": false, + "_integrity": "sha1-9JvmtIeJTdxA3MlKMi9hEJLgDV4=", + "_location": "/range-parser", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "range-parser@~1.2.0", + "name": "range-parser", + "escapedName": "range-parser", + "rawSpec": "~1.2.0", + "saveSpec": null, + "fetchSpec": "~1.2.0" + }, + "_requiredBy": [ + "/express", + "/send" + ], + "_resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.0.tgz", + "_shasum": "f49be6b487894ddc40dcc94a322f611092e00d5e", + "_spec": "range-parser@~1.2.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + }, + "bugs": { + "url": "https://github.com/jshttp/range-parser/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "James Wyatt Cready", + "email": "wyatt.cready@lanetix.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "deprecated": false, + "description": "Range header field string parser", + "devDependencies": { + "eslint": "2.11.1", + "eslint-config-standard": "5.3.1", + "eslint-plugin-promise": "1.1.0", + "eslint-plugin-standard": "1.3.2", + "istanbul": "0.4.3", + "mocha": "1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "homepage": "https://github.com/jshttp/range-parser#readme", + "keywords": [ + "range", + "parser", + "http" + ], + "license": "MIT", + "name": "range-parser", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/range-parser.git" + }, + "scripts": { + "lint": "eslint **/*.js", + "test": "mocha --reporter spec", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot" + }, + "version": "1.2.0" +} diff --git a/8 node/node_modules/send/HISTORY.md b/8 node/node_modules/send/HISTORY.md new file mode 100644 index 000000000..3297ba078 --- /dev/null +++ b/8 node/node_modules/send/HISTORY.md @@ -0,0 +1,411 @@ +0.15.3 / 2017-05-16 +=================== + + * deps: debug@2.6.7 + - deps: ms@2.0.0 + * deps: ms@2.0.0 + +0.15.2 / 2017-04-26 +=================== + + * deps: debug@2.6.4 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@0.7.3 + * deps: ms@1.0.0 + +0.15.1 / 2017-03-04 +=================== + + * Fix issue when `Date.parse` does not return `NaN` on invalid date + * Fix strict violation in broken environments + +0.15.0 / 2017-02-25 +=================== + + * Support `If-Match` and `If-Unmodified-Since` headers + * Add `res` and `path` arguments to `directory` event + * Remove usage of `res._headers` private field + - Improves compatibility with Node.js 8 nightly + * Send complete HTML document in redirect & error responses + * Set default CSP header in redirect & error responses + * Use `res.getHeaderNames()` when available + * Use `res.headersSent` when available + * deps: debug@2.6.1 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable set to `3` or higher + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: etag@~1.8.0 + * deps: fresh@0.5.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - perf: delay reading header values until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove duplicate conditional + - perf: remove unnecessary boolean coercions + - perf: skip checking modified time if ETag check failed + - perf: skip parsing `If-None-Match` when no `ETag` header + - perf: use `Date.parse` instead of `new Date` + * deps: http-errors@~1.6.1 + - Make `message` property enumerable for `HttpError`s + - deps: setprototypeof@1.0.3 + +0.14.2 / 2017-01-23 +=================== + + * deps: http-errors@~1.5.1 + - deps: inherits@2.0.3 + - deps: setprototypeof@1.0.2 + - deps: statuses@'>= 1.3.1 < 2' + * deps: ms@0.7.2 + * deps: statuses@~1.3.1 + +0.14.1 / 2016-06-09 +=================== + + * Fix redirect error when `path` contains raw non-URL characters + * Fix redirect when `path` starts with multiple forward slashes + +0.14.0 / 2016-06-06 +=================== + + * Add `acceptRanges` option + * Add `cacheControl` option + * Attempt to combine multiple ranges into single range + * Correctly inherit from `Stream` class + * Fix `Content-Range` header in 416 responses when using `start`/`end` options + * Fix `Content-Range` header missing from default 416 responses + * Ignore non-byte `Range` headers + * deps: http-errors@~1.5.0 + - Add `HttpError` export, for `err instanceof createError.HttpError` + - Support new code `421 Misdirected Request` + - Use `setprototypeof` module to replace `__proto__` setting + - deps: inherits@2.0.1 + - deps: statuses@'>= 1.3.0 < 2' + - perf: enable strict mode + * deps: range-parser@~1.2.0 + - Fix incorrectly returning -1 when there is at least one valid range + - perf: remove internal function + * deps: statuses@~1.3.0 + - Add `421 Misdirected Request` + - perf: enable strict mode + * perf: remove argument reassignment + +0.13.2 / 2016-03-05 +=================== + + * Fix invalid `Content-Type` header when `send.mime.default_type` unset + +0.13.1 / 2016-01-16 +=================== + + * deps: depd@~1.1.0 + - Support web browser loading + - perf: enable strict mode + * deps: destroy@~1.0.4 + - perf: enable strict mode + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + * deps: range-parser@~1.0.3 + - perf: enable strict mode + +0.13.0 / 2015-06-16 +=================== + + * Allow Node.js HTTP server to set `Date` response header + * Fix incorrectly removing `Content-Location` on 304 response + * Improve the default redirect response headers + * Send appropriate headers on default error response + * Use `http-errors` for standard emitted errors + * Use `statuses` instead of `http` module for status messages + * deps: escape-html@1.0.2 + * deps: etag@~1.7.0 + - Improve stat performance by removing hashing + * deps: fresh@0.3.0 + - Add weak `ETag` matching support + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * perf: enable strict mode + * perf: remove unnecessary array allocations + +0.12.3 / 2015-05-13 +=================== + + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: depd@~1.0.1 + * deps: etag@~1.6.0 + - Improve support for JXcore + - Support "fake" stats objects in environments without `fs` + * deps: ms@0.7.1 + - Prevent extraordinarily long inputs + * deps: on-finished@~2.2.1 + +0.12.2 / 2015-03-13 +=================== + + * Throw errors early for invalid `extensions` or `index` options + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + +0.12.1 / 2015-02-17 +=================== + + * Fix regression sending zero-length files + +0.12.0 / 2015-02-16 +=================== + + * Always read the stat size from the file + * Fix mutating passed-in `options` + * deps: mime@1.3.4 + +0.11.1 / 2015-01-20 +=================== + + * Fix `root` path disclosure + +0.11.0 / 2015-01-05 +=================== + + * deps: debug@~2.1.1 + * deps: etag@~1.5.1 + - deps: crc@3.2.1 + * deps: ms@0.7.0 + - Add `milliseconds` + - Add `msecs` + - Add `secs` + - Add `mins` + - Add `hrs` + - Add `yrs` + * deps: on-finished@~2.2.0 + +0.10.1 / 2014-10-22 +=================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + +0.10.0 / 2014-10-15 +=================== + + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + * deps: etag@~1.5.0 + - Improve string performance + - Slightly improve speed for weak ETags over 1KB + +0.9.3 / 2014-09-24 +================== + + * deps: etag@~1.4.0 + - Support "fake" stats objects + +0.9.2 / 2014-09-15 +================== + + * deps: depd@0.4.5 + * deps: etag@~1.3.1 + * deps: range-parser@~1.0.2 + +0.9.1 / 2014-09-07 +================== + + * deps: fresh@0.2.4 + +0.9.0 / 2014-09-07 +================== + + * Add `lastModified` option + * Use `etag` to generate `ETag` header + * deps: debug@~2.0.0 + +0.8.5 / 2014-09-04 +================== + + * Fix malicious path detection for empty string path + +0.8.4 / 2014-09-04 +================== + + * Fix a path traversal issue when using `root` + +0.8.3 / 2014-08-16 +================== + + * deps: destroy@1.0.3 + - renamed from dethroy + * deps: on-finished@2.1.0 + +0.8.2 / 2014-08-14 +================== + + * Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + * deps: dethroy@1.0.2 + +0.8.1 / 2014-08-05 +================== + + * Fix `extensions` behavior when file already has extension + +0.8.0 / 2014-08-05 +================== + + * Add `extensions` option + +0.7.4 / 2014-08-04 +================== + + * Fix serving index files without root dir + +0.7.3 / 2014-07-29 +================== + + * Fix incorrect 403 on Windows and Node.js 0.11 + +0.7.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +0.7.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +0.7.0 / 2014-07-20 +================== + + * Deprecate `hidden` option; use `dotfiles` option + * Add `dotfiles` option + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + +0.6.0 / 2014-07-11 +================== + + * Deprecate `from` option; use `root` option + * Deprecate `send.etag()` -- use `etag` in `options` + * Deprecate `send.hidden()` -- use `hidden` in `options` + * Deprecate `send.index()` -- use `index` in `options` + * Deprecate `send.maxage()` -- use `maxAge` in `options` + * Deprecate `send.root()` -- use `root` in `options` + * Cap `maxAge` value to 1 year + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + +0.5.0 / 2014-06-28 +================== + + * Accept string for `maxAge` (converted by `ms`) + * Add `headers` event + * Include link in default redirect response + * Use `EventEmitter.listenerCount` to count listeners + +0.4.3 / 2014-06-11 +================== + + * Do not throw un-catchable error on file open race condition + * Use `escape-html` for HTML escaping + * deps: debug@1.0.2 + - fix some debugging output colors on node.js 0.8 + * deps: finished@1.2.2 + * deps: fresh@0.2.2 + +0.4.2 / 2014-06-09 +================== + + * fix "event emitter leak" warnings + * deps: debug@1.0.1 + * deps: finished@1.2.1 + +0.4.1 / 2014-06-02 +================== + + * Send `max-age` in `Cache-Control` in correct format + +0.4.0 / 2014-05-27 +================== + + * Calculate ETag with md5 for reduced collisions + * Fix wrong behavior when index file matches directory + * Ignore stream errors after request ends + - Goodbye `EBADF, read` + * Skip directories in index file search + * deps: debug@0.8.1 + +0.3.0 / 2014-04-24 +================== + + * Fix sending files with dots without root set + * Coerce option types + * Accept API options in options object + * Set etags to "weak" + * Include file path in etag + * Make "Can't set headers after they are sent." catchable + * Send full entity-body for multi range requests + * Default directory access to 403 when index disabled + * Support multiple index paths + * Support "If-Range" header + * Control whether to generate etags + * deps: mime@1.2.11 + +0.2.0 / 2014-01-29 +================== + + * update range-parser and fresh + +0.1.4 / 2013-08-11 +================== + + * update fresh + +0.1.3 / 2013-07-08 +================== + + * Revert "Fix fd leak" + +0.1.2 / 2013-07-03 +================== + + * Fix fd leak + +0.1.0 / 2012-08-25 +================== + + * add options parameter to send() that is passed to fs.createReadStream() [kanongil] + +0.0.4 / 2012-08-16 +================== + + * allow custom "Accept-Ranges" definition + +0.0.3 / 2012-07-16 +================== + + * fix normalization of the root directory. Closes #3 + +0.0.2 / 2012-07-09 +================== + + * add passing of req explicitly for now (YUCK) + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/8 node/node_modules/send/LICENSE b/8 node/node_modules/send/LICENSE new file mode 100644 index 000000000..4aa69e83d --- /dev/null +++ b/8 node/node_modules/send/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012 TJ Holowaychuk +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/send/README.md b/8 node/node_modules/send/README.md new file mode 100644 index 000000000..0c8d11df6 --- /dev/null +++ b/8 node/node_modules/send/README.md @@ -0,0 +1,301 @@ +# send + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Test Coverage][coveralls-image]][coveralls-url] +[![Gratipay][gratipay-image]][gratipay-url] + +Send is a library for streaming files from the file system as a http response +supporting partial responses (Ranges), conditional-GET negotiation (If-Match, +If-Unmodified-Since, If-None-Match, If-Modified-Since), high test coverage, +and granular events which may be leveraged to take appropriate actions in your +application or framework. + +Looking to serve up entire folders mapped to URLs? Try [serve-static](https://www.npmjs.org/package/serve-static). + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install send +``` + +## API + + + +```js +var send = require('send') +``` + +### send(req, path, [options]) + +Create a new `SendStream` for the given path to send to a `res`. The `req` is +the Node.js HTTP request and the `path` is a urlencoded path to send (urlencoded, +not the actual file-system path). + +#### Options + +##### acceptRanges + +Enable or disable accepting ranged requests, defaults to true. +Disabling this will not send `Accept-Ranges` and ignore the contents +of the `Range` request header. + +##### cacheControl + +Enable or disable setting `Cache-Control` response header, defaults to +true. Disabling this will ignore the `maxAge` option. + +##### dotfiles + +Set how "dotfiles" are treated when encountered. A dotfile is a file +or directory that begins with a dot ("."). Note this check is done on +the path itself without checking if the path actually exists on the +disk. If `root` is specified, only the dotfiles above the root are +checked (i.e. the root itself can be within a dotfile when when set +to "deny"). + + - `'allow'` No special treatment for dotfiles. + - `'deny'` Send a 403 for any request for a dotfile. + - `'ignore'` Pretend like the dotfile does not exist and 404. + +The default value is _similar_ to `'ignore'`, with the exception that +this default will not ignore the files within a directory that begins +with a dot, for backward-compatibility. + +##### end + +Byte offset at which the stream ends, defaults to the length of the file +minus 1. The end is inclusive in the stream, meaning `end: 3` will include +the 4th byte in the stream. + +##### etag + +Enable or disable etag generation, defaults to true. + +##### extensions + +If a given file doesn't exist, try appending one of the given extensions, +in the given order. By default, this is disabled (set to `false`). An +example value that will serve extension-less HTML files: `['html', 'htm']`. +This is skipped if the requested file already has an extension. + +##### index + +By default send supports "index.html" files, to disable this +set `false` or to supply a new index pass a string or an array +in preferred order. + +##### lastModified + +Enable or disable `Last-Modified` header, defaults to true. Uses the file +system's last modified value. + +##### maxAge + +Provide a max-age in milliseconds for http caching, defaults to 0. +This can also be a string accepted by the +[ms](https://www.npmjs.org/package/ms#readme) module. + +##### root + +Serve files relative to `path`. + +##### start + +Byte offset at which the stream starts, defaults to 0. The start is inclusive, +meaning `start: 2` will include the 3rd byte in the stream. + +#### Events + +The `SendStream` is an event emitter and will emit the following events: + + - `error` an error occurred `(err)` + - `directory` a directory was requested `(res, path)` + - `file` a file was requested `(path, stat)` + - `headers` the headers are about to be set on a file `(res, path, stat)` + - `stream` file streaming has started `(stream)` + - `end` streaming has completed + +#### .pipe + +The `pipe` method is used to pipe the response into the Node.js HTTP response +object, typically `send(req, path, options).pipe(res)`. + +### .mime + +The `mime` export is the global instance of of the +[`mime` npm module](https://www.npmjs.com/package/mime). + +This is used to configure the MIME types that are associated with file extensions +as well as other options for how to resolve the MIME type of a file (like the +default type to use for an unknown file extension). + +## Error-handling + +By default when no `error` listeners are present an automatic response will be +made, otherwise you have full control over the response, aka you may show a 5xx +page etc. + +## Caching + +It does _not_ perform internal caching, you should use a reverse proxy cache +such as Varnish for this, or those fancy things called CDNs. If your +application is small enough that it would benefit from single-node memory +caching, it's small enough that it does not need caching at all ;). + +## Debugging + +To enable `debug()` instrumentation output export __DEBUG__: + +``` +$ DEBUG=send node app +``` + +## Running tests + +``` +$ npm install +$ npm test +``` + +## Examples + +### Small example + +```js +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +var server = http.createServer(function onRequest (req, res) { + send(req, parseUrl(req).pathname).pipe(res) +}) + +server.listen(3000) +``` + +### Custom file types + +```js +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +// Default unknown types to text/plain +send.mime.default_type = 'text/plain' + +// Add a custom type +send.mime.define({ + 'application/x-my-type': ['x-mt', 'x-mtt'] +}) + +var server = http.createServer(function onRequest (req, res) { + send(req, parseUrl(req).pathname).pipe(res) +}) + +server.listen(3000) +``` + +### Custom directory index view + +This is a example of serving up a structure of directories with a +custom function to render a listing of a directory. + +```js +var http = require('http') +var fs = require('fs') +var parseUrl = require('parseurl') +var send = require('send') + +// Transfer arbitrary files from within /www/example.com/public/* +// with a custom handler for directory listing +var server = http.createServer(function onRequest (req, res) { + send(req, parseUrl(req).pathname, {index: false, root: '/www/example.com/public'}) + .once('directory', directory) + .pipe(res) +}) + +server.listen(3000) + +// Custom directory handler +function directory (res, path) { + var stream = this + + // redirect to trailing slash for consistent url + if (!stream.hasTrailingSlash()) { + return stream.redirect(path) + } + + // get directory list + fs.readdir(path, function onReaddir (err, list) { + if (err) return stream.error(err) + + // render an index for the directory + res.setHeader('Content-Type', 'text/plain; charset=UTF-8') + res.end(list.join('\n') + '\n') + }) +} +``` + +### Serving from a root directory with custom error-handling + +```js +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +var server = http.createServer(function onRequest (req, res) { + // your custom error-handling logic: + function error (err) { + res.statusCode = err.status || 500 + res.end(err.message) + } + + // your custom headers + function headers (res, path, stat) { + // serve all files for download + res.setHeader('Content-Disposition', 'attachment') + } + + // your custom directory handling logic: + function redirect () { + res.statusCode = 301 + res.setHeader('Location', req.url + '/') + res.end('Redirecting to ' + req.url + '/') + } + + // transfer arbitrary files from within + // /www/example.com/public/* + send(req, parseUrl(req).pathname, {root: '/www/example.com/public'}) + .on('error', error) + .on('directory', redirect) + .on('headers', headers) + .pipe(res) +}) + +server.listen(3000) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/send.svg +[npm-url]: https://npmjs.org/package/send +[travis-image]: https://img.shields.io/travis/pillarjs/send/master.svg?label=linux +[travis-url]: https://travis-ci.org/pillarjs/send +[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/send/master.svg?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/send +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/send/master.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/send?branch=master +[downloads-image]: https://img.shields.io/npm/dm/send.svg +[downloads-url]: https://npmjs.org/package/send +[gratipay-image]: https://img.shields.io/gratipay/dougwilson.svg +[gratipay-url]: https://www.gratipay.com/dougwilson/ diff --git a/8 node/node_modules/send/index.js b/8 node/node_modules/send/index.js new file mode 100644 index 000000000..375684125 --- /dev/null +++ b/8 node/node_modules/send/index.js @@ -0,0 +1,1074 @@ +/*! + * send + * Copyright(c) 2012 TJ Holowaychuk + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var createError = require('http-errors') +var debug = require('debug')('send') +var deprecate = require('depd')('send') +var destroy = require('destroy') +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var etag = require('etag') +var EventEmitter = require('events').EventEmitter +var fresh = require('fresh') +var fs = require('fs') +var mime = require('mime') +var ms = require('ms') +var onFinished = require('on-finished') +var parseRange = require('range-parser') +var path = require('path') +var statuses = require('statuses') +var Stream = require('stream') +var util = require('util') + +/** + * Path function references. + * @private + */ + +var extname = path.extname +var join = path.join +var normalize = path.normalize +var resolve = path.resolve +var sep = path.sep + +/** + * Regular expression for identifying a bytes Range header. + * @private + */ + +var BYTES_RANGE_REGEXP = /^ *bytes=/ + +/** + * Simple expression to split token list. + * @private + */ + +var TOKEN_LIST_REGEXP = / *, */ + +/** + * Maximum value allowed for the max age. + * @private + */ + +var MAX_MAXAGE = 60 * 60 * 24 * 365 * 1000 // 1 year + +/** + * Regular expression to match a path with a directory up component. + * @private + */ + +var UP_PATH_REGEXP = /(?:^|[\\/])\.\.(?:[\\/]|$)/ + +/** + * Module exports. + * @public + */ + +module.exports = send +module.exports.mime = mime + +/** + * Shim EventEmitter.listenerCount for node.js < 0.10 + */ + +/* istanbul ignore next */ +var listenerCount = EventEmitter.listenerCount || + function (emitter, type) { return emitter.listeners(type).length } + +/** + * Return a `SendStream` for `req` and `path`. + * + * @param {object} req + * @param {string} path + * @param {object} [options] + * @return {SendStream} + * @public + */ + +function send (req, path, options) { + return new SendStream(req, path, options) +} + +/** + * Initialize a `SendStream` with the given `path`. + * + * @param {Request} req + * @param {String} path + * @param {object} [options] + * @private + */ + +function SendStream (req, path, options) { + Stream.call(this) + + var opts = options || {} + + this.options = opts + this.path = path + this.req = req + + this._acceptRanges = opts.acceptRanges !== undefined + ? Boolean(opts.acceptRanges) + : true + + this._cacheControl = opts.cacheControl !== undefined + ? Boolean(opts.cacheControl) + : true + + this._etag = opts.etag !== undefined + ? Boolean(opts.etag) + : true + + this._dotfiles = opts.dotfiles !== undefined + ? opts.dotfiles + : 'ignore' + + if (this._dotfiles !== 'ignore' && this._dotfiles !== 'allow' && this._dotfiles !== 'deny') { + throw new TypeError('dotfiles option must be "allow", "deny", or "ignore"') + } + + this._hidden = Boolean(opts.hidden) + + if (opts.hidden !== undefined) { + deprecate('hidden: use dotfiles: \'' + (this._hidden ? 'allow' : 'ignore') + '\' instead') + } + + // legacy support + if (opts.dotfiles === undefined) { + this._dotfiles = undefined + } + + this._extensions = opts.extensions !== undefined + ? normalizeList(opts.extensions, 'extensions option') + : [] + + this._index = opts.index !== undefined + ? normalizeList(opts.index, 'index option') + : ['index.html'] + + this._lastModified = opts.lastModified !== undefined + ? Boolean(opts.lastModified) + : true + + this._maxage = opts.maxAge || opts.maxage + this._maxage = typeof this._maxage === 'string' + ? ms(this._maxage) + : Number(this._maxage) + this._maxage = !isNaN(this._maxage) + ? Math.min(Math.max(0, this._maxage), MAX_MAXAGE) + : 0 + + this._root = opts.root + ? resolve(opts.root) + : null + + if (!this._root && opts.from) { + this.from(opts.from) + } +} + +/** + * Inherits from `Stream`. + */ + +util.inherits(SendStream, Stream) + +/** + * Enable or disable etag generation. + * + * @param {Boolean} val + * @return {SendStream} + * @api public + */ + +SendStream.prototype.etag = deprecate.function(function etag (val) { + this._etag = Boolean(val) + debug('etag %s', this._etag) + return this +}, 'send.etag: pass etag as option') + +/** + * Enable or disable "hidden" (dot) files. + * + * @param {Boolean} path + * @return {SendStream} + * @api public + */ + +SendStream.prototype.hidden = deprecate.function(function hidden (val) { + this._hidden = Boolean(val) + this._dotfiles = undefined + debug('hidden %s', this._hidden) + return this +}, 'send.hidden: use dotfiles option') + +/** + * Set index `paths`, set to a falsy + * value to disable index support. + * + * @param {String|Boolean|Array} paths + * @return {SendStream} + * @api public + */ + +SendStream.prototype.index = deprecate.function(function index (paths) { + var index = !paths ? [] : normalizeList(paths, 'paths argument') + debug('index %o', paths) + this._index = index + return this +}, 'send.index: pass index as option') + +/** + * Set root `path`. + * + * @param {String} path + * @return {SendStream} + * @api public + */ + +SendStream.prototype.root = function root (path) { + this._root = resolve(String(path)) + debug('root %s', this._root) + return this +} + +SendStream.prototype.from = deprecate.function(SendStream.prototype.root, + 'send.from: pass root as option') + +SendStream.prototype.root = deprecate.function(SendStream.prototype.root, + 'send.root: pass root as option') + +/** + * Set max-age to `maxAge`. + * + * @param {Number} maxAge + * @return {SendStream} + * @api public + */ + +SendStream.prototype.maxage = deprecate.function(function maxage (maxAge) { + this._maxage = typeof maxAge === 'string' + ? ms(maxAge) + : Number(maxAge) + this._maxage = !isNaN(this._maxage) + ? Math.min(Math.max(0, this._maxage), MAX_MAXAGE) + : 0 + debug('max-age %d', this._maxage) + return this +}, 'send.maxage: pass maxAge as option') + +/** + * Emit error with `status`. + * + * @param {number} status + * @param {Error} [err] + * @private + */ + +SendStream.prototype.error = function error (status, err) { + // emit if listeners instead of responding + if (listenerCount(this, 'error') !== 0) { + return this.emit('error', createError(status, err, { + expose: false + })) + } + + var res = this.res + var msg = statuses[status] || String(status) + var doc = createHtmlDocument('Error', escapeHtml(msg)) + + // clear existing headers + clearHeaders(res) + + // add error headers + if (err && err.headers) { + setHeaders(res, err.headers) + } + + // send basic response + res.statusCode = status + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(doc)) + res.setHeader('Content-Security-Policy', "default-src 'self'") + res.setHeader('X-Content-Type-Options', 'nosniff') + res.end(doc) +} + +/** + * Check if the pathname ends with "/". + * + * @return {boolean} + * @private + */ + +SendStream.prototype.hasTrailingSlash = function hasTrailingSlash () { + return this.path[this.path.length - 1] === '/' +} + +/** + * Check if this is a conditional GET request. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isConditionalGET = function isConditionalGET () { + return this.req.headers['if-match'] || + this.req.headers['if-unmodified-since'] || + this.req.headers['if-none-match'] || + this.req.headers['if-modified-since'] +} + +/** + * Check if the request preconditions failed. + * + * @return {boolean} + * @private + */ + +SendStream.prototype.isPreconditionFailure = function isPreconditionFailure () { + var req = this.req + var res = this.res + + // if-match + var match = req.headers['if-match'] + if (match) { + var etag = res.getHeader('ETag') + return !etag || (match !== '*' && match.split(TOKEN_LIST_REGEXP).every(function (match) { + return match !== etag && match !== 'W/' + etag && 'W/' + match !== etag + })) + } + + // if-unmodified-since + var unmodifiedSince = parseHttpDate(req.headers['if-unmodified-since']) + if (!isNaN(unmodifiedSince)) { + var lastModified = parseHttpDate(res.getHeader('Last-Modified')) + return isNaN(lastModified) || lastModified > unmodifiedSince + } + + return false +} + +/** + * Strip content-* header fields. + * + * @private + */ + +SendStream.prototype.removeContentHeaderFields = function removeContentHeaderFields () { + var res = this.res + var headers = getHeaderNames(res) + + for (var i = 0; i < headers.length; i++) { + var header = headers[i] + if (header.substr(0, 8) === 'content-' && header !== 'content-location') { + res.removeHeader(header) + } + } +} + +/** + * Respond with 304 not modified. + * + * @api private + */ + +SendStream.prototype.notModified = function notModified () { + var res = this.res + debug('not modified') + this.removeContentHeaderFields() + res.statusCode = 304 + res.end() +} + +/** + * Raise error that headers already sent. + * + * @api private + */ + +SendStream.prototype.headersAlreadySent = function headersAlreadySent () { + var err = new Error('Can\'t set headers after they are sent.') + debug('headers already sent') + this.error(500, err) +} + +/** + * Check if the request is cacheable, aka + * responded with 2xx or 304 (see RFC 2616 section 14.2{5,6}). + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isCachable = function isCachable () { + var statusCode = this.res.statusCode + return (statusCode >= 200 && statusCode < 300) || + statusCode === 304 +} + +/** + * Handle stat() error. + * + * @param {Error} error + * @private + */ + +SendStream.prototype.onStatError = function onStatError (error) { + switch (error.code) { + case 'ENAMETOOLONG': + case 'ENOENT': + case 'ENOTDIR': + this.error(404, error) + break + default: + this.error(500, error) + break + } +} + +/** + * Check if the cache is fresh. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isFresh = function isFresh () { + return fresh(this.req.headers, { + 'etag': this.res.getHeader('ETag'), + 'last-modified': this.res.getHeader('Last-Modified') + }) +} + +/** + * Check if the range is fresh. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isRangeFresh = function isRangeFresh () { + var ifRange = this.req.headers['if-range'] + + if (!ifRange) { + return true + } + + // if-range as etag + if (ifRange.indexOf('"') !== -1) { + var etag = this.res.getHeader('ETag') + return Boolean(etag && ifRange.indexOf(etag) !== -1) + } + + // if-range as modified date + var lastModified = this.res.getHeader('Last-Modified') + return parseHttpDate(lastModified) <= parseHttpDate(ifRange) +} + +/** + * Redirect to path. + * + * @param {string} path + * @private + */ + +SendStream.prototype.redirect = function redirect (path) { + var res = this.res + + if (listenerCount(this, 'directory') !== 0) { + this.emit('directory', res, path) + return + } + + if (this.hasTrailingSlash()) { + this.error(403) + return + } + + var loc = encodeUrl(collapseLeadingSlashes(this.path + '/')) + var doc = createHtmlDocument('Redirecting', 'Redirecting to ' + + escapeHtml(loc) + '') + + // redirect + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(doc)) + res.setHeader('Content-Security-Policy', "default-src 'self'") + res.setHeader('X-Content-Type-Options', 'nosniff') + res.setHeader('Location', loc) + res.end(doc) +} + +/** + * Pipe to `res. + * + * @param {Stream} res + * @return {Stream} res + * @api public + */ + +SendStream.prototype.pipe = function pipe (res) { + // root path + var root = this._root + + // references + this.res = res + + // decode the path + var path = decode(this.path) + if (path === -1) { + this.error(400) + return res + } + + // null byte(s) + if (~path.indexOf('\0')) { + this.error(400) + return res + } + + var parts + if (root !== null) { + // malicious path + if (UP_PATH_REGEXP.test(normalize('.' + sep + path))) { + debug('malicious path "%s"', path) + this.error(403) + return res + } + + // join / normalize from optional root dir + path = normalize(join(root, path)) + root = normalize(root + sep) + + // explode path parts + parts = path.substr(root.length).split(sep) + } else { + // ".." is malicious without "root" + if (UP_PATH_REGEXP.test(path)) { + debug('malicious path "%s"', path) + this.error(403) + return res + } + + // explode path parts + parts = normalize(path).split(sep) + + // resolve the path + path = resolve(path) + } + + // dotfile handling + if (containsDotFile(parts)) { + var access = this._dotfiles + + // legacy support + if (access === undefined) { + access = parts[parts.length - 1][0] === '.' + ? (this._hidden ? 'allow' : 'ignore') + : 'allow' + } + + debug('%s dotfile "%s"', access, path) + switch (access) { + case 'allow': + break + case 'deny': + this.error(403) + return res + case 'ignore': + default: + this.error(404) + return res + } + } + + // index file support + if (this._index.length && this.hasTrailingSlash()) { + this.sendIndex(path) + return res + } + + this.sendFile(path) + return res +} + +/** + * Transfer `path`. + * + * @param {String} path + * @api public + */ + +SendStream.prototype.send = function send (path, stat) { + var len = stat.size + var options = this.options + var opts = {} + var res = this.res + var req = this.req + var ranges = req.headers.range + var offset = options.start || 0 + + if (headersSent(res)) { + // impossible to send now + this.headersAlreadySent() + return + } + + debug('pipe "%s"', path) + + // set header fields + this.setHeader(path, stat) + + // set content-type + this.type(path) + + // conditional GET support + if (this.isConditionalGET()) { + if (this.isPreconditionFailure()) { + this.error(412) + return + } + + if (this.isCachable() && this.isFresh()) { + this.notModified() + return + } + } + + // adjust len to start/end options + len = Math.max(0, len - offset) + if (options.end !== undefined) { + var bytes = options.end - offset + 1 + if (len > bytes) len = bytes + } + + // Range support + if (this._acceptRanges && BYTES_RANGE_REGEXP.test(ranges)) { + // parse + ranges = parseRange(len, ranges, { + combine: true + }) + + // If-Range support + if (!this.isRangeFresh()) { + debug('range stale') + ranges = -2 + } + + // unsatisfiable + if (ranges === -1) { + debug('range unsatisfiable') + + // Content-Range + res.setHeader('Content-Range', contentRange('bytes', len)) + + // 416 Requested Range Not Satisfiable + return this.error(416, { + headers: {'Content-Range': res.getHeader('Content-Range')} + }) + } + + // valid (syntactically invalid/multiple ranges are treated as a regular response) + if (ranges !== -2 && ranges.length === 1) { + debug('range %j', ranges) + + // Content-Range + res.statusCode = 206 + res.setHeader('Content-Range', contentRange('bytes', len, ranges[0])) + + // adjust for requested range + offset += ranges[0].start + len = ranges[0].end - ranges[0].start + 1 + } + } + + // clone options + for (var prop in options) { + opts[prop] = options[prop] + } + + // set read options + opts.start = offset + opts.end = Math.max(offset, offset + len - 1) + + // content-length + res.setHeader('Content-Length', len) + + // HEAD support + if (req.method === 'HEAD') { + res.end() + return + } + + this.stream(path, opts) +} + +/** + * Transfer file for `path`. + * + * @param {String} path + * @api private + */ +SendStream.prototype.sendFile = function sendFile (path) { + var i = 0 + var self = this + + debug('stat "%s"', path) + fs.stat(path, function onstat (err, stat) { + if (err && err.code === 'ENOENT' && !extname(path) && path[path.length - 1] !== sep) { + // not found, check extensions + return next(err) + } + if (err) return self.onStatError(err) + if (stat.isDirectory()) return self.redirect(path) + self.emit('file', path, stat) + self.send(path, stat) + }) + + function next (err) { + if (self._extensions.length <= i) { + return err + ? self.onStatError(err) + : self.error(404) + } + + var p = path + '.' + self._extensions[i++] + + debug('stat "%s"', p) + fs.stat(p, function (err, stat) { + if (err) return next(err) + if (stat.isDirectory()) return next() + self.emit('file', p, stat) + self.send(p, stat) + }) + } +} + +/** + * Transfer index for `path`. + * + * @param {String} path + * @api private + */ +SendStream.prototype.sendIndex = function sendIndex (path) { + var i = -1 + var self = this + + function next (err) { + if (++i >= self._index.length) { + if (err) return self.onStatError(err) + return self.error(404) + } + + var p = join(path, self._index[i]) + + debug('stat "%s"', p) + fs.stat(p, function (err, stat) { + if (err) return next(err) + if (stat.isDirectory()) return next() + self.emit('file', p, stat) + self.send(p, stat) + }) + } + + next() +} + +/** + * Stream `path` to the response. + * + * @param {String} path + * @param {Object} options + * @api private + */ + +SendStream.prototype.stream = function stream (path, options) { + // TODO: this is all lame, refactor meeee + var finished = false + var self = this + var res = this.res + + // pipe + var stream = fs.createReadStream(path, options) + this.emit('stream', stream) + stream.pipe(res) + + // response finished, done with the fd + onFinished(res, function onfinished () { + finished = true + destroy(stream) + }) + + // error handling code-smell + stream.on('error', function onerror (err) { + // request already finished + if (finished) return + + // clean up stream + finished = true + destroy(stream) + + // error + self.onStatError(err) + }) + + // end + stream.on('end', function onend () { + self.emit('end') + }) +} + +/** + * Set content-type based on `path` + * if it hasn't been explicitly set. + * + * @param {String} path + * @api private + */ + +SendStream.prototype.type = function type (path) { + var res = this.res + + if (res.getHeader('Content-Type')) return + + var type = mime.lookup(path) + + if (!type) { + debug('no content-type') + return + } + + var charset = mime.charsets.lookup(type) + + debug('content-type %s', type) + res.setHeader('Content-Type', type + (charset ? '; charset=' + charset : '')) +} + +/** + * Set response header fields, most + * fields may be pre-defined. + * + * @param {String} path + * @param {Object} stat + * @api private + */ + +SendStream.prototype.setHeader = function setHeader (path, stat) { + var res = this.res + + this.emit('headers', res, path, stat) + + if (this._acceptRanges && !res.getHeader('Accept-Ranges')) { + debug('accept ranges') + res.setHeader('Accept-Ranges', 'bytes') + } + + if (this._cacheControl && !res.getHeader('Cache-Control')) { + var cacheControl = 'public, max-age=' + Math.floor(this._maxage / 1000) + debug('cache-control %s', cacheControl) + res.setHeader('Cache-Control', cacheControl) + } + + if (this._lastModified && !res.getHeader('Last-Modified')) { + var modified = stat.mtime.toUTCString() + debug('modified %s', modified) + res.setHeader('Last-Modified', modified) + } + + if (this._etag && !res.getHeader('ETag')) { + var val = etag(stat) + debug('etag %s', val) + res.setHeader('ETag', val) + } +} + +/** + * Clear all headers from a response. + * + * @param {object} res + * @private + */ + +function clearHeaders (res) { + var headers = getHeaderNames(res) + + for (var i = 0; i < headers.length; i++) { + res.removeHeader(headers[i]) + } +} + +/** + * Collapse all leading slashes into a single slash + * + * @param {string} str + * @private + */ +function collapseLeadingSlashes (str) { + for (var i = 0; i < str.length; i++) { + if (str[i] !== '/') { + break + } + } + + return i > 1 + ? '/' + str.substr(i) + : str +} + +/** + * Determine if path parts contain a dotfile. + * + * @api private + */ + +function containsDotFile (parts) { + for (var i = 0; i < parts.length; i++) { + if (parts[i][0] === '.') { + return true + } + } + + return false +} + +/** + * Create a Content-Range header. + * + * @param {string} type + * @param {number} size + * @param {array} [range] + */ + +function contentRange (type, size, range) { + return type + ' ' + (range ? range.start + '-' + range.end : '*') + '/' + size +} + +/** + * Create a minimal HTML document. + * + * @param {string} title + * @param {string} body + * @private + */ + +function createHtmlDocument (title, body) { + return '\n' + + '\n' + + '\n' + + '\n' + + '' + title + '\n' + + '\n' + + '\n' + + '
' + body + '
\n' + + '\n' +} + +/** + * decodeURIComponent. + * + * Allows V8 to only deoptimize this fn instead of all + * of send(). + * + * @param {String} path + * @api private + */ + +function decode (path) { + try { + return decodeURIComponent(path) + } catch (err) { + return -1 + } +} + +/** + * Get the header names on a respnse. + * + * @param {object} res + * @returns {array[string]} + * @private + */ + +function getHeaderNames (res) { + return typeof res.getHeaderNames !== 'function' + ? Object.keys(res._headers || {}) + : res.getHeaderNames() +} + +/** + * Determine if the response headers have been sent. + * + * @param {object} res + * @returns {boolean} + * @private + */ + +function headersSent (res) { + return typeof res.headersSent !== 'boolean' + ? Boolean(res._header) + : res.headersSent +} + +/** + * Normalize the index option into an array. + * + * @param {boolean|string|array} val + * @param {string} name + * @private + */ + +function normalizeList (val, name) { + var list = [].concat(val || []) + + for (var i = 0; i < list.length; i++) { + if (typeof list[i] !== 'string') { + throw new TypeError(name + ' must be array of strings or false') + } + } + + return list +} + +/** + * Parse an HTTP Date into a number. + * + * @param {string} date + * @private + */ + +function parseHttpDate (date) { + var timestamp = date && Date.parse(date) + + return typeof timestamp === 'number' + ? timestamp + : NaN +} + +/** + * Set an object of headers on a response. + * + * @param {object} res + * @param {object} headers + * @private + */ + +function setHeaders (res, headers) { + var keys = Object.keys(headers) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + res.setHeader(key, headers[key]) + } +} diff --git a/8 node/node_modules/send/package.json b/8 node/node_modules/send/package.json new file mode 100644 index 000000000..f9616c890 --- /dev/null +++ b/8 node/node_modules/send/package.json @@ -0,0 +1,104 @@ +{ + "_from": "send@0.15.3", + "_id": "send@0.15.3", + "_inBundle": false, + "_integrity": "sha1-UBP5+ZAj31DRvZiSwZ4979HVMwk=", + "_location": "/send", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "send@0.15.3", + "name": "send", + "escapedName": "send", + "rawSpec": "0.15.3", + "saveSpec": null, + "fetchSpec": "0.15.3" + }, + "_requiredBy": [ + "/express", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/send/-/send-0.15.3.tgz", + "_shasum": "5013f9f99023df50d1bd9892c19e3defd1d53309", + "_spec": "send@0.15.3", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "bugs": { + "url": "https://github.com/pillarjs/send/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "James Wyatt Cready", + "email": "jcready@gmail.com" + }, + { + "name": "Jesús Leganés Combarro", + "email": "piranna@gmail.com" + } + ], + "dependencies": { + "debug": "2.6.7", + "depd": "~1.1.0", + "destroy": "~1.0.4", + "encodeurl": "~1.0.1", + "escape-html": "~1.0.3", + "etag": "~1.8.0", + "fresh": "0.5.0", + "http-errors": "~1.6.1", + "mime": "1.3.4", + "ms": "2.0.0", + "on-finished": "~2.3.0", + "range-parser": "~1.2.0", + "statuses": "~1.3.1" + }, + "deprecated": false, + "description": "Better streaming static file server with Range and conditional-GET support", + "devDependencies": { + "after": "0.8.2", + "eslint": "3.19.0", + "eslint-config-standard": "7.1.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "2.3.1", + "istanbul": "0.4.5", + "mocha": "2.5.3", + "supertest": "1.1.0" + }, + "engines": { + "node": ">= 0.8.0" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/pillarjs/send#readme", + "keywords": [ + "static", + "file", + "server" + ], + "license": "MIT", + "name": "send", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/send.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --check-leaks --reporter spec --bail", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot" + }, + "version": "0.15.3" +} diff --git a/8 node/node_modules/serve-static/HISTORY.md b/8 node/node_modules/serve-static/HISTORY.md new file mode 100644 index 000000000..c9811070d --- /dev/null +++ b/8 node/node_modules/serve-static/HISTORY.md @@ -0,0 +1,377 @@ +1.12.3 / 2017-05-16 +=================== + + * deps: send@0.15.3 + - deps: debug@2.6.7 + +1.12.2 / 2017-04-26 +=================== + + * deps: send@0.15.2 + - deps: debug@2.6.4 + +1.12.1 / 2017-03-04 +=================== + + * deps: send@0.15.1 + - Fix issue when `Date.parse` does not return `NaN` on invalid date + - Fix strict violation in broken environments + +1.12.0 / 2017-02-25 +=================== + + * Send complete HTML document in redirect response + * Set default CSP header in redirect response + * deps: send@0.15.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - Remove usage of `res._headers` private field + - Support `If-Match` and `If-Unmodified-Since` headers + - Use `res.getHeaderNames()` when available + - Use `res.headersSent` when available + - deps: debug@2.6.1 + - deps: etag@~1.8.0 + - deps: fresh@0.5.0 + - deps: http-errors@~1.6.1 + +1.11.2 / 2017-01-23 +=================== + + * deps: send@0.14.2 + - deps: http-errors@~1.5.1 + - deps: ms@0.7.2 + - deps: statuses@~1.3.1 + +1.11.1 / 2016-06-10 +=================== + + * Fix redirect error when `req.url` contains raw non-URL characters + * deps: send@0.14.1 + +1.11.0 / 2016-06-07 +=================== + + * Use status code 301 for redirects + * deps: send@0.14.0 + - Add `acceptRanges` option + - Add `cacheControl` option + - Attempt to combine multiple ranges into single range + - Correctly inherit from `Stream` class + - Fix `Content-Range` header in 416 responses when using `start`/`end` options + - Fix `Content-Range` header missing from default 416 responses + - Ignore non-byte `Range` headers + - deps: http-errors@~1.5.0 + - deps: range-parser@~1.2.0 + - deps: statuses@~1.3.0 + - perf: remove argument reassignment + +1.10.3 / 2016-05-30 +=================== + + * deps: send@0.13.2 + - Fix invalid `Content-Type` header when `send.mime.default_type` unset + +1.10.2 / 2016-01-19 +=================== + + * deps: parseurl@~1.3.1 + - perf: enable strict mode + +1.10.1 / 2016-01-16 +=================== + + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + * deps: send@0.13.1 + - deps: depd@~1.1.0 + - deps: destroy@~1.0.4 + - deps: escape-html@~1.0.3 + - deps: range-parser@~1.0.3 + +1.10.0 / 2015-06-17 +=================== + + * Add `fallthrough` option + - Allows declaring this middleware is the final destination + - Provides better integration with Express patterns + * Fix reading options from options prototype + * Improve the default redirect response headers + * deps: escape-html@1.0.2 + * deps: send@0.13.0 + - Allow Node.js HTTP server to set `Date` response header + - Fix incorrectly removing `Content-Location` on 304 response + - Improve the default redirect response headers + - Send appropriate headers on default error response + - Use `http-errors` for standard emitted errors + - Use `statuses` instead of `http` module for status messages + - deps: escape-html@1.0.2 + - deps: etag@~1.7.0 + - deps: fresh@0.3.0 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove unnecessary array allocations + * perf: enable strict mode + * perf: remove argument reassignment + +1.9.3 / 2015-05-14 +================== + + * deps: send@0.12.3 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: etag@~1.6.0 + - deps: ms@0.7.1 + - deps: on-finished@~2.2.1 + +1.9.2 / 2015-03-14 +================== + + * deps: send@0.12.2 + - Throw errors early for invalid `extensions` or `index` options + - deps: debug@~2.1.3 + +1.9.1 / 2015-02-17 +================== + + * deps: send@0.12.1 + - Fix regression sending zero-length files + +1.9.0 / 2015-02-16 +================== + + * deps: send@0.12.0 + - Always read the stat size from the file + - Fix mutating passed-in `options` + - deps: mime@1.3.4 + +1.8.1 / 2015-01-20 +================== + + * Fix redirect loop in Node.js 0.11.14 + * deps: send@0.11.1 + - Fix root path disclosure + +1.8.0 / 2015-01-05 +================== + + * deps: send@0.11.0 + - deps: debug@~2.1.1 + - deps: etag@~1.5.1 + - deps: ms@0.7.0 + - deps: on-finished@~2.2.0 + +1.7.2 / 2015-01-02 +================== + + * Fix potential open redirect when mounted at root + +1.7.1 / 2014-10-22 +================== + + * deps: send@0.10.1 + - deps: on-finished@~2.1.1 + +1.7.0 / 2014-10-15 +================== + + * deps: send@0.10.0 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: etag@~1.5.0 + +1.6.5 / 2015-02-04 +================== + + * Fix potential open redirect when mounted at root + - Back-ported from v1.7.2 + +1.6.4 / 2014-10-08 +================== + + * Fix redirect loop when index file serving disabled + +1.6.3 / 2014-09-24 +================== + + * deps: send@0.9.3 + - deps: etag@~1.4.0 + +1.6.2 / 2014-09-15 +================== + + * deps: send@0.9.2 + - deps: depd@0.4.5 + - deps: etag@~1.3.1 + - deps: range-parser@~1.0.2 + +1.6.1 / 2014-09-07 +================== + + * deps: send@0.9.1 + - deps: fresh@0.2.4 + +1.6.0 / 2014-09-07 +================== + + * deps: send@0.9.0 + - Add `lastModified` option + - Use `etag` to generate `ETag` header + - deps: debug@~2.0.0 + +1.5.4 / 2014-09-04 +================== + + * deps: send@0.8.5 + - Fix a path traversal issue when using `root` + - Fix malicious path detection for empty string path + +1.5.3 / 2014-08-17 +================== + + * deps: send@0.8.3 + +1.5.2 / 2014-08-14 +================== + + * deps: send@0.8.2 + - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + +1.5.1 / 2014-08-09 +================== + + * Fix parsing of weird `req.originalUrl` values + * deps: parseurl@~1.3.0 + * deps: utils-merge@1.0.0 + +1.5.0 / 2014-08-05 +================== + + * deps: send@0.8.1 + - Add `extensions` option + +1.4.4 / 2014-08-04 +================== + + * deps: send@0.7.4 + - Fix serving index files without root dir + +1.4.3 / 2014-07-29 +================== + + * deps: send@0.7.3 + - Fix incorrect 403 on Windows and Node.js 0.11 + +1.4.2 / 2014-07-27 +================== + + * deps: send@0.7.2 + - deps: depd@0.4.4 + +1.4.1 / 2014-07-26 +================== + + * deps: send@0.7.1 + - deps: depd@0.4.3 + +1.4.0 / 2014-07-21 +================== + + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * deps: send@0.7.0 + - Add `dotfiles` option + - deps: debug@1.0.4 + - deps: depd@0.4.2 + +1.3.2 / 2014-07-11 +================== + + * deps: send@0.6.0 + - Cap `maxAge` value to 1 year + - deps: debug@1.0.3 + +1.3.1 / 2014-07-09 +================== + + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + +1.3.0 / 2014-06-28 +================== + + * Add `setHeaders` option + * Include HTML link in redirect response + * deps: send@0.5.0 + - Accept string for `maxAge` (converted by `ms`) + +1.2.3 / 2014-06-11 +================== + + * deps: send@0.4.3 + - Do not throw un-catchable error on file open race condition + - Use `escape-html` for HTML escaping + - deps: debug@1.0.2 + - deps: finished@1.2.2 + - deps: fresh@0.2.2 + +1.2.2 / 2014-06-09 +================== + + * deps: send@0.4.2 + - fix "event emitter leak" warnings + - deps: debug@1.0.1 + - deps: finished@1.2.1 + +1.2.1 / 2014-06-02 +================== + + * use `escape-html` for escaping + * deps: send@0.4.1 + - Send `max-age` in `Cache-Control` in correct format + +1.2.0 / 2014-05-29 +================== + + * deps: send@0.4.0 + - Calculate ETag with md5 for reduced collisions + - Fix wrong behavior when index file matches directory + - Ignore stream errors after request ends + - Skip directories in index file search + - deps: debug@0.8.1 + +1.1.0 / 2014-04-24 +================== + + * Accept options directly to `send` module + * deps: send@0.3.0 + +1.0.4 / 2014-04-07 +================== + + * Resolve relative paths at middleware setup + * Use parseurl to parse the URL from request + +1.0.3 / 2014-03-20 +================== + + * Do not rely on connect-like environments + +1.0.2 / 2014-03-06 +================== + + * deps: send@0.2.0 + +1.0.1 / 2014-03-05 +================== + + * Add mime export for back-compat + +1.0.0 / 2014-03-05 +================== + + * Genesis from `connect` diff --git a/8 node/node_modules/serve-static/LICENSE b/8 node/node_modules/serve-static/LICENSE new file mode 100644 index 000000000..cbe62e8e7 --- /dev/null +++ b/8 node/node_modules/serve-static/LICENSE @@ -0,0 +1,25 @@ +(The MIT License) + +Copyright (c) 2010 Sencha Inc. +Copyright (c) 2011 LearnBoost +Copyright (c) 2011 TJ Holowaychuk +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/serve-static/README.md b/8 node/node_modules/serve-static/README.md new file mode 100644 index 000000000..3dd5f48c3 --- /dev/null +++ b/8 node/node_modules/serve-static/README.md @@ -0,0 +1,253 @@ +# serve-static + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Test Coverage][coveralls-image]][coveralls-url] +[![Gratipay][gratipay-image]][gratipay-url] + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install serve-static +``` + +## API + + + +```js +var serveStatic = require('serve-static') +``` + +### serveStatic(root, options) + +Create a new middleware function to serve files from within a given root +directory. The file to serve will be determined by combining `req.url` +with the provided root directory. When a file is not found, instead of +sending a 404 response, this module will instead call `next()` to move on +to the next middleware, allowing for stacking and fall-backs. + +#### Options + +##### acceptRanges + +Enable or disable accepting ranged requests, defaults to true. +Disabling this will not send `Accept-Ranges` and ignore the contents +of the `Range` request header. + +##### cacheControl + +Enable or disable setting `Cache-Control` response header, defaults to +true. Disabling this will ignore the `maxAge` option. + +##### dotfiles + + Set how "dotfiles" are treated when encountered. A dotfile is a file +or directory that begins with a dot ("."). Note this check is done on +the path itself without checking if the path actually exists on the +disk. If `root` is specified, only the dotfiles above the root are +checked (i.e. the root itself can be within a dotfile when set +to "deny"). + + - `'allow'` No special treatment for dotfiles. + - `'deny'` Deny a request for a dotfile and 403/`next()`. + - `'ignore'` Pretend like the dotfile does not exist and 404/`next()`. + +The default value is similar to `'ignore'`, with the exception that this +default will not ignore the files within a directory that begins with a dot. + +##### etag + +Enable or disable etag generation, defaults to true. + +##### extensions + +Set file extension fallbacks. When set, if a file is not found, the given +extensions will be added to the file name and search for. The first that +exists will be served. Example: `['html', 'htm']`. + +The default value is `false`. + +##### fallthrough + +Set the middleware to have client errors fall-through as just unhandled +requests, otherwise forward a client error. The difference is that client +errors like a bad request or a request to a non-existent file will cause +this middleware to simply `next()` to your next middleware when this value +is `true`. When this value is `false`, these errors (even 404s), will invoke +`next(err)`. + +Typically `true` is desired such that multiple physical directories can be +mapped to the same web address or for routes to fill in non-existent files. + +The value `false` can be used if this middleware is mounted at a path that +is designed to be strictly a single file system directory, which allows for +short-circuiting 404s for less overhead. This middleware will also reply to +all methods. + +The default value is `true`. + +##### index + +By default this module will send "index.html" files in response to a request +on a directory. To disable this set `false` or to supply a new index pass a +string or an array in preferred order. + +##### lastModified + +Enable or disable `Last-Modified` header, defaults to true. Uses the file +system's last modified value. + +##### maxAge + +Provide a max-age in milliseconds for http caching, defaults to 0. This +can also be a string accepted by the [ms](https://www.npmjs.org/package/ms#readme) +module. + +##### redirect + +Redirect to trailing "/" when the pathname is a dir. Defaults to `true`. + +##### setHeaders + +Function to set custom headers on response. Alterations to the headers need to +occur synchronously. The function is called as `fn(res, path, stat)`, where +the arguments are: + + - `res` the response object + - `path` the file path that is being sent + - `stat` the stat object of the file that is being sent + +## Examples + +### Serve files with vanilla node.js http server + +```js +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +// Serve up public/ftp folder +var serve = serveStatic('public/ftp', {'index': ['index.html', 'index.htm']}) + +// Create server +var server = http.createServer(function onRequest (req, res) { + serve(req, res, finalhandler(req, res)) +}) + +// Listen +server.listen(3000) +``` + +### Serve all files as downloads + +```js +var contentDisposition = require('content-disposition') +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +// Serve up public/ftp folder +var serve = serveStatic('public/ftp', { + 'index': false, + 'setHeaders': setHeaders +}) + +// Set header to force download +function setHeaders (res, path) { + res.setHeader('Content-Disposition', contentDisposition(path)) +} + +// Create server +var server = http.createServer(function onRequest (req, res) { + serve(req, res, finalhandler(req, res)) +}) + +// Listen +server.listen(3000) +``` + +### Serving using express + +#### Simple + +This is a simple example of using Express. + +```js +var express = require('express') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic('public/ftp', {'index': ['default.html', 'default.htm']})) +app.listen(3000) +``` + +#### Multiple roots + +This example shows a simple way to search through multiple directories. +Files are look for in `public-optimized/` first, then `public/` second as +a fallback. + +```js +var express = require('express') +var path = require('path') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic(path.join(__dirname, 'public-optimized'))) +app.use(serveStatic(path.join(__dirname, 'public'))) +app.listen(3000) +``` + +#### Different settings for paths + +This example shows how to set a different max age depending on the served +file type. In this example, HTML files are not cached, while everything else +is for 1 day. + +```js +var express = require('express') +var path = require('path') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic(path.join(__dirname, 'public'), { + maxAge: '1d', + setHeaders: setCustomCacheControl +})) + +app.listen(3000) + +function setCustomCacheControl (res, path) { + if (serveStatic.mime.lookup(path) === 'text/html') { + // Custom Cache-Control for HTML files + res.setHeader('Cache-Control', 'public, max-age=0') + } +} +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/serve-static.svg +[npm-url]: https://npmjs.org/package/serve-static +[travis-image]: https://img.shields.io/travis/expressjs/serve-static/master.svg?label=linux +[travis-url]: https://travis-ci.org/expressjs/serve-static +[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/serve-static/master.svg?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/serve-static +[coveralls-image]: https://img.shields.io/coveralls/expressjs/serve-static/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/serve-static +[downloads-image]: https://img.shields.io/npm/dm/serve-static.svg +[downloads-url]: https://npmjs.org/package/serve-static +[gratipay-image]: https://img.shields.io/gratipay/dougwilson.svg +[gratipay-url]: https://gratipay.com/dougwilson/ diff --git a/8 node/node_modules/serve-static/index.js b/8 node/node_modules/serve-static/index.js new file mode 100644 index 000000000..85df3d05d --- /dev/null +++ b/8 node/node_modules/serve-static/index.js @@ -0,0 +1,209 @@ +/*! + * serve-static + * Copyright(c) 2010 Sencha Inc. + * Copyright(c) 2011 TJ Holowaychuk + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var parseUrl = require('parseurl') +var resolve = require('path').resolve +var send = require('send') +var url = require('url') + +/** + * Module exports. + * @public + */ + +module.exports = serveStatic +module.exports.mime = send.mime + +/** + * @param {string} root + * @param {object} [options] + * @return {function} + * @public + */ + +function serveStatic (root, options) { + if (!root) { + throw new TypeError('root path required') + } + + if (typeof root !== 'string') { + throw new TypeError('root path must be a string') + } + + // copy options object + var opts = Object.create(options || null) + + // fall-though + var fallthrough = opts.fallthrough !== false + + // default redirect + var redirect = opts.redirect !== false + + // headers listener + var setHeaders = opts.setHeaders + + if (setHeaders && typeof setHeaders !== 'function') { + throw new TypeError('option setHeaders must be function') + } + + // setup options for send + opts.maxage = opts.maxage || opts.maxAge || 0 + opts.root = resolve(root) + + // construct directory listener + var onDirectory = redirect + ? createRedirectDirectoryListener() + : createNotFoundDirectoryListener() + + return function serveStatic (req, res, next) { + if (req.method !== 'GET' && req.method !== 'HEAD') { + if (fallthrough) { + return next() + } + + // method not allowed + res.statusCode = 405 + res.setHeader('Allow', 'GET, HEAD') + res.setHeader('Content-Length', '0') + res.end() + return + } + + var forwardError = !fallthrough + var originalUrl = parseUrl.original(req) + var path = parseUrl(req).pathname + + // make sure redirect occurs at mount + if (path === '/' && originalUrl.pathname.substr(-1) !== '/') { + path = '' + } + + // create send stream + var stream = send(req, path, opts) + + // add directory handler + stream.on('directory', onDirectory) + + // add headers listener + if (setHeaders) { + stream.on('headers', setHeaders) + } + + // add file listener for fallthrough + if (fallthrough) { + stream.on('file', function onFile () { + // once file is determined, always forward error + forwardError = true + }) + } + + // forward errors + stream.on('error', function error (err) { + if (forwardError || !(err.statusCode < 500)) { + next(err) + return + } + + next() + }) + + // pipe + stream.pipe(res) + } +} + +/** + * Collapse all leading slashes into a single slash + * @private + */ +function collapseLeadingSlashes (str) { + for (var i = 0; i < str.length; i++) { + if (str[i] !== '/') { + break + } + } + + return i > 1 + ? '/' + str.substr(i) + : str +} + + /** + * Create a minimal HTML document. + * + * @param {string} title + * @param {string} body + * @private + */ + +function createHtmlDocument (title, body) { + return '\n' + + '\n' + + '\n' + + '\n' + + '' + title + '\n' + + '\n' + + '\n' + + '
' + body + '
\n' + + '\n' +} + +/** + * Create a directory listener that just 404s. + * @private + */ + +function createNotFoundDirectoryListener () { + return function notFound () { + this.error(404) + } +} + +/** + * Create a directory listener that performs a redirect. + * @private + */ + +function createRedirectDirectoryListener () { + return function redirect (res) { + if (this.hasTrailingSlash()) { + this.error(404) + return + } + + // get original URL + var originalUrl = parseUrl.original(this.req) + + // append trailing slash + originalUrl.path = null + originalUrl.pathname = collapseLeadingSlashes(originalUrl.pathname + '/') + + // reformat the URL + var loc = encodeUrl(url.format(originalUrl)) + var doc = createHtmlDocument('Redirecting', 'Redirecting to ' + + escapeHtml(loc) + '') + + // send redirect response + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(doc)) + res.setHeader('Content-Security-Policy', "default-src 'self'") + res.setHeader('X-Content-Type-Options', 'nosniff') + res.setHeader('Location', loc) + res.end(doc) + } +} diff --git a/8 node/node_modules/serve-static/package.json b/8 node/node_modules/serve-static/package.json new file mode 100644 index 000000000..20c1ef84e --- /dev/null +++ b/8 node/node_modules/serve-static/package.json @@ -0,0 +1,75 @@ +{ + "_from": "serve-static@1.12.3", + "_id": "serve-static@1.12.3", + "_inBundle": false, + "_integrity": "sha1-n0uhni8wMMVH+K+ZEHg47DjVseI=", + "_location": "/serve-static", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "serve-static@1.12.3", + "name": "serve-static", + "escapedName": "serve-static", + "rawSpec": "1.12.3", + "saveSpec": null, + "fetchSpec": "1.12.3" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.12.3.tgz", + "_shasum": "9f4ba19e2f3030c547f8af99107838ec38d5b1e2", + "_spec": "serve-static@1.12.3", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/expressjs/serve-static/issues" + }, + "bundleDependencies": false, + "dependencies": { + "encodeurl": "~1.0.1", + "escape-html": "~1.0.3", + "parseurl": "~1.3.1", + "send": "0.15.3" + }, + "deprecated": false, + "description": "Serve static files", + "devDependencies": { + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.2.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-node": "4.2.2", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "2.5.3", + "supertest": "1.1.0" + }, + "engines": { + "node": ">= 0.8.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/expressjs/serve-static#readme", + "license": "MIT", + "name": "serve-static", + "repository": { + "type": "git", + "url": "git+https://github.com/expressjs/serve-static.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "1.12.3" +} diff --git a/8 node/node_modules/setprototypeof/LICENSE b/8 node/node_modules/setprototypeof/LICENSE new file mode 100644 index 000000000..61afa2f18 --- /dev/null +++ b/8 node/node_modules/setprototypeof/LICENSE @@ -0,0 +1,13 @@ +Copyright (c) 2015, Wes Todd + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY +SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION +OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN +CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/8 node/node_modules/setprototypeof/README.md b/8 node/node_modules/setprototypeof/README.md new file mode 100644 index 000000000..01d794705 --- /dev/null +++ b/8 node/node_modules/setprototypeof/README.md @@ -0,0 +1,21 @@ +# Polyfill for `Object.setPrototypeOf` + +A simple cross platform implementation to set the prototype of an instianted object. Supports all modern browsers and at least back to IE8. + +## Usage: + +``` +$ npm install --save setprototypeof +``` + +```javascript +var setPrototypeOf = require('setprototypeof'); + +var obj = {}; +setPrototypeOf(obj, { + foo: function() { + return 'bar'; + } +}); +obj.foo(); // bar +``` diff --git a/8 node/node_modules/setprototypeof/index.js b/8 node/node_modules/setprototypeof/index.js new file mode 100644 index 000000000..93ea4176c --- /dev/null +++ b/8 node/node_modules/setprototypeof/index.js @@ -0,0 +1,15 @@ +module.exports = Object.setPrototypeOf || ({__proto__:[]} instanceof Array ? setProtoOf : mixinProperties); + +function setProtoOf(obj, proto) { + obj.__proto__ = proto; + return obj; +} + +function mixinProperties(obj, proto) { + for (var prop in proto) { + if (!obj.hasOwnProperty(prop)) { + obj[prop] = proto[prop]; + } + } + return obj; +} diff --git a/8 node/node_modules/setprototypeof/package.json b/8 node/node_modules/setprototypeof/package.json new file mode 100644 index 000000000..a386a52ff --- /dev/null +++ b/8 node/node_modules/setprototypeof/package.json @@ -0,0 +1,52 @@ +{ + "_from": "setprototypeof@1.0.3", + "_id": "setprototypeof@1.0.3", + "_inBundle": false, + "_integrity": "sha1-ZlZ+NwQ+608E2RvWWMDL77VbjgQ=", + "_location": "/setprototypeof", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "setprototypeof@1.0.3", + "name": "setprototypeof", + "escapedName": "setprototypeof", + "rawSpec": "1.0.3", + "saveSpec": null, + "fetchSpec": "1.0.3" + }, + "_requiredBy": [ + "/express", + "/http-errors" + ], + "_resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.0.3.tgz", + "_shasum": "66567e37043eeb4f04d91bd658c0cbefb55b8e04", + "_spec": "setprototypeof@1.0.3", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Wes Todd" + }, + "bugs": { + "url": "https://github.com/wesleytodd/setprototypeof/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "A small polyfill for Object.setprototypeof", + "homepage": "https://github.com/wesleytodd/setprototypeof", + "keywords": [ + "polyfill", + "object", + "setprototypeof" + ], + "license": "ISC", + "main": "index.js", + "name": "setprototypeof", + "repository": { + "type": "git", + "url": "git+https://github.com/wesleytodd/setprototypeof.git" + }, + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1" + }, + "version": "1.0.3" +} diff --git a/8 node/node_modules/statuses/HISTORY.md b/8 node/node_modules/statuses/HISTORY.md new file mode 100644 index 000000000..3015a5fec --- /dev/null +++ b/8 node/node_modules/statuses/HISTORY.md @@ -0,0 +1,55 @@ +1.3.1 / 2016-11-11 +================== + + * Fix return type in JSDoc + +1.3.0 / 2016-05-17 +================== + + * Add `421 Misdirected Request` + * perf: enable strict mode + +1.2.1 / 2015-02-01 +================== + + * Fix message for status 451 + - `451 Unavailable For Legal Reasons` + +1.2.0 / 2014-09-28 +================== + + * Add `208 Already Repored` + * Add `226 IM Used` + * Add `306 (Unused)` + * Add `415 Unable For Legal Reasons` + * Add `508 Loop Detected` + +1.1.1 / 2014-09-24 +================== + + * Add missing 308 to `codes.json` + +1.1.0 / 2014-09-21 +================== + + * Add `codes.json` for universal support + +1.0.4 / 2014-08-20 +================== + + * Package cleanup + +1.0.3 / 2014-06-08 +================== + + * Add 308 to `.redirect` category + +1.0.2 / 2014-03-13 +================== + + * Add `.retry` category + +1.0.1 / 2014-03-12 +================== + + * Initial release diff --git a/8 node/node_modules/statuses/LICENSE b/8 node/node_modules/statuses/LICENSE new file mode 100644 index 000000000..82af4df54 --- /dev/null +++ b/8 node/node_modules/statuses/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com +Copyright (c) 2016 Douglas Christopher Wilson doug@somethingdoug.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/8 node/node_modules/statuses/README.md b/8 node/node_modules/statuses/README.md new file mode 100644 index 000000000..2bf0756e0 --- /dev/null +++ b/8 node/node_modules/statuses/README.md @@ -0,0 +1,103 @@ +# Statuses + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP status utility for node. + +## API + +```js +var status = require('statuses') +``` + +### var code = status(Integer || String) + +If `Integer` or `String` is a valid HTTP code or status message, then the appropriate `code` will be returned. Otherwise, an error will be thrown. + +```js +status(403) // => 403 +status('403') // => 403 +status('forbidden') // => 403 +status('Forbidden') // => 403 +status(306) // throws, as it's not supported by node.js +``` + +### status.codes + +Returns an array of all the status codes as `Integer`s. + +### var msg = status[code] + +Map of `code` to `status message`. `undefined` for invalid `code`s. + +```js +status[404] // => 'Not Found' +``` + +### var code = status[msg] + +Map of `status message` to `code`. `msg` can either be title-cased or lower-cased. `undefined` for invalid `status message`s. + +```js +status['not found'] // => 404 +status['Not Found'] // => 404 +``` + +### status.redirect[code] + +Returns `true` if a status code is a valid redirect status. + +```js +status.redirect[200] // => undefined +status.redirect[301] // => true +``` + +### status.empty[code] + +Returns `true` if a status code expects an empty body. + +```js +status.empty[200] // => undefined +status.empty[204] // => true +status.empty[304] // => true +``` + +### status.retry[code] + +Returns `true` if you should retry the rest. + +```js +status.retry[501] // => undefined +status.retry[503] // => true +``` + +## Adding Status Codes + +The status codes are primarily sourced from http://www.iana.org/assignments/http-status-codes/http-status-codes-1.csv. +Additionally, custom codes are added from http://en.wikipedia.org/wiki/List_of_HTTP_status_codes. +These are added manually in the `lib/*.json` files. +If you would like to add a status code, add it to the appropriate JSON file. + +To rebuild `codes.json`, run the following: + +```bash +# update src/iana.json +npm run fetch +# build codes.json +npm run build +``` + +[npm-image]: https://img.shields.io/npm/v/statuses.svg +[npm-url]: https://npmjs.org/package/statuses +[node-version-image]: https://img.shields.io/badge/node.js-%3E%3D_0.6-brightgreen.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/jshttp/statuses.svg +[travis-url]: https://travis-ci.org/jshttp/statuses +[coveralls-image]: https://img.shields.io/coveralls/jshttp/statuses.svg +[coveralls-url]: https://coveralls.io/r/jshttp/statuses?branch=master +[downloads-image]: https://img.shields.io/npm/dm/statuses.svg +[downloads-url]: https://npmjs.org/package/statuses diff --git a/8 node/node_modules/statuses/codes.json b/8 node/node_modules/statuses/codes.json new file mode 100644 index 000000000..e76512337 --- /dev/null +++ b/8 node/node_modules/statuses/codes.json @@ -0,0 +1,65 @@ +{ + "100": "Continue", + "101": "Switching Protocols", + "102": "Processing", + "200": "OK", + "201": "Created", + "202": "Accepted", + "203": "Non-Authoritative Information", + "204": "No Content", + "205": "Reset Content", + "206": "Partial Content", + "207": "Multi-Status", + "208": "Already Reported", + "226": "IM Used", + "300": "Multiple Choices", + "301": "Moved Permanently", + "302": "Found", + "303": "See Other", + "304": "Not Modified", + "305": "Use Proxy", + "306": "(Unused)", + "307": "Temporary Redirect", + "308": "Permanent Redirect", + "400": "Bad Request", + "401": "Unauthorized", + "402": "Payment Required", + "403": "Forbidden", + "404": "Not Found", + "405": "Method Not Allowed", + "406": "Not Acceptable", + "407": "Proxy Authentication Required", + "408": "Request Timeout", + "409": "Conflict", + "410": "Gone", + "411": "Length Required", + "412": "Precondition Failed", + "413": "Payload Too Large", + "414": "URI Too Long", + "415": "Unsupported Media Type", + "416": "Range Not Satisfiable", + "417": "Expectation Failed", + "418": "I'm a teapot", + "421": "Misdirected Request", + "422": "Unprocessable Entity", + "423": "Locked", + "424": "Failed Dependency", + "425": "Unordered Collection", + "426": "Upgrade Required", + "428": "Precondition Required", + "429": "Too Many Requests", + "431": "Request Header Fields Too Large", + "451": "Unavailable For Legal Reasons", + "500": "Internal Server Error", + "501": "Not Implemented", + "502": "Bad Gateway", + "503": "Service Unavailable", + "504": "Gateway Timeout", + "505": "HTTP Version Not Supported", + "506": "Variant Also Negotiates", + "507": "Insufficient Storage", + "508": "Loop Detected", + "509": "Bandwidth Limit Exceeded", + "510": "Not Extended", + "511": "Network Authentication Required" +} \ No newline at end of file diff --git a/8 node/node_modules/statuses/index.js b/8 node/node_modules/statuses/index.js new file mode 100644 index 000000000..9f955c6fc --- /dev/null +++ b/8 node/node_modules/statuses/index.js @@ -0,0 +1,110 @@ +/*! + * statuses + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var codes = require('./codes.json') + +/** + * Module exports. + * @public + */ + +module.exports = status + +// array of status codes +status.codes = populateStatusesMap(status, codes) + +// status codes for redirects +status.redirect = { + 300: true, + 301: true, + 302: true, + 303: true, + 305: true, + 307: true, + 308: true +} + +// status codes for empty bodies +status.empty = { + 204: true, + 205: true, + 304: true +} + +// status codes for when you should retry the request +status.retry = { + 502: true, + 503: true, + 504: true +} + +/** + * Populate the statuses map for given codes. + * @private + */ + +function populateStatusesMap (statuses, codes) { + var arr = [] + + Object.keys(codes).forEach(function forEachCode (code) { + var message = codes[code] + var status = Number(code) + + // Populate properties + statuses[status] = message + statuses[message] = status + statuses[message.toLowerCase()] = status + + // Add to array + arr.push(status) + }) + + return arr +} + +/** + * Get the status code. + * + * Given a number, this will throw if it is not a known status + * code, otherwise the code will be returned. Given a string, + * the string will be parsed for a number and return the code + * if valid, otherwise will lookup the code assuming this is + * the status message. + * + * @param {string|number} code + * @returns {number} + * @public + */ + +function status (code) { + if (typeof code === 'number') { + if (!status[code]) throw new Error('invalid status code: ' + code) + return code + } + + if (typeof code !== 'string') { + throw new TypeError('code must be a number or string') + } + + // '403' + var n = parseInt(code, 10) + if (!isNaN(n)) { + if (!status[n]) throw new Error('invalid status code: ' + n) + return n + } + + n = status[code.toLowerCase()] + if (!n) throw new Error('invalid status message: "' + code + '"') + return n +} diff --git a/8 node/node_modules/statuses/package.json b/8 node/node_modules/statuses/package.json new file mode 100644 index 000000000..81e5a4d35 --- /dev/null +++ b/8 node/node_modules/statuses/package.json @@ -0,0 +1,86 @@ +{ + "_from": "statuses@~1.3.1", + "_id": "statuses@1.3.1", + "_inBundle": false, + "_integrity": "sha1-+vUbnrdKrvOzrPStX2Gr8ky3uT4=", + "_location": "/statuses", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "statuses@~1.3.1", + "name": "statuses", + "escapedName": "statuses", + "rawSpec": "~1.3.1", + "saveSpec": null, + "fetchSpec": "~1.3.1" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/http-errors", + "/send" + ], + "_resolved": "https://registry.npmjs.org/statuses/-/statuses-1.3.1.tgz", + "_shasum": "faf51b9eb74aaef3b3acf4ad5f61abf24cb7b93e", + "_spec": "statuses@~1.3.1", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/statuses/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "deprecated": false, + "description": "HTTP status utility", + "devDependencies": { + "csv-parse": "1.1.7", + "eslint": "3.10.0", + "eslint-config-standard": "6.2.1", + "eslint-plugin-promise": "3.3.2", + "eslint-plugin-standard": "2.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5", + "stream-to-array": "2.3.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "index.js", + "codes.json", + "LICENSE" + ], + "homepage": "https://github.com/jshttp/statuses#readme", + "keywords": [ + "http", + "status", + "code" + ], + "license": "MIT", + "name": "statuses", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/statuses.git" + }, + "scripts": { + "build": "node scripts/build.js", + "fetch": "node scripts/fetch.js", + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "update": "npm run fetch && npm run build" + }, + "version": "1.3.1" +} diff --git a/8 node/node_modules/type-is/HISTORY.md b/8 node/node_modules/type-is/HISTORY.md new file mode 100644 index 000000000..96bc93ed5 --- /dev/null +++ b/8 node/node_modules/type-is/HISTORY.md @@ -0,0 +1,218 @@ +1.6.15 / 2017-03-31 +=================== + + * deps: mime-types@~2.1.15 + - Add new mime types + +1.6.14 / 2016-11-18 +=================== + + * deps: mime-types@~2.1.13 + - Add new mime types + +1.6.13 / 2016-05-18 +=================== + + * deps: mime-types@~2.1.11 + - Add new mime types + +1.6.12 / 2016-02-28 +=================== + + * deps: mime-types@~2.1.10 + - Add new mime types + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + +1.6.11 / 2016-01-29 +=================== + + * deps: mime-types@~2.1.9 + - Add new mime types + +1.6.10 / 2015-12-01 +=================== + + * deps: mime-types@~2.1.8 + - Add new mime types + +1.6.9 / 2015-09-27 +================== + + * deps: mime-types@~2.1.7 + - Add new mime types + +1.6.8 / 2015-09-04 +================== + + * deps: mime-types@~2.1.6 + - Add new mime types + +1.6.7 / 2015-08-20 +================== + + * Fix type error when given invalid type to match against + * deps: mime-types@~2.1.5 + - Add new mime types + +1.6.6 / 2015-07-31 +================== + + * deps: mime-types@~2.1.4 + - Add new mime types + +1.6.5 / 2015-07-16 +================== + + * deps: mime-types@~2.1.3 + - Add new mime types + +1.6.4 / 2015-07-01 +================== + + * deps: mime-types@~2.1.2 + - Add new mime types + * perf: enable strict mode + * perf: remove argument reassignment + +1.6.3 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - Add new mime types + * perf: reduce try block size + * perf: remove bitwise operations + +1.6.2 / 2015-05-10 +================== + + * deps: mime-types@~2.0.11 + - Add new mime types + +1.6.1 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - Add new mime types + +1.6.0 / 2015-02-12 +================== + + * fix false-positives in `hasBody` `Transfer-Encoding` check + * support wildcard for both type and subtype (`*/*`) + +1.5.7 / 2015-02-09 +================== + + * fix argument reassignment + * deps: mime-types@~2.0.9 + - Add new mime types + +1.5.6 / 2015-01-29 +================== + + * deps: mime-types@~2.0.8 + - Add new mime types + +1.5.5 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - Add new mime types + - Fix missing extensions + - Fix various invalid MIME type entries + - Remove example template MIME types + - deps: mime-db@~1.5.0 + +1.5.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - Add new mime types + - deps: mime-db@~1.3.0 + +1.5.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - Add new mime types + - deps: mime-db@~1.2.0 + +1.5.2 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - Add new mime types + - deps: mime-db@~1.1.0 + +1.5.1 / 2014-09-07 +================== + + * Support Node.js 0.6 + * deps: media-typer@0.3.0 + * deps: mime-types@~2.0.1 + - Support Node.js 0.6 + +1.5.0 / 2014-09-05 +================== + + * fix `hasbody` to be true for `content-length: 0` + +1.4.0 / 2014-09-02 +================== + + * update mime-types + +1.3.2 / 2014-06-24 +================== + + * use `~` range on mime-types + +1.3.1 / 2014-06-19 +================== + + * fix global variable leak + +1.3.0 / 2014-06-19 +================== + + * improve type parsing + + - invalid media type never matches + - media type not case-sensitive + - extra LWS does not affect results + +1.2.2 / 2014-06-19 +================== + + * fix behavior on unknown type argument + +1.2.1 / 2014-06-03 +================== + + * switch dependency from `mime` to `mime-types@1.0.0` + +1.2.0 / 2014-05-11 +================== + + * support suffix matching: + + - `+json` matches `application/vnd+json` + - `*/vnd+json` matches `application/vnd+json` + - `application/*+json` matches `application/vnd+json` + +1.1.0 / 2014-04-12 +================== + + * add non-array values support + * expose internal utilities: + + - `.is()` + - `.hasBody()` + - `.normalize()` + - `.match()` + +1.0.1 / 2014-03-30 +================== + + * add `multipart` as a shorthand diff --git a/8 node/node_modules/type-is/LICENSE b/8 node/node_modules/type-is/LICENSE new file mode 100644 index 000000000..386b7b694 --- /dev/null +++ b/8 node/node_modules/type-is/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/type-is/README.md b/8 node/node_modules/type-is/README.md new file mode 100644 index 000000000..70c47daec --- /dev/null +++ b/8 node/node_modules/type-is/README.md @@ -0,0 +1,146 @@ +# type-is + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Infer the content-type of a request. + +### Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install type-is +``` + +## API + +```js +var http = require('http') +var typeis = require('type-is') + +http.createServer(function (req, res) { + var istext = typeis(req, ['text/*']) + res.end('you ' + (istext ? 'sent' : 'did not send') + ' me text') +}) +``` + +### type = typeis(request, types) + +`request` is the node HTTP request. `types` is an array of types. + + + +```js +// req.headers.content-type = 'application/json' + +typeis(req, ['json']) // 'json' +typeis(req, ['html', 'json']) // 'json' +typeis(req, ['application/*']) // 'application/json' +typeis(req, ['application/json']) // 'application/json' + +typeis(req, ['html']) // false +``` + +### typeis.hasBody(request) + +Returns a Boolean if the given `request` has a body, regardless of the +`Content-Type` header. + +Having a body has no relation to how large the body is (it may be 0 bytes). +This is similar to how file existence works. If a body does exist, then this +indicates that there is data to read from the Node.js request stream. + + + +```js +if (typeis.hasBody(req)) { + // read the body, since there is one + + req.on('data', function (chunk) { + // ... + }) +} +``` + +### type = typeis.is(mediaType, types) + +`mediaType` is the [media type](https://tools.ietf.org/html/rfc6838) string. `types` is an array of types. + + + +```js +var mediaType = 'application/json' + +typeis.is(mediaType, ['json']) // 'json' +typeis.is(mediaType, ['html', 'json']) // 'json' +typeis.is(mediaType, ['application/*']) // 'application/json' +typeis.is(mediaType, ['application/json']) // 'application/json' + +typeis.is(mediaType, ['html']) // false +``` + +### Each type can be: + +- An extension name such as `json`. This name will be returned if matched. +- A mime type such as `application/json`. +- A mime type with a wildcard such as `*/*` or `*/json` or `application/*`. The full mime type will be returned if matched. +- A suffix such as `+json`. This can be combined with a wildcard such as `*/vnd+json` or `application/*+json`. The full mime type will be returned if matched. + +`false` will be returned if no type matches or the content type is invalid. + +`null` will be returned if the request does not have a body. + +## Examples + +### Example body parser + +```js +var express = require('express') +var typeis = require('type-is') + +var app = express() + +app.use(function bodyParser (req, res, next) { + if (!typeis.hasBody(req)) { + return next() + } + + switch (typeis(req, ['urlencoded', 'json', 'multipart'])) { + case 'urlencoded': + // parse urlencoded body + throw new Error('implement urlencoded body parsing') + case 'json': + // parse json body + throw new Error('implement json body parsing') + case 'multipart': + // parse multipart body + throw new Error('implement multipart body parsing') + default: + // 415 error code + res.statusCode = 415 + res.end() + break + } +}) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/type-is.svg +[npm-url]: https://npmjs.org/package/type-is +[node-version-image]: https://img.shields.io/node/v/type-is.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/type-is/master.svg +[travis-url]: https://travis-ci.org/jshttp/type-is +[coveralls-image]: https://img.shields.io/coveralls/jshttp/type-is/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/type-is?branch=master +[downloads-image]: https://img.shields.io/npm/dm/type-is.svg +[downloads-url]: https://npmjs.org/package/type-is diff --git a/8 node/node_modules/type-is/index.js b/8 node/node_modules/type-is/index.js new file mode 100644 index 000000000..4da730118 --- /dev/null +++ b/8 node/node_modules/type-is/index.js @@ -0,0 +1,262 @@ +/*! + * type-is + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var typer = require('media-typer') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = typeofrequest +module.exports.is = typeis +module.exports.hasBody = hasbody +module.exports.normalize = normalize +module.exports.match = mimeMatch + +/** + * Compare a `value` content-type with `types`. + * Each `type` can be an extension like `html`, + * a special shortcut like `multipart` or `urlencoded`, + * or a mime type. + * + * If no types match, `false` is returned. + * Otherwise, the first `type` that matches is returned. + * + * @param {String} value + * @param {Array} types + * @public + */ + +function typeis (value, types_) { + var i + var types = types_ + + // remove parameters and normalize + var val = tryNormalizeType(value) + + // no type or invalid + if (!val) { + return false + } + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length - 1) + for (i = 0; i < types.length; i++) { + types[i] = arguments[i + 1] + } + } + + // no types, return the content type + if (!types || !types.length) { + return val + } + + var type + for (i = 0; i < types.length; i++) { + if (mimeMatch(normalize(type = types[i]), val)) { + return type[0] === '+' || type.indexOf('*') !== -1 + ? val + : type + } + } + + // no matches + return false +} + +/** + * Check if a request has a request body. + * A request with a body __must__ either have `transfer-encoding` + * or `content-length` headers set. + * http://www.w3.org/Protocols/rfc2616/rfc2616-sec4.html#sec4.3 + * + * @param {Object} request + * @return {Boolean} + * @public + */ + +function hasbody (req) { + return req.headers['transfer-encoding'] !== undefined || + !isNaN(req.headers['content-length']) +} + +/** + * Check if the incoming request contains the "Content-Type" + * header field, and it contains any of the give mime `type`s. + * If there is no request body, `null` is returned. + * If there is no content type, `false` is returned. + * Otherwise, it returns the first `type` that matches. + * + * Examples: + * + * // With Content-Type: text/html; charset=utf-8 + * this.is('html'); // => 'html' + * this.is('text/html'); // => 'text/html' + * this.is('text/*', 'application/json'); // => 'text/html' + * + * // When Content-Type is application/json + * this.is('json', 'urlencoded'); // => 'json' + * this.is('application/json'); // => 'application/json' + * this.is('html', 'application/*'); // => 'application/json' + * + * this.is('html'); // => false + * + * @param {String|Array} types... + * @return {String|false|null} + * @public + */ + +function typeofrequest (req, types_) { + var types = types_ + + // no body + if (!hasbody(req)) { + return null + } + + // support flattened arguments + if (arguments.length > 2) { + types = new Array(arguments.length - 1) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i + 1] + } + } + + // request content type + var value = req.headers['content-type'] + + return typeis(value, types) +} + +/** + * Normalize a mime type. + * If it's a shorthand, expand it to a valid mime type. + * + * In general, you probably want: + * + * var type = is(req, ['urlencoded', 'json', 'multipart']); + * + * Then use the appropriate body parsers. + * These three are the most common request body types + * and are thus ensured to work. + * + * @param {String} type + * @private + */ + +function normalize (type) { + if (typeof type !== 'string') { + // invalid type + return false + } + + switch (type) { + case 'urlencoded': + return 'application/x-www-form-urlencoded' + case 'multipart': + return 'multipart/*' + } + + if (type[0] === '+') { + // "+json" -> "*/*+json" expando + return '*/*' + type + } + + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if `expected` mime type + * matches `actual` mime type with + * wildcard and +suffix support. + * + * @param {String} expected + * @param {String} actual + * @return {Boolean} + * @private + */ + +function mimeMatch (expected, actual) { + // invalid type + if (expected === false) { + return false + } + + // split types + var actualParts = actual.split('/') + var expectedParts = expected.split('/') + + // invalid format + if (actualParts.length !== 2 || expectedParts.length !== 2) { + return false + } + + // validate type + if (expectedParts[0] !== '*' && expectedParts[0] !== actualParts[0]) { + return false + } + + // validate suffix wildcard + if (expectedParts[1].substr(0, 2) === '*+') { + return expectedParts[1].length <= actualParts[1].length + 1 && + expectedParts[1].substr(1) === actualParts[1].substr(1 - expectedParts[1].length) + } + + // validate subtype + if (expectedParts[1] !== '*' && expectedParts[1] !== actualParts[1]) { + return false + } + + return true +} + +/** + * Normalize a type and remove parameters. + * + * @param {string} value + * @return {string} + * @private + */ + +function normalizeType (value) { + // parse the type + var type = typer.parse(value) + + // remove the parameters + type.parameters = undefined + + // reformat it + return typer.format(type) +} + +/** + * Try to normalize a type and remove parameters. + * + * @param {string} value + * @return {string} + * @private + */ + +function tryNormalizeType (value) { + try { + return normalizeType(value) + } catch (err) { + return null + } +} diff --git a/8 node/node_modules/type-is/package.json b/8 node/node_modules/type-is/package.json new file mode 100644 index 000000000..6e18cffd8 --- /dev/null +++ b/8 node/node_modules/type-is/package.json @@ -0,0 +1,82 @@ +{ + "_from": "type-is@~1.6.15", + "_id": "type-is@1.6.15", + "_inBundle": false, + "_integrity": "sha1-yrEPtJCeRByChC6v4a1kbIGARBA=", + "_location": "/type-is", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "type-is@~1.6.15", + "name": "type-is", + "escapedName": "type-is", + "rawSpec": "~1.6.15", + "saveSpec": null, + "fetchSpec": "~1.6.15" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.15.tgz", + "_shasum": "cab10fb4909e441c82842eafe1ad646c81804410", + "_spec": "type-is@~1.6.15", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/type-is/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "media-typer": "0.3.0", + "mime-types": "~2.1.15" + }, + "deprecated": false, + "description": "Infer the content-type of a request.", + "devDependencies": { + "eslint": "3.19.0", + "eslint-config-standard": "7.1.0", + "eslint-plugin-markdown": "1.0.0-beta.4", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "2.1.1", + "istanbul": "0.4.5", + "mocha": "1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/type-is#readme", + "keywords": [ + "content", + "type", + "checking" + ], + "license": "MIT", + "name": "type-is", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/type-is.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.6.15" +} diff --git a/8 node/node_modules/unpipe/HISTORY.md b/8 node/node_modules/unpipe/HISTORY.md new file mode 100644 index 000000000..85e0f8d74 --- /dev/null +++ b/8 node/node_modules/unpipe/HISTORY.md @@ -0,0 +1,4 @@ +1.0.0 / 2015-06-14 +================== + + * Initial release diff --git a/8 node/node_modules/unpipe/LICENSE b/8 node/node_modules/unpipe/LICENSE new file mode 100644 index 000000000..aed013827 --- /dev/null +++ b/8 node/node_modules/unpipe/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/unpipe/README.md b/8 node/node_modules/unpipe/README.md new file mode 100644 index 000000000..e536ad2c0 --- /dev/null +++ b/8 node/node_modules/unpipe/README.md @@ -0,0 +1,43 @@ +# unpipe + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Unpipe a stream from all destinations. + +## Installation + +```sh +$ npm install unpipe +``` + +## API + +```js +var unpipe = require('unpipe') +``` + +### unpipe(stream) + +Unpipes all destinations from a given stream. With stream 2+, this is +equivalent to `stream.unpipe()`. When used with streams 1 style streams +(typically Node.js 0.8 and below), this module attempts to undo the +actions done in `stream.pipe(dest)`. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/unpipe.svg +[npm-url]: https://npmjs.org/package/unpipe +[node-image]: https://img.shields.io/node/v/unpipe.svg +[node-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/stream-utils/unpipe.svg +[travis-url]: https://travis-ci.org/stream-utils/unpipe +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/unpipe.svg +[coveralls-url]: https://coveralls.io/r/stream-utils/unpipe?branch=master +[downloads-image]: https://img.shields.io/npm/dm/unpipe.svg +[downloads-url]: https://npmjs.org/package/unpipe diff --git a/8 node/node_modules/unpipe/index.js b/8 node/node_modules/unpipe/index.js new file mode 100644 index 000000000..15c3d97a1 --- /dev/null +++ b/8 node/node_modules/unpipe/index.js @@ -0,0 +1,69 @@ +/*! + * unpipe + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = unpipe + +/** + * Determine if there are Node.js pipe-like data listeners. + * @private + */ + +function hasPipeDataListeners(stream) { + var listeners = stream.listeners('data') + + for (var i = 0; i < listeners.length; i++) { + if (listeners[i].name === 'ondata') { + return true + } + } + + return false +} + +/** + * Unpipe a stream from all destinations. + * + * @param {object} stream + * @public + */ + +function unpipe(stream) { + if (!stream) { + throw new TypeError('argument stream is required') + } + + if (typeof stream.unpipe === 'function') { + // new-style + stream.unpipe() + return + } + + // Node.js 0.8 hack + if (!hasPipeDataListeners(stream)) { + return + } + + var listener + var listeners = stream.listeners('close') + + for (var i = 0; i < listeners.length; i++) { + listener = listeners[i] + + if (listener.name !== 'cleanup' && listener.name !== 'onclose') { + continue + } + + // invoke the listener + listener.call(stream) + } +} diff --git a/8 node/node_modules/unpipe/package.json b/8 node/node_modules/unpipe/package.json new file mode 100644 index 000000000..c6c58b7a4 --- /dev/null +++ b/8 node/node_modules/unpipe/package.json @@ -0,0 +1,62 @@ +{ + "_from": "unpipe@~1.0.0", + "_id": "unpipe@1.0.0", + "_inBundle": false, + "_integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=", + "_location": "/unpipe", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "unpipe@~1.0.0", + "name": "unpipe", + "escapedName": "unpipe", + "rawSpec": "~1.0.0", + "saveSpec": null, + "fetchSpec": "~1.0.0" + }, + "_requiredBy": [ + "/finalhandler" + ], + "_resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "_shasum": "b2bf4ee8514aae6165b4817829d21b2ef49904ec", + "_spec": "unpipe@~1.0.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/finalhandler", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/stream-utils/unpipe/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Unpipe a stream from all destinations", + "devDependencies": { + "istanbul": "0.3.15", + "mocha": "2.2.5", + "readable-stream": "1.1.13" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/stream-utils/unpipe#readme", + "license": "MIT", + "name": "unpipe", + "repository": { + "type": "git", + "url": "git+https://github.com/stream-utils/unpipe.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.0.0" +} diff --git a/8 node/node_modules/utils-merge/.travis.yml b/8 node/node_modules/utils-merge/.travis.yml new file mode 100644 index 000000000..af92b021b --- /dev/null +++ b/8 node/node_modules/utils-merge/.travis.yml @@ -0,0 +1,6 @@ +language: "node_js" +node_js: + - "0.4" + - "0.6" + - "0.8" + - "0.10" diff --git a/8 node/node_modules/utils-merge/LICENSE b/8 node/node_modules/utils-merge/LICENSE new file mode 100644 index 000000000..e33bd10bb --- /dev/null +++ b/8 node/node_modules/utils-merge/LICENSE @@ -0,0 +1,20 @@ +(The MIT License) + +Copyright (c) 2013 Jared Hanson + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/utils-merge/README.md b/8 node/node_modules/utils-merge/README.md new file mode 100644 index 000000000..2f94e9bd2 --- /dev/null +++ b/8 node/node_modules/utils-merge/README.md @@ -0,0 +1,34 @@ +# utils-merge + +Merges the properties from a source object into a destination object. + +## Install + + $ npm install utils-merge + +## Usage + +```javascript +var a = { foo: 'bar' } + , b = { bar: 'baz' }; + +merge(a, b); +// => { foo: 'bar', bar: 'baz' } +``` + +## Tests + + $ npm install + $ npm test + +[![Build Status](https://secure.travis-ci.org/jaredhanson/utils-merge.png)](http://travis-ci.org/jaredhanson/utils-merge) + +## Credits + + - [Jared Hanson](http://github.com/jaredhanson) + +## License + +[The MIT License](http://opensource.org/licenses/MIT) + +Copyright (c) 2013 Jared Hanson <[http://jaredhanson.net/](http://jaredhanson.net/)> diff --git a/8 node/node_modules/utils-merge/index.js b/8 node/node_modules/utils-merge/index.js new file mode 100644 index 000000000..4265c694f --- /dev/null +++ b/8 node/node_modules/utils-merge/index.js @@ -0,0 +1,23 @@ +/** + * Merge object b with object a. + * + * var a = { foo: 'bar' } + * , b = { bar: 'baz' }; + * + * merge(a, b); + * // => { foo: 'bar', bar: 'baz' } + * + * @param {Object} a + * @param {Object} b + * @return {Object} + * @api public + */ + +exports = module.exports = function(a, b){ + if (a && b) { + for (var key in b) { + a[key] = b[key]; + } + } + return a; +}; diff --git a/8 node/node_modules/utils-merge/package.json b/8 node/node_modules/utils-merge/package.json new file mode 100644 index 000000000..715a1afa7 --- /dev/null +++ b/8 node/node_modules/utils-merge/package.json @@ -0,0 +1,64 @@ +{ + "_from": "utils-merge@1.0.0", + "_id": "utils-merge@1.0.0", + "_inBundle": false, + "_integrity": "sha1-ApT7kiu5N1FTVBxPcJYjHyh8ivg=", + "_location": "/utils-merge", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "utils-merge@1.0.0", + "name": "utils-merge", + "escapedName": "utils-merge", + "rawSpec": "1.0.0", + "saveSpec": null, + "fetchSpec": "1.0.0" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.0.tgz", + "_shasum": "0294fb922bb9375153541c4f7096231f287c8af8", + "_spec": "utils-merge@1.0.0", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Jared Hanson", + "email": "jaredhanson@gmail.com", + "url": "http://www.jaredhanson.net/" + }, + "bugs": { + "url": "http://github.com/jaredhanson/utils-merge/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "merge() utility function", + "devDependencies": { + "chai": "1.x.x", + "mocha": "1.x.x" + }, + "engines": { + "node": ">= 0.4.0" + }, + "homepage": "https://github.com/jaredhanson/utils-merge#readme", + "keywords": [ + "util" + ], + "licenses": [ + { + "type": "MIT", + "url": "http://www.opensource.org/licenses/MIT" + } + ], + "main": "./index", + "name": "utils-merge", + "repository": { + "type": "git", + "url": "git://github.com/jaredhanson/utils-merge.git" + }, + "scripts": { + "test": "mocha --reporter spec --require test/bootstrap/node test/*.test.js" + }, + "version": "1.0.0" +} diff --git a/8 node/node_modules/vary/HISTORY.md b/8 node/node_modules/vary/HISTORY.md new file mode 100644 index 000000000..23d13de2a --- /dev/null +++ b/8 node/node_modules/vary/HISTORY.md @@ -0,0 +1,34 @@ +1.1.1 / 2017-03-20 +================== + + * perf: hoist regular expression + +1.1.0 / 2015-09-29 +================== + + * Only accept valid field names in the `field` argument + - Ensures the resulting string is a valid HTTP header value + +1.0.1 / 2015-07-08 +================== + + * Fix setting empty header from empty `field` + * perf: enable strict mode + * perf: remove argument reassignments + +1.0.0 / 2014-08-10 +================== + + * Accept valid `Vary` header string as `field` + * Add `vary.append` for low-level string manipulation + * Move to `jshttp` orgainzation + +0.1.0 / 2014-06-05 +================== + + * Support array of fields to set + +0.0.0 / 2014-06-04 +================== + + * Initial release diff --git a/8 node/node_modules/vary/LICENSE b/8 node/node_modules/vary/LICENSE new file mode 100644 index 000000000..84441fbb5 --- /dev/null +++ b/8 node/node_modules/vary/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/8 node/node_modules/vary/README.md b/8 node/node_modules/vary/README.md new file mode 100644 index 000000000..cc000b346 --- /dev/null +++ b/8 node/node_modules/vary/README.md @@ -0,0 +1,101 @@ +# vary + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Manipulate the HTTP Vary header + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install vary +``` + +## API + + + +```js +var vary = require('vary') +``` + +### vary(res, field) + +Adds the given header `field` to the `Vary` response header of `res`. +This can be a string of a single field, a string of a valid `Vary` +header, or an array of multiple fields. + +This will append the header if not already listed, otherwise leaves +it listed in the current location. + + + +```js +// Append "Origin" to the Vary header of the response +vary(res, 'Origin') +``` + +### vary.append(header, field) + +Adds the given header `field` to the `Vary` response header string `header`. +This can be a string of a single field, a string of a valid `Vary` header, +or an array of multiple fields. + +This will append the header if not already listed, otherwise leaves +it listed in the current location. The new header string is returned. + + + +```js +// Get header string appending "Origin" to "Accept, User-Agent" +vary.append('Accept, User-Agent', 'Origin') +``` + +## Examples + +### Updating the Vary header when content is based on it + +```js +var http = require('http') +var vary = require('vary') + +http.createServer(function onRequest (req, res) { + // about to user-agent sniff + vary(res, 'User-Agent') + + var ua = req.headers['user-agent'] || '' + var isMobile = /mobi|android|touch|mini/i.test(ua) + + // serve site, depending on isMobile + res.setHeader('Content-Type', 'text/html') + res.end('You are (probably) ' + (isMobile ? '' : 'not ') + 'a mobile user') +}) +``` + +## Testing + +```sh +$ npm test +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/vary.svg +[npm-url]: https://npmjs.org/package/vary +[node-version-image]: https://img.shields.io/node/v/vary.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/jshttp/vary/master.svg +[travis-url]: https://travis-ci.org/jshttp/vary +[coveralls-image]: https://img.shields.io/coveralls/jshttp/vary/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/vary +[downloads-image]: https://img.shields.io/npm/dm/vary.svg +[downloads-url]: https://npmjs.org/package/vary diff --git a/8 node/node_modules/vary/index.js b/8 node/node_modules/vary/index.js new file mode 100644 index 000000000..ac37a8338 --- /dev/null +++ b/8 node/node_modules/vary/index.js @@ -0,0 +1,131 @@ +/*! + * vary + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = vary +module.exports.append = append + +/** + * Regular expression to split on commas, trimming spaces + * @private + */ + +var ARRAY_SPLIT_REGEXP = / *, */ + +/** + * RegExp to match field-name in RFC 7230 sec 3.2 + * + * field-name = token + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + */ + +var FIELD_NAME_REGEXP = /^[!#$%&'*+\-.^_`|~0-9A-Za-z]+$/ + +/** + * Append a field to a vary header. + * + * @param {String} header + * @param {String|Array} field + * @return {String} + * @public + */ + +function append (header, field) { + if (typeof header !== 'string') { + throw new TypeError('header argument is required') + } + + if (!field) { + throw new TypeError('field argument is required') + } + + // get fields array + var fields = !Array.isArray(field) + ? parse(String(field)) + : field + + // assert on invalid field names + for (var j = 0; j < fields.length; j++) { + if (!FIELD_NAME_REGEXP.test(fields[j])) { + throw new TypeError('field argument contains an invalid header name') + } + } + + // existing, unspecified vary + if (header === '*') { + return header + } + + // enumerate current values + var val = header + var vals = parse(header.toLowerCase()) + + // unspecified vary + if (fields.indexOf('*') !== -1 || vals.indexOf('*') !== -1) { + return '*' + } + + for (var i = 0; i < fields.length; i++) { + var fld = fields[i].toLowerCase() + + // append value (case-preserving) + if (vals.indexOf(fld) === -1) { + vals.push(fld) + val = val + ? val + ', ' + fields[i] + : fields[i] + } + } + + return val +} + +/** + * Parse a vary header into an array. + * + * @param {String} header + * @return {Array} + * @private + */ + +function parse (header) { + return header.trim().split(ARRAY_SPLIT_REGEXP) +} + +/** + * Mark that a request is varied on a header field. + * + * @param {Object} res + * @param {String|Array} field + * @public + */ + +function vary (res, field) { + if (!res || !res.getHeader || !res.setHeader) { + // quack quack + throw new TypeError('res argument is required') + } + + // get existing header + var val = res.getHeader('Vary') || '' + var header = Array.isArray(val) + ? val.join(', ') + : String(val) + + // set new header + if ((val = append(header, field))) { + res.setHeader('Vary', val) + } +} diff --git a/8 node/node_modules/vary/package.json b/8 node/node_modules/vary/package.json new file mode 100644 index 000000000..6bd371c84 --- /dev/null +++ b/8 node/node_modules/vary/package.json @@ -0,0 +1,73 @@ +{ + "_from": "vary@~1.1.1", + "_id": "vary@1.1.1", + "_inBundle": false, + "_integrity": "sha1-Z1Neu2lMHVIldFeYRmUyP1h+jTc=", + "_location": "/vary", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "vary@~1.1.1", + "name": "vary", + "escapedName": "vary", + "rawSpec": "~1.1.1", + "saveSpec": null, + "fetchSpec": "~1.1.1" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/vary/-/vary-1.1.1.tgz", + "_shasum": "67535ebb694c1d52257457984665323f587e8d37", + "_spec": "vary@~1.1.1", + "_where": "/Users/sunshine/Workspace/WebStudy01_JavaScript/8 node/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/vary/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Manipulate the HTTP Vary header", + "devDependencies": { + "eslint": "3.18.0", + "eslint-config-standard": "7.1.0", + "eslint-plugin-markdown": "1.0.0-beta.4", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "2.1.1", + "istanbul": "0.4.5", + "mocha": "2.5.3", + "supertest": "1.1.0" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/vary#readme", + "keywords": [ + "http", + "res", + "vary" + ], + "license": "MIT", + "name": "vary", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/vary.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.1" +} diff --git a/8 node/output.txt b/8 node/output.txt new file mode 100644 index 000000000..e54d4ee88 --- /dev/null +++ b/8 node/output.txt @@ -0,0 +1 @@ +sunshine studio --CS逍遥剑仙 \ No newline at end of file diff --git a/8 node/package-lock.json b/8 node/package-lock.json new file mode 100644 index 000000000..92eec1e37 --- /dev/null +++ b/8 node/package-lock.json @@ -0,0 +1,215 @@ +{ + "lockfileVersion": 1, + "dependencies": { + "accepts": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.3.tgz", + "integrity": "sha1-w8p0NJOGSMPg2cHjKN1otiLChMo=" + }, + "array-flatten": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=" + }, + "content-disposition": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.2.tgz", + "integrity": "sha1-DPaLud318r55YcOoUXjLhdunjLQ=" + }, + "content-type": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.2.tgz", + "integrity": "sha1-t9ETrueo3Se9IRM8TcJSnfFyHu0=" + }, + "cookie": { + "version": "0.3.1", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.3.1.tgz", + "integrity": "sha1-5+Ch+e9DtMi6klxcWpboBtFoc7s=" + }, + "cookie-signature": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=" + }, + "debug": { + "version": "2.6.7", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.7.tgz", + "integrity": "sha1-krrR9tBbu2u6Isyoi80OyJTChh4=" + }, + "depd": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.0.tgz", + "integrity": "sha1-4b2Cxqq2ztlluXuIsX7T5SjKGMM=" + }, + "destroy": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz", + "integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=" + }, + "ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=" + }, + "encodeurl": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.1.tgz", + "integrity": "sha1-eePVhlU0aQn+bw9Fpd5oEDspTSA=" + }, + "escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=" + }, + "etag": { + "version": "1.8.0", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.0.tgz", + "integrity": "sha1-b2Ma7zNtbEY2K1F2QETOIWvjwFE=" + }, + "express": { + "version": "4.15.3", + "resolved": "https://registry.npmjs.org/express/-/express-4.15.3.tgz", + "integrity": "sha1-urZdDwOqgMNYQIly/HAPkWlEtmI=" + }, + "finalhandler": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.0.3.tgz", + "integrity": "sha1-70fneVDpmXgOhgIqVg4yF+DQzIk=" + }, + "forwarded": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.0.tgz", + "integrity": "sha1-Ge+YdMSuHCl7zweP3mOgm2aoQ2M=" + }, + "fresh": { + "version": "0.5.0", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.0.tgz", + "integrity": "sha1-9HTKXmqSRtb9jglTz6m5yAWvp44=" + }, + "http-errors": { + "version": "1.6.1", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.6.1.tgz", + "integrity": "sha1-X4uO2YrKVFZWv1cplzh/kEpyIlc=" + }, + "inherits": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" + }, + "ipaddr.js": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.3.0.tgz", + "integrity": "sha1-HgOlL9rYOou7KyXL9JmLTP/NPew=" + }, + "media-typer": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=" + }, + "merge-descriptors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", + "integrity": "sha1-sAqqVW3YtEVoFQ7J0blT8/kMu2E=" + }, + "methods": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "integrity": "sha1-VSmk1nZUE07cxSZmVoNbD4Ua/O4=" + }, + "mime": { + "version": "1.3.4", + "resolved": "https://registry.npmjs.org/mime/-/mime-1.3.4.tgz", + "integrity": "sha1-EV+eO2s9rylZmDyzjxSaLUDrXVM=" + }, + "mime-db": { + "version": "1.27.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.27.0.tgz", + "integrity": "sha1-gg9XIpa70g7CXtVeW13oaeVDbrE=" + }, + "mime-types": { + "version": "2.1.15", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.15.tgz", + "integrity": "sha1-pOv1BkCUVpI3uM9wBGd20J/JKu0=" + }, + "ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "negotiator": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.1.tgz", + "integrity": "sha1-KzJxhOiZIQEXeyhWP7XnECrNDKk=" + }, + "on-finished": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz", + "integrity": "sha1-IPEzZIGwg811M3mSoWlxqi2QaUc=" + }, + "parseurl": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.1.tgz", + "integrity": "sha1-yKuMkiO6NIiKpkopeyiFO+wY2lY=" + }, + "path-to-regexp": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", + "integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=" + }, + "proxy-addr": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-1.1.4.tgz", + "integrity": "sha1-J+VF9pYKRKYn2bREZ+NcG2tM4vM=" + }, + "qs": { + "version": "6.4.0", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.4.0.tgz", + "integrity": "sha1-E+JtKK1rD/qpExLNO/cI7TUecjM=" + }, + "range-parser": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.0.tgz", + "integrity": "sha1-9JvmtIeJTdxA3MlKMi9hEJLgDV4=" + }, + "send": { + "version": "0.15.3", + "resolved": "https://registry.npmjs.org/send/-/send-0.15.3.tgz", + "integrity": "sha1-UBP5+ZAj31DRvZiSwZ4979HVMwk=" + }, + "serve-static": { + "version": "1.12.3", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.12.3.tgz", + "integrity": "sha1-n0uhni8wMMVH+K+ZEHg47DjVseI=" + }, + "setprototypeof": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.0.3.tgz", + "integrity": "sha1-ZlZ+NwQ+608E2RvWWMDL77VbjgQ=" + }, + "statuses": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.3.1.tgz", + "integrity": "sha1-+vUbnrdKrvOzrPStX2Gr8ky3uT4=" + }, + "type-is": { + "version": "1.6.15", + "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.15.tgz", + "integrity": "sha1-yrEPtJCeRByChC6v4a1kbIGARBA=" + }, + "unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=" + }, + "utils-merge": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.0.tgz", + "integrity": "sha1-ApT7kiu5N1FTVBxPcJYjHyh8ivg=" + }, + "vary": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.1.tgz", + "integrity": "sha1-Z1Neu2lMHVIldFeYRmUyP1h+jTc=" + } + } +}