diff --git a/.rspec b/.rspec index b5b2bad..53607ea 100644 --- a/.rspec +++ b/.rspec @@ -1 +1 @@ ---colour -fs +--colour diff --git a/Gemfile b/Gemfile index a9b431c..f52dc08 100644 --- a/Gemfile +++ b/Gemfile @@ -1,13 +1,17 @@ -source 'http://rubygems.org' +source 'https://rubygems.org' -gem 'rails', '3.0.10' +gem 'rails', '3.2.0.rc2' # Bundle edge Rails instead: # gem 'rails', :git => 'git://github.com/rails/rails.git' +gem 'enju_bookmark', :git => 'git://github.com/nabeta/enju_bookmark.git' +gem 'enju_oai', :git => 'git://github.com/nabeta/enju_oai.git' + platforms :ruby do gem 'pg' - #gem 'mysql2', '~> 0.2.11' + #gem 'mysql2', '~> 0.3' + #gem 'sqlite3' gem 'ruby-prof', :group => [:development, :test] gem 'zipruby' gem 'kgio' @@ -35,34 +39,32 @@ gem 'fastercsv' if RUBY_VERSION < '1.9' gem 'will_paginate', '~> 3.0' gem 'exception_notification', '~> 2.5.2' gem 'delayed_job', '>= 2.1.4' -gem 'state_machine' -gem 'sunspot_rails', '~> 1.3.0.rc4' -gem 'sunspot_solr', '~> 1.3.0.rc4' +gem 'state_machine', :git => 'git://github.com/pluginaweek/state_machine.git' +gem 'sunspot_rails', '~> 1.3' +gem 'sunspot_solr', '~> 1.3' gem 'progress_bar' -gem "friendly_id", "~> 3.3" +gem "friendly_id", "~> 4.0" gem 'inherited_resources', '~> 1.3' gem 'has_scope' gem 'nokogiri' gem 'marc' -gem 'strongbox', '>= 0.4.8' -gem 'acts-as-taggable-on', '~> 2.1' +#gem 'strongbox', '>= 0.5.0' gem 'dalli', '~> 1.1' -gem 'sitemap_generator', '~> 2.1' +gem 'sitemap_generator', '~> 2.2' gem 'ri_cal' gem 'file_wrapper' -gem 'paper_trail', '~> 2.3' +gem 'paper_trail', '~> 2.5' gem 'recurrence' -gem 'prism' -gem 'money' -gem 'RedCloth', '>= 4.2.8' +gem 'RedCloth', '>= 4.2.9' gem 'isbn-tools', :git => 'git://github.com/nabeta/isbn-tools.git', :require => 'isbn/tools' gem 'attribute_normalizer' gem 'configatron' gem 'extractcontent' -gem 'cancan', '>= 1.6.5' +gem 'cancan', '>= 1.6.7' gem 'scribd_fu' -gem 'devise', '~> 1.4' -gem 'omniauth', '>= 0.2.6' +gem 'devise', '~> 2.0.0.rc' +gem 'omniauth', '~> 1.0' +gem 'addressable' gem 'paperclip', '~> 2.4' gem 'whenever', '~> 0.6', :require => false gem 'amazon-ecs', '>= 2.2.0', :require => 'amazon/ecs' @@ -70,10 +72,7 @@ gem 'aws-s3', :require => 'aws/s3' gem 'astrails-safe' gem 'dynamic_form' gem 'sanitize' -gem 'barby', '~> 0.5' -gem 'rqrcode' -gem 'event-calendar', :require => 'event_calendar' -gem 'jpmobile', '~> 1.0' +gem 'jpmobile', '2.0.4' #gem 'geokit' gem 'geocoder' gem 'acts_as_list', :git => 'git://github.com/swanandp/acts_as_list.git' @@ -91,21 +90,33 @@ group :development do end group :development, :test do - gem 'rspec-rails' + gem 'rspec-rails', '~> 2.8.1' gem 'guard-rspec' - gem 'factory_girl_rails', '~> 1.2' + gem 'factory_girl_rails', '~> 1.4' gem 'spork', '~> 0.9.0.rc9' gem 'metric_fu', '~> 2.1' gem 'timecop' + gem 'sunspot-rails-tester' + gem 'vcr', '~> 2.0.0.rc1' + gem 'fakeweb' end # Gems used only for assets and not required # in production environments by default. -#group :assets do -# gem 'sass-rails', " ~> 3.1.0" -# gem 'coffee-rails', "~> 3.1.0" -# gem 'uglifier' -#end +group :assets do + gem 'sass-rails', '~> 3.2.3' + gem 'coffee-rails', '~> 3.2.0' + + gem 'uglifier', '>= 1.0.3' +end + +gem 'jquery-rails' + +# To use ActiveModel has_secure_password +# gem 'bcrypt-ruby', '~> 3.0.0' + +# To use Jbuilder templates for JSON +# gem 'jbuilder' # Use unicorn as the web server # gem 'unicorn' @@ -113,19 +124,5 @@ end # Deploy with Capistrano # gem 'capistrano' -# To use debugger (ruby-debug for Ruby 1.8.7+, ruby-debug19 for Ruby 1.9.2+) -# gem 'ruby-debug' -# gem 'ruby-debug19' - -# Bundle the extra gems: -# gem 'bj' -# gem 'nokogiri' -# gem 'sqlite3-ruby', :require => 'sqlite3' -# gem 'aws-s3', :require => 'aws/s3' - -# Bundle gems for the local environment. Make sure to -# put test-only gems in this group so their generators -# and rake tasks are available in development mode: -# group :development, :test do -# gem 'webrat' -# end +# To use debugger +# gem 'ruby-debug19', :require => 'ruby-debug' diff --git a/public/images/icons/arrow_divide.png b/app/assets/images/icons/arrow_divide.png similarity index 100% rename from public/images/icons/arrow_divide.png rename to app/assets/images/icons/arrow_divide.png diff --git a/public/images/arrow_down.png b/app/assets/images/icons/arrow_down.png similarity index 100% rename from public/images/arrow_down.png rename to app/assets/images/icons/arrow_down.png diff --git a/public/images/icons/arrow_left.png b/app/assets/images/icons/arrow_left.png similarity index 100% rename from public/images/icons/arrow_left.png rename to app/assets/images/icons/arrow_left.png diff --git a/public/images/arrow_up.png b/app/assets/images/icons/arrow_up.png similarity index 100% rename from public/images/arrow_up.png rename to app/assets/images/icons/arrow_up.png diff --git a/public/images/icons/basket_add.png b/app/assets/images/icons/basket_add.png similarity index 100% rename from public/images/icons/basket_add.png rename to app/assets/images/icons/basket_add.png diff --git a/public/images/icons/book.png b/app/assets/images/icons/book.png similarity index 100% rename from public/images/icons/book.png rename to app/assets/images/icons/book.png diff --git a/public/images/icons/book_edit.png b/app/assets/images/icons/book_edit.png similarity index 100% rename from public/images/icons/book_edit.png rename to app/assets/images/icons/book_edit.png diff --git a/public/images/icons/bullet_go.png b/app/assets/images/icons/bullet_go.png similarity index 100% rename from public/images/icons/bullet_go.png rename to app/assets/images/icons/bullet_go.png diff --git a/public/images/icons/cancel.png b/app/assets/images/icons/cancel.png similarity index 100% rename from public/images/icons/cancel.png rename to app/assets/images/icons/cancel.png diff --git a/public/images/icons/cd.png b/app/assets/images/icons/cd.png similarity index 100% rename from public/images/icons/cd.png rename to app/assets/images/icons/cd.png diff --git a/public/images/icons/comments.png b/app/assets/images/icons/comments.png similarity index 100% rename from public/images/icons/comments.png rename to app/assets/images/icons/comments.png diff --git a/public/images/cross.png b/app/assets/images/icons/cross.png similarity index 100% rename from public/images/cross.png rename to app/assets/images/icons/cross.png diff --git a/public/images/icons/delete.png b/app/assets/images/icons/delete.png similarity index 100% rename from public/images/icons/delete.png rename to app/assets/images/icons/delete.png diff --git a/public/images/icons/dvd.png b/app/assets/images/icons/dvd.png similarity index 100% rename from public/images/icons/dvd.png rename to app/assets/images/icons/dvd.png diff --git a/public/images/icons/email.png b/app/assets/images/icons/email.png similarity index 100% rename from public/images/icons/email.png rename to app/assets/images/icons/email.png diff --git a/app/assets/images/icons/feed.png b/app/assets/images/icons/feed.png new file mode 100644 index 0000000..315c4f4 Binary files /dev/null and b/app/assets/images/icons/feed.png differ diff --git a/public/images/icons/film.png b/app/assets/images/icons/film.png similarity index 100% rename from public/images/icons/film.png rename to app/assets/images/icons/film.png diff --git a/public/images/icons/group.png b/app/assets/images/icons/group.png similarity index 100% rename from public/images/icons/group.png rename to app/assets/images/icons/group.png diff --git a/public/images/icons/help.png b/app/assets/images/icons/help.png similarity index 100% rename from public/images/icons/help.png rename to app/assets/images/icons/help.png diff --git a/public/images/icons/lock.png b/app/assets/images/icons/lock.png similarity index 100% rename from public/images/icons/lock.png rename to app/assets/images/icons/lock.png diff --git a/public/images/icons/map.png b/app/assets/images/icons/map.png similarity index 100% rename from public/images/icons/map.png rename to app/assets/images/icons/map.png diff --git a/public/images/icons/monitor.png b/app/assets/images/icons/monitor.png similarity index 100% rename from public/images/icons/monitor.png rename to app/assets/images/icons/monitor.png diff --git a/public/images/icons/newspaper.png b/app/assets/images/icons/newspaper.png similarity index 100% rename from public/images/icons/newspaper.png rename to app/assets/images/icons/newspaper.png diff --git a/public/images/icons/page_edit.png b/app/assets/images/icons/page_edit.png similarity index 100% rename from public/images/icons/page_edit.png rename to app/assets/images/icons/page_edit.png diff --git a/public/images/icons/page_go.png b/app/assets/images/icons/page_go.png similarity index 100% rename from public/images/icons/page_go.png rename to app/assets/images/icons/page_go.png diff --git a/public/images/icons/page_white_acrobat.png b/app/assets/images/icons/page_white_acrobat.png similarity index 100% rename from public/images/icons/page_white_acrobat.png rename to app/assets/images/icons/page_white_acrobat.png diff --git a/public/images/icons/page_white_cd.png b/app/assets/images/icons/page_white_cd.png similarity index 100% rename from public/images/icons/page_white_cd.png rename to app/assets/images/icons/page_white_cd.png diff --git a/public/images/icons/page_white_delete.png b/app/assets/images/icons/page_white_delete.png similarity index 100% rename from public/images/icons/page_white_delete.png rename to app/assets/images/icons/page_white_delete.png diff --git a/public/images/icons/page_white_dvd.png b/app/assets/images/icons/page_white_dvd.png similarity index 100% rename from public/images/icons/page_white_dvd.png rename to app/assets/images/icons/page_white_dvd.png diff --git a/public/images/icons/page_white_edit.png b/app/assets/images/icons/page_white_edit.png similarity index 100% rename from public/images/icons/page_white_edit.png rename to app/assets/images/icons/page_white_edit.png diff --git a/public/images/icons/page_white_excel.png b/app/assets/images/icons/page_white_excel.png similarity index 100% rename from public/images/icons/page_white_excel.png rename to app/assets/images/icons/page_white_excel.png diff --git a/public/images/icons/page_white_flash.png b/app/assets/images/icons/page_white_flash.png similarity index 100% rename from public/images/icons/page_white_flash.png rename to app/assets/images/icons/page_white_flash.png diff --git a/public/images/icons/page_white_go.png b/app/assets/images/icons/page_white_go.png similarity index 100% rename from public/images/icons/page_white_go.png rename to app/assets/images/icons/page_white_go.png diff --git a/public/images/icons/page_white_picture.png b/app/assets/images/icons/page_white_picture.png similarity index 100% rename from public/images/icons/page_white_picture.png rename to app/assets/images/icons/page_white_picture.png diff --git a/public/images/icons/page_white_powerpoint.png b/app/assets/images/icons/page_white_powerpoint.png similarity index 100% rename from public/images/icons/page_white_powerpoint.png rename to app/assets/images/icons/page_white_powerpoint.png diff --git a/public/images/icons/page_white_text.png b/app/assets/images/icons/page_white_text.png similarity index 100% rename from public/images/icons/page_white_text.png rename to app/assets/images/icons/page_white_text.png diff --git a/public/images/icons/page_white_word.png b/app/assets/images/icons/page_white_word.png similarity index 100% rename from public/images/icons/page_white_word.png rename to app/assets/images/icons/page_white_word.png diff --git a/public/images/icons/page_white_zip.png b/app/assets/images/icons/page_white_zip.png similarity index 100% rename from public/images/icons/page_white_zip.png rename to app/assets/images/icons/page_white_zip.png diff --git a/public/images/icons/picture.png b/app/assets/images/icons/picture.png similarity index 100% rename from public/images/icons/picture.png rename to app/assets/images/icons/picture.png diff --git a/public/images/icons/picture_link.png b/app/assets/images/icons/picture_link.png similarity index 100% rename from public/images/icons/picture_link.png rename to app/assets/images/icons/picture_link.png diff --git a/public/images/icons/sound.png b/app/assets/images/icons/sound.png similarity index 100% rename from public/images/icons/sound.png rename to app/assets/images/icons/sound.png diff --git a/public/images/icons/star.png b/app/assets/images/icons/star.png similarity index 100% rename from public/images/icons/star.png rename to app/assets/images/icons/star.png diff --git a/public/images/icons/tag_blue_edit.png b/app/assets/images/icons/tag_blue_edit.png similarity index 100% rename from public/images/icons/tag_blue_edit.png rename to app/assets/images/icons/tag_blue_edit.png diff --git a/public/images/icons/user.png b/app/assets/images/icons/user.png similarity index 100% rename from public/images/icons/user.png rename to app/assets/images/icons/user.png diff --git a/public/images/icons/world.png b/app/assets/images/icons/world.png similarity index 100% rename from public/images/icons/world.png rename to app/assets/images/icons/world.png diff --git a/public/images/icons/world_go.png b/app/assets/images/icons/world_go.png similarity index 100% rename from public/images/icons/world_go.png rename to app/assets/images/icons/world_go.png diff --git a/public/images/rails.png b/app/assets/images/rails.png similarity index 100% rename from public/images/rails.png rename to app/assets/images/rails.png diff --git a/public/images/spinner.gif b/app/assets/images/spinner.gif similarity index 100% rename from public/images/spinner.gif rename to app/assets/images/spinner.gif diff --git a/public/images/unknown_resource.png b/app/assets/images/unknown_resource.png similarity index 100% rename from public/images/unknown_resource.png rename to app/assets/images/unknown_resource.png diff --git a/app/assets/javascripts/application.js b/app/assets/javascripts/application.js new file mode 100644 index 0000000..89e2899 --- /dev/null +++ b/app/assets/javascripts/application.js @@ -0,0 +1,15 @@ +//= require jquery +//= require jquery-ui +//= require jquery.colorbox +//= require jquery_ujs +//= require jquery.highlight-3 +//= require jquery.hotkeys +//= require jquery.cookie +//= require fg.menu +//= require fg.menu.enju +//= require pagination +//= require select_locale +//= require portlets +//= require tab_view +//= require event_calendar +//= require rails.validations diff --git a/app/assets/javascripts/create_types.js.coffee b/app/assets/javascripts/create_types.js.coffee new file mode 100644 index 0000000..7615679 --- /dev/null +++ b/app/assets/javascripts/create_types.js.coffee @@ -0,0 +1,3 @@ +# Place all the behaviors and hooks related to the matching controller here. +# All this logic will automatically be available in application.js. +# You can use CoffeeScript in this file: http://jashkenas.github.com/coffee-script/ diff --git a/app/assets/javascripts/event_calendar.js b/app/assets/javascripts/event_calendar.js new file mode 100644 index 0000000..e3b2885 --- /dev/null +++ b/app/assets/javascripts/event_calendar.js @@ -0,0 +1,37 @@ +/* + * Smart event highlighting + * Handles when events span rows, or don't have a background color + */ +jQuery(document).ready(function($) { + var highlight_color = "#2EAC6A"; + + // highlight events that have a background color + $(".ec-event-bg").live("mouseover", function() { + event_id = $(this).attr("data-event-id"); + event_class_name = $(this).attr("data-event-class"); + $(".ec-"+event_class_name+"-"+event_id).css("background-color", highlight_color); + }); + $(".ec-event-bg").live("mouseout", function() { + event_id = $(this).attr("data-event-id"); + event_class_name = $(this).attr("data-event-class"); + event_color = $(this).attr("data-color"); + $(".ec-"+event_class_name+"-"+event_id).css("background-color", event_color); + }); + + // highlight events that don't have a background color + $(".ec-event-no-bg").live("mouseover", function() { + ele = $(this); + ele.css("color", "white"); + ele.find("a").css("color", "white"); + ele.find(".ec-bullet").css("background-color", "white"); + ele.css("background-color", highlight_color); + }); + $(".ec-event-no-bg").live("mouseout", function() { + ele = $(this); + event_color = $(this).attr("data-color"); + ele.css("color", event_color); + ele.find("a").css("color", event_color); + ele.find(".ec-bullet").css("background-color", event_color); + ele.css("background-color", "transparent"); + }); +}); \ No newline at end of file diff --git a/public/javascripts/fg.menu.enju.js b/app/assets/javascripts/fg.menu.enju.js similarity index 100% rename from public/javascripts/fg.menu.enju.js rename to app/assets/javascripts/fg.menu.enju.js diff --git a/public/javascripts/fg.menu.js b/app/assets/javascripts/fg.menu.js similarity index 100% rename from public/javascripts/fg.menu.js rename to app/assets/javascripts/fg.menu.js diff --git a/public/javascripts/jquery-ui.js b/app/assets/javascripts/jquery-ui.js similarity index 98% rename from public/javascripts/jquery-ui.js rename to app/assets/javascripts/jquery-ui.js index bc11b03..fc8d9d1 100644 --- a/public/javascripts/jquery-ui.js +++ b/app/assets/javascripts/jquery-ui.js @@ -1,5 +1,5 @@ /*! - * jQuery UI 1.8.14 + * jQuery UI 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. @@ -18,7 +18,7 @@ if ( $.ui.version ) { } $.extend( $.ui, { - version: "1.8.14", + version: "1.8.16", keyCode: { ALT: 18, @@ -58,6 +58,8 @@ $.extend( $.ui, { // plugins $.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + _focus: $.fn.focus, focus: function( delay, fn ) { return typeof delay === "number" ? @@ -311,7 +313,7 @@ $.extend( $.ui, { })( jQuery ); /*! - * jQuery UI Widget 1.8.14 + * jQuery UI Widget 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. @@ -326,7 +328,10 @@ if ( $.cleanData ) { var _cleanData = $.cleanData; $.cleanData = function( elems ) { for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { - $( elem ).triggerHandler( "remove" ); + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} } _cleanData( elems ); }; @@ -337,7 +342,10 @@ if ( $.cleanData ) { if ( !keepData ) { if ( !selector || $.filter( selector, [ this ] ).length ) { $( "*", this ).add( [ this ] ).each(function() { - $( this ).triggerHandler( "remove" ); + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} }); } } @@ -573,7 +581,7 @@ $.Widget.prototype = { })( jQuery ); /*! - * jQuery UI Mouse 1.8.14 + * jQuery UI Mouse 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. @@ -587,7 +595,7 @@ $.Widget.prototype = { (function( $, undefined ) { var mouseHandled = false; -$(document).mousedown(function(e) { +$( document ).mouseup( function( e ) { mouseHandled = false; }); @@ -623,7 +631,7 @@ $.widget("ui.mouse", { _mouseDown: function(event) { // don't let more than one widget handle mouseStart - if(mouseHandled) {return}; + if( mouseHandled ) { return }; // we may have missed mouseup (out of window) (this._mouseStarted && this._mouseUp(event)); @@ -632,7 +640,9 @@ $.widget("ui.mouse", { var self = this, btnIsLeft = (event.which == 1), - elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).closest(this.options.cancel).length : false); + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { return true; } @@ -733,7 +743,259 @@ $.widget("ui.mouse", { })(jQuery); /* - * jQuery UI Draggable 1.8.14 + * jQuery UI Position 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions (see #5280) + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +}( jQuery )); +/* + * jQuery UI Draggable 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. @@ -814,15 +1076,17 @@ $.widget("ui.draggable", $.ui.mouse, { if (!this.handle) return false; - $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { - $('
') - .css({ - width: this.offsetWidth+"px", height: this.offsetHeight+"px", - position: "absolute", opacity: "0.001", zIndex: 1000 - }) - .css($(this).offset()) - .appendTo("body"); - }); + if ( o.iframeFix ) { + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + } return true; @@ -1237,7 +1501,7 @@ $.widget("ui.draggable", $.ui.mouse, { }); $.extend($.ui.draggable, { - version: "1.8.14" + version: "1.8.16" }); $.ui.plugin.add("draggable", "connectToSortable", { @@ -1556,7 +1820,7 @@ $.ui.plugin.add("draggable", "zIndex", { })(jQuery); /* - * jQuery UI Droppable 1.8.14 + * jQuery UI Droppable 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. @@ -1704,7 +1968,7 @@ $.widget("ui.droppable", { }); $.extend($.ui.droppable, { - version: "1.8.14" + version: "1.8.16" }); $.ui.intersect = function(draggable, droppable, toleranceMode) { @@ -1797,7 +2061,7 @@ $.ui.ddmanager = { }, dragStart: function( draggable, event ) { //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) - draggable.element.parentsUntil( "body" ).bind( "scroll.droppable", function() { + draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); }); }, @@ -1844,7 +2108,7 @@ $.ui.ddmanager = { }, dragStop: function( draggable, event ) { - draggable.element.parentsUntil( "body" ).unbind( "scroll.droppable" ); + draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); } @@ -1852,7 +2116,7 @@ $.ui.ddmanager = { })(jQuery); /* - * jQuery UI Resizable 1.8.14 + * jQuery UI Resizable 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. @@ -2402,7 +2666,7 @@ $.widget("ui.resizable", $.ui.mouse, { }); $.extend($.ui.resizable, { - version: "1.8.14" + version: "1.8.16" }); /* @@ -2694,7 +2958,7 @@ var isNumber = function(value) { })(jQuery); /* - * jQuery UI Selectable 1.8.14 + * jQuery UI Selectable 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. @@ -2955,12 +3219,12 @@ $.widget("ui.selectable", $.ui.mouse, { }); $.extend($.ui.selectable, { - version: "1.8.14" + version: "1.8.16" }); })(jQuery); /* - * jQuery UI Sortable 1.8.14 + * jQuery UI Sortable 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. @@ -4032,2214 +4296,639 @@ $.widget("ui.sortable", $.ui.mouse, { }); $.extend($.ui.sortable, { - version: "1.8.14" + version: "1.8.16" }); })(jQuery); /* - * jQuery UI Effects 1.8.14 + * jQuery UI Accordion 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * - * http://docs.jquery.com/UI/Effects/ + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js */ -;jQuery.effects || (function($, undefined) { +(function( $, undefined ) { -$.effects = {}; +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + _create: function() { + var self = this, + options = self.options; + self.running = 0; -/******************************************************************************/ -/****************************** COLOR ANIMATIONS ******************************/ -/******************************************************************************/ + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); -// override the animation for color styles -$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', - 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], -function(i, attr) { - $.fx.step[attr] = function(fx) { - if (!fx.colorInit) { - fx.start = getColor(fx.elem, attr); - fx.end = getRGB(fx.end); - fx.colorInit = true; + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } } - fx.elem.style[attr] = 'rgb(' + - Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + - Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + - Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; - }; -}); + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); -// Color Conversion functions from highlightFade -// By Blair Mitchelmore -// http://jquery.offput.ca/highlightFade/ + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); -// Parse strings looking for color tuples [255,255,255] -function getRGB(color) { - var result; + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); - // Check if we're already dealing with an array of colors - if ( color && color.constructor == Array && color.length == 3 ) - return color; + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); - // Look for rgb(num,num,num) - if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) - return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } - // Look for rgb(num%,num%,num%) - if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) - return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } - // Look for #a0b1c2 - if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) - return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, - // Look for #fff - if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) - return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, - // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 - if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) - return colors['transparent']; + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, - // Otherwise, we're most likely dealing with a named color - return colors[$.trim(color).toLowerCase()]; -} + destroy: function() { + var options = this.options; -function getColor(elem, attr) { - var color; + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); - do { - color = $.curCSS(elem, attr); + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); - // Keep going until we find an element that has color, or we hit the body - if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) - break; + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } - attr = "backgroundColor"; - } while ( elem = elem.parentNode ); + return $.Widget.prototype.destroy.call( this ); + }, - return getRGB(color); -}; + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, -// Some named colors to work with -// From Interface by Stefan Petre -// http://interface.eyecon.ro/ - -var colors = { - aqua:[0,255,255], - azure:[240,255,255], - beige:[245,245,220], - black:[0,0,0], - blue:[0,0,255], - brown:[165,42,42], - cyan:[0,255,255], - darkblue:[0,0,139], - darkcyan:[0,139,139], - darkgrey:[169,169,169], - darkgreen:[0,100,0], - darkkhaki:[189,183,107], - darkmagenta:[139,0,139], - darkolivegreen:[85,107,47], - darkorange:[255,140,0], - darkorchid:[153,50,204], - darkred:[139,0,0], - darksalmon:[233,150,122], - darkviolet:[148,0,211], - fuchsia:[255,0,255], - gold:[255,215,0], - green:[0,128,0], - indigo:[75,0,130], - khaki:[240,230,140], - lightblue:[173,216,230], - lightcyan:[224,255,255], - lightgreen:[144,238,144], - lightgrey:[211,211,211], - lightpink:[255,182,193], - lightyellow:[255,255,224], - lime:[0,255,0], - magenta:[255,0,255], - maroon:[128,0,0], - navy:[0,0,128], - olive:[128,128,0], - orange:[255,165,0], - pink:[255,192,203], - purple:[128,0,128], - violet:[128,0,128], - red:[255,0,0], - silver:[192,192,192], - white:[255,255,255], - yellow:[255,255,0], - transparent: [255,255,255] -}; + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } -/******************************************************************************/ -/****************************** CLASS ANIMATIONS ******************************/ -/******************************************************************************/ + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } -var classAnimationActions = ['add', 'remove', 'toggle'], - shorthandStyles = { - border: 1, - borderBottom: 1, - borderColor: 1, - borderLeft: 1, - borderRight: 1, - borderTop: 1, - borderWidth: 1, - margin: 1, - padding: 1 - }; + return true; + }, -function getElementStyles() { - var style = document.defaultView - ? document.defaultView.getComputedStyle(this, null) - : this.currentStyle, - newStyle = {}, - key, - camelCase; + resize: function() { + var options = this.options, + maxHeight; - // webkit enumerates style porperties - if (style && style.length && style[0] && style[style[0]]) { - var len = style.length; - while (len--) { - key = style[len]; - if (typeof style[key] == 'string') { - camelCase = key.replace(/\-(\w)/g, function(all, letter){ - return letter.toUpperCase(); - }); - newStyle[camelCase] = style[key]; + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); } - } - } else { - for (key in style) { - if (typeof style[key] === 'string') { - newStyle[key] = style[key]; + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); } - } - } - - return newStyle; -} - -function filterStyles(styles) { - var name, value; - for (name in styles) { - value = styles[name]; - if ( - // ignore null and undefined values - value == null || - // ignore functions (when does this occur?) - $.isFunction(value) || - // shorthand styles that need to be expanded - name in shorthandStyles || - // ignore scrollbars (break in IE) - (/scrollbar/).test(name) || - - // only colors or values that can be converted to numbers - (!(/color/i).test(name) && isNaN(parseFloat(value))) - ) { - delete styles[name]; - } - } - - return styles; -} -function styleDifference(oldStyle, newStyle) { - var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 - name; + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); - for (name in newStyle) { - if (oldStyle[name] != newStyle[name]) { - diff[name] = newStyle[name]; + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); } - } - - return diff; -} - -$.effects.animateClass = function(value, duration, easing, callback) { - if ($.isFunction(easing)) { - callback = easing; - easing = null; - } - - return this.queue(function() { - var that = $(this), - originalStyleAttr = that.attr('style') || ' ', - originalStyle = filterStyles(getElementStyles.call(this)), - newStyle, - className = that.attr('class'); - $.each(classAnimationActions, function(i, action) { - if (value[action]) { - that[action + 'Class'](value[action]); - } - }); - newStyle = filterStyles(getElementStyles.call(this)); - that.attr('class', className); + return this; + }, - that.animate(styleDifference(originalStyle, newStyle), { - queue: false, - duration: duration, - easing: easing, - complete: function() { - $.each(classAnimationActions, function(i, action) { - if (value[action]) { that[action + 'Class'](value[action]); } - }); - // work around bug in IE by clearing the cssText before setting it - if (typeof that.attr('style') == 'object') { - that.attr('style').cssText = ''; - that.attr('style').cssText = originalStyleAttr; - } else { - that.attr('style', originalStyleAttr); - } - if (callback) { callback.apply(this, arguments); } - $.dequeue( this ); - } - }); - }); -}; + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); -$.fn.extend({ - _addClass: $.fn.addClass, - addClass: function(classNames, speed, easing, callback) { - return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + return this; }, - _removeClass: $.fn.removeClass, - removeClass: function(classNames,speed,easing,callback) { - return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); }, - _toggleClass: $.fn.toggleClass, - toggleClass: function(classNames, force, speed, easing, callback) { - if ( typeof force == "boolean" || force === undefined ) { - if ( !speed ) { - // without speed parameter; - return this._toggleClass(classNames, force); - } else { - return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); - } - } else { - // without switch parameter; - return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; } - }, - switchClass: function(remove,add,speed,easing,callback) { - return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); - } -}); + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); -/******************************************************************************/ -/*********************************** EFFECTS **********************************/ -/******************************************************************************/ + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } -$.extend($.effects, { - version: "1.8.14", + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); - // Saves a set of properties in a data storage - save: function(element, set) { - for(var i=0; i < set.length; i++) { - if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); - } - }, + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); - // Restores a set of previously saved properties from a data storage - restore: function(element, set) { - for(var i=0; i < set.length; i++) { - if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); } - }, - setMode: function(el, mode) { - if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle - return mode; - }, - - getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value - // this should be a little more flexible in the future to handle a string & hash - var y, x; - switch (origin[0]) { - case 'top': y = 0; break; - case 'middle': y = 0.5; break; - case 'bottom': y = 1; break; - default: y = origin[0] / original.height; - }; - switch (origin[1]) { - case 'left': x = 0; break; - case 'center': x = 0.5; break; - case 'right': x = 1; break; - default: x = origin[1] / original.width; - }; - return {x: x, y: y}; + return; }, - // Wraps the element around a wrapper that copies position properties - createWrapper: function(element) { - - // if the element is already wrapped, return it - if (element.parent().is('.ui-effects-wrapper')) { - return element.parent(); - } + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; - // wrap the element - var props = { - width: element.outerWidth(true), - height: element.outerHeight(true), - 'float': element.css('float') - }, - wrapper = $('
') - .addClass('ui-effects-wrapper') - .css({ - fontSize: '100%', - background: 'transparent', - border: 'none', - margin: 0, - padding: 0 - }); + self.toShow = toShow; + self.toHide = toHide; + self.data = data; - element.wrap(wrapper); - wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; - // transfer positioning properties to the wrapper - if (element.css('position') == 'static') { - wrapper.css({ position: 'relative' }); - element.css({ position: 'relative' }); - } else { - $.extend(props, { - position: element.css('position'), - zIndex: element.css('z-index') - }); - $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { - props[pos] = element.css(pos); - if (isNaN(parseInt(props[pos], 10))) { - props[pos] = 'auto'; - } - }); - element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); - } + // trigger changestart event + self._trigger( "changestart", null, self.data ); - return wrapper.css(props).show(); - }, + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); - removeWrapper: function(element) { - if (element.parent().is('.ui-effects-wrapper')) - return element.parent().replaceWith(element); - return element; - }, + if ( options.animated ) { + var animOptions = {}; - setTransition: function(element, list, factor, value) { - value = value || {}; - $.each(list, function(i, x){ - unit = element.cssUnit(x); - if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; - }); - return value; - } -}); + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + if ( !options.proxied ) { + options.proxied = options.animated; + } -function _normalizeArguments(effect, options, speed, callback) { - // shift params for method overloading - if (typeof effect == 'object') { - callback = options; - speed = null; - options = effect; - effect = options.effect; - } - if ($.isFunction(options)) { - callback = options; - speed = null; - options = {}; - } - if (typeof options == 'number' || $.fx.speeds[options]) { - callback = speed; - speed = options; - options = {}; - } - if ($.isFunction(speed)) { - callback = speed; - speed = null; - } + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } - options = options || {}; + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; - speed = speed || options.duration; - speed = $.fx.off ? 0 : typeof speed == 'number' - ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; - callback = callback || options.complete; + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; - return [effect, options, speed, callback]; -} + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } -function standardSpeed( speed ) { - // valid standard speeds - if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { - return true; - } - - // invalid strings - treat as "normal" speed - if ( typeof speed === "string" && !$.effects[ speed ] ) { - return true; - } - - return false; -} - -$.fn.extend({ - effect: function(effect, options, speed, callback) { - var args = _normalizeArguments.apply(this, arguments), - // TODO: make effects take actual parameters instead of a hash - args2 = { - options: args[1], - duration: args[2], - callback: args[3] - }, - mode = args2.options.mode, - effectMethod = $.effects[effect]; - - if ( $.fx.off || !effectMethod ) { - // delegate to the original method (e.g., .show()) if possible - if ( mode ) { - return this[ mode ]( args2.duration, args2.callback ); + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); } else { - return this.each(function() { - if ( args2.callback ) { - args2.callback.call( this ); - } - }); + toHide.hide(); + toShow.show(); } + + complete( true ); } - - return effectMethod.call(this, args2); + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); }, - _show: $.fn.show, - show: function(speed) { - if ( standardSpeed( speed ) ) { - return this._show.apply(this, arguments); - } else { - var args = _normalizeArguments.apply(this, arguments); - args[1].mode = 'show'; - return this.effect.apply(this, args); + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; } - }, - _hide: $.fn.hide, - hide: function(speed) { - if ( standardSpeed( speed ) ) { - return this._hide.apply(this, arguments); - } else { - var args = _normalizeArguments.apply(this, arguments); - args[1].mode = 'hide'; - return this.effect.apply(this, args); + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); } - }, - // jQuery core overloads toggle and creates _toggle - __toggle: $.fn.toggle, - toggle: function(speed) { - if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { - return this.__toggle.apply(this, arguments); - } else { - var args = _normalizeArguments.apply(this, arguments); - args[1].mode = 'toggle'; - return this.effect.apply(this, args); + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; } - }, - // helper functions - cssUnit: function(key) { - var style = this.css(key), val = []; - $.each( ['em','px','%','pt'], function(i, unit){ - if(style.indexOf(unit) > 0) - val = [parseFloat(style), unit]; - }); - return val; + this._trigger( "change", null, this.data ); } }); +$.extend( $.ui.accordion, { + version: "1.8.16", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt( s.parent().width(), 10 ) + - parseInt( s.css( "paddingLeft" ), 10 ) + - parseInt( s.css( "paddingRight" ), 10 ) + - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 ) + - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } -/******************************************************************************/ -/*********************************** EASING ***********************************/ -/******************************************************************************/ + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); +})( jQuery ); /* - * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ - * - * Uses the built in easing capabilities added In jQuery 1.1 - * to offer multiple easing options - * - * TERMS OF USE - jQuery Easing + * jQuery UI Autocomplete 1.8.16 * - * Open source under the BSD License. - * - * Copyright 2008 George McGinley Smith - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without modification, - * are permitted provided that the following conditions are met: - * - * Redistributions of source code must retain the above copyright notice, this list of - * conditions and the following disclaimer. - * Redistributions in binary form must reproduce the above copyright notice, this list - * of conditions and the following disclaimer in the documentation and/or other materials - * provided with the distribution. - * - * Neither the name of the author nor the names of contributors may be used to endorse - * or promote products derived from this software without specific prior written permission. + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY - * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE - * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, - * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE - * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED - * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING - * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED - * OF THE POSSIBILITY OF SUCH DAMAGE. + * http://docs.jquery.com/UI/Autocomplete * -*/ + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { -// t: current time, b: begInnIng value, c: change In value, d: duration -$.easing.jswing = $.easing.swing; - -$.extend($.easing, -{ - def: 'easeOutQuad', - swing: function (x, t, b, c, d) { - //alert($.easing.default); - return $.easing[$.easing.def](x, t, b, c, d); - }, - easeInQuad: function (x, t, b, c, d) { - return c*(t/=d)*t + b; - }, - easeOutQuad: function (x, t, b, c, d) { - return -c *(t/=d)*(t-2) + b; - }, - easeInOutQuad: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t + b; - return -c/2 * ((--t)*(t-2) - 1) + b; - }, - easeInCubic: function (x, t, b, c, d) { - return c*(t/=d)*t*t + b; - }, - easeOutCubic: function (x, t, b, c, d) { - return c*((t=t/d-1)*t*t + 1) + b; - }, - easeInOutCubic: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t*t + b; - return c/2*((t-=2)*t*t + 2) + b; - }, - easeInQuart: function (x, t, b, c, d) { - return c*(t/=d)*t*t*t + b; - }, - easeOutQuart: function (x, t, b, c, d) { - return -c * ((t=t/d-1)*t*t*t - 1) + b; - }, - easeInOutQuart: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t*t*t + b; - return -c/2 * ((t-=2)*t*t*t - 2) + b; - }, - easeInQuint: function (x, t, b, c, d) { - return c*(t/=d)*t*t*t*t + b; - }, - easeOutQuint: function (x, t, b, c, d) { - return c*((t=t/d-1)*t*t*t*t + 1) + b; - }, - easeInOutQuint: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; - return c/2*((t-=2)*t*t*t*t + 2) + b; - }, - easeInSine: function (x, t, b, c, d) { - return -c * Math.cos(t/d * (Math.PI/2)) + c + b; - }, - easeOutSine: function (x, t, b, c, d) { - return c * Math.sin(t/d * (Math.PI/2)) + b; - }, - easeInOutSine: function (x, t, b, c, d) { - return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; - }, - easeInExpo: function (x, t, b, c, d) { - return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; - }, - easeOutExpo: function (x, t, b, c, d) { - return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; - }, - easeInOutExpo: function (x, t, b, c, d) { - if (t==0) return b; - if (t==d) return b+c; - if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; - return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; - }, - easeInCirc: function (x, t, b, c, d) { - return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; - }, - easeOutCirc: function (x, t, b, c, d) { - return c * Math.sqrt(1 - (t=t/d-1)*t) + b; - }, - easeInOutCirc: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; - return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; - }, - easeInElastic: function (x, t, b, c, d) { - var s=1.70158;var p=0;var a=c; - if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; - if (a < Math.abs(c)) { a=c; var s=p/4; } - else var s = p/(2*Math.PI) * Math.asin (c/a); - return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; - }, - easeOutElastic: function (x, t, b, c, d) { - var s=1.70158;var p=0;var a=c; - if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; - if (a < Math.abs(c)) { a=c; var s=p/4; } - else var s = p/(2*Math.PI) * Math.asin (c/a); - return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; - }, - easeInOutElastic: function (x, t, b, c, d) { - var s=1.70158;var p=0;var a=c; - if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); - if (a < Math.abs(c)) { a=c; var s=p/4; } - else var s = p/(2*Math.PI) * Math.asin (c/a); - if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; - return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; - }, - easeInBack: function (x, t, b, c, d, s) { - if (s == undefined) s = 1.70158; - return c*(t/=d)*t*((s+1)*t - s) + b; - }, - easeOutBack: function (x, t, b, c, d, s) { - if (s == undefined) s = 1.70158; - return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; - }, - easeInOutBack: function (x, t, b, c, d, s) { - if (s == undefined) s = 1.70158; - if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; - return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; - }, - easeInBounce: function (x, t, b, c, d) { - return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; - }, - easeOutBounce: function (x, t, b, c, d) { - if ((t/=d) < (1/2.75)) { - return c*(7.5625*t*t) + b; - } else if (t < (2/2.75)) { - return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; - } else if (t < (2.5/2.75)) { - return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; - } else { - return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; - } - }, - easeInOutBounce: function (x, t, b, c, d) { - if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; - return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; - } -}); - -/* - * - * TERMS OF USE - EASING EQUATIONS - * - * Open source under the BSD License. - * - * Copyright 2001 Robert Penner - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without modification, - * are permitted provided that the following conditions are met: - * - * Redistributions of source code must retain the above copyright notice, this list of - * conditions and the following disclaimer. - * Redistributions in binary form must reproduce the above copyright notice, this list - * of conditions and the following disclaimer in the documentation and/or other materials - * provided with the distribution. - * - * Neither the name of the author nor the names of contributors may be used to endorse - * or promote products derived from this software without specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY - * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE - * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, - * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE - * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED - * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING - * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED - * OF THE POSSIBILITY OF SUCH DAMAGE. - * - */ - -})(jQuery); -/* - * jQuery UI Effects Blind 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Blind - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.blind = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','bottom','left','right']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var direction = o.options.direction || 'vertical'; // Default direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var ref = (direction == 'vertical') ? 'height' : 'width'; - var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); - if(mode == 'show') wrapper.css(ref, 0); // Shift - - // Animation - var animation = {}; - animation[ref] = mode == 'show' ? distance : 0; - - // Animate - wrapper.animate(animation, o.duration, o.options.easing, function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(el[0], arguments); // Callback - el.dequeue(); - }); - - }); - -}; - -})(jQuery); -/* - * jQuery UI Effects Bounce 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Bounce - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.bounce = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','bottom','left','right']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var direction = o.options.direction || 'up'; // Default direction - var distance = o.options.distance || 20; // Default distance - var times = o.options.times || 5; // Default # of times - var speed = o.duration || 250; // Default speed per bounce - if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); - if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift - if (mode == 'hide') distance = distance / (times * 2); - if (mode != 'hide') times--; - - // Animate - if (mode == 'show') { // Show Bounce - var animation = {opacity: 1}; - animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; - el.animate(animation, speed / 2, o.options.easing); - distance = distance / 2; - times--; - }; - for (var i = 0; i < times; i++) { // Bounces - var animation1 = {}, animation2 = {}; - animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; - el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); - distance = (mode == 'hide') ? distance * 2 : distance / 2; - }; - if (mode == 'hide') { // Last Bounce - var animation = {opacity: 0}; - animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - el.animate(animation, speed / 2, o.options.easing, function(){ - el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - }); - } else { - var animation1 = {}, animation2 = {}; - animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; - el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - }); - }; - el.queue('fx', function() { el.dequeue(); }); - el.dequeue(); - }); - -}; - -})(jQuery); -/* - * jQuery UI Effects Clip 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Clip - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.clip = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','bottom','left','right','height','width']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var direction = o.options.direction || 'vertical'; // Default direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var animate = el[0].tagName == 'IMG' ? wrapper : el; - var ref = { - size: (direction == 'vertical') ? 'height' : 'width', - position: (direction == 'vertical') ? 'top' : 'left' - }; - var distance = (direction == 'vertical') ? animate.height() : animate.width(); - if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift - - // Animation - var animation = {}; - animation[ref.size] = mode == 'show' ? distance : 0; - animation[ref.position] = mode == 'show' ? 0 : distance / 2; - - // Animate - animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(el[0], arguments); // Callback - el.dequeue(); - }}); - - }); - -}; - -})(jQuery); -/* - * jQuery UI Effects Drop 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Drop - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.drop = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','bottom','left','right','opacity']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var direction = o.options.direction || 'left'; // Default Direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); - if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift - - // Animation - var animation = {opacity: mode == 'show' ? 1 : 0}; - animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; - - // Animate - el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - el.dequeue(); - }}); - - }); - -}; - -})(jQuery); -/* - * jQuery UI Effects Explode 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Explode - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.explode = function(o) { - - return this.queue(function() { - - var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; - var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; - - o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; - var el = $(this).show().css('visibility', 'hidden'); - var offset = el.offset(); - - //Substract the margins - not fixing the problem yet. - offset.top -= parseInt(el.css("marginTop"),10) || 0; - offset.left -= parseInt(el.css("marginLeft"),10) || 0; - - var width = el.outerWidth(true); - var height = el.outerHeight(true); - - for(var i=0;i') - .css({ - position: 'absolute', - visibility: 'visible', - left: -j*(width/cells), - top: -i*(height/rows) - }) - .parent() - .addClass('ui-effects-explode') - .css({ - position: 'absolute', - overflow: 'hidden', - width: width/cells, - height: height/rows, - left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), - top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), - opacity: o.options.mode == 'show' ? 0 : 1 - }).animate({ - left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), - top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), - opacity: o.options.mode == 'show' ? 1 : 0 - }, o.duration || 500); - } - } - - // Set a timeout, to call the callback approx. when the other animations have finished - setTimeout(function() { - - o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); - if(o.callback) o.callback.apply(el[0]); // Callback - el.dequeue(); - - $('div.ui-effects-explode').remove(); - - }, o.duration || 500); - - - }); - -}; - -})(jQuery); -/* - * jQuery UI Effects Fade 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Fade - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.fade = function(o) { - return this.queue(function() { - var elem = $(this), - mode = $.effects.setMode(elem, o.options.mode || 'hide'); - - elem.animate({ opacity: mode }, { - queue: false, - duration: o.duration, - easing: o.options.easing, - complete: function() { - (o.callback && o.callback.apply(this, arguments)); - elem.dequeue(); - } - }); - }); -}; - -})(jQuery); -/* - * jQuery UI Effects Fold 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Fold - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.fold = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','bottom','left','right']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var size = o.options.size || 15; // Default fold size - var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value - var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var widthFirst = ((mode == 'show') != horizFirst); - var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; - var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; - var percent = /([0-9]+)%/.exec(size); - if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; - if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift - - // Animation - var animation1 = {}, animation2 = {}; - animation1[ref[0]] = mode == 'show' ? distance[0] : size; - animation2[ref[1]] = mode == 'show' ? distance[1] : 0; - - // Animate - wrapper.animate(animation1, duration, o.options.easing) - .animate(animation2, duration, o.options.easing, function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(el[0], arguments); // Callback - el.dequeue(); - }); - - }); - -}; - -})(jQuery); -/* - * jQuery UI Effects Highlight 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Highlight - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.highlight = function(o) { - return this.queue(function() { - var elem = $(this), - props = ['backgroundImage', 'backgroundColor', 'opacity'], - mode = $.effects.setMode(elem, o.options.mode || 'show'), - animation = { - backgroundColor: elem.css('backgroundColor') - }; - - if (mode == 'hide') { - animation.opacity = 0; - } - - $.effects.save(elem, props); - elem - .show() - .css({ - backgroundImage: 'none', - backgroundColor: o.options.color || '#ffff99' - }) - .animate(animation, { - queue: false, - duration: o.duration, - easing: o.options.easing, - complete: function() { - (mode == 'hide' && elem.hide()); - $.effects.restore(elem, props); - (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); - (o.callback && o.callback.apply(this, arguments)); - elem.dequeue(); - } - }); - }); -}; - -})(jQuery); -/* - * jQuery UI Effects Pulsate 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Pulsate - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.pulsate = function(o) { - return this.queue(function() { - var elem = $(this), - mode = $.effects.setMode(elem, o.options.mode || 'show'); - times = ((o.options.times || 5) * 2) - 1; - duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, - isVisible = elem.is(':visible'), - animateTo = 0; - - if (!isVisible) { - elem.css('opacity', 0).show(); - animateTo = 1; - } - - if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { - times--; - } - - for (var i = 0; i < times; i++) { - elem.animate({ opacity: animateTo }, duration, o.options.easing); - animateTo = (animateTo + 1) % 2; - } - - elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { - if (animateTo == 0) { - elem.hide(); - } - (o.callback && o.callback.apply(this, arguments)); - }); - - elem - .queue('fx', function() { elem.dequeue(); }) - .dequeue(); - }); -}; - -})(jQuery); -/* - * jQuery UI Effects Scale 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Scale - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.puff = function(o) { - return this.queue(function() { - var elem = $(this), - mode = $.effects.setMode(elem, o.options.mode || 'hide'), - percent = parseInt(o.options.percent, 10) || 150, - factor = percent / 100, - original = { height: elem.height(), width: elem.width() }; - - $.extend(o.options, { - fade: true, - mode: mode, - percent: mode == 'hide' ? percent : 100, - from: mode == 'hide' - ? original - : { - height: original.height * factor, - width: original.width * factor - } - }); - - elem.effect('scale', o.options, o.duration, o.callback); - elem.dequeue(); - }); -}; - -$.effects.scale = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this); - - // Set options - var options = $.extend(true, {}, o.options); - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent - var direction = o.options.direction || 'both'; // Set default axis - var origin = o.options.origin; // The origin of the scaling - if (mode != 'effect') { // Set default origin and restore for show/hide - options.origin = origin || ['middle','center']; - options.restore = true; - } - var original = {height: el.height(), width: el.width()}; // Save original - el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state - - // Adjust - var factor = { // Set scaling factor - y: direction != 'horizontal' ? (percent / 100) : 1, - x: direction != 'vertical' ? (percent / 100) : 1 - }; - el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state - - if (o.options.fade) { // Fade option to support puff - if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; - if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; - }; - - // Animation - options.from = el.from; options.to = el.to; options.mode = mode; - - // Animate - el.effect('size', options, o.duration, o.callback); - el.dequeue(); - }); - -}; - -$.effects.size = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; - var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore - var props2 = ['width','height','overflow']; // Copy for children - var cProps = ['fontSize']; - var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; - var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var restore = o.options.restore || false; // Default restore - var scale = o.options.scale || 'both'; // Default scale mode - var origin = o.options.origin; // The origin of the sizing - var original = {height: el.height(), width: el.width()}; // Save original - el.from = o.options.from || original; // Default from state - el.to = o.options.to || original; // Default to state - // Adjust - if (origin) { // Calculate baseline shifts - var baseline = $.effects.getBaseline(origin, original); - el.from.top = (original.height - el.from.height) * baseline.y; - el.from.left = (original.width - el.from.width) * baseline.x; - el.to.top = (original.height - el.to.height) * baseline.y; - el.to.left = (original.width - el.to.width) * baseline.x; - }; - var factor = { // Set scaling factor - from: {y: el.from.height / original.height, x: el.from.width / original.width}, - to: {y: el.to.height / original.height, x: el.to.width / original.width} - }; - if (scale == 'box' || scale == 'both') { // Scale the css box - if (factor.from.y != factor.to.y) { // Vertical props scaling - props = props.concat(vProps); - el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); - el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); - }; - if (factor.from.x != factor.to.x) { // Horizontal props scaling - props = props.concat(hProps); - el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); - el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); - }; - }; - if (scale == 'content' || scale == 'both') { // Scale the content - if (factor.from.y != factor.to.y) { // Vertical props scaling - props = props.concat(cProps); - el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); - el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); - }; - }; - $.effects.save(el, restore ? props : props1); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - el.css('overflow','hidden').css(el.from); // Shift - - // Animate - if (scale == 'content' || scale == 'both') { // Scale the children - vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size - hProps = hProps.concat(['marginLeft','marginRight']); // Add margins - props2 = props.concat(vProps).concat(hProps); // Concat - el.find("*[width]").each(function(){ - child = $(this); - if (restore) $.effects.save(child, props2); - var c_original = {height: child.height(), width: child.width()}; // Save original - child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; - child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; - if (factor.from.y != factor.to.y) { // Vertical props scaling - child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); - child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); - }; - if (factor.from.x != factor.to.x) { // Horizontal props scaling - child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); - child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); - }; - child.css(child.from); // Shift children - child.animate(child.to, o.duration, o.options.easing, function(){ - if (restore) $.effects.restore(child, props2); // Restore children - }); // Animate children - }); - }; - - // Animate - el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if (el.to.opacity === 0) { - el.css('opacity', el.from.opacity); - } - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - el.dequeue(); - }}); - - }); - -}; - -})(jQuery); -/* - * jQuery UI Effects Shake 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Shake - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.shake = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','bottom','left','right']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var direction = o.options.direction || 'left'; // Default direction - var distance = o.options.distance || 20; // Default distance - var times = o.options.times || 3; // Default # of times - var speed = o.duration || o.options.duration || 140; // Default speed per shake - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - - // Animation - var animation = {}, animation1 = {}, animation2 = {}; - animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; - animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; - - // Animate - el.animate(animation, speed, o.options.easing); - for (var i = 1; i < times; i++) { // Shakes - el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); - }; - el.animate(animation1, speed, o.options.easing). - animate(animation, speed / 2, o.options.easing, function(){ // Last shake - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - }); - el.queue('fx', function() { el.dequeue(); }); - el.dequeue(); - }); - -}; - -})(jQuery); -/* - * jQuery UI Effects Slide 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Slide - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.slide = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','bottom','left','right']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode - var direction = o.options.direction || 'left'; // Default Direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); - if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift - - // Animation - var animation = {}; - animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; - - // Animate - el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - el.dequeue(); - }}); - - }); - -}; - -})(jQuery); -/* - * jQuery UI Effects Transfer 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Transfer - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { - -$.effects.transfer = function(o) { - return this.queue(function() { - var elem = $(this), - target = $(o.options.to), - endPosition = target.offset(), - animation = { - top: endPosition.top, - left: endPosition.left, - height: target.innerHeight(), - width: target.innerWidth() - }, - startPosition = elem.offset(), - transfer = $('
') - .appendTo(document.body) - .addClass(o.options.className) - .css({ - top: startPosition.top, - left: startPosition.left, - height: elem.innerHeight(), - width: elem.innerWidth(), - position: 'absolute' - }) - .animate(animation, o.duration, o.options.easing, function() { - transfer.remove(); - (o.callback && o.callback.apply(elem[0], arguments)); - elem.dequeue(); - }); - }); -}; - -})(jQuery); -/* - * jQuery UI Accordion 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Accordion - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function( $, undefined ) { - -$.widget( "ui.accordion", { - options: { - active: 0, - animated: "slide", - autoHeight: true, - clearStyle: false, - collapsible: false, - event: "click", - fillSpace: false, - header: "> li > :first-child,> :not(li):even", - icons: { - header: "ui-icon-triangle-1-e", - headerSelected: "ui-icon-triangle-1-s" - }, - navigation: false, - navigationFilter: function() { - return this.href.toLowerCase() === location.href.toLowerCase(); - } - }, - - _create: function() { - var self = this, - options = self.options; - - self.running = 0; - - self.element - .addClass( "ui-accordion ui-widget ui-helper-reset" ) - // in lack of child-selectors in CSS - // we need to mark top-LIs in a UL-accordion for some IE-fix - .children( "li" ) - .addClass( "ui-accordion-li-fix" ); - - self.headers = self.element.find( options.header ) - .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) - .bind( "mouseenter.accordion", function() { - if ( options.disabled ) { - return; - } - $( this ).addClass( "ui-state-hover" ); - }) - .bind( "mouseleave.accordion", function() { - if ( options.disabled ) { - return; - } - $( this ).removeClass( "ui-state-hover" ); - }) - .bind( "focus.accordion", function() { - if ( options.disabled ) { - return; - } - $( this ).addClass( "ui-state-focus" ); - }) - .bind( "blur.accordion", function() { - if ( options.disabled ) { - return; - } - $( this ).removeClass( "ui-state-focus" ); - }); - - self.headers.next() - .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); - - if ( options.navigation ) { - var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); - if ( current.length ) { - var header = current.closest( ".ui-accordion-header" ); - if ( header.length ) { - // anchor within header - self.active = header; - } else { - // anchor within content - self.active = current.closest( ".ui-accordion-content" ).prev(); - } - } - } - - self.active = self._findActive( self.active || options.active ) - .addClass( "ui-state-default ui-state-active" ) - .toggleClass( "ui-corner-all" ) - .toggleClass( "ui-corner-top" ); - self.active.next().addClass( "ui-accordion-content-active" ); - - self._createIcons(); - self.resize(); - - // ARIA - self.element.attr( "role", "tablist" ); - - self.headers - .attr( "role", "tab" ) - .bind( "keydown.accordion", function( event ) { - return self._keydown( event ); - }) - .next() - .attr( "role", "tabpanel" ); - - self.headers - .not( self.active || "" ) - .attr({ - "aria-expanded": "false", - "aria-selected": "false", - tabIndex: -1 - }) - .next() - .hide(); - - // make sure at least one header is in the tab order - if ( !self.active.length ) { - self.headers.eq( 0 ).attr( "tabIndex", 0 ); - } else { - self.active - .attr({ - "aria-expanded": "true", - "aria-selected": "true", - tabIndex: 0 - }); - } - - // only need links in tab order for Safari - if ( !$.browser.safari ) { - self.headers.find( "a" ).attr( "tabIndex", -1 ); - } - - if ( options.event ) { - self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { - self._clickHandler.call( self, event, this ); - event.preventDefault(); - }); - } - }, - - _createIcons: function() { - var options = this.options; - if ( options.icons ) { - $( "" ) - .addClass( "ui-icon " + options.icons.header ) - .prependTo( this.headers ); - this.active.children( ".ui-icon" ) - .toggleClass(options.icons.header) - .toggleClass(options.icons.headerSelected); - this.element.addClass( "ui-accordion-icons" ); - } - }, - - _destroyIcons: function() { - this.headers.children( ".ui-icon" ).remove(); - this.element.removeClass( "ui-accordion-icons" ); - }, - - destroy: function() { - var options = this.options; - - this.element - .removeClass( "ui-accordion ui-widget ui-helper-reset" ) - .removeAttr( "role" ); - - this.headers - .unbind( ".accordion" ) - .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) - .removeAttr( "role" ) - .removeAttr( "aria-expanded" ) - .removeAttr( "aria-selected" ) - .removeAttr( "tabIndex" ); - - this.headers.find( "a" ).removeAttr( "tabIndex" ); - this._destroyIcons(); - var contents = this.headers.next() - .css( "display", "" ) - .removeAttr( "role" ) - .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); - if ( options.autoHeight || options.fillHeight ) { - contents.css( "height", "" ); - } - - return $.Widget.prototype.destroy.call( this ); - }, - - _setOption: function( key, value ) { - $.Widget.prototype._setOption.apply( this, arguments ); - - if ( key == "active" ) { - this.activate( value ); - } - if ( key == "icons" ) { - this._destroyIcons(); - if ( value ) { - this._createIcons(); - } - } - // #5332 - opacity doesn't cascade to positioned elements in IE - // so we need to add the disabled class to the headers and panels - if ( key == "disabled" ) { - this.headers.add(this.headers.next()) - [ value ? "addClass" : "removeClass" ]( - "ui-accordion-disabled ui-state-disabled" ); - } - }, - - _keydown: function( event ) { - if ( this.options.disabled || event.altKey || event.ctrlKey ) { - return; - } - - var keyCode = $.ui.keyCode, - length = this.headers.length, - currentIndex = this.headers.index( event.target ), - toFocus = false; - - switch ( event.keyCode ) { - case keyCode.RIGHT: - case keyCode.DOWN: - toFocus = this.headers[ ( currentIndex + 1 ) % length ]; - break; - case keyCode.LEFT: - case keyCode.UP: - toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; - break; - case keyCode.SPACE: - case keyCode.ENTER: - this._clickHandler( { target: event.target }, event.target ); - event.preventDefault(); - } - - if ( toFocus ) { - $( event.target ).attr( "tabIndex", -1 ); - $( toFocus ).attr( "tabIndex", 0 ); - toFocus.focus(); - return false; - } - - return true; - }, - - resize: function() { - var options = this.options, - maxHeight; - - if ( options.fillSpace ) { - if ( $.browser.msie ) { - var defOverflow = this.element.parent().css( "overflow" ); - this.element.parent().css( "overflow", "hidden"); - } - maxHeight = this.element.parent().height(); - if ($.browser.msie) { - this.element.parent().css( "overflow", defOverflow ); - } - - this.headers.each(function() { - maxHeight -= $( this ).outerHeight( true ); - }); - - this.headers.next() - .each(function() { - $( this ).height( Math.max( 0, maxHeight - - $( this ).innerHeight() + $( this ).height() ) ); - }) - .css( "overflow", "auto" ); - } else if ( options.autoHeight ) { - maxHeight = 0; - this.headers.next() - .each(function() { - maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); - }) - .height( maxHeight ); - } - - return this; - }, - - activate: function( index ) { - // TODO this gets called on init, changing the option without an explicit call for that - this.options.active = index; - // call clickHandler with custom event - var active = this._findActive( index )[ 0 ]; - this._clickHandler( { target: active }, active ); - - return this; - }, - - _findActive: function( selector ) { - return selector - ? typeof selector === "number" - ? this.headers.filter( ":eq(" + selector + ")" ) - : this.headers.not( this.headers.not( selector ) ) - : selector === false - ? $( [] ) - : this.headers.filter( ":eq(0)" ); - }, - - // TODO isn't event.target enough? why the separate target argument? - _clickHandler: function( event, target ) { - var options = this.options; - if ( options.disabled ) { - return; - } - - // called only when using activate(false) to close all parts programmatically - if ( !event.target ) { - if ( !options.collapsible ) { - return; - } - this.active - .removeClass( "ui-state-active ui-corner-top" ) - .addClass( "ui-state-default ui-corner-all" ) - .children( ".ui-icon" ) - .removeClass( options.icons.headerSelected ) - .addClass( options.icons.header ); - this.active.next().addClass( "ui-accordion-content-active" ); - var toHide = this.active.next(), - data = { - options: options, - newHeader: $( [] ), - oldHeader: options.active, - newContent: $( [] ), - oldContent: toHide - }, - toShow = ( this.active = $( [] ) ); - this._toggle( toShow, toHide, data ); - return; - } - - // get the click target - var clicked = $( event.currentTarget || target ), - clickedIsActive = clicked[0] === this.active[0]; - - // TODO the option is changed, is that correct? - // TODO if it is correct, shouldn't that happen after determining that the click is valid? - options.active = options.collapsible && clickedIsActive ? - false : - this.headers.index( clicked ); - - // if animations are still active, or the active header is the target, ignore click - if ( this.running || ( !options.collapsible && clickedIsActive ) ) { - return; - } - - // find elements to show and hide - var active = this.active, - toShow = clicked.next(), - toHide = this.active.next(), - data = { - options: options, - newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, - oldHeader: this.active, - newContent: clickedIsActive && options.collapsible ? $([]) : toShow, - oldContent: toHide - }, - down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); - - // when the call to ._toggle() comes after the class changes - // it causes a very odd bug in IE 8 (see #6720) - this.active = clickedIsActive ? $([]) : clicked; - this._toggle( toShow, toHide, data, clickedIsActive, down ); - - // switch classes - active - .removeClass( "ui-state-active ui-corner-top" ) - .addClass( "ui-state-default ui-corner-all" ) - .children( ".ui-icon" ) - .removeClass( options.icons.headerSelected ) - .addClass( options.icons.header ); - if ( !clickedIsActive ) { - clicked - .removeClass( "ui-state-default ui-corner-all" ) - .addClass( "ui-state-active ui-corner-top" ) - .children( ".ui-icon" ) - .removeClass( options.icons.header ) - .addClass( options.icons.headerSelected ); - clicked - .next() - .addClass( "ui-accordion-content-active" ); - } - - return; - }, - - _toggle: function( toShow, toHide, data, clickedIsActive, down ) { - var self = this, - options = self.options; - - self.toShow = toShow; - self.toHide = toHide; - self.data = data; - - var complete = function() { - if ( !self ) { - return; - } - return self._completed.apply( self, arguments ); - }; - - // trigger changestart event - self._trigger( "changestart", null, self.data ); - - // count elements to animate - self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); - - if ( options.animated ) { - var animOptions = {}; - - if ( options.collapsible && clickedIsActive ) { - animOptions = { - toShow: $( [] ), - toHide: toHide, - complete: complete, - down: down, - autoHeight: options.autoHeight || options.fillSpace - }; - } else { - animOptions = { - toShow: toShow, - toHide: toHide, - complete: complete, - down: down, - autoHeight: options.autoHeight || options.fillSpace - }; - } - - if ( !options.proxied ) { - options.proxied = options.animated; - } - - if ( !options.proxiedDuration ) { - options.proxiedDuration = options.duration; - } - - options.animated = $.isFunction( options.proxied ) ? - options.proxied( animOptions ) : - options.proxied; - - options.duration = $.isFunction( options.proxiedDuration ) ? - options.proxiedDuration( animOptions ) : - options.proxiedDuration; - - var animations = $.ui.accordion.animations, - duration = options.duration, - easing = options.animated; - - if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { - easing = "slide"; - } - if ( !animations[ easing ] ) { - animations[ easing ] = function( options ) { - this.slide( options, { - easing: easing, - duration: duration || 700 - }); - }; - } - - animations[ easing ]( animOptions ); - } else { - if ( options.collapsible && clickedIsActive ) { - toShow.toggle(); - } else { - toHide.hide(); - toShow.show(); - } - - complete( true ); - } - - // TODO assert that the blur and focus triggers are really necessary, remove otherwise - toHide.prev() - .attr({ - "aria-expanded": "false", - "aria-selected": "false", - tabIndex: -1 - }) - .blur(); - toShow.prev() - .attr({ - "aria-expanded": "true", - "aria-selected": "true", - tabIndex: 0 - }) - .focus(); - }, - - _completed: function( cancel ) { - this.running = cancel ? 0 : --this.running; - if ( this.running ) { - return; - } - - if ( this.options.clearStyle ) { - this.toShow.add( this.toHide ).css({ - height: "", - overflow: "" - }); - } - - // other classes are removed before the animation; this one needs to stay until completed - this.toHide.removeClass( "ui-accordion-content-active" ); - // Work around for rendering bug in IE (#5421) - if ( this.toHide.length ) { - this.toHide.parent()[0].className = this.toHide.parent()[0].className; - } - - this._trigger( "change", null, this.data ); - } -}); - -$.extend( $.ui.accordion, { - version: "1.8.14", - animations: { - slide: function( options, additions ) { - options = $.extend({ - easing: "swing", - duration: 300 - }, options, additions ); - if ( !options.toHide.size() ) { - options.toShow.animate({ - height: "show", - paddingTop: "show", - paddingBottom: "show" - }, options ); - return; - } - if ( !options.toShow.size() ) { - options.toHide.animate({ - height: "hide", - paddingTop: "hide", - paddingBottom: "hide" - }, options ); - return; - } - var overflow = options.toShow.css( "overflow" ), - percentDone = 0, - showProps = {}, - hideProps = {}, - fxAttrs = [ "height", "paddingTop", "paddingBottom" ], - originalWidth; - // fix width before calculating height of hidden element - var s = options.toShow; - originalWidth = s[0].style.width; - s.width( parseInt( s.parent().width(), 10 ) - - parseInt( s.css( "paddingLeft" ), 10 ) - - parseInt( s.css( "paddingRight" ), 10 ) - - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 ) - - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) ); - - $.each( fxAttrs, function( i, prop ) { - hideProps[ prop ] = "hide"; - - var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); - showProps[ prop ] = { - value: parts[ 1 ], - unit: parts[ 2 ] || "px" - }; - }); - options.toShow.css({ height: 0, overflow: "hidden" }).show(); - options.toHide - .filter( ":hidden" ) - .each( options.complete ) - .end() - .filter( ":visible" ) - .animate( hideProps, { - step: function( now, settings ) { - // only calculate the percent when animating height - // IE gets very inconsistent results when animating elements - // with small values, which is common for padding - if ( settings.prop == "height" ) { - percentDone = ( settings.end - settings.start === 0 ) ? 0 : - ( settings.now - settings.start ) / ( settings.end - settings.start ); - } - - options.toShow[ 0 ].style[ settings.prop ] = - ( percentDone * showProps[ settings.prop ].value ) - + showProps[ settings.prop ].unit; - }, - duration: options.duration, - easing: options.easing, - complete: function() { - if ( !options.autoHeight ) { - options.toShow.css( "height", "" ); - } - options.toShow.css({ - width: originalWidth, - overflow: overflow - }); - options.complete(); - } - }); - }, - bounceslide: function( options ) { - this.slide( options, { - easing: options.down ? "easeOutBounce" : "swing", - duration: options.down ? 1000 : 200 - }); - } - } -}); - -})( jQuery ); -/* - * jQuery UI Autocomplete 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Autocomplete - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.position.js - */ -(function( $, undefined ) { - -// used to prevent race conditions with remote data sources -var requestIndex = 0; +// used to prevent race conditions with remote data sources +var requestIndex = 0; $.widget( "ui.autocomplete", { options: { @@ -6272,7 +4961,7 @@ $.widget( "ui.autocomplete", { "aria-haspopup": "true" }) .bind( "keydown.autocomplete", function( event ) { - if ( self.options.disabled || self.element.attr( "readonly" ) ) { + if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { return; } @@ -6629,3573 +5318,4754 @@ $.widget( "ui.autocomplete", { this.menu.deactivate(); return; } - this.menu[ direction ]( event ); + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.scrollTop(), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.scrollTop( scroll + offset); + } else if (offset >= elementHeight) { + this.element.scrollTop( scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } }, - widget: function() { - return this.menu.element; - } -}); + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } -$.extend( $.ui.autocomplete, { - escapeRegex: function( value ) { - return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + var base = this.active.offset().top, + height = this.element.height(); + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } }, - filter: function(array, term) { - var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); - return $.grep( array, function(value) { - return matcher.test( value.label || value.value || value ); - }); + + hasScroll: function() { + return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); } }); -}( jQuery )); - +}(jQuery)); /* - * jQuery UI Menu (not officially released) - * - * This widget isn't yet finished and the API is subject to change. We plan to finish - * it for the next release. You're welcome to give it a try anyway and give us feedback, - * as long as you're okay with migrating your code later on. We can help with that, too. + * jQuery UI Button 1.8.16 * - * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * - * http://docs.jquery.com/UI/Menu + * http://docs.jquery.com/UI/Button * * Depends: * jquery.ui.core.js - * jquery.ui.widget.js + * jquery.ui.widget.js */ -(function($) { +(function( $, undefined ) { -$.widget("ui.menu", { +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, _create: function() { - var self = this; - this.element - .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") - .attr({ - role: "listbox", - "aria-activedescendant": "ui-active-menuitem" + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = this.element.propAttr( "disabled" ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + if ( this.element.is( ":disabled" ) ) { + options.disabled = true; + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } }) - .click(function( event ) { - if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + .bind( "mouseleave.button", function() { + if ( options.disabled ) { return; } - // temporary - event.preventDefault(); - self.select( event ); + $( this ).removeClass( hoverClass ); + }) + .bind( "click.button", function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } }); - this.refresh(); - }, - - refresh: function() { - var self = this; - // don't refresh list items that are already adapted - var items = this.element.children("li:not(.ui-menu-item):has(a)") - .addClass("ui-menu-item") - .attr("role", "menuitem"); - - items.children("a") - .addClass("ui-corner-all") - .attr("tabindex", -1) - // mouseenter doesn't work with event delegation - .mouseenter(function( event ) { - self.activate( event, $(this).parent() ); + this.element + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + self.buttonElement.addClass( focusClass ); }) - .mouseleave(function() { - self.deactivate(); + .bind( "blur.button", function() { + self.buttonElement.removeClass( focusClass ); }); - }, - activate: function( event, item ) { - this.deactivate(); - if (this.hasScroll()) { - var offset = item.offset().top - this.element.offset().top, - scroll = this.element.scrollTop(), - elementHeight = this.element.height(); - if (offset < 0) { - this.element.scrollTop( scroll + offset); - } else if (offset >= elementHeight) { - this.element.scrollTop( scroll + offset - elementHeight + item.height()); + if ( toggleButton ) { + this.element.bind( "change.button", function() { + if ( clickDragged ) { + return; + } + self.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown.button", function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup.button", function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", "true" ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); } } - this.active = item.eq(0) - .children("a") - .addClass("ui-state-hover") - .attr("id", "ui-active-menuitem") - .end(); - this._trigger("focus", event, { item: item }); + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); }, - deactivate: function() { - if (!this.active) { return; } + _determineButtonType: function() { - this.active.children("a") - .removeClass("ui-state-hover") - .removeAttr("id"); - this._trigger("blur"); - this.active = null; - }, + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } - next: function(event) { - this.move("next", ".ui-menu-item:first", event); - }, + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for='" + this.element.attr("id") + "']"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); - previous: function(event) { - this.move("prev", ".ui-menu-item:last", event); + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } }, - first: function() { - return this.active && !this.active.prevAll(".ui-menu-item").length; + widget: function() { + return this.buttonElement; }, - last: function() { - return this.active && !this.active.nextAll(".ui-menu-item").length; + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); }, - move: function(direction, edge, event) { - if (!this.active) { - this.activate(event, this.element.children(edge)); + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.propAttr( "disabled", true ); + } else { + this.element.propAttr( "disabled", false ); + } return; } - var next = this.active[direction + "All"](".ui-menu-item").eq(0); - if (next.length) { - this.activate(event, next); - } else { - this.activate(event, this.element.children(edge)); - } + this._resetButton(); }, - // TODO merge with previousPage - nextPage: function(event) { - if (this.hasScroll()) { - // TODO merge with no-scroll-else - if (!this.active || this.last()) { - this.activate(event, this.element.children(".ui-menu-item:first")); - return; + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); } - var base = this.active.offset().top, - height = this.element.height(), - result = this.element.children(".ui-menu-item").filter(function() { - var close = $(this).offset().top - base - height + $(this).height(); - // TODO improve approximation - return close < 10 && close > -10; - }); + } + }, - // TODO try to catch this earlier when scrollTop indicates the last page anyway - if (!result.length) { - result = this.element.children(".ui-menu-item:last"); + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); } - this.activate(event, result); - } else { - this.activate(event, this.element.children(".ui-menu-item") - .filter(!this.active || this.last() ? ":first" : ":last")); + return; } - }, + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "" ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; - // TODO merge with nextPage - previousPage: function(event) { - if (this.hasScroll()) { - // TODO merge with no-scroll-else - if (!this.active || this.first()) { - this.activate(event, this.element.children(".ui-menu-item:last")); - return; + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); } - var base = this.active.offset().top, - height = this.element.height(); - result = this.element.children(".ui-menu-item").filter(function() { - var close = $(this).offset().top - base + height - $(this).height(); - // TODO improve approximation - return close < 10 && close > -10; - }); + if ( icons.primary ) { + buttonElement.prepend( "" ); + } - // TODO try to catch this earlier when scrollTop indicates the last page anyway - if (!result.length) { - result = this.element.children(".ui-menu-item:first"); + if ( icons.secondary ) { + buttonElement.append( "" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } } - this.activate(event, result); } else { - this.activate(event, this.element.children(".ui-menu-item") - .filter(!this.active || this.first() ? ":last" : ":first")); + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + var ltr = this.element.css( "direction" ) === "ltr"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( ltr ? "ui-corner-left" : "ui-corner-right" ) + .end() + .filter( ":last" ) + .addClass( ltr ? "ui-corner-right" : "ui-corner-left" ) + .end() + .end(); }, - hasScroll: function() { - return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); - }, + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); - select: function( event ) { - this._trigger("selected", event, { item: this.active }); + $.Widget.prototype.destroy.call( this ); } }); -}(jQuery)); +}( jQuery ) ); /* - * jQuery UI Button 1.8.14 + * jQuery UI Dialog 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * - * http://docs.jquery.com/UI/Button + * http://docs.jquery.com/UI/Dialog * * Depends: * jquery.ui.core.js * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js */ (function( $, undefined ) { -var lastActive, startXPos, startYPos, clickDragged, - baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", - stateClasses = "ui-state-hover ui-state-active ", - typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", - formResetHandler = function() { - var buttons = $( this ).find( ":ui-button" ); - setTimeout(function() { - buttons.button( "refresh" ); - }, 1 ); +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true }, - radioGroup = function( radio ) { - var name = radio.name, - form = radio.form, - radios = $( [] ); - if ( name ) { - if ( form ) { - radios = $( form ).find( "[name='" + name + "']" ); - } else { - radios = $( "[name='" + name + "']", radio.ownerDocument ) - .filter(function() { - return !this.form; - }); - } - } - return radios; + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true }; -$.widget( "ui.button", { +$.widget("ui.dialog", { options: { - disabled: null, - text: true, - label: null, - icons: { - primary: null, - secondary: null - } + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 }, + _create: function() { - this.element.closest( "form" ) - .unbind( "reset.button" ) - .bind( "reset.button", formResetHandler ); + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('
')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('
')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); - if ( typeof this.options.disabled !== "boolean" ) { - this.options.disabled = this.element.attr( "disabled" ); + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); } - this._determineButtonType(); - this.hasTitle = !!this.buttonElement.attr( "title" ); + return self; + }, - var self = this, - options = this.options, - toggleButton = this.type === "checkbox" || this.type === "radio", - hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), - focusClass = "ui-state-focus"; + widget: function() { + return this.uiDialog; + }, - if ( options.label === null ) { - options.label = this.buttonElement.html(); + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; } - if ( this.element.is( ":disabled" ) ) { - options.disabled = true; + if (self.overlay) { + self.overlay.destroy(); } + self.uiDialog.unbind('keypress.ui-dialog'); - this.buttonElement - .addClass( baseClasses ) - .attr( "role", "button" ) - .bind( "mouseenter.button", function() { - if ( options.disabled ) { - return; - } - $( this ).addClass( "ui-state-hover" ); - if ( this === lastActive ) { - $( this ).addClass( "ui-state-active" ); - } - }) - .bind( "mouseleave.button", function() { - if ( options.disabled ) { - return; - } - $( this ).removeClass( hoverClass ); - }) - .bind( "click.button", function( event ) { - if ( options.disabled ) { - event.preventDefault(); - event.stopImmediatePropagation(); - } - }); + self._isOpen = false; - this.element - .bind( "focus.button", function() { - // no need to check disabled, focus won't be triggered anyway - self.buttonElement.addClass( focusClass ); - }) - .bind( "blur.button", function() { - self.buttonElement.removeClass( focusClass ); + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } - if ( toggleButton ) { - this.element.bind( "change.button", function() { - if ( clickDragged ) { - return; - } - self.refresh(); - }); - // if mouse moves between mousedown and mouseup (drag) set clickDragged flag - // prevents issue where button state changes but checkbox/radio checked state - // does not in Firefox (see ticket #6970) - this.buttonElement - .bind( "mousedown.button", function( event ) { - if ( options.disabled ) { - return; - } - clickDragged = false; - startXPos = event.pageX; - startYPos = event.pageY; - }) - .bind( "mouseup.button", function( event ) { - if ( options.disabled ) { - return; - } - if ( startXPos !== event.pageX || startYPos !== event.pageY ) { - clickDragged = true; + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); } + } }); + $.ui.dialog.maxZ = maxZ; } - if ( this.type === "checkbox" ) { - this.buttonElement.bind( "click.button", function() { - if ( options.disabled || clickDragged ) { - return false; - } - $( this ).toggleClass( "ui-state-active" ); - self.buttonElement.attr( "aria-pressed", self.element[0].checked ); - }); - } else if ( this.type === "radio" ) { - this.buttonElement.bind( "click.button", function() { - if ( options.disabled || clickDragged ) { - return false; - } - $( this ).addClass( "ui-state-active" ); - self.buttonElement.attr( "aria-pressed", true ); + return self; + }, - var radio = self.element[ 0 ]; - radioGroup( radio ) - .not( radio ) - .map(function() { - return $( this ).button( "widget" )[ 0 ]; - }) - .removeClass( "ui-state-active" ) - .attr( "aria-pressed", false ); - }); - } else { - this.buttonElement - .bind( "mousedown.button", function() { - if ( options.disabled ) { - return false; - } - $( this ).addClass( "ui-state-active" ); - lastActive = this; - $( document ).one( "mouseup", function() { - lastActive = null; - }); - }) - .bind( "mouseup.button", function() { - if ( options.disabled ) { - return false; - } - $( this ).removeClass( "ui-state-active" ); - }) - .bind( "keydown.button", function(event) { - if ( options.disabled ) { - return false; - } - if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { - $( this ).addClass( "ui-state-active" ); - } - }) - .bind( "keyup.button", function() { - $( this ).removeClass( "ui-state-active" ); - }); + isOpen: function() { + return this._isOpen; + }, - if ( this.buttonElement.is("a") ) { - this.buttonElement.keyup(function(event) { - if ( event.keyCode === $.ui.keyCode.SPACE ) { - // TODO pass through original event correctly (just as 2nd argument doesn't work) - $( this ).click(); - } - }); - } + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); } - // TODO: pull out $.Widget's handling for the disabled option into - // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can - // be overridden by individual plugins - this._setOption( "disabled", options.disabled ); - this._resetButton(); + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; }, - _determineButtonType: function() { + open: function() { + if (this._isOpen) { return; } - if ( this.element.is(":checkbox") ) { - this.type = "checkbox"; - } else if ( this.element.is(":radio") ) { - this.type = "radio"; - } else if ( this.element.is("input") ) { - this.type = "input"; - } else { - this.type = "button"; - } + var self = this, + options = self.options, + uiDialog = self.uiDialog; - if ( this.type === "checkbox" || this.type === "radio" ) { - // we don't search against the document in case the element - // is disconnected from the DOM - var ancestor = this.element.parents().filter(":last"), - labelSelector = "label[for=" + this.element.attr("id") + "]"; - this.buttonElement = ancestor.find( labelSelector ); - if ( !this.buttonElement.length ) { - ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); - this.buttonElement = ancestor.filter( labelSelector ); - if ( !this.buttonElement.length ) { - this.buttonElement = ancestor.find( labelSelector ); + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if (options.modal) { + uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode !== $.ui.keyCode.TAB) { + return; } - } - this.element.addClass( "ui-helper-hidden-accessible" ); - var checked = this.element.is( ":checked" ); - if ( checked ) { - this.buttonElement.addClass( "ui-state-active" ); - } - this.buttonElement.attr( "aria-pressed", checked ); - } else { - this.buttonElement = this.element; + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); } - }, - - widget: function() { - return this.buttonElement; - }, - destroy: function() { - this.element - .removeClass( "ui-helper-hidden-accessible" ); - this.buttonElement - .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) - .removeAttr( "role" ) - .removeAttr( "aria-pressed" ) - .html( this.buttonElement.find(".ui-button-text").html() ); + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); - if ( !this.hasTitle ) { - this.buttonElement.removeAttr( "title" ); - } + self._isOpen = true; + self._trigger('open'); - $.Widget.prototype.destroy.call( this ); + return self; }, - _setOption: function( key, value ) { - $.Widget.prototype._setOption.apply( this, arguments ); - if ( key === "disabled" ) { - if ( value ) { - this.element.attr( "disabled", true ); - } else { - this.element.removeAttr( "disabled" ); - } - return; - } - this._resetButton(); - }, + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "
" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); - refresh: function() { - var isDisabled = this.element.is( ":disabled" ); - if ( isDisabled !== this.options.disabled ) { - this._setOption( "disabled", isDisabled ); + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); } - if ( this.type === "radio" ) { - radioGroup( this.element[0] ).each(function() { - if ( $( this ).is( ":checked" ) ) { - $( this ).button( "widget" ) - .addClass( "ui-state-active" ) - .attr( "aria-pressed", true ); - } else { - $( this ).button( "widget" ) - .removeClass( "ui-state-active" ) - .attr( "aria-pressed", false ); + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); } }); - } else if ( this.type === "checkbox" ) { - if ( this.element.is( ":checked" ) ) { - this.buttonElement - .addClass( "ui-state-active" ) - .attr( "aria-pressed", true ); - } else { - this.buttonElement - .removeClass( "ui-state-active" ) - .attr( "aria-pressed", false ); - } + uiDialogButtonPane.appendTo(self.uiDialog); } }, - _resetButton: function() { - if ( this.type === "input" ) { - if ( this.options.label ) { - this.element.val( this.options.label ); - } - return; - } - var buttonElement = this.buttonElement.removeClass( typeClasses ), - buttonText = $( "" ) - .addClass( "ui-button-text" ) - .html( this.options.label ) - .appendTo( buttonElement.empty() ) - .text(), - icons = this.options.icons, - multipleIcons = icons.primary && icons.secondary, - buttonClasses = []; - - if ( icons.primary || icons.secondary ) { - if ( this.options.text ) { - buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); - } - - if ( icons.primary ) { - buttonElement.prepend( "" ); - } - - if ( icons.secondary ) { - buttonElement.append( "" ); - } - - if ( !this.options.text ) { - buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; - if ( !this.hasTitle ) { - buttonElement.attr( "title", buttonText ); - } - } - } else { - buttonClasses.push( "ui-button-text-only" ); + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; } - buttonElement.addClass( buttonClasses.join( " " ) ); - } -}); -$.widget( "ui.buttonset", { - options: { - items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); }, - _create: function() { - this.element.addClass( "ui-buttonset" ); - }, - - _init: function() { - this.refresh(); - }, + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); - _setOption: function( key, value ) { - if ( key === "disabled" ) { - this.buttons.button( "option", key, value ); + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; } - $.Widget.prototype._setOption.apply( this, arguments ); + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); }, - - refresh: function() { - var ltr = this.element.css( "direction" ) === "ltr"; - - this.buttons = this.element.find( this.options.items ) - .filter( ":ui-button" ) - .button( "refresh" ) - .end() - .not( ":ui-button" ) - .button() - .end() - .map(function() { - return $( this ).button( "widget" )[ 0 ]; - }) - .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) - .filter( ":first" ) - .addClass( ltr ? "ui-corner-left" : "ui-corner-right" ) - .end() - .filter( ":last" ) - .addClass( ltr ? "ui-corner-right" : "ui-corner-left" ) - .end() - .end(); + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } }, - destroy: function() { - this.element.removeClass( "ui-buttonset" ); - this.buttons - .map(function() { - return $( this ).button( "widget" )[ 0 ]; - }) - .removeClass( "ui-corner-left ui-corner-right" ) - .end() - .button( "destroy" ); + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; - $.Widget.prototype.destroy.call( this ); - } -}); + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); -}( jQuery ) ); -/* - * jQuery UI Datepicker 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Datepicker - * - * Depends: - * jquery.ui.core.js - */ -(function( $, undefined ) { + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } -$.extend($.ui, { datepicker: { version: "1.8.14" } }); + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); -var PROP_NAME = 'datepicker'; -var dpuuid = new Date().getTime(); -var instActive; + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } -/* Date picker manager. - Use the singleton instance of this class, $.datepicker, to interact with the date picker. - Settings for (groups of) date pickers are maintained in an instance object, - allowing multiple different settings on the same page. */ + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } -function Datepicker() { - this.debug = false; // Change this to true to start debugging - this._curInst = null; // The current instance in use - this._keyEvent = false; // If the last event was a key event - this._disabledInputs = []; // List of date picker inputs that have been disabled - this._datepickerShowing = false; // True if the popup picker is showing , false if not - this._inDialog = false; // True if showing within a "dialog", false if not - this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division - this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class - this._appendClass = 'ui-datepicker-append'; // The name of the append marker class - this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class - this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class - this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class - this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class - this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class - this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class - this.regional = []; // Available regional settings, indexed by language code - this.regional[''] = { // Default regional settings - closeText: 'Done', // Display text for close link - prevText: 'Prev', // Display text for previous month link - nextText: 'Next', // Display text for next month link - currentText: 'Today', // Display text for current month link - monthNames: ['January','February','March','April','May','June', - 'July','August','September','October','November','December'], // Names of months for drop-down and formatting - monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting - dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting - dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting - dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday - weekHeader: 'Wk', // Column header for week of the year - dateFormat: 'mm/dd/yy', // See format options on parseDate - firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... - isRTL: false, // True if right-to-left language, false if left-to-right - showMonthAfterYear: false, // True if the year select precedes month, false for month then year - yearSuffix: '' // Additional text to append to the year in the month headers - }; - this._defaults = { // Global defaults for all the date picker instances - showOn: 'focus', // 'focus' for popup on focus, - // 'button' for trigger button, or 'both' for either - showAnim: 'fadeIn', // Name of jQuery animation for popup - showOptions: {}, // Options for enhanced animations - defaultDate: null, // Used when field is blank: actual date, - // +/-number for offset from today, null for today - appendText: '', // Display text following the input box, e.g. showing the format - buttonText: '...', // Text for trigger button - buttonImage: '', // URL for trigger button image - buttonImageOnly: false, // True if the image appears alone, false if it appears on a button - hideIfNoPrevNext: false, // True to hide next/previous month links - // if not applicable, false to just disable them - navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links - gotoCurrent: false, // True if today link goes back to current selection instead - changeMonth: false, // True if month can be selected directly, false if only prev/next - changeYear: false, // True if year can be selected directly, false if only prev/next - yearRange: 'c-10:c+10', // Range of years to display in drop-down, - // either relative to today's year (-nn:+nn), relative to currently displayed year - // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) - showOtherMonths: false, // True to show dates in other months, false to leave blank - selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable - showWeek: false, // True to show week of the year, false to not show it - calculateWeek: this.iso8601Week, // How to calculate the week of the year, - // takes a Date and returns the number of the week for it - shortYearCutoff: '+10', // Short year values < this are in the current century, - // > this are in the previous century, - // string value starting with '+' for current year + value - minDate: null, // The earliest selectable date, or null for no limit - maxDate: null, // The latest selectable date, or null for no limit - duration: 'fast', // Duration of display/closure - beforeShowDay: null, // Function that takes a date and returns an array with - // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', - // [2] = cell title (optional), e.g. $.datepicker.noWeekends - beforeShow: null, // Function that takes an input field and - // returns a set of custom settings for the date picker - onSelect: null, // Define a callback function when a date is selected - onChangeMonthYear: null, // Define a callback function when the month or year is changed - onClose: null, // Define a callback function when the datepicker is closed - numberOfMonths: 1, // Number of months to show at a time - showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) - stepMonths: 1, // Number of months to step back/forward - stepBigMonths: 12, // Number of months to step back/forward for the big links - altField: '', // Selector for an alternate field to store selected dates into - altFormat: '', // The date format to use for the alternate field - constrainInput: true, // The input is constrained by the current date format - showButtonPanel: false, // True to show button panel, false to not show it - autoSize: false // True to size the input for the date format, false to leave as is - }; - $.extend(this._defaults, this.regional['']); - this.dpDiv = bindHover($('
')); -} + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, -$.extend(Datepicker.prototype, { - /* Class name added to elements to indicate already configured with a date picker. */ - markerClassName: 'hasDatepicker', - - //Keep track of the maximum number of rows displayed (see #7043) - maxRows: 4, + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; - /* Debug logging (if enabled). */ - log: function () { - if (this.debug) - console.log.apply('', arguments); - }, - - // TODO rename to "widget" when switching to widget factory - _widgetDatepicker: function() { - return this.dpDiv; - }, + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); - /* Override the default settings for all instances of the date picker. - @param settings object - the new settings to use as defaults (anonymous object) - @return the manager object */ - setDefaults: function(settings) { - extendRemove(this._defaults, settings || {}); - return this; + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } }, - /* Attach the date picker to a jQuery selection. - @param target element - the target input field or division or span - @param settings object - the new settings to use for this date picker instance (anonymous) */ - _attachDatepicker: function(target, settings) { - // check for settings on the control itself - in namespace 'date:' - var inlineSettings = null; - for (var attrName in this._defaults) { - var attrValue = target.getAttribute('date:' + attrName); - if (attrValue) { - inlineSettings = inlineSettings || {}; - try { - inlineSettings[attrName] = eval(attrValue); - } catch (err) { - inlineSettings[attrName] = attrValue; + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); } - } - } - var nodeName = target.nodeName.toLowerCase(); - var inline = (nodeName == 'div' || nodeName == 'span'); - if (!target.id) { - this.uuid += 1; - target.id = 'dp' + this.uuid; - } - var inst = this._newInst($(target), inline); - inst.settings = $.extend({}, settings || {}, inlineSettings || {}); - if (nodeName == 'input') { - this._connectDatepicker(target, inst); - } else if (inline) { - this._inlineDatepicker(target, inst); + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; } - }, - /* Create a new instance object. */ - _newInst: function(target, inline) { - var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars - return {id: id, input: target, // associated target - selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection - drawMonth: 0, drawYear: 0, // month being drawn - inline: inline, // is datepicker inline or not - dpDiv: (!inline ? this.dpDiv : // presentation div - bindHover($('
')))}; + $.Widget.prototype._setOption.apply(self, arguments); }, - /* Attach the date picker to an input field. */ - _connectDatepicker: function(target, inst) { - var input = $(target); - inst.append = $([]); - inst.trigger = $([]); - if (input.hasClass(this.markerClassName)) - return; - this._attachments(input, inst); - input.addClass(this.markerClassName).keydown(this._doKeyDown). - keypress(this._doKeyPress).keyup(this._doKeyUp). - bind("setData.datepicker", function(event, key, value) { - inst.settings[key] = value; - }).bind("getData.datepicker", function(event, key) { - return this._get(inst, key); - }); - this._autoSize(inst); - $.data(target, PROP_NAME, inst); - }, + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); - /* Make attachments based on settings. */ - _attachments: function(input, inst) { - var appendText = this._get(inst, 'appendText'); - var isRTL = this._get(inst, 'isRTL'); - if (inst.append) - inst.append.remove(); - if (appendText) { - inst.append = $('' + appendText + ''); - input[isRTL ? 'before' : 'after'](inst.append); - } - input.unbind('focus', this._showDatepicker); - if (inst.trigger) - inst.trigger.remove(); - var showOn = this._get(inst, 'showOn'); - if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field - input.focus(this._showDatepicker); - if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked - var buttonText = this._get(inst, 'buttonText'); - var buttonImage = this._get(inst, 'buttonImage'); - inst.trigger = $(this._get(inst, 'buttonImageOnly') ? - $('').addClass(this._triggerClass). - attr({ src: buttonImage, alt: buttonText, title: buttonText }) : - $('').addClass(this._triggerClass). - html(buttonImage == '' ? buttonText : $('').attr( - { src:buttonImage, alt:buttonText, title:buttonText }))); - input[isRTL ? 'before' : 'after'](inst.trigger); - inst.trigger.click(function() { - if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) - $.datepicker._hideDatepicker(); - else - $.datepicker._showDatepicker(input[0]); - return false; - }); + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; } - }, - /* Apply the maximum length for the date format. */ - _autoSize: function(inst) { - if (this._get(inst, 'autoSize') && !inst.inline) { - var date = new Date(2009, 12 - 1, 20); // Ensure double digits - var dateFormat = this._get(inst, 'dateFormat'); - if (dateFormat.match(/[DM]/)) { - var findMax = function(names) { - var max = 0; - var maxI = 0; - for (var i = 0; i < names.length; i++) { - if (names[i].length > max) { - max = names[i].length; - maxI = i; - } - } - return maxI; - }; - date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? - 'monthNames' : 'monthNamesShort')))); - date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? - 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); } - inst.input.attr('size', this._formatDate(inst, date).length); + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); } - }, - /* Attach an inline date picker to a div. */ - _inlineDatepicker: function(target, inst) { - var divSpan = $(target); - if (divSpan.hasClass(this.markerClassName)) - return; - divSpan.addClass(this.markerClassName).append(inst.dpDiv). - bind("setData.datepicker", function(event, key, value){ - inst.settings[key] = value; - }).bind("getData.datepicker", function(event, key){ - return this._get(inst, key); - }); - $.data(target, PROP_NAME, inst); - this._setDate(inst, this._getDefaultDate(inst), true); - this._updateDatepicker(inst); - this._updateAlternate(inst); - inst.dpDiv.show(); - }, + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); - /* Pop-up the date picker in a "dialog" box. - @param input element - ignored - @param date string or Date - the initial date to display - @param onSelect function - the function to call when a date is selected - @param settings object - update the dialog date picker instance's settings (anonymous object) - @param pos int[2] - coordinates for the dialog's position within the screen or - event - with x/y coordinates or - leave empty for default (screen centre) - @return the manager object */ - _dialogDatepicker: function(input, date, onSelect, settings, pos) { - var inst = this._dialogInst; // internal instance - if (!inst) { +$.extend($.ui.dialog, { + version: "1.8.16", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { this.uuid += 1; - var id = 'dp' + this.uuid; - this._dialogInput = $(''); - this._dialogInput.keydown(this._doKeyDown); - $('body').append(this._dialogInput); - inst = this._dialogInst = this._newInst(this._dialogInput, false); - inst.settings = {}; - $.data(this._dialogInput[0], PROP_NAME, inst); + id = this.uuid; } - extendRemove(inst.settings, settings || {}); - date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); - this._dialogInput.val(date); + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); - this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); - if (!this._pos) { - var browserWidth = document.documentElement.clientWidth; - var browserHeight = document.documentElement.clientHeight; - var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; - var scrollY = document.documentElement.scrollTop || document.body.scrollTop; - this._pos = // should use actual width/height below - [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); } - // move input on screen for focus, but hidden behind dialog - this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); - inst.settings.onSelect = onSelect; - this._inDialog = true; - this.dpDiv.addClass(this._dialogClass); - this._showDatepicker(this._dialogInput[0]); - if ($.blockUI) - $.blockUI(this.dpDiv); - $.data(this._dialogInput[0], PROP_NAME, inst); - return this; - }, + var $el = (this.oldInstances.pop() || $('
').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); - /* Detach a datepicker from its control. - @param target element - the target input field or division or span */ - _destroyDatepicker: function(target) { - var $target = $(target); - var inst = $.data(target, PROP_NAME); - if (!$target.hasClass(this.markerClassName)) { - return; + if ($.fn.bgiframe) { + $el.bgiframe(); } - var nodeName = target.nodeName.toLowerCase(); - $.removeData(target, PROP_NAME); - if (nodeName == 'input') { - inst.append.remove(); - inst.trigger.remove(); - $target.removeClass(this.markerClassName). - unbind('focus', this._showDatepicker). - unbind('keydown', this._doKeyDown). - unbind('keypress', this._doKeyPress). - unbind('keyup', this._doKeyUp); - } else if (nodeName == 'div' || nodeName == 'span') - $target.removeClass(this.markerClassName).empty(); + + this.instances.push($el); + return $el; }, - /* Enable the date picker to a jQuery selection. - @param target element - the target input field or division or span */ - _enableDatepicker: function(target) { - var $target = $(target); - var inst = $.data(target, PROP_NAME); - if (!$target.hasClass(this.markerClassName)) { - return; - } - var nodeName = target.nodeName.toLowerCase(); - if (nodeName == 'input') { - target.disabled = false; - inst.trigger.filter('button'). - each(function() { this.disabled = false; }).end(). - filter('img').css({opacity: '1.0', cursor: ''}); + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); } - else if (nodeName == 'div' || nodeName == 'span') { - var inline = $target.children('.' + this._inlineClass); - inline.children().removeClass('ui-state-disabled'); - inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). - removeAttr("disabled"); + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); } - this._disabledInputs = $.map(this._disabledInputs, - function(value) { return (value == target ? null : value); }); // delete entry + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; }, - /* Disable the date picker to a jQuery selection. - @param target element - the target input field or division or span */ - _disableDatepicker: function(target) { - var $target = $(target); - var inst = $.data(target, PROP_NAME); - if (!$target.hasClass(this.markerClassName)) { - return; - } - var nodeName = target.nodeName.toLowerCase(); - if (nodeName == 'input') { - target.disabled = true; - inst.trigger.filter('button'). - each(function() { this.disabled = true; }).end(). - filter('img').css({opacity: '0.5', cursor: 'default'}); - } - else if (nodeName == 'div' || nodeName == 'span') { - var inline = $target.children('.' + this._inlineClass); - inline.children().addClass('ui-state-disabled'); - inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). - attr("disabled", "disabled"); + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; } - this._disabledInputs = $.map(this._disabledInputs, - function(value) { return (value == target ? null : value); }); // delete entry - this._disabledInputs[this._disabledInputs.length] = target; }, - /* Is the first field in a jQuery collection disabled as a datepicker? - @param target element - the target input field or division or span - @return boolean - true if disabled, false if enabled */ - _isDisabledDatepicker: function(target) { - if (!target) { - return false; - } - for (var i = 0; i < this._disabledInputs.length; i++) { - if (this._disabledInputs[i] == target) - return true; + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; } - return false; }, - /* Retrieve the instance data for the target control. - @param target element - the target input field or division or span - @return object - the associated instance data - @throws error if a jQuery problem getting data */ - _getInst: function(target) { - try { - return $.data(target, PROP_NAME); - } - catch (err) { - throw 'Missing instance data for this datepicker'; - } - }, + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); +/* + * jQuery UI Slider 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); - /* Update or retrieve the settings for a date picker attached to an input field or division. - @param target element - the target input field or division or span - @param name object - the new settings to update or - string - the name of the setting to change or retrieve, - when retrieving also 'all' for all instance settings or - 'defaults' for all global defaults - @param value any - the new value for the setting - (omit if above is an object or to retrieve a value) */ - _optionDatepicker: function(target, name, value) { - var inst = this._getInst(target); - if (arguments.length == 2 && typeof name == 'string') { - return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : - (inst ? (name == 'all' ? $.extend({}, inst.settings) : - this._get(inst, name)) : null)); - } - var settings = name || {}; - if (typeof name == 'string') { - settings = {}; - settings[name] = value; - } - if (inst) { - if (this._curInst == inst) { - this._hideDatepicker(); - } - var date = this._getDateDatepicker(target, true); - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - extendRemove(inst.settings, settings); - // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided - if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) - inst.settings.minDate = this._formatDate(inst, minDate); - if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) - inst.settings.maxDate = this._formatDate(inst, maxDate); - this._attachments($(target), inst); - this._autoSize(inst); - this._setDate(inst, date); - this._updateAlternate(inst); - this._updateDatepicker(inst); - } - }, + this.range = $([]); - // change method deprecated - _changeDatepicker: function(target, name, value) { - this._optionDatepicker(target, name, value); - }, + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } - /* Redraw the date picker attached to an input field or division. - @param target element - the target input field or division or span */ - _refreshDatepicker: function(target) { - var inst = this._getInst(target); - if (inst) { - this._updateDatepicker(inst); + this.range = $( "
" ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); } - }, - /* Set the dates for a jQuery selection. - @param target element - the target input field or division or span - @param date Date - the new date */ - _setDateDatepicker: function(target, date) { - var inst = this._getInst(target); - if (inst) { - this._setDate(inst, date); - this._updateDatepicker(inst); - this._updateAlternate(inst); + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); } - }, - /* Get the date(s) for the first entry in a jQuery selection. - @param target element - the target input field or division or span - @param noDefault boolean - true if no default date is to be used - @return Date - the current date */ - _getDateDatepicker: function(target, noDefault) { - var inst = this._getInst(target); - if (inst && !inst.inline) - this._setDateFromField(inst, noDefault); - return (inst ? this._getDate(inst) : null); - }, + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); - /* Handle keystrokes. */ - _doKeyDown: function(event) { - var inst = $.datepicker._getInst(event.target); - var handled = true; - var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); - inst._keyEvent = true; - if ($.datepicker._datepickerShowing) - switch (event.keyCode) { - case 9: $.datepicker._hideDatepicker(); - handled = false; - break; // hide on tab out - case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + - $.datepicker._currentClass + ')', inst.dpDiv); - if (sel[0]) - $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); - else - $.datepicker._hideDatepicker(); - return false; // don't submit the form - break; // select the value on enter - case 27: $.datepicker._hideDatepicker(); - break; // hide on escape - case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? - -$.datepicker._get(inst, 'stepBigMonths') : - -$.datepicker._get(inst, 'stepMonths')), 'M'); - break; // previous month/year on page up/+ ctrl - case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? - +$.datepicker._get(inst, 'stepBigMonths') : - +$.datepicker._get(inst, 'stepMonths')), 'M'); - break; // next month/year on page down/+ ctrl - case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); - handled = event.ctrlKey || event.metaKey; - break; // clear on ctrl or command +end - case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); - handled = event.ctrlKey || event.metaKey; - break; // current on ctrl or command +home - case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); - handled = event.ctrlKey || event.metaKey; - // -1 day on ctrl or command +left - if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? - -$.datepicker._get(inst, 'stepBigMonths') : - -$.datepicker._get(inst, 'stepMonths')), 'M'); - // next month/year on alt +left on Mac + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var ret = true, + index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } break; - case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); - handled = event.ctrlKey || event.metaKey; - break; // -1 week on ctrl or command +up - case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); - handled = event.ctrlKey || event.metaKey; - // +1 day on ctrl or command +right - if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? - +$.datepicker._get(inst, 'stepBigMonths') : - +$.datepicker._get(inst, 'stepMonths')), 'M'); - // next month/year on alt +right + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); break; - case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); - handled = event.ctrlKey || event.metaKey; - break; // +1 week on ctrl or command +down - default: handled = false; - } - else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home - $.datepicker._showDatepicker(this); - else { - handled = false; - } - if (handled) { - event.preventDefault(); - event.stopPropagation(); - } + } + + self._slide( event, index, newVal ); + + return ret; + + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; }, - /* Filter entered characters - based on date format. */ - _doKeyPress: function(event) { - var inst = $.datepicker._getInst(event.target); - if ($.datepicker._get(inst, 'constrainInput')) { - var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); - var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); - return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); - } + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; }, - /* Synchronise manual entry and field/alternate field. */ - _doKeyUp: function(event) { - var inst = $.datepicker._getInst(event.target); - if (inst.input.val() != inst.lastVal) { - try { - var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), - (inst.input ? inst.input.val() : null), - $.datepicker._getFormatConfig(inst)); - if (date) { // only if valid - $.datepicker._setDateFromField(inst); - $.datepicker._updateAlternate(inst); - $.datepicker._updateDatepicker(inst); - } - } - catch (event) { - $.datepicker.log(event); - } + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; } - return true; - }, - /* Pop-up the date picker for a given input field. - @param input element - the input field attached to the date picker or - event - if triggered by focus */ - _showDatepicker: function(input) { - input = input.target || input; - if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger - input = $('input', input.parentNode)[0]; - if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here - return; - var inst = $.datepicker._getInst(input); - if ($.datepicker._curInst && $.datepicker._curInst != inst) { - if ( $.datepicker._datepickerShowing ) { - $.datepicker._triggerOnClose($.datepicker._curInst); + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; } - $.datepicker._curInst.dpDiv.stop(true, true); - } - var beforeShow = $.datepicker._get(inst, 'beforeShow'); - extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {})); - inst.lastVal = null; - $.datepicker._lastInput = input; - $.datepicker._setDateFromField(inst); - if ($.datepicker._inDialog) // hide cursor - input.value = ''; - if (!$.datepicker._pos) { // position below input - $.datepicker._pos = $.datepicker._findPos(input); - $.datepicker._pos[1] += input.offsetHeight; // add the height - } - var isFixed = false; - $(input).parents().each(function() { - isFixed |= $(this).css('position') == 'fixed'; - return !isFixed; }); - if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled - $.datepicker._pos[0] -= document.documentElement.scrollLeft; - $.datepicker._pos[1] -= document.documentElement.scrollTop; - } - var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; - $.datepicker._pos = null; - //to avoid flashes on Firefox - inst.dpDiv.empty(); - // determine sizing offscreen - inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); - $.datepicker._updateDatepicker(inst); - // fix width for dynamic number of date pickers - // and adjust position before showing - offset = $.datepicker._checkOffset(inst, offset, isFixed); - inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? - 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', - left: offset.left + 'px', top: offset.top + 'px'}); - if (!inst.inline) { - var showAnim = $.datepicker._get(inst, 'showAnim'); - var duration = $.datepicker._get(inst, 'duration'); - var postProcess = function() { - var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only - if( !! cover.length ){ - var borders = $.datepicker._getBorders(inst.dpDiv); - cover.css({left: -borders[0], top: -borders[1], - width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); - } - }; - inst.dpDiv.zIndex($(input).zIndex()+1); - $.datepicker._datepickerShowing = true; - if ($.effects && $.effects[showAnim]) - inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); - else - inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); - if (!showAnim || !duration) - postProcess(); - if (inst.input.is(':visible') && !inst.input.is(':disabled')) - inst.input.focus(); - $.datepicker._curInst = inst; + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); } - }, - /* Generate the date picker content. */ - _updateDatepicker: function(inst) { - var self = this; - self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) - var borders = $.datepicker._getBorders(inst.dpDiv); - instActive = inst; // for delegate hover events - inst.dpDiv.empty().append(this._generateHTML(inst)); - var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only - if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 - cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; } - inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); - var numMonths = this._getNumberOfMonths(inst); - var cols = numMonths[1]; - var width = 17; - inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); - if (cols > 1) - inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); - inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + - 'Class']('ui-datepicker-multi'); - inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + - 'Class']('ui-datepicker-rtl'); - if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && - // #6694 - don't focus the input if it's already focused - // this breaks the change event in IE - inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) - inst.input.focus(); - // deffered render of the years select (to avoid flashes on Firefox) - if( inst.yearshtml ){ - var origyearshtml = inst.yearshtml; - setTimeout(function(){ - //assure that inst.yearshtml didn't change. - if( origyearshtml === inst.yearshtml && inst.yearshtml ){ - inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); - } - origyearshtml = inst.yearshtml = null; - }, 0); + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; }, - /* Retrieve the size of left and top borders for an element. - @param elem (jQuery object) the element of interest - @return (number[2]) the left and top borders */ - _getBorders: function(elem) { - var convert = function(value) { - return {thin: 1, medium: 2, thick: 3}[value] || value; - }; - return [parseFloat(convert(elem.css('border-left-width'))), - parseFloat(convert(elem.css('border-top-width')))]; + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; }, - /* Check positioning to remain on screen. */ - _checkOffset: function(inst, offset, isFixed) { - var dpWidth = inst.dpDiv.outerWidth(); - var dpHeight = inst.dpDiv.outerHeight(); - var inputWidth = inst.input ? inst.input.outerWidth() : 0; - var inputHeight = inst.input ? inst.input.outerHeight() : 0; - var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); - var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; - offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); - offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; - offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); - // now check if datepicker is showing outside window viewport - move to a better place if so. - offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? - Math.abs(offset.left + dpWidth - viewWidth) : 0); - offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? - Math.abs(dpHeight + inputHeight) : 0); + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; - return offset; + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; }, - /* Find an object's position on the screen. */ - _findPos: function(obj) { - var inst = this._getInst(obj); - var isRTL = this._get(inst, 'isRTL'); - while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { - obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; - } - var position = $(obj).offset(); - return [position.left, position.top]; + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); }, - /* Trigger custom callback of onClose. */ - _triggerOnClose: function(inst) { - var onClose = this._get(inst, 'onClose'); - if (onClose) - onClose.apply((inst.input ? inst.input[0] : null), - [(inst.input ? inst.input.val() : ''), inst]); + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); }, - /* Hide the date picker from view. - @param input element - the input field attached to the date picker */ - _hideDatepicker: function(input) { - var inst = this._curInst; - if (!inst || (input && inst != $.data(input, PROP_NAME))) - return; - if (this._datepickerShowing) { - var showAnim = this._get(inst, 'showAnim'); - var duration = this._get(inst, 'duration'); - var postProcess = function() { - $.datepicker._tidyDialog(inst); - this._curInst = null; - }; - if ($.effects && $.effects[showAnim]) - inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); - else - inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : - (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); - if (!showAnim) - postProcess(); - $.datepicker._triggerOnClose(inst); - this._datepickerShowing = false; - this._lastInput = null; - if (this._inDialog) { - this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); - if ($.blockUI) { - $.unblockUI(); - $('body').append(this.dpDiv); + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); } } - this._inDialog = false; } }, - /* Tidy up after a dialog display. */ - _tidyDialog: function(inst) { - inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); - }, + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } - /* Close date picker if clicked elsewhere. */ - _checkExternalClick: function(event) { - if (!$.datepicker._curInst) - return; - var $target = $(event.target); - if ($target[0].id != $.datepicker._mainDivId && - $target.parents('#' + $.datepicker._mainDivId).length == 0 && - !$target.hasClass($.datepicker.markerClassName) && - !$target.hasClass($.datepicker._triggerClass) && - $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) - $.datepicker._hideDatepicker(); + this._trigger( "stop", event, uiHash ); }, - /* Adjust one of the date sub-fields. */ - _adjustDate: function(id, offset, period) { - var target = $(id); - var inst = this._getInst(target[0]); - if (this._isDisabledDatepicker(target[0])) { - return; + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); } - this._adjustInstDate(inst, offset + - (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning - period); - this._updateDatepicker(inst); }, - /* Action for current link. */ - _gotoToday: function(id) { - var target = $(id); - var inst = this._getInst(target[0]); - if (this._get(inst, 'gotoCurrent') && inst.currentDay) { - inst.selectedDay = inst.currentDay; - inst.drawMonth = inst.selectedMonth = inst.currentMonth; - inst.drawYear = inst.selectedYear = inst.currentYear; - } - else { - var date = new Date(); - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; } - this._notifyChange(inst); - this._adjustDate(target); - }, - /* Action for selecting a new month/year. */ - _selectMonthYear: function(id, select, period) { - var target = $(id); - var inst = this._getInst(target[0]); - inst._selectingMonthYear = false; - inst['selected' + (period == 'M' ? 'Month' : 'Year')] = - inst['draw' + (period == 'M' ? 'Month' : 'Year')] = - parseInt(select.options[select.selectedIndex].value,10); - this._notifyChange(inst); - this._adjustDate(target); + return this._value(); }, - /* Restore input focus after not changing month/year. */ - _clickMonthYear: function(id) { - var target = $(id); - var inst = this._getInst(target[0]); - if (inst.input && inst._selectingMonthYear) { - setTimeout(function() { - inst.input.focus(); - }, 0); - } - inst._selectingMonthYear = !inst._selectingMonthYear; - }, + values: function( index, newValue ) { + var vals, + newValues, + i; - /* Action for selecting a day. */ - _selectDay: function(id, month, year, td) { - var target = $(id); - if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); return; } - var inst = this._getInst(target[0]); - inst.selectedDay = inst.currentDay = $('a', td).html(); - inst.selectedMonth = inst.currentMonth = month; - inst.selectedYear = inst.currentYear = year; - this._selectDate(id, this._formatDate(inst, - inst.currentDay, inst.currentMonth, inst.currentYear)); - }, - /* Erase the input field and hide the date picker. */ - _clearDate: function(id) { - var target = $(id); - var inst = this._getInst(target[0]); - this._selectDate(target, ''); + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } }, - /* Update the input field with the selected date. */ - _selectDate: function(id, dateStr) { - var target = $(id); - var inst = this._getInst(target[0]); - dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); - if (inst.input) - inst.input.val(dateStr); - this._updateAlternate(inst); - var onSelect = this._get(inst, 'onSelect'); - if (onSelect) - onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback - else if (inst.input) - inst.input.trigger('change'); // fire the change event - if (inst.inline) - this._updateDatepicker(inst); - else { - this._hideDatepicker(); - this._lastInput = inst.input[0]; - if (typeof(inst.input[0]) != 'object') - inst.input.focus(); // restore focus - this._lastInput = null; + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; } - }, - /* Update any alternate field to synchronise with the main field. */ - _updateAlternate: function(inst) { - var altField = this._get(inst, 'altField'); - if (altField) { // update alternate field too - var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); - var date = this._getDate(inst); - var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); - $(altField).each(function() { $(this).val(dateStr); }); + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; } }, - /* Set as beforeShowDay function to prevent selection of weekends. - @param date Date - the date to customise - @return [boolean, string] - is this date selectable?, what is its CSS class? */ - noWeekends: function(date) { - var day = date.getDay(); - return [(day > 0 && day < 6), '']; - }, + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); - /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. - @param date Date - the date to get the week for - @return number - the number of the week within the year that contains this date */ - iso8601Week: function(date) { - var checkDate = new Date(date.getTime()); - // Find Thursday of this week starting on Monday - checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); - var time = checkDate.getTime(); - checkDate.setMonth(0); // Compare with Jan 1 - checkDate.setDate(1); - return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + return val; }, - /* Parse a string value into a date object. - See formatDate below for the possible formats. - - @param format string - the expected format of the date - @param value string - the date in the above format - @param settings Object - attributes include: - shortYearCutoff number - the cutoff year for determining the century (optional) - dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) - dayNames string[7] - names of the days from Sunday (optional) - monthNamesShort string[12] - abbreviated names of the months (optional) - monthNames string[12] - names of the months (optional) - @return Date - the extracted date value or null if value is blank */ - parseDate: function (format, value, settings) { - if (format == null || value == null) - throw 'Invalid arguments'; - value = (typeof value == 'object' ? value.toString() : value + ''); - if (value == '') - return null; - var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; - shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : - new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); - var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; - var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; - var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; - var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; - var year = -1; - var month = -1; - var day = -1; - var doy = -1; - var literal = false; - // Check whether a format character is doubled - var lookAhead = function(match) { - var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); - if (matches) - iFormat++; - return matches; - }; - // Extract a number from the string value - var getNumber = function(match) { - var isDoubled = lookAhead(match); - var size = (match == '@' ? 14 : (match == '!' ? 20 : - (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); - var digits = new RegExp('^\\d{1,' + size + '}'); - var num = value.substring(iValue).match(digits); - if (!num) - throw 'Missing number at position ' + iValue; - iValue += num[0].length; - return parseInt(num[0], 10); - }; - // Extract a name from the string value and convert to an index - var getName = function(match, shortNames, longNames) { - var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { - return [ [k, v] ]; - }).sort(function (a, b) { - return -(a[1].length - b[1].length); - }); - var index = -1; - $.each(names, function (i, pair) { - var name = pair[1]; - if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { - index = pair[0]; - iValue += name.length; - return false; - } - }); - if (index != -1) - return index + 1; - else - throw 'Unknown name at position ' + iValue; - }; - // Confirm that a literal character matches the string value - var checkLiteral = function() { - if (value.charAt(iValue) != format.charAt(iFormat)) - throw 'Unexpected literal at position ' + iValue; - iValue++; - }; - var iValue = 0; - for (var iFormat = 0; iFormat < format.length; iFormat++) { - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - checkLiteral(); - else - switch (format.charAt(iFormat)) { - case 'd': - day = getNumber('d'); - break; - case 'D': - getName('D', dayNamesShort, dayNames); - break; - case 'o': - doy = getNumber('o'); - break; - case 'm': - month = getNumber('m'); - break; - case 'M': - month = getName('M', monthNamesShort, monthNames); - break; - case 'y': - year = getNumber('y'); - break; - case '@': - var date = new Date(getNumber('@')); - year = date.getFullYear(); - month = date.getMonth() + 1; - day = date.getDate(); - break; - case '!': - var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); - year = date.getFullYear(); - month = date.getMonth() + 1; - day = date.getDate(); - break; - case "'": - if (lookAhead("'")) - checkLiteral(); - else - literal = true; - break; - default: - checkLiteral(); - } + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; } - if (iValue < value.length){ - throw "Extra/unparsed characters found in date: " + value.substring(iValue); + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); } - if (year == -1) - year = new Date().getFullYear(); - else if (year < 100) - year += new Date().getFullYear() - new Date().getFullYear() % 100 + - (year <= shortYearCutoff ? 0 : -100); - if (doy > -1) { - month = 1; - day = doy; - do { - var dim = this._getDaysInMonth(year, month - 1); - if (day <= dim) - break; - month++; - day -= dim; - } while (true); + if ( val >= this._valueMax() ) { + return this._valueMax(); } - var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); - if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) - throw 'Invalid date'; // E.g. 31/02/00 - return date; - }, + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; - /* Standard date formats. */ - ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) - COOKIE: 'D, dd M yy', - ISO_8601: 'yy-mm-dd', - RFC_822: 'D, d M y', - RFC_850: 'DD, dd-M-y', - RFC_1036: 'D, d M y', - RFC_1123: 'D, d M yy', - RFC_2822: 'D, d M yy', - RSS: 'D, d M y', // RFC 822 - TICKS: '!', - TIMESTAMP: '@', - W3C: 'yy-mm-dd', // ISO 8601 + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } - _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + - Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, - /* Format a date object into a string value. - The format can be combinations of the following: - d - day of month (no leading zero) - dd - day of month (two digit) - o - day of year (no leading zeros) - oo - day of year (three digit) - D - day name short - DD - day name long - m - month of year (no leading zero) - mm - month of year (two digit) - M - month name short - MM - month name long - y - year (two digit) - yy - year (four digit) - @ - Unix timestamp (ms since 01/01/1970) - ! - Windows ticks (100ns since 01/01/0001) - '...' - literal text - '' - single quote + _valueMin: function() { + return this.options.min; + }, - @param format string - the desired format of the date - @param date Date - the date value to format - @param settings Object - attributes include: - dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) - dayNames string[7] - names of the days from Sunday (optional) - monthNamesShort string[12] - abbreviated names of the months (optional) - monthNames string[12] - names of the months (optional) - @return string - the date in the above format */ - formatDate: function (format, date, settings) { - if (!date) - return ''; - var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; - var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; - var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; - var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; - // Check whether a format character is doubled - var lookAhead = function(match) { - var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); - if (matches) - iFormat++; - return matches; - }; - // Format a number, with leading zero if necessary - var formatNumber = function(match, value, len) { - var num = '' + value; - if (lookAhead(match)) - while (num.length < len) - num = '0' + num; - return num; - }; - // Format a name, short or long as requested - var formatName = function(match, value, shortNames, longNames) { - return (lookAhead(match) ? longNames[value] : shortNames[value]); - }; - var output = ''; - var literal = false; - if (date) - for (var iFormat = 0; iFormat < format.length; iFormat++) { - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - output += format.charAt(iFormat); - else - switch (format.charAt(iFormat)) { - case 'd': - output += formatNumber('d', date.getDate(), 2); - break; - case 'D': - output += formatName('D', date.getDay(), dayNamesShort, dayNames); - break; - case 'o': - output += formatNumber('o', - Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); - break; - case 'm': - output += formatNumber('m', date.getMonth() + 1, 2); - break; - case 'M': - output += formatName('M', date.getMonth(), monthNamesShort, monthNames); - break; - case 'y': - output += (lookAhead('y') ? date.getFullYear() : - (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); - break; - case '@': - output += date.getTime(); - break; - case '!': - output += date.getTime() * 10000 + this._ticksTo1970; - break; - case "'": - if (lookAhead("'")) - output += "'"; - else - literal = true; - break; - default: - output += format.charAt(iFormat); + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); } - return output; - }, + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.16" +}); + +}(jQuery)); +/* + * jQuery UI Tabs 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { - /* Extract all possible characters from the date format. */ - _possibleChars: function (format) { - var chars = ''; - var literal = false; - // Check whether a format character is doubled - var lookAhead = function(match) { - var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); - if (matches) - iFormat++; - return matches; - }; - for (var iFormat = 0; iFormat < format.length; iFormat++) - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - chars += format.charAt(iFormat); - else - switch (format.charAt(iFormat)) { - case 'd': case 'm': case 'y': case '@': - chars += '0123456789'; - break; - case 'D': case 'M': - return null; // Accept anything - case "'": - if (lookAhead("'")) - chars += "'"; - else - literal = true; - break; - default: - chars += format.charAt(iFormat); - } - return chars; +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "
", + remove: null, + select: null, + show: null, + spinner: "Loading…", + tabTemplate: "
  • #{label}
  • " }, - /* Get a setting value, defaulting if necessary. */ - _get: function(inst, name) { - return inst.settings[name] !== undefined ? - inst.settings[name] : this._defaults[name]; + _create: function() { + this._tabify( true ); }, - /* Parse existing date and initialise date picker. */ - _setDateFromField: function(inst, noDefault) { - if (inst.input.val() == inst.lastVal) { - return; - } - var dateFormat = this._get(inst, 'dateFormat'); - var dates = inst.lastVal = inst.input ? inst.input.val() : null; - var date, defaultDate; - date = defaultDate = this._getDefaultDate(inst); - var settings = this._getFormatConfig(inst); - try { - date = this.parseDate(dateFormat, dates, settings) || defaultDate; - } catch (event) { - this.log(event); - dates = (noDefault ? '' : dates); + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); } - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); - inst.currentDay = (dates ? date.getDate() : 0); - inst.currentMonth = (dates ? date.getMonth() : 0); - inst.currentYear = (dates ? date.getFullYear() : 0); - this._adjustInstDate(inst); }, - /* Retrieve the default date shown on opening. */ - _getDefaultDate: function(inst) { - return this._restrictMinMax(inst, - this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); }, - /* A date may be specified as an exact value or a relative one. */ - _determineDate: function(inst, date, defaultDate) { - var offsetNumeric = function(offset) { - var date = new Date(); - date.setDate(date.getDate() + offset); - return date; - }; - var offsetString = function(offset) { - try { - return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), - offset, $.datepicker._getFormatConfig(inst)); - } - catch (e) { - // Ignore - } - var date = (offset.toLowerCase().match(/^c/) ? - $.datepicker._getDate(inst) : null) || new Date(); - var year = date.getFullYear(); - var month = date.getMonth(); - var day = date.getDate(); - var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; - var matches = pattern.exec(offset); - while (matches) { - switch (matches[2] || 'd') { - case 'd' : case 'D' : - day += parseInt(matches[1],10); break; - case 'w' : case 'W' : - day += parseInt(matches[1],10) * 7; break; - case 'm' : case 'M' : - month += parseInt(matches[1],10); - day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); - break; - case 'y': case 'Y' : - year += parseInt(matches[1],10); - day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); - break; - } - matches = pattern.exec(offset); - } - return new Date(year, month, day); - }; - var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : - (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); - newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); - if (newDate) { - newDate.setHours(0); - newDate.setMinutes(0); - newDate.setSeconds(0); - newDate.setMilliseconds(0); - } - return this._daylightSavingAdjust(newDate); + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); }, - /* Handle switch to/from daylight saving. - Hours may be non-zero on daylight saving cut-over: - > 12 when midnight changeover, but then cannot generate - midnight datetime, so jump to 1AM, otherwise reset. - @param date (Date) the date to check - @return (Date) the corrected date */ - _daylightSavingAdjust: function(date) { - if (!date) return null; - date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); - return date; + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); }, - /* Set the date(s) directly. */ - _setDate: function(inst, date, noChange) { - var clear = !date; - var origMonth = inst.selectedMonth; - var origYear = inst.selectedYear; - var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); - inst.selectedDay = inst.currentDay = newDate.getDate(); - inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); - inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); - if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) - this._notifyChange(inst); - this._adjustInstDate(inst); - if (inst.input) { - inst.input.val(clear ? '' : this._formatDate(inst)); - } + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; }, - /* Retrieve the date(s) directly. */ - _getDate: function(inst) { - var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : - this._daylightSavingAdjust(new Date( - inst.currentYear, inst.currentMonth, inst.currentDay))); - return startDate; + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); }, - /* Generate the HTML for the current state of the date picker. */ - _generateHTML: function(inst) { - var today = new Date(); - today = this._daylightSavingAdjust( - new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time - var isRTL = this._get(inst, 'isRTL'); - var showButtonPanel = this._get(inst, 'showButtonPanel'); - var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); - var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); - var numMonths = this._getNumberOfMonths(inst); - var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); - var stepMonths = this._get(inst, 'stepMonths'); - var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); - var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : - new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - var drawMonth = inst.drawMonth - showCurrentAtPos; - var drawYear = inst.drawYear; - if (drawMonth < 0) { - drawMonth += 12; - drawYear--; - } - if (maxDate) { - var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), - maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); - maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); - while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { - drawMonth--; - if (drawMonth < 0) { - drawMonth = 11; - drawYear--; + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); } - } - inst.drawMonth = drawMonth; - inst.drawYear = drawYear; - var prevText = this._get(inst, 'prevText'); - prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, - this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), - this._getFormatConfig(inst))); - var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? - '' + prevText + '' : - (hideIfNoPrevNext ? '' : '' + prevText + '')); - var nextText = this._get(inst, 'nextText'); - nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, - this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), - this._getFormatConfig(inst))); - var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? - '' + nextText + '' : - (hideIfNoPrevNext ? '' : '' + nextText + '')); - var currentText = this._get(inst, 'currentText'); - var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); - currentText = (!navigationAsDateFormat ? currentText : - this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); - var controls = (!inst.inline ? '' : ''); - var buttonPanel = (showButtonPanel) ? '
    ' + (isRTL ? controls : '') + - (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
    ' : ''; - var firstDay = parseInt(this._get(inst, 'firstDay'),10); - firstDay = (isNaN(firstDay) ? 0 : firstDay); - var showWeek = this._get(inst, 'showWeek'); - var dayNames = this._get(inst, 'dayNames'); - var dayNamesShort = this._get(inst, 'dayNamesShort'); - var dayNamesMin = this._get(inst, 'dayNamesMin'); - var monthNames = this._get(inst, 'monthNames'); - var monthNamesShort = this._get(inst, 'monthNamesShort'); - var beforeShowDay = this._get(inst, 'beforeShowDay'); - var showOtherMonths = this._get(inst, 'showOtherMonths'); - var selectOtherMonths = this._get(inst, 'selectOtherMonths'); - var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; - var defaultDate = this._getDefaultDate(inst); - var html = ''; - for (var row = 0; row < numMonths[0]; row++) { - var group = ''; - this.maxRows = 4; - for (var col = 0; col < numMonths[1]; col++) { - var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); - var cornerClass = ' ui-corner-all'; - var calender = ''; - if (isMultiMonth) { - calender += '
    + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; } - calender += '">'; + }); } - calender += '
    ' + - (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + - (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + - this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, - row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers - '
    ' + - ''; - var thead = (showWeek ? '' : ''); - for (var dow = 0; dow < 7; dow++) { // days of the week - var day = (dow + firstDay) % 7; - thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + - '' + dayNamesMin[day] + ''; + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); } - calender += thead + ''; - var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); - if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) - inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); - var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; - var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate - var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) - this.maxRows = numRows; - var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); - for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows - calender += ''; - var tbody = (!showWeek ? '' : ''); - for (var dow = 0; dow < 7; dow++) { // create date picker days - var daySettings = (beforeShowDay ? - beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); - var otherMonth = (printDate.getMonth() != drawMonth); - var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || - (minDate && printDate < minDate) || (maxDate && printDate > maxDate); - tbody += ''; // display selectable date - printDate.setDate(printDate.getDate() + 1); - printDate = this._daylightSavingAdjust(printDate); - } - calender += tbody + ''; + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); } - drawMonth++; - if (drawMonth > 11) { - drawMonth = 0; - drawYear++; + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); } - calender += '
    ' + this._get(inst, 'weekHeader') + '
    ' + - this._get(inst, 'calculateWeek')(printDate) + '' + // actions - (otherMonth && !showOtherMonths ? ' ' : // display for other months - (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
    ' + (isMultiMonth ? '
    ' + - ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
    ' : '') : ''); - group += calender; + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; } - html += group; } - html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? - '' : ''); - inst._keyEvent = false; - return html; - }, - /* Generate the month and year header. */ - _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, - secondary, monthNames, monthNamesShort) { - var changeMonth = this._get(inst, 'changeMonth'); - var changeYear = this._get(inst, 'changeYear'); - var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); - var html = '
    '; - var monthHtml = ''; - // month selection - if (secondary || !changeMonth) - monthHtml += '' + monthNames[drawMonth] + ''; - else { - var inMinYear = (minDate && minDate.getFullYear() == drawYear); - var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); - monthHtml += ''; } - if (!showMonthAfterYear) - html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); - // year selection - if ( !inst.yearshtml ) { - inst.yearshtml = ''; - if (secondary || !changeYear) - html += '' + drawYear + ''; - else { - // determine range of years to display - var years = this._get(inst, 'yearRange').split(':'); - var thisYear = new Date().getFullYear(); - var determineYear = function(value) { - var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : - (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : - parseInt(value, 10))); - return (isNaN(year) ? thisYear : year); - }; - var year = determineYear(years[0]); - var endYear = Math.max(year, determineYear(years[1] || '')); - year = (minDate ? Math.max(year, minDate.getFullYear()) : year); - endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); - inst.yearshtml += ''; - - html += inst.yearshtml; - inst.yearshtml = null; } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); } - html += this._get(inst, 'yearSuffix'); - if (showMonthAfterYear) - html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; - html += '
    '; // Close datepicker_header - return html; - }, - /* Adjust one of the date sub-fields. */ - _adjustInstDate: function(inst, offset, period) { - var year = inst.drawYear + (period == 'Y' ? offset : 0); - var month = inst.drawMonth + (period == 'M' ? offset : 0); - var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + - (period == 'D' ? offset : 0); - var date = this._restrictMinMax(inst, - this._daylightSavingAdjust(new Date(year, month, day))); - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); - if (period == 'M' || period == 'Y') - this._notifyChange(inst); + return this; }, - /* Ensure a date is within any min/max bounds. */ - _restrictMinMax: function(inst, date) { - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - var newDate = (minDate && date < minDate ? minDate : date); - newDate = (maxDate && newDate > maxDate ? maxDate : newDate); - return newDate; - }, + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } - /* Notify change of month/year. */ - _notifyChange: function(inst) { - var onChange = this._get(inst, 'onChangeMonthYear'); - if (onChange) - onChange.apply((inst.input ? inst.input[0] : null), - [inst.selectedYear, inst.selectedMonth + 1, inst]); + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; }, - /* Determine the number of months to show. */ - _getNumberOfMonths: function(inst) { - var numMonths = this._get(inst, 'numberOfMonths'); - return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; }, - /* Determine the current maximum date - ensure no time components are set. */ - _getMinMaxDate: function(inst, minMax) { - return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; }, - /* Find the number of days in a given month. */ - _getDaysInMonth: function(year, month) { - return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; }, - /* Find the day of the week of the first of a month. */ - _getFirstDayOfMonth: function(year, month) { - return new Date(year, month, 1).getDay(); + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; }, - /* Determines if we should allow a "next/prev" month display change. */ - _canAdjustMonth: function(inst, offset, curYear, curMonth) { - var numMonths = this._getNumberOfMonths(inst); - var date = this._daylightSavingAdjust(new Date(curYear, - curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); - if (offset < 0) - date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); - return this._isInRange(inst, date); + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; }, - /* Is the given date in the accepted range? */ - _isInRange: function(inst, date) { - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - return ((!minDate || date.getTime() >= minDate.getTime()) && - (!maxDate || date.getTime() <= maxDate.getTime())); + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; }, - /* Provide the configuration settings for formatting/parsing. */ - _getFormatConfig: function(inst) { - var shortYearCutoff = this._get(inst, 'shortYearCutoff'); - shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : - new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); - return {shortYearCutoff: shortYearCutoff, - dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), - monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; }, - /* Format the given date for display. */ - _formatDate: function(inst, day, month, year) { - if (!day) { - inst.currentDay = inst.selectedDay; - inst.currentMonth = inst.selectedMonth; - inst.currentYear = inst.selectedYear; - } - var date = (day ? (typeof day == 'object' ? day : - this._daylightSavingAdjust(new Date(year, month, day))) : - this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); - return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + length: function() { + return this.anchors.length; } }); +$.extend( $.ui.tabs, { + version: "1.8.16" +}); + /* - * Bind hover events for datepicker elements. - * Done via delegate so the binding only occurs once in the lifetime of the parent div. - * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. - */ -function bindHover(dpDiv) { - var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; - return dpDiv.bind('mouseout', function(event) { - var elem = $( event.target ).closest( selector ); - if ( !elem.length ) { - return; - } - elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); - }) - .bind('mouseover', function(event) { - var elem = $( event.target ).closest( selector ); - if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || - !elem.length ) { - return; + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); } - elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); - elem.addClass('ui-state-hover'); - if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); - if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); }); -} -/* jQuery extend now ignores nulls! */ -function extendRemove(target, props) { - $.extend(target, props); - for (var name in props) - if (props[name] == null || props[name] == undefined) - target[name] = props[name]; - return target; -}; + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + t = o.selected; + rotate(); + }); -/* Determine whether an object is an array. */ -function isArray(a) { - return (a && (($.browser.safari && typeof a == 'object' && a.length) || - (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); -}; + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } -/* Invoke the datepicker functionality. - @param options string - a command, optionally followed by additional parameters or - Object - settings for attaching new datepicker functionality - @return jQuery object */ -$.fn.datepicker = function(options){ - - /* Verify an empty collection wasn't passed - Fixes #6976 */ - if ( !this.length ) { return this; } +}); + +})( jQuery ); +/* + * jQuery UI Datepicker 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.16" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); +var instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = bindHover($('
    ')); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', - /* Initialise the date picker. */ - if (!$.datepicker.initialized) { - $(document).mousedown($.datepicker._checkExternalClick). - find('body').append($.datepicker.dpDiv); - $.datepicker.initialized = true; - } + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, - var otherArgs = Array.prototype.slice.call(arguments, 1); - if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) - return $.datepicker['_' + options + 'Datepicker']. - apply($.datepicker, [this[0]].concat(otherArgs)); - if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') - return $.datepicker['_' + options + 'Datepicker']. - apply($.datepicker, [this[0]].concat(otherArgs)); - return this.each(function() { - typeof options == 'string' ? - $.datepicker['_' + options + 'Datepicker']. - apply($.datepicker, [this].concat(otherArgs)) : - $.datepicker._attachDatepicker(this, options); - }); -}; + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, -$.datepicker = new Datepicker(); // singleton instance -$.datepicker.initialized = false; -$.datepicker.uuid = new Date().getTime(); -$.datepicker.version = "1.8.14"; + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, -// Workaround for #4055 -// Add another global to avoid noConflict issues with inline event handlers -window['DP_jQuery_' + dpuuid] = $; + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, -})(jQuery); -/* - * jQuery UI Dialog 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.button.js - * jquery.ui.draggable.js - * jquery.ui.mouse.js - * jquery.ui.position.js - * jquery.ui.resizable.js - */ -(function( $, undefined ) { + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($('
    ')))}; + }, -var uiDialogClasses = - 'ui-dialog ' + - 'ui-widget ' + - 'ui-widget-content ' + - 'ui-corner-all ', - sizeRelatedOptions = { - buttons: true, - height: true, - maxHeight: true, - maxWidth: true, - minHeight: true, - minWidth: true, - width: true + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } }, - resizableRelatedOptions = { - maxHeight: true, - maxWidth: true, - minHeight: true, - minWidth: true + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('' + appendText + ''); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } }, - // support for jQuery 1.3.2 - handle common attrFn methods for dialog - attrFn = $.attrFn || { - val: true, - css: true, - html: true, - text: true, - data: true, - width: true, - height: true, - offset: true, - click: true - }; -$.widget("ui.dialog", { - options: { - autoOpen: true, - buttons: {}, - closeOnEscape: true, - closeText: 'close', - dialogClass: '', - draggable: true, - hide: null, - height: 'auto', - maxHeight: false, - maxWidth: false, - minHeight: 150, - minWidth: 150, - modal: false, - position: { - my: 'center', - at: 'center', - collision: 'fit', - // ensure that the titlebar is never outside the document - using: function(pos) { - var topOffset = $(this).css(pos).offset().top; - if (topOffset < 0) { - $(this).css('top', pos.top - topOffset); - } + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); } - }, - resizable: true, - show: null, - stack: true, - title: '', - width: 300, - zIndex: 1000 + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); }, - _create: function() { - this.originalTitle = this.element.attr('title'); - // #5742 - .attr() might return a DOMElement - if ( typeof this.originalTitle !== "string" ) { - this.originalTitle = ""; + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $(''); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); - this.options.title = this.options.title || this.originalTitle; - var self = this, - options = self.options, - - title = options.title || ' ', - titleId = $.ui.dialog.getTitleId(self.element), - - uiDialog = (self.uiDialog = $('
    ')) - .appendTo(document.body) - .hide() - .addClass(uiDialogClasses + options.dialogClass) - .css({ - zIndex: options.zIndex - }) - // setting tabIndex makes the div focusable - // setting outline to 0 prevents a border on focus in Mozilla - .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { - if (options.closeOnEscape && event.keyCode && - event.keyCode === $.ui.keyCode.ESCAPE) { - - self.close(event); - event.preventDefault(); - } - }) - .attr({ - role: 'dialog', - 'aria-labelledby': titleId - }) - .mousedown(function(event) { - self.moveToTop(false, event); - }), - - uiDialogContent = self.element - .show() - .removeAttr('title') - .addClass( - 'ui-dialog-content ' + - 'ui-widget-content') - .appendTo(uiDialog), + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } - uiDialogTitlebar = (self.uiDialogTitlebar = $('
    ')) - .addClass( - 'ui-dialog-titlebar ' + - 'ui-widget-header ' + - 'ui-corner-all ' + - 'ui-helper-clearfix' - ) - .prependTo(uiDialog), + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, - uiDialogTitlebarClose = $('') - .addClass( - 'ui-dialog-titlebar-close ' + - 'ui-corner-all' - ) - .attr('role', 'button') - .hover( - function() { - uiDialogTitlebarClose.addClass('ui-state-hover'); - }, - function() { - uiDialogTitlebarClose.removeClass('ui-state-hover'); - } - ) - .focus(function() { - uiDialogTitlebarClose.addClass('ui-state-focus'); - }) - .blur(function() { - uiDialogTitlebarClose.removeClass('ui-state-focus'); - }) - .click(function(event) { - self.close(event); - return false; - }) - .appendTo(uiDialogTitlebar), + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, - uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) - .addClass( - 'ui-icon ' + - 'ui-icon-closethick' - ) - .text(options.closeText) - .appendTo(uiDialogTitlebarClose), + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, - uiDialogTitle = $('') - .addClass('ui-dialog-title') - .attr('id', titleId) - .html(title) - .prependTo(uiDialogTitlebar); + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, - //handling of deprecated beforeclose (vs beforeClose) option - //Ticket #4669 http://dev.jqueryui.com/ticket/4669 - //TODO: remove in 1.9pre - if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { - options.beforeClose = options.beforeclose; + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; } + return false; + }, - uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, - if (options.draggable && $.fn.draggable) { - self._makeDraggable(); + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); } - if (options.resizable && $.fn.resizable) { - self._makeResizable(); + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); } + }, - self._createButtons(options.buttons); - self._isOpen = false; + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, - if ($.fn.bgiframe) { - uiDialog.bgiframe(); + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); } }, - _init: function() { - if ( this.options.autoOpen ) { - this.open(); + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); } }, - destroy: function() { - var self = this; - - if (self.overlay) { - self.overlay.destroy(); - } - self.uiDialog.hide(); - self.element - .unbind('.dialog') - .removeData('dialog') - .removeClass('ui-dialog-content ui-widget-content') - .hide().appendTo('body'); - self.uiDialog.remove(); + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, - if (self.originalTitle) { - self.element.attr('title', self.originalTitle); + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); } + }, - return self; + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } }, - widget: function() { - return this.uiDialog; + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (event) { + $.datepicker.log(event); + } + } + return true; }, - close: function(event) { - var self = this, - maxZ, thisZ; - - if (false === self._trigger('beforeClose', event)) { + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + if ( $.datepicker._datepickerShowing ) { + $.datepicker._triggerOnClose($.datepicker._curInst); + } + $.datepicker._curInst.dpDiv.stop(true, true); + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false return; } - - if (self.overlay) { - self.overlay.destroy(); + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height } - self.uiDialog.unbind('keypress.ui-dialog'); - - self._isOpen = false; - - if (self.options.hide) { - self.uiDialog.hide(self.options.hide, function() { - self._trigger('close', event); - }); - } else { - self.uiDialog.hide(); - self._trigger('close', event); + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; } + }, - $.ui.dialog.overlay.resize(); - - // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) - if (self.options.modal) { - maxZ = 0; - $('.ui-dialog').each(function() { - if (this !== self.uiDialog[0]) { - thisZ = $(this).css('z-index'); - if(!isNaN(thisZ)) { - maxZ = Math.max(maxZ, thisZ); - } + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); } - }); - $.ui.dialog.maxZ = maxZ; + origyearshtml = inst.yearshtml = null; + }, 0); } - - return self; }, - isOpen: function() { - return this._isOpen; + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; }, - // the force parameter allows us to move modal dialogs to their correct - // position on open - moveToTop: function(force, event) { - var self = this, - options = self.options, - saveScroll; - - if ((options.modal && !force) || - (!options.stack && !options.modal)) { - return self._trigger('focus', event); - } + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); - if (options.zIndex > $.ui.dialog.maxZ) { - $.ui.dialog.maxZ = options.zIndex; - } - if (self.overlay) { - $.ui.dialog.maxZ += 1; - self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); - } + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; - //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. - // http://ui.jquery.com/bugs/ticket/3193 - saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') }; - $.ui.dialog.maxZ += 1; - self.uiDialog.css('z-index', $.ui.dialog.maxZ); - self.element.attr(saveScroll); - self._trigger('focus', event); + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); - return self; + return offset; }, - open: function() { - if (this._isOpen) { return; } - - var self = this, - options = self.options, - uiDialog = self.uiDialog; - - self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; - self._size(); - self._position(options.position); - uiDialog.show(options.show); - self.moveToTop(true); - - // prevent tabbing out of modal dialogs - if (options.modal) { - uiDialog.bind('keypress.ui-dialog', function(event) { - if (event.keyCode !== $.ui.keyCode.TAB) { - return; - } + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, - var tabbables = $(':tabbable', this), - first = tabbables.filter(':first'), - last = tabbables.filter(':last'); + /* Trigger custom callback of onClose. */ + _triggerOnClose: function(inst) { + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + }, - if (event.target === last[0] && !event.shiftKey) { - first.focus(1); - return false; - } else if (event.target === first[0] && event.shiftKey) { - last.focus(1); - return false; + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + this._curInst = null; + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + $.datepicker._triggerOnClose(inst); + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); } - }); + } + this._inDialog = false; } - - // set focus to the first tabbable element in the content area or the first button - // if there are no tabbable elements, set focus on the dialog itself - $(self.element.find(':tabbable').get().concat( - uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( - uiDialog.get()))).eq(0).focus(); - - self._isOpen = true; - self._trigger('open'); - - return self; }, - _createButtons: function(buttons) { - var self = this, - hasButtons = false, - uiDialogButtonPane = $('
    ') - .addClass( - 'ui-dialog-buttonpane ' + - 'ui-widget-content ' + - 'ui-helper-clearfix' - ), - uiButtonSet = $( "
    " ) - .addClass( "ui-dialog-buttonset" ) - .appendTo( uiDialogButtonPane ); - - // if we already have a button pane, remove it - self.uiDialog.find('.ui-dialog-buttonpane').remove(); + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, - if (typeof buttons === 'object' && buttons !== null) { - $.each(buttons, function() { - return !(hasButtons = true); - }); - } - if (hasButtons) { - $.each(buttons, function(name, props) { - props = $.isFunction( props ) ? - { click: props, text: name } : - props; - var button = $('') - .click(function() { - props.click.apply(self.element[0], arguments); - }) - .appendTo(uiButtonSet); - // can't use .attr( props, true ) with jQuery 1.3.2. - $.each( props, function( key, value ) { - if ( key === "click" ) { - return; - } - if ( key in attrFn ) { - button[ key ]( value ); - } else { - button.attr( key, value ); - } - }); - if ($.fn.button) { - button.button(); - } - }); - uiDialogButtonPane.appendTo(self.uiDialog); - } + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if ($target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(); }, - _makeDraggable: function() { - var self = this, - options = self.options, - doc = $(document), - heightBeforeDrag; - - function filteredUi(ui) { - return { - position: ui.position, - offset: ui.offset - }; + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, - self.uiDialog.draggable({ - cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', - handle: '.ui-dialog-titlebar', - containment: 'document', - start: function(event, ui) { - heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); - $(this).height($(this).height()).addClass("ui-dialog-dragging"); - self._trigger('dragStart', event, filteredUi(ui)); - }, - drag: function(event, ui) { - self._trigger('drag', event, filteredUi(ui)); - }, - stop: function(event, ui) { - options.position = [ui.position.left - doc.scrollLeft(), - ui.position.top - doc.scrollTop()]; - $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); - self._trigger('dragStop', event, filteredUi(ui)); - $.ui.dialog.overlay.resize(); - } - }); + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); }, - _makeResizable: function(handles) { - handles = (handles === undefined ? this.options.resizable : handles); - var self = this, - options = self.options, - // .ui-resizable has position: relative defined in the stylesheet - // but dialogs have to use absolute or fixed positioning - position = self.uiDialog.css('position'), - resizeHandles = (typeof handles === 'string' ? - handles : - 'n,e,s,w,se,sw,ne,nw' - ); + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, - function filteredUi(ui) { - return { - originalPosition: ui.originalPosition, - originalSize: ui.originalSize, - position: ui.position, - size: ui.size - }; + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, - self.uiDialog.resizable({ - cancel: '.ui-dialog-content', - containment: 'document', - alsoResize: self.element, - maxWidth: options.maxWidth, - maxHeight: options.maxHeight, - minWidth: options.minWidth, - minHeight: self._minHeight(), - handles: resizeHandles, - start: function(event, ui) { - $(this).addClass("ui-dialog-resizing"); - self._trigger('resizeStart', event, filteredUi(ui)); - }, - resize: function(event, ui) { - self._trigger('resize', event, filteredUi(ui)); - }, - stop: function(event, ui) { - $(this).removeClass("ui-dialog-resizing"); - options.height = $(this).height(); - options.width = $(this).width(); - self._trigger('resizeStop', event, filteredUi(ui)); - $.ui.dialog.overlay.resize(); - } - }) - .css('position', position) - .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); }, - _minHeight: function() { - var options = this.options; + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, - if (options.height === 'auto') { - return options.minHeight; - } else { - return Math.min(options.minHeight, options.height); + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); } }, - _position: function(position) { - var myAt = [], - offset = [0, 0], - isVisible; + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, - if (position) { - // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( - // if (typeof position == 'string' || $.isArray(position)) { - // myAt = $.isArray(position) ? position : position.split(' '); + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, - if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { - myAt = position.split ? position.split(' ') : [position[0], position[1]]; - if (myAt.length === 1) { - myAt[1] = myAt[0]; + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); } - - $.each(['left', 'top'], function(i, offsetPosition) { - if (+myAt[i] === myAt[i]) { - offset[i] = myAt[i]; - myAt[i] = offsetPosition; - } - }); - - position = { - my: myAt.join(" "), - at: myAt.join(" "), - offset: offset.join(" ") - }; - } - - position = $.extend({}, $.ui.dialog.prototype.options.position, position); - } else { - position = $.ui.dialog.prototype.options.position; } - - // need to show the dialog to get the actual offset in the position plugin - isVisible = this.uiDialog.is(':visible'); - if (!isVisible) { - this.uiDialog.show(); + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); } - this.uiDialog - // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 - .css({ top: 0, left: 0 }) - .position($.extend({ of: window }, position)); - if (!isVisible) { - this.uiDialog.hide(); + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; }, - _setOptions: function( options ) { - var self = this, - resizableOptions = {}, - resize = false; + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 - $.each( options, function( key, value ) { - self._setOption( key, value ); - - if ( key in sizeRelatedOptions ) { - resize = true; - } - if ( key in resizableRelatedOptions ) { - resizableOptions[ key ] = value; - } - }); + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), - if ( resize ) { - this._size(); - } - if ( this.uiDialog.is( ":data(resizable)" ) ) { - this.uiDialog.resizable( "option", resizableOptions ); - } + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; }, - _setOption: function(key, value){ - var self = this, - uiDialog = self.uiDialog; - - switch (key) { - //handling of deprecated beforeclose (vs beforeClose) option - //Ticket #4669 http://dev.jqueryui.com/ticket/4669 - //TODO: remove in 1.9pre - case "beforeclose": - key = "beforeClose"; - break; - case "buttons": - self._createButtons(value); - break; - case "closeText": - // ensure that we always pass a string - self.uiDialogTitlebarCloseText.text("" + value); - break; - case "dialogClass": - uiDialog - .removeClass(self.options.dialogClass) - .addClass(uiDialogClasses + value); - break; - case "disabled": - if (value) { - uiDialog.addClass('ui-dialog-disabled'); - } else { - uiDialog.removeClass('ui-dialog-disabled'); - } - break; - case "draggable": - var isDraggable = uiDialog.is( ":data(draggable)" ); - if ( isDraggable && !value ) { - uiDialog.draggable( "destroy" ); - } - - if ( !isDraggable && value ) { - self._makeDraggable(); - } - break; - case "position": - self._position(value); - break; - case "resizable": - // currently resizable, becoming non-resizable - var isResizable = uiDialog.is( ":data(resizable)" ); - if (isResizable && !value) { - uiDialog.resizable('destroy'); - } - - // currently resizable, changing handles - if (isResizable && typeof value === 'string') { - uiDialog.resizable('option', 'handles', value); - } - - // currently non-resizable, becoming resizable - if (!isResizable && value !== false) { - self._makeResizable(value); + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); } - break; - case "title": - // convert whatever was passed in o a string, for html() to not throw up - $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); - break; - } - - $.Widget.prototype._setOption.apply(self, arguments); + return chars; }, - _size: function() { - /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content - * divs will both have width and height set, so we need to reset them - */ - var options = this.options, - nonContentHeight, - minContentHeight, - isVisible = this.uiDialog.is( ":visible" ); - - // reset content sizing - this.element.show().css({ - width: 'auto', - minHeight: 0, - height: 0 - }); - - if (options.minWidth > options.width) { - options.width = options.minWidth; - } - - // reset wrapper sizing - // determine the height of all the non-content elements - nonContentHeight = this.uiDialog.css({ - height: 'auto', - width: options.width - }) - .height(); - minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); - - if ( options.height === "auto" ) { - // only needed for IE6 support - if ( $.support.minHeight ) { - this.element.css({ - minHeight: minContentHeight, - height: "auto" - }); - } else { - this.uiDialog.show(); - var autoHeight = this.element.css( "height", "auto" ).height(); - if ( !isVisible ) { - this.uiDialog.hide(); - } - this.element.height( Math.max( autoHeight, minContentHeight ) ); - } - } else { - this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); - } + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, - if (this.uiDialog.is(':data(resizable)')) { - this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; } - } -}); - -$.extend($.ui.dialog, { - version: "1.8.14", - - uuid: 0, - maxZ: 0, - - getTitleId: function($el) { - var id = $el.attr('id'); - if (!id) { - this.uuid += 1; - id = this.uuid; + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); } - return 'ui-dialog-title-' + id; + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); }, - overlay: function(dialog) { - this.$el = $.ui.dialog.overlay.create(dialog); - } -}); - -$.extend($.ui.dialog.overlay, { - instances: [], - // reuse old instances due to IE memory leak with alpha transparency (see #5185) - oldInstances: [], - maxZ: 0, - events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), - function(event) { return event + '.dialog-overlay'; }).join(' '), - create: function(dialog) { - if (this.instances.length === 0) { - // prevent use of anchors and inputs - // we use a setTimeout in case the overlay is created from an - // event that we're going to be cancelling (see #2804) - setTimeout(function() { - // handle $(el).dialog().dialog('close') (see #4065) - if ($.ui.dialog.overlay.instances.length) { - $(document).bind($.ui.dialog.overlay.events, function(event) { - // stop events if the z-index of the target is < the z-index of the overlay - // we cannot return true when we don't want to cancel the event (#3523) - if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { - return false; - } - }); - } - }, 1); + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, - // allow closing by pressing the escape key - $(document).bind('keydown.dialog-overlay', function(event) { - if (dialog.options.closeOnEscape && event.keyCode && - event.keyCode === $.ui.keyCode.ESCAPE) { - - dialog.close(event); - event.preventDefault(); + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; } - }); - - // handle window resize - $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); } + return this._daylightSavingAdjust(newDate); + }, - var $el = (this.oldInstances.pop() || $('
    ').addClass('ui-widget-overlay')) - .appendTo(document.body) - .css({ - width: this.width(), - height: this.height() - }); + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, - if ($.fn.bgiframe) { - $el.bgiframe(); + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); } + }, - this.instances.push($el); - return $el; + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; }, - destroy: function($el) { - var indexOf = $.inArray($el, this.instances); - if (indexOf != -1){ - this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; } - - if (this.instances.length === 0) { - $([document, window]).unbind('.dialog-overlay'); + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } } - - $el.remove(); - - // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) - var maxZ = 0; - $.each(this.instances, function() { - maxZ = Math.max(maxZ, this.css('z-index')); - }); - this.maxZ = maxZ; - }, - - height: function() { - var scrollHeight, - offsetHeight; - // handle IE 6 - if ($.browser.msie && $.browser.version < 7) { - scrollHeight = Math.max( - document.documentElement.scrollHeight, - document.body.scrollHeight - ); - offsetHeight = Math.max( - document.documentElement.offsetHeight, - document.body.offsetHeight - ); - - if (scrollHeight < offsetHeight) { - return $(window).height() + 'px'; - } else { - return scrollHeight + 'px'; + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
    ' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
    ' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
    '; + } + calender += '
    ' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
    ' + + ''; + var thead = (showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = (!showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
    ' + this._get(inst, 'weekHeader') + '
    ' + + this._get(inst, 'calculateWeek')(printDate) + '' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
    ' + (isMultiMonth ? '
    ' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
    ' : '') : ''); + group += calender; } - // handle "good" browsers - } else { - return $(document).height() + 'px'; + html += group; } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; }, - width: function() { - var scrollWidth, - offsetWidth; - // handle IE - if ( $.browser.msie ) { - scrollWidth = Math.max( - document.documentElement.scrollWidth, - document.body.scrollWidth - ); - offsetWidth = Math.max( - document.documentElement.offsetWidth, - document.body.offsetWidth - ); - - if (scrollWidth < offsetWidth) { - return $(window).width() + 'px'; - } else { - return scrollWidth + 'px'; + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
    '; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; } - }, - - resize: function() { - /* If the dialog is draggable and the user drags it past the - * right edge of the window, the document becomes wider so we - * need to stretch the overlay. If the user then drags the - * dialog back to the left, the document will become narrower, - * so we need to shrink the overlay to the appropriate size. - * This is handled by shrinking the overlay before setting it - * to the full document size. - */ - var $overlays = $([]); - $.each($.ui.dialog.overlay.instances, function() { - $overlays = $overlays.add(this); - }); - - $overlays.css({ - width: 0, - height: 0 - }).css({ - width: $.ui.dialog.overlay.width(), - height: $.ui.dialog.overlay.height() - }); - } -}); - -$.extend($.ui.dialog.overlay.prototype, { - destroy: function() { - $.ui.dialog.overlay.destroy(this.$el); - } -}); - -}(jQuery)); -/* - * jQuery UI Position 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Position - */ -(function( $, undefined ) { - -$.ui = $.ui || {}; - -var horizontalPositions = /left|center|right/, - verticalPositions = /top|center|bottom/, - center = "center", - _position = $.fn.position, - _offset = $.fn.offset; - -$.fn.position = function( options ) { - if ( !options || !options.of ) { - return _position.apply( this, arguments ); - } - - // make a copy, we don't want to modify arguments - options = $.extend( {}, options ); - - var target = $( options.of ), - targetElem = target[0], - collision = ( options.collision || "flip" ).split( " " ), - offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], - targetWidth, - targetHeight, - basePosition; - - if ( targetElem.nodeType === 9 ) { - targetWidth = target.width(); - targetHeight = target.height(); - basePosition = { top: 0, left: 0 }; - // TODO: use $.isWindow() in 1.9 - } else if ( targetElem.setTimeout ) { - targetWidth = target.width(); - targetHeight = target.height(); - basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; - } else if ( targetElem.preventDefault ) { - // force left top to allow flipping - options.at = "left top"; - targetWidth = targetHeight = 0; - basePosition = { top: options.of.pageY, left: options.of.pageX }; - } else { - targetWidth = target.outerWidth(); - targetHeight = target.outerHeight(); - basePosition = target.offset(); - } - - // force my and at to have valid horizontal and veritcal positions - // if a value is missing or invalid, it will be converted to center - $.each( [ "my", "at" ], function() { - var pos = ( options[this] || "" ).split( " " ); - if ( pos.length === 1) { - pos = horizontalPositions.test( pos[0] ) ? - pos.concat( [center] ) : - verticalPositions.test( pos[0] ) ? - [ center ].concat( pos ) : - [ center, center ]; + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ''; + + html += inst.yearshtml; + inst.yearshtml = null; + } } - pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; - pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; - options[ this ] = pos; - }); - - // normalize collision option - if ( collision.length === 1 ) { - collision[ 1 ] = collision[ 0 ]; - } - - // normalize offset option - offset[ 0 ] = parseInt( offset[0], 10 ) || 0; - if ( offset.length === 1 ) { - offset[ 1 ] = offset[ 0 ]; - } - offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '
    '; // Close datepicker_header + return html; + }, - if ( options.at[0] === "right" ) { - basePosition.left += targetWidth; - } else if ( options.at[0] === center ) { - basePosition.left += targetWidth / 2; - } + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, - if ( options.at[1] === "bottom" ) { - basePosition.top += targetHeight; - } else if ( options.at[1] === center ) { - basePosition.top += targetHeight / 2; - } + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, - basePosition.left += offset[ 0 ]; - basePosition.top += offset[ 1 ]; + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, - return this.each(function() { - var elem = $( this ), - elemWidth = elem.outerWidth(), - elemHeight = elem.outerHeight(), - marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, - marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, - collisionWidth = elemWidth + marginLeft + - ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), - collisionHeight = elemHeight + marginTop + - ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), - position = $.extend( {}, basePosition ), - collisionPosition; + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, - if ( options.my[0] === "right" ) { - position.left -= elemWidth; - } else if ( options.my[0] === center ) { - position.left -= elemWidth / 2; - } + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, - if ( options.my[1] === "bottom" ) { - position.top -= elemHeight; - } else if ( options.my[1] === center ) { - position.top -= elemHeight / 2; - } + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, - // prevent fractions (see #5280) - position.left = Math.round( position.left ); - position.top = Math.round( position.top ); + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, - collisionPosition = { - left: position.left - marginLeft, - top: position.top - marginTop - }; + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, - $.each( [ "left", "top" ], function( i, dir ) { - if ( $.ui.position[ collision[i] ] ) { - $.ui.position[ collision[i] ][ dir ]( position, { - targetWidth: targetWidth, - targetHeight: targetHeight, - elemWidth: elemWidth, - elemHeight: elemHeight, - collisionPosition: collisionPosition, - collisionWidth: collisionWidth, - collisionHeight: collisionHeight, - offset: offset, - my: options.my, - at: options.at - }); - } - }); + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, - if ( $.fn.bgiframe ) { - elem.bgiframe(); - } - elem.offset( $.extend( position, { using: options.using } ) ); - }); -}; + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, -$.ui.position = { - fit: { - left: function( position, data ) { - var win = $( window ), - over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); - position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); - }, - top: function( position, data ) { - var win = $( window ), - over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); - position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; } - }, + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); - flip: { - left: function( position, data ) { - if ( data.at[0] === center ) { +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { return; } - var win = $( window ), - over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), - myOffset = data.my[ 0 ] === "left" ? - -data.elemWidth : - data.my[ 0 ] === "right" ? - data.elemWidth : - 0, - atOffset = data.at[ 0 ] === "left" ? - data.targetWidth : - -data.targetWidth, - offset = -2 * data.offset[ 0 ]; - position.left += data.collisionPosition.left < 0 ? - myOffset + atOffset + offset : - over > 0 ? - myOffset + atOffset + offset : - 0; - }, - top: function( position, data ) { - if ( data.at[1] === center ) { + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { return; } - var win = $( window ), - over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), - myOffset = data.my[ 1 ] === "top" ? - -data.elemHeight : - data.my[ 1 ] === "bottom" ? - data.elemHeight : - 0, - atOffset = data.at[ 1 ] === "top" ? - data.targetHeight : - -data.targetHeight, - offset = -2 * data.offset[ 1 ]; - position.top += data.collisionPosition.top < 0 ? - myOffset + atOffset + offset : - over > 0 ? - myOffset + atOffset + offset : - 0; - } - } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; }; -// offset setter from jQuery 1.4 -if ( !$.offset.setOffset ) { - $.offset.setOffset = function( elem, options ) { - // set position first, in-case top/left are set even on static elem - if ( /static/.test( $.curCSS( elem, "position" ) ) ) { - elem.style.position = "relative"; - } - var curElem = $( elem ), - curOffset = curElem.offset(), - curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, - curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, - props = { - top: (options.top - curOffset.top) + curTop, - left: (options.left - curOffset.left) + curLeft - }; - - if ( 'using' in options ) { - options.using.call( elem, props ); - } else { - curElem.css( props ); - } - }; +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; - $.fn.offset = function( options ) { - var elem = this[ 0 ]; - if ( !elem || !elem.ownerDocument ) { return null; } - if ( options ) { - return this.each(function() { - $.offset.setOffset( this, options ); - }); - } - return _offset.call( this ); - }; -} +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; -}( jQuery )); +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.16"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); /* - * jQuery UI Progressbar 1.8.14 + * jQuery UI Progressbar 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. @@ -10299,1431 +10169,1599 @@ $.widget( "ui.progressbar", { }); $.extend( $.ui.progressbar, { - version: "1.8.14" + version: "1.8.16" }); })( jQuery ); /* - * jQuery UI Slider 1.8.14 + * jQuery UI Effects 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * - * http://docs.jquery.com/UI/Slider - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js + * http://docs.jquery.com/UI/Effects/ */ -(function( $, undefined ) { +;jQuery.effects || (function($, undefined) { -// number of pages in a slider -// (how many times can you page up/down to go through the whole range) -var numPages = 5; +$.effects = {}; -$.widget( "ui.slider", $.ui.mouse, { - widgetEventPrefix: "slide", - options: { - animate: false, - distance: 0, - max: 100, - min: 0, - orientation: "horizontal", - range: false, - step: 1, - value: 0, - values: null - }, +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ - _create: function() { - var self = this, - o = this.options, - existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), - handle = "", - handleCount = ( o.values && o.values.length ) || 1, - handles = []; +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } - this._keySliding = false; - this._mouseSliding = false; - this._animateOff = true; - this._handleIndex = null; - this._detectOrientation(); - this._mouseInit(); + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); - this.element - .addClass( "ui-slider" + - " ui-slider-" + this.orientation + - " ui-widget" + - " ui-widget-content" + - " ui-corner-all" + - ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ - this.range = $([]); +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; - if ( o.range ) { - if ( o.range === true ) { - if ( !o.values ) { - o.values = [ this._valueMin(), this._valueMin() ]; - } - if ( o.values.length && o.values.length !== 2 ) { - o.values = [ o.values[0], o.values[0] ]; - } + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; } + } + } + + return newStyle; +} - this.range = $( "
    " ) - .appendTo( this.element ) - .addClass( "ui-slider-range" + - // note: this isn't the most fittingly semantic framework class for this element, - // but worked best visually with a variety of themes - " ui-widget-header" + - ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; } + } + + return styles; +} - for ( var i = existingHandles.length; i < handleCount; i += 1 ) { - handles.push( handle ); +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; } + } - this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + return diff; +} - this.handle = this.handles.eq( 0 ); +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } - this.handles.add( this.range ).filter( "a" ) - .click(function( event ) { - event.preventDefault(); - }) - .hover(function() { - if ( !o.disabled ) { - $( this ).addClass( "ui-state-hover" ); - } - }, function() { - $( this ).removeClass( "ui-state-hover" ); - }) - .focus(function() { - if ( !o.disabled ) { - $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); - $( this ).addClass( "ui-state-focus" ); - } else { - $( this ).blur(); - } - }) - .blur(function() { - $( this ).removeClass( "ui-state-focus" ); - }); + return this.queue(function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('class'); - this.handles.each(function( i ) { - $( this ).data( "index.ui-slider-handle", i ); + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('class', className); - this.handles - .keydown(function( event ) { - var ret = true, - index = $( this ).data( "index.ui-slider-handle" ), - allowed, - curVal, - newVal, - step; - - if ( self.options.disabled ) { - return; - } - - switch ( event.keyCode ) { - case $.ui.keyCode.HOME: - case $.ui.keyCode.END: - case $.ui.keyCode.PAGE_UP: - case $.ui.keyCode.PAGE_DOWN: - case $.ui.keyCode.UP: - case $.ui.keyCode.RIGHT: - case $.ui.keyCode.DOWN: - case $.ui.keyCode.LEFT: - ret = false; - if ( !self._keySliding ) { - self._keySliding = true; - $( this ).addClass( "ui-state-active" ); - allowed = self._start( event, index ); - if ( allowed === false ) { - return; - } - } - break; - } - - step = self.options.step; - if ( self.options.values && self.options.values.length ) { - curVal = newVal = self.values( index ); + that.animate(styleDifference(originalStyle, newStyle), { + queue: false, + duration: duration, + easing: easing, + complete: function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; } else { - curVal = newVal = self.value(); - } - - switch ( event.keyCode ) { - case $.ui.keyCode.HOME: - newVal = self._valueMin(); - break; - case $.ui.keyCode.END: - newVal = self._valueMax(); - break; - case $.ui.keyCode.PAGE_UP: - newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); - break; - case $.ui.keyCode.PAGE_DOWN: - newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); - break; - case $.ui.keyCode.UP: - case $.ui.keyCode.RIGHT: - if ( curVal === self._valueMax() ) { - return; - } - newVal = self._trimAlignValue( curVal + step ); - break; - case $.ui.keyCode.DOWN: - case $.ui.keyCode.LEFT: - if ( curVal === self._valueMin() ) { - return; - } - newVal = self._trimAlignValue( curVal - step ); - break; - } - - self._slide( event, index, newVal ); - - return ret; - - }) - .keyup(function( event ) { - var index = $( this ).data( "index.ui-slider-handle" ); - - if ( self._keySliding ) { - self._keySliding = false; - self._stop( event, index ); - self._change( event, index ); - $( this ).removeClass( "ui-state-active" ); + that.attr('style', originalStyleAttr); } - - }); - - this._refreshValue(); + if (callback) { callback.apply(this, arguments); } + $.dequeue( this ); + } + }); + }); +}; - this._animateOff = false; +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); }, - destroy: function() { - this.handles.remove(); - this.range.remove(); - - this.element - .removeClass( "ui-slider" + - " ui-slider-horizontal" + - " ui-slider-vertical" + - " ui-slider-disabled" + - " ui-widget" + - " ui-widget-content" + - " ui-corner-all" ) - .removeData( "slider" ) - .unbind( ".slider" ); - - this._mouseDestroy(); - - return this; + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); }, - _mouseCapture: function( event ) { - var o = this.options, - position, - normValue, - distance, - closestHandle, - self, - index, - allowed, - offset, - mouseOverHandle; - - if ( o.disabled ) { - return false; - } - - this.elementSize = { - width: this.element.outerWidth(), - height: this.element.outerHeight() - }; - this.elementOffset = this.element.offset(); - - position = { x: event.pageX, y: event.pageY }; - normValue = this._normValueFromMouse( position ); - distance = this._valueMax() - this._valueMin() + 1; - self = this; - this.handles.each(function( i ) { - var thisDistance = Math.abs( normValue - self.values(i) ); - if ( distance > thisDistance ) { - distance = thisDistance; - closestHandle = $( this ); - index = i; + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); } - }); - - // workaround for bug #3736 (if both handles of a range are at 0, - // the first is always used as the one with least distance, - // and moving it is obviously prevented by preventing negative ranges) - if( o.range === true && this.values(1) === o.min ) { - index += 1; - closestHandle = $( this.handles[index] ); + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); } + }, - allowed = this._start( event, index ); - if ( allowed === false ) { - return false; - } - this._mouseSliding = true; + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); - self._handleIndex = index; - closestHandle - .addClass( "ui-state-active" ) - .focus(); - - offset = closestHandle.offset(); - mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); - this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { - left: event.pageX - offset.left - ( closestHandle.width() / 2 ), - top: event.pageY - offset.top - - ( closestHandle.height() / 2 ) - - ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - - ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + - ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) - }; - if ( !this.handles.hasClass( "ui-state-hover" ) ) { - this._slide( event, index, normValue ); +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.16", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); } - this._animateOff = true; - return true; }, - _mouseStart: function( event ) { - return true; + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } }, - _mouseDrag: function( event ) { - var position = { x: event.pageX, y: event.pageY }, - normValue = this._normValueFromMouse( position ); - - this._slide( event, this._handleIndex, normValue ); - - return false; + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; }, - _mouseStop: function( event ) { - this.handles.removeClass( "ui-state-active" ); - this._mouseSliding = false; + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, - this._stop( event, this._handleIndex ); - this._change( event, this._handleIndex ); + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { - this._handleIndex = null; - this._clickOffset = null; - this._animateOff = false; + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } - return false; - }, - - _detectOrientation: function() { - this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; - }, + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('
    ') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }), + active = document.activeElement; - _normValueFromMouse: function( position ) { - var pixelTotal, - pixelMouse, - percentMouse, - valueTotal, - valueMouse; + element.wrap(wrapper); - if ( this.orientation === "horizontal" ) { - pixelTotal = this.elementSize.width; - pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); - } else { - pixelTotal = this.elementSize.height; - pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element - percentMouse = ( pixelMouse / pixelTotal ); - if ( percentMouse > 1 ) { - percentMouse = 1; - } - if ( percentMouse < 0 ) { - percentMouse = 0; - } - if ( this.orientation === "vertical" ) { - percentMouse = 1 - percentMouse; + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); } - valueTotal = this._valueMax() - this._valueMin(); - valueMouse = this._valueMin() + percentMouse * valueTotal; - - return this._trimAlignValue( valueMouse ); + return wrapper.css(props).show(); }, - _start: function( event, index ) { - var uiHash = { - handle: this.handles[ index ], - value: this.value() - }; - if ( this.options.values && this.options.values.length ) { - uiHash.value = this.values( index ); - uiHash.values = this.values(); + removeWrapper: function(element) { + var parent, + active = document.activeElement; + + if (element.parent().is('.ui-effects-wrapper')) { + parent = element.parent().replaceWith(element); + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + return parent; } - return this._trigger( "start", event, uiHash ); + + return element; }, - _slide: function( event, index, newVal ) { - var otherVal, - newValues, - allowed; + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); - if ( this.options.values && this.options.values.length ) { - otherVal = this.values( index ? 0 : 1 ); - if ( ( this.options.values.length === 2 && this.options.range === true ) && - ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) - ) { - newVal = otherVal; - } +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } - if ( newVal !== this.values( index ) ) { - newValues = this.values(); - newValues[ index ] = newVal; - // A slide can be canceled by returning false from the slide callback - allowed = this._trigger( "slide", event, { - handle: this.handles[ index ], - value: newVal, - values: newValues - } ); - otherVal = this.values( index ? 0 : 1 ); - if ( allowed !== false ) { - this.values( index, newVal, true ); - } - } - } else { - if ( newVal !== this.value() ) { - // A slide can be canceled by returning false from the slide callback - allowed = this._trigger( "slide", event, { - handle: this.handles[ index ], - value: newVal - } ); - if ( allowed !== false ) { - this.value( newVal ); - } + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); } } + + return effectMethod.call(this, args2); }, - _stop: function( event, index ) { - var uiHash = { - handle: this.handles[ index ], - value: this.value() - }; - if ( this.options.values && this.options.values.length ) { - uiHash.value = this.values( index ); - uiHash.values = this.values(); + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); } - - this._trigger( "stop", event, uiHash ); }, - _change: function( event, index ) { - if ( !this._keySliding && !this._mouseSliding ) { - var uiHash = { - handle: this.handles[ index ], - value: this.value() - }; - if ( this.options.values && this.options.values.length ) { - uiHash.value = this.values( index ); - uiHash.values = this.values(); - } - - this._trigger( "change", event, uiHash ); + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); } }, - value: function( newValue ) { - if ( arguments.length ) { - this.options.value = this._trimAlignValue( newValue ); - this._refreshValue(); - this._change( null, 0 ); - return; + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); } - - return this._value(); }, - values: function( index, newValue ) { - var vals, - newValues, - i; + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); - if ( arguments.length > 1 ) { - this.options.values[ index ] = this._trimAlignValue( newValue ); - this._refreshValue(); - this._change( null, index ); - return; - } - if ( arguments.length ) { - if ( $.isArray( arguments[ 0 ] ) ) { - vals = this.options.values; - newValues = arguments[ 0 ]; - for ( i = 0; i < vals.length; i += 1 ) { - vals[ i ] = this._trimAlignValue( newValues[ i ] ); - this._change( null, i ); - } - this._refreshValue(); - } else { - if ( this.options.values && this.options.values.length ) { - return this._values( index ); - } else { - return this.value(); - } - } - } else { - return this._values(); - } + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; }, - - _setOption: function( key, value ) { - var i, - valsLength = 0; - - if ( $.isArray( this.options.values ) ) { - valsLength = this.options.values.length; - } - - $.Widget.prototype._setOption.apply( this, arguments ); - - switch ( key ) { - case "disabled": - if ( value ) { - this.handles.filter( ".ui-state-focus" ).blur(); - this.handles.removeClass( "ui-state-hover" ); - this.handles.attr( "disabled", "disabled" ); - this.element.addClass( "ui-disabled" ); - } else { - this.handles.removeAttr( "disabled" ); - this.element.removeClass( "ui-disabled" ); - } - break; - case "orientation": - this._detectOrientation(); - this.element - .removeClass( "ui-slider-horizontal ui-slider-vertical" ) - .addClass( "ui-slider-" + this.orientation ); - this._refreshValue(); - break; - case "value": - this._animateOff = true; - this._refreshValue(); - this._change( null, 0 ); - this._animateOff = false; - break; - case "values": - this._animateOff = true; - this._refreshValue(); - for ( i = 0; i < valsLength; i += 1 ) { - this._change( null, i ); - } - this._animateOff = false; - break; - } + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; }, - - //internal value getter - // _value() returns value trimmed by min and max, aligned by step - _value: function() { - var val = this.options.value; - val = this._trimAlignValue( val ); - - return val; + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; }, - - //internal values getter - // _values() returns array of values trimmed by min and max, aligned by step - // _values( index ) returns single value trimmed by min and max, aligned by step - _values: function( index ) { - var val, - vals, - i; - - if ( arguments.length ) { - val = this.options.values[ index ]; - val = this._trimAlignValue( val ); - - return val; + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; } else { - // .slice() creates a copy of the array - // this copy gets trimmed by min and max and then returned - vals = this.options.values.slice(); - for ( i = 0; i < vals.length; i+= 1) { - vals[ i ] = this._trimAlignValue( vals[ i ] ); - } - - return vals; + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; } }, - - // returns the step-aligned value that val is closest to, between (inclusive) min and max - _trimAlignValue: function( val ) { - if ( val <= this._valueMin() ) { - return this._valueMin(); - } - if ( val >= this._valueMax() ) { - return this._valueMax(); - } - var step = ( this.options.step > 0 ) ? this.options.step : 1, - valModStep = (val - this._valueMin()) % step; - alignValue = val - valModStep; + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); - if ( Math.abs(valModStep) * 2 >= step ) { - alignValue += ( valModStep > 0 ) ? step : ( -step ); - } +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ - // Since JavaScript has problems with large floats, round - // the final value to 5 digits after the decimal point (see #4124) - return parseFloat( alignValue.toFixed(5) ); - }, +})(jQuery); +/* + * jQuery UI Effects Blind 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { - _valueMin: function() { - return this.options.min; - }, +$.effects.blind = function(o) { - _valueMax: function() { - return this.options.max; - }, - - _refreshValue: function() { - var oRange = this.options.range, - o = this.options, - self = this, - animate = ( !this._animateOff ) ? o.animate : false, - valPercent, - _set = {}, - lastValPercent, - value, - valueMin, - valueMax; + return this.queue(function() { - if ( this.options.values && this.options.values.length ) { - this.handles.each(function( i, j ) { - valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; - _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; - $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); - if ( self.options.range === true ) { - if ( self.orientation === "horizontal" ) { - if ( i === 0 ) { - self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); - } - if ( i === 1 ) { - self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); - } - } else { - if ( i === 0 ) { - self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); - } - if ( i === 1 ) { - self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); - } - } - } - lastValPercent = valPercent; - }); - } else { - value = this.value(); - valueMin = this._valueMin(); - valueMax = this._valueMax(); - valPercent = ( valueMax !== valueMin ) ? - ( value - valueMin ) / ( valueMax - valueMin ) * 100 : - 0; - _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; - this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; - if ( oRange === "min" && this.orientation === "horizontal" ) { - this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); - } - if ( oRange === "max" && this.orientation === "horizontal" ) { - this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); - } - if ( oRange === "min" && this.orientation === "vertical" ) { - this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); - } - if ( oRange === "max" && this.orientation === "vertical" ) { - this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); - } - } - } + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction -}); + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift -$.extend( $.ui.slider, { - version: "1.8.14" -}); + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); -}(jQuery)); +}; + +})(jQuery); /* - * jQuery UI Tabs 1.8.14 + * jQuery UI Effects Bounce 1.8.16 * * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * - * http://docs.jquery.com/UI/Tabs + * http://docs.jquery.com/UI/Effects/Bounce * * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js + * jquery.effects.core.js */ (function( $, undefined ) { -var tabId = 0, - listId = 0; +$.effects.bounce = function(o) { -function getNextTabId() { - return ++tabId; -} + return this.queue(function() { -function getNextListId() { - return ++listId; -} + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; -$.widget( "ui.tabs", { - options: { - add: null, - ajaxOptions: null, - cache: false, - cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } - collapsible: false, - disable: null, - disabled: [], - enable: null, - event: "click", - fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } - idPrefix: "ui-tabs-", - load: null, - panelTemplate: "
    ", - remove: null, - select: null, - show: null, - spinner: "Loading…", - tabTemplate: "
  • #{label}
  • " - }, + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE - _create: function() { - this._tabify( true ); - }, + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; - _setOption: function( key, value ) { - if ( key == "selected" ) { - if (this.options.collapsible && value == this.options.selected ) { - return; - } - this.select( value ); + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); } else { - this.options[ key ] = value; - this._tabify(); - } - }, - - _tabId: function( a ) { - return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || - this.options.idPrefix + getNextTabId(); - }, - - _sanitizeSelector: function( hash ) { - // we need this because an id may contain a ":" - return hash.replace( /:/g, "\\:" ); - }, - - _cookie: function() { - var cookie = this.cookie || - ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); - return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); - }, - - _ui: function( tab, panel ) { - return { - tab: tab, - panel: panel, - index: this.anchors.index( tab ) + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); }; - }, - - _cleanup: function() { - // restore all former loading tabs labels - this.lis.filter( ".ui-state-processing" ) - .removeClass( "ui-state-processing" ) - .find( "span:data(label.tabs)" ) - .each(function() { - var el = $( this ); - el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); - }); - }, - - _tabify: function( init ) { - var self = this, - o = this.options, - fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash - - this.list = this.element.find( "ol,ul" ).eq( 0 ); - this.lis = $( " > li:has(a[href])", this.list ); - this.anchors = this.lis.map(function() { - return $( "a", this )[ 0 ]; - }); - this.panels = $( [] ); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); - this.anchors.each(function( i, a ) { - var href = $( a ).attr( "href" ); - // For dynamically created HTML that contains a hash as href IE < 8 expands - // such href to the full page url with hash and then misinterprets tab as ajax. - // Same consideration applies for an added tab with a fragment identifier - // since a[href=#fragment-identifier] does unexpectedly not match. - // Thus normalize href attribute... - var hrefBase = href.split( "#" )[ 0 ], - baseEl; - if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || - ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { - href = a.hash; - a.href = href; - } +}; - // inline tab - if ( fragmentId.test( href ) ) { - self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); - // remote tab - // prevent loading the page itself if href is just "#" - } else if ( href && href !== "#" ) { - // required for restore on destroy - $.data( a, "href.tabs", href ); +})(jQuery); +/* + * jQuery UI Effects Clip 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { - // TODO until #3808 is fixed strip fragment identifier from url - // (IE fails to load from such url) - $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); +$.effects.clip = function(o) { - var id = self._tabId( a ); - a.href = "#" + id; - var $panel = self.element.find( "#" + id ); - if ( !$panel.length ) { - $panel = $( o.panelTemplate ) - .attr( "id", id ) - .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) - .insertAfter( self.panels[ i - 1 ] || self.list ); - $panel.data( "destroy.tabs", true ); - } - self.panels = self.panels.add( $panel ); - // invalid tab href - } else { - o.disabled.push( i ); - } - }); + return this.queue(function() { - // initialization from scratch - if ( init ) { - // attach necessary classes for styling - this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); - this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); - this.lis.addClass( "ui-state-default ui-corner-top" ); - this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; - // Selected tab - // use "selected" option or try to retrieve: - // 1. from fragment identifier in url - // 2. from cookie - // 3. from selected class attribute on
  • - if ( o.selected === undefined ) { - if ( location.hash ) { - this.anchors.each(function( i, a ) { - if ( a.hash == location.hash ) { - o.selected = i; - return false; - } - }); - } - if ( typeof o.selected !== "number" && o.cookie ) { - o.selected = parseInt( self._cookie(), 10 ); - } - if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { - o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); - } - o.selected = o.selected || ( this.lis.length ? 0 : -1 ); - } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release - o.selected = -1; - } + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction - // sanity check - default to first tab... - o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) - ? o.selected - : 0; + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift - // Take disabling tabs via class attribute from HTML - // into account and update option properly. - // A selected tab cannot become disabled. - o.disabled = $.unique( o.disabled.concat( - $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { - return self.lis.index( n ); - }) - ) ).sort(); + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; - if ( $.inArray( o.selected, o.disabled ) != -1 ) { - o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); - } + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); - // highlight selected tab - this.panels.addClass( "ui-tabs-hide" ); - this.lis.removeClass( "ui-tabs-selected ui-state-active" ); - // check for length avoids error when initializing empty list - if ( o.selected >= 0 && this.anchors.length ) { - self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); - this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + }); - // seems to be expected behavior that the show callback is fired - self.element.queue( "tabs", function() { - self._trigger( "show", null, - self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); - }); +}; - this.load( o.selected ); - } +})(jQuery); +/* + * jQuery UI Effects Drop 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { - // clean up to avoid memory leaks in certain versions of IE 6 - // TODO: namespace this event - $( window ).bind( "unload", function() { - self.lis.add( self.anchors ).unbind( ".tabs" ); - self.lis = self.anchors = self.panels = null; - }); - // update selected after add/remove - } else { - o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); - } +$.effects.drop = function(o) { - // update collapsible - // TODO: use .toggleClass() - this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + return this.queue(function() { - // set or update cookie after init and add/remove respectively - if ( o.cookie ) { - this._cookie( o.selected, o.cookie ); - } + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; - // disable tabs - for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { - $( li )[ $.inArray( i, o.disabled ) != -1 && - // TODO: use .toggleClass() - !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); - } + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction - // reset cache if switching from cached to not cached - if ( o.cache === false ) { - this.anchors.removeData( "cache.tabs" ); - } + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift - // remove all handlers before, tabify may run on existing tabs after add or option change - this.lis.add( this.anchors ).unbind( ".tabs" ); + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; - if ( o.event !== "mouseover" ) { - var addState = function( state, el ) { - if ( el.is( ":not(.ui-state-disabled)" ) ) { - el.addClass( "ui-state-" + state ); - } - }; - var removeState = function( state, el ) { - el.removeClass( "ui-state-" + state ); - }; - this.lis.bind( "mouseover.tabs" , function() { - addState( "hover", $( this ) ); - }); - this.lis.bind( "mouseout.tabs", function() { - removeState( "hover", $( this ) ); - }); - this.anchors.bind( "focus.tabs", function() { - addState( "focus", $( this ).closest( "li" ) ); - }); - this.anchors.bind( "blur.tabs", function() { - removeState( "focus", $( this ).closest( "li" ) ); - }); - } + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); - // set up animations - var hideFx, showFx; - if ( o.fx ) { - if ( $.isArray( o.fx ) ) { - hideFx = o.fx[ 0 ]; - showFx = o.fx[ 1 ]; - } else { - hideFx = showFx = o.fx; - } - } + }); - // Reset certain styles left over from animation - // and prevent IE's ClearType bug... - function resetStyle( $el, fx ) { - $el.css( "display", "" ); - if ( !$.support.opacity && fx.opacity ) { - $el[ 0 ].style.removeAttribute( "filter" ); - } - } +}; - // Show a tab... - var showTab = showFx - ? function( clicked, $show ) { - $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); - $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way - .animate( showFx, showFx.duration || "normal", function() { - resetStyle( $show, showFx ); - self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); - }); - } - : function( clicked, $show ) { - $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); - $show.removeClass( "ui-tabs-hide" ); - self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); - }; +})(jQuery); +/* + * jQuery UI Effects Explode 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { - // Hide a tab, $show is optional... - var hideTab = hideFx - ? function( clicked, $hide ) { - $hide.animate( hideFx, hideFx.duration || "normal", function() { - self.lis.removeClass( "ui-tabs-selected ui-state-active" ); - $hide.addClass( "ui-tabs-hide" ); - resetStyle( $hide, hideFx ); - self.element.dequeue( "tabs" ); - }); - } - : function( clicked, $hide, $show ) { - self.lis.removeClass( "ui-tabs-selected ui-state-active" ); - $hide.addClass( "ui-tabs-hide" ); - self.element.dequeue( "tabs" ); - }; +$.effects.explode = function(o) { - // attach tab event handler, unbind to avoid duplicates from former tabifying... - this.anchors.bind( o.event + ".tabs", function() { - var el = this, - $li = $(el).closest( "li" ), - $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), - $show = self.element.find( self._sanitizeSelector( el.hash ) ); + return this.queue(function() { - // If tab is already selected and not collapsible or tab disabled or - // or is already loading or click callback returns false stop here. - // Check if click handler returns false last so that it is not executed - // for a disabled or loading tab! - if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || - $li.hasClass( "ui-state-disabled" ) || - $li.hasClass( "ui-state-processing" ) || - self.panels.filter( ":animated" ).length || - self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { - this.blur(); - return false; - } + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; - o.selected = self.anchors.index( this ); + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); - self.abort(); + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; - // if tab may be closed - if ( o.collapsible ) { - if ( $li.hasClass( "ui-tabs-selected" ) ) { - o.selected = -1; + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } - if ( o.cookie ) { - self._cookie( o.selected, o.cookie ); - } + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { - self.element.queue( "tabs", function() { - hideTab( el, $hide ); - }).dequeue( "tabs" ); + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); - this.blur(); - return false; - } else if ( !$hide.length ) { - if ( o.cookie ) { - self._cookie( o.selected, o.cookie ); - } + $('div.ui-effects-explode').remove(); - self.element.queue( "tabs", function() { - showTab( el, $show ); - }); + }, o.duration || 500); - // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 - self.load( self.anchors.index( this ) ); - this.blur(); - return false; - } - } + }); - if ( o.cookie ) { - self._cookie( o.selected, o.cookie ); - } +}; - // show new tab - if ( $show.length ) { - if ( $hide.length ) { - self.element.queue( "tabs", function() { - hideTab( el, $hide ); - }); - } - self.element.queue( "tabs", function() { - showTab( el, $show ); - }); +})(jQuery); +/* + * jQuery UI Effects Fade 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { - self.load( self.anchors.index( this ) ); - } else { - throw "jQuery UI Tabs: Mismatching fragment identifier."; - } +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); - // Prevent IE from keeping other link focussed when using the back button - // and remove dotted border from clicked link. This is controlled via CSS - // in modern browsers; blur() removes focus from address bar in Firefox - // which can become a usability and annoying problem with tabs('rotate'). - if ( $.browser.msie ) { - this.blur(); + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); } }); + }); +}; - // disable click in any case - this.anchors.bind( "click.tabs", function(){ - return false; - }); - }, +})(jQuery); +/* + * jQuery UI Effects Fold 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { - _getIndex: function( index ) { - // meta-function to give users option to provide a href string instead of a numerical index. - // also sanitizes numerical indexes to valid values. - if ( typeof index == "string" ) { - index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); - } +$.effects.fold = function(o) { - return index; - }, + return this.queue(function() { - destroy: function() { - var o = this.options; + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; - this.abort(); + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; - this.element - .unbind( ".tabs" ) - .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) - .removeData( "tabs" ); + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift - this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; - this.anchors.each(function() { - var href = $.data( this, "href.tabs" ); - if ( href ) { - this.href = href; - } - var $this = $( this ).unbind( ".tabs" ); - $.each( [ "href", "load", "cache" ], function( i, prefix ) { - $this.removeData( prefix + ".tabs" ); - }); + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); }); - this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { - if ( $.data( this, "destroy.tabs" ) ) { - $( this ).remove(); - } else { - $( this ).removeClass([ - "ui-state-default", - "ui-corner-top", - "ui-tabs-selected", - "ui-state-active", - "ui-state-hover", - "ui-state-focus", - "ui-state-disabled", - "ui-tabs-panel", - "ui-widget-content", - "ui-corner-bottom", - "ui-tabs-hide" - ].join( " " ) ); - } - }); + }); - if ( o.cookie ) { - this._cookie( null, o.cookie ); - } +}; - return this; - }, +})(jQuery); +/* + * jQuery UI Effects Highlight 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { - add: function( url, label, index ) { - if ( index === undefined ) { - index = this.anchors.length; +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; } - var self = this, - o = this.options, - $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), - id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; - $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); +})(jQuery); +/* + * jQuery UI Effects Pulsate 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'); + times = ((o.options.times || 5) * 2) - 1; + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } - // try to find an existing element before creating a new one - var $panel = self.element.find( "#" + id ); - if ( !$panel.length ) { - $panel = $( o.panelTemplate ) - .attr( "id", id ) - .data( "destroy.tabs", true ); + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; } - $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); - if ( index >= this.lis.length ) { - $li.appendTo( this.list ); - $panel.appendTo( this.list[ 0 ].parentNode ); - } else { - $li.insertBefore( this.lis[ index ] ); - $panel.insertBefore( this.panels[ index ] ); + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; } - o.disabled = $.map( o.disabled, function( n, i ) { - return n >= index ? ++n : n; + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); }); - this._tabify(); + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; - if ( this.anchors.length == 1 ) { - o.selected = 0; - $li.addClass( "ui-tabs-selected ui-state-active" ); - $panel.removeClass( "ui-tabs-hide" ); - this.element.queue( "tabs", function() { - self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); - }); +})(jQuery); +/* + * jQuery UI Effects Scale 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { - this.load( 0 ); - } +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; - this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); - return this; - }, + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); - remove: function( index ) { - index = this._getIndex( index ); - var o = this.options, - $li = this.lis.eq( index ).remove(), - $panel = this.panels.eq( index ).remove(); + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; - // If selected tab was removed focus tab to the right or - // in case the last tab was removed the tab to the left. - if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { - this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state - o.disabled = $.map( - $.grep( o.disabled, function(n, i) { - return n != index; - }), - function( n, i ) { - return n >= index ? --n : n; - }); + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state - this._tabify(); + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; - this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); - return this; - }, + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; - enable: function( index ) { - index = this._getIndex( index ); - var o = this.options; - if ( $.inArray( index, o.disabled ) == -1 ) { - return; - } + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); - this.lis.eq( index ).removeClass( "ui-state-disabled" ); - o.disabled = $.grep( o.disabled, function( n, i ) { - return n != index; - }); +}; - this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); - return this; - }, +$.effects.size = function(o) { - disable: function( index ) { - index = this._getIndex( index ); - var self = this, o = this.options; - // cannot disable already selected tab - if ( index != o.selected ) { - this.lis.eq( index ).addClass( "ui-state-disabled" ); + return this.queue(function() { - o.disabled.push( index ); - o.disabled.sort(); + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; - this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); - } + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift - return this; - }, + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; - select: function( index ) { - index = this._getIndex( index ); - if ( index == -1 ) { - if ( this.options.collapsible && this.options.selected != -1 ) { - index = this.options.selected; - } else { - return this; + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); } - } - this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); - return this; - }, + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); - load: function( index ) { - index = this._getIndex( index ); - var self = this, - o = this.options, - a = this.anchors.eq( index )[ 0 ], - url = $.data( a, "load.tabs" ); +}; - this.abort(); +})(jQuery); +/* + * jQuery UI Effects Shake 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { - // not remote or from cache - if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { - this.element.dequeue( "tabs" ); - return; - } +$.effects.shake = function(o) { - // load remote from here on - this.lis.eq( index ).addClass( "ui-state-processing" ); + return this.queue(function() { - if ( o.spinner ) { - var span = $( "span", a ); - span.data( "label.tabs", span.html() ).html( o.spinner ); - } + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; - this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { - url: url, - success: function( r, s ) { - self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake - // take care of tab labels - self._cleanup(); + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - if ( o.cache ) { - $.data( a, "cache.tabs", true ); - } + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; - self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); - try { - o.ajaxOptions.success( r, s ); - } - catch ( e ) {} - }, - error: function( xhr, s, e ) { - // take care of tab labels - self._cleanup(); + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); - self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); - try { - // Passing index avoid a race condition when this method is - // called after the user has selected another tab. - // Pass the anchor that initiated this request allows - // loadError to manipulate the tab content panel via $(a.hash) - o.ajaxOptions.error( xhr, s, index, a ); - } - catch ( e ) {} - } - } ) ); +}; - // last, so that load event is fired before show... - self.element.dequeue( "tabs" ); +})(jQuery); +/* + * jQuery UI Effects Slide 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { - return this; - }, +$.effects.slide = function(o) { - abort: function() { - // stop possibly running animations - this.element.queue( [] ); - this.panels.stop( false, true ); + return this.queue(function() { - // "tabs" queue must not contain more than two elements, - // which are the callbacks for the latest clicked tab... - this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; - // terminate pending requests from other tabs - if ( this.xhr ) { - this.xhr.abort(); - delete this.xhr; - } + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction - // take care of tab labels - this._cleanup(); - return this; - }, + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift - url: function( index, url ) { - this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); - return this; - }, + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; - length: function() { - return this.anchors.length; - } -}); + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); -$.extend( $.ui.tabs, { - version: "1.8.14" -}); + }); -/* - * Tabs Extensions - */ +}; +})(jQuery); /* - * Rotate + * jQuery UI Effects Transfer 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js */ -$.extend( $.ui.tabs.prototype, { - rotation: null, - rotate: function( ms, continuing ) { - var self = this, - o = this.options; - - var rotate = self._rotate || ( self._rotate = function( e ) { - clearTimeout( self.rotation ); - self.rotation = setTimeout(function() { - var t = o.selected; - self.select( ++t < self.anchors.length ? t : 0 ); - }, ms ); - - if ( e ) { - e.stopPropagation(); - } - }); - - var stop = self._unrotate || ( self._unrotate = !continuing - ? function(e) { - if (e.clientX) { // in case of a true click - self.rotate(null); - } - } - : function( e ) { - t = o.selected; - rotate(); - }); - - // start rotation - if ( ms ) { - this.element.bind( "tabsshow", rotate ); - this.anchors.bind( o.event + ".tabs", stop ); - rotate(); - // stop rotation - } else { - clearTimeout( self.rotation ); - this.element.unbind( "tabsshow", rotate ); - this.anchors.unbind( o.event + ".tabs", stop ); - delete this._rotate; - delete this._unrotate; - } +(function( $, undefined ) { - return this; - } -}); +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('
    ') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; -})( jQuery ); +})(jQuery); diff --git a/app/assets/javascripts/jquery.colorbox.js b/app/assets/javascripts/jquery.colorbox.js new file mode 100755 index 0000000..a82c6af --- /dev/null +++ b/app/assets/javascripts/jquery.colorbox.js @@ -0,0 +1,888 @@ +// ColorBox v1.3.19 - jQuery lightbox plugin +// (c) 2011 Jack Moore - jacklmoore.com +// License: http://www.opensource.org/licenses/mit-license.php +(function ($, document, window) { + var + // Default settings object. + // See http://jacklmoore.com/colorbox for details. + defaults = { + transition: "elastic", + speed: 300, + width: false, + initialWidth: "600", + innerWidth: false, + maxWidth: false, + height: false, + initialHeight: "450", + innerHeight: false, + maxHeight: false, + scalePhotos: true, + scrolling: true, + inline: false, + html: false, + iframe: false, + fastIframe: true, + photo: false, + href: false, + title: false, + rel: false, + opacity: 0.9, + preloading: true, + current: "image {current} of {total}", + previous: "previous", + next: "next", + close: "close", + open: false, + returnFocus: true, + reposition: true, + loop: true, + slideshow: false, + slideshowAuto: true, + slideshowSpeed: 2500, + slideshowStart: "start slideshow", + slideshowStop: "stop slideshow", + onOpen: false, + onLoad: false, + onComplete: false, + onCleanup: false, + onClosed: false, + overlayClose: true, + escKey: true, + arrowKey: true, + top: false, + bottom: false, + left: false, + right: false, + fixed: false, + data: undefined + }, + + // Abstracting the HTML and event identifiers for easy rebranding + colorbox = 'colorbox', + prefix = 'cbox', + boxElement = prefix + 'Element', + + // Events + event_open = prefix + '_open', + event_load = prefix + '_load', + event_complete = prefix + '_complete', + event_cleanup = prefix + '_cleanup', + event_closed = prefix + '_closed', + event_purge = prefix + '_purge', + + // Special Handling for IE + isIE = !$.support.opacity && !$.support.style, // IE7 & IE8 + isIE6 = isIE && !window.XMLHttpRequest, // IE6 + event_ie6 = prefix + '_IE6', + + // Cached jQuery Object Variables + $overlay, + $box, + $wrap, + $content, + $topBorder, + $leftBorder, + $rightBorder, + $bottomBorder, + $related, + $window, + $loaded, + $loadingBay, + $loadingOverlay, + $title, + $current, + $slideshow, + $next, + $prev, + $close, + $groupControls, + + // Variables for cached values or use across multiple functions + settings, + interfaceHeight, + interfaceWidth, + loadedHeight, + loadedWidth, + element, + index, + photo, + open, + active, + closing, + loadingTimer, + publicMethod, + div = "div", + init; + + // **************** + // HELPER FUNCTIONS + // **************** + + // Convience function for creating new jQuery objects + function $tag(tag, id, css) { + var element = document.createElement(tag); + + if (id) { + element.id = prefix + id; + } + + if (css) { + element.style.cssText = css; + } + + return $(element); + } + + // Determine the next and previous members in a group. + function getIndex(increment) { + var + max = $related.length, + newIndex = (index + increment) % max; + + return (newIndex < 0) ? max + newIndex : newIndex; + } + + // Convert '%' and 'px' values to integers + function setSize(size, dimension) { + return Math.round((/%/.test(size) ? ((dimension === 'x' ? $window.width() : $window.height()) / 100) : 1) * parseInt(size, 10)); + } + + // Checks an href to see if it is a photo. + // There is a force photo option (photo: true) for hrefs that cannot be matched by this regex. + function isImage(url) { + return settings.photo || /\.(gif|png|jpe?g|bmp|ico)((#|\?).*)?$/i.test(url); + } + + // Assigns function results to their respective properties + function makeSettings() { + var i; + settings = $.extend({}, $.data(element, colorbox)); + + for (i in settings) { + if ($.isFunction(settings[i]) && i.slice(0, 2) !== 'on') { // checks to make sure the function isn't one of the callbacks, they will be handled at the appropriate time. + settings[i] = settings[i].call(element); + } + } + + settings.rel = settings.rel || element.rel || 'nofollow'; + settings.href = settings.href || $(element).attr('href'); + settings.title = settings.title || element.title; + + if (typeof settings.href === "string") { + settings.href = $.trim(settings.href); + } + } + + function trigger(event, callback) { + $.event.trigger(event); + if (callback) { + callback.call(element); + } + } + + // Slideshow functionality + function slideshow() { + var + timeOut, + className = prefix + "Slideshow_", + click = "click." + prefix, + start, + stop, + clear; + + if (settings.slideshow && $related[1]) { + start = function () { + $slideshow + .text(settings.slideshowStop) + .unbind(click) + .bind(event_complete, function () { + if (settings.loop || $related[index + 1]) { + timeOut = setTimeout(publicMethod.next, settings.slideshowSpeed); + } + }) + .bind(event_load, function () { + clearTimeout(timeOut); + }) + .one(click + ' ' + event_cleanup, stop); + $box.removeClass(className + "off").addClass(className + "on"); + timeOut = setTimeout(publicMethod.next, settings.slideshowSpeed); + }; + + stop = function () { + clearTimeout(timeOut); + $slideshow + .text(settings.slideshowStart) + .unbind([event_complete, event_load, event_cleanup, click].join(' ')) + .one(click, function () { + publicMethod.next(); + start(); + }); + $box.removeClass(className + "on").addClass(className + "off"); + }; + + if (settings.slideshowAuto) { + start(); + } else { + stop(); + } + } else { + $box.removeClass(className + "off " + className + "on"); + } + } + + function launch(target) { + if (!closing) { + + element = target; + + makeSettings(); + + $related = $(element); + + index = 0; + + if (settings.rel !== 'nofollow') { + $related = $('.' + boxElement).filter(function () { + var relRelated = $.data(this, colorbox).rel || this.rel; + return (relRelated === settings.rel); + }); + index = $related.index(element); + + // Check direct calls to ColorBox. + if (index === -1) { + $related = $related.add(element); + index = $related.length - 1; + } + } + + if (!open) { + open = active = true; // Prevents the page-change action from queuing up if the visitor holds down the left or right keys. + + $box.show(); + + if (settings.returnFocus) { + $(element).blur().one(event_closed, function () { + $(this).focus(); + }); + } + + // +settings.opacity avoids a problem in IE when using non-zero-prefixed-string-values, like '.5' + $overlay.css({"opacity": +settings.opacity, "cursor": settings.overlayClose ? "pointer" : "auto"}).show(); + + // Opens inital empty ColorBox prior to content being loaded. + settings.w = setSize(settings.initialWidth, 'x'); + settings.h = setSize(settings.initialHeight, 'y'); + publicMethod.position(); + + if (isIE6) { + $window.bind('resize.' + event_ie6 + ' scroll.' + event_ie6, function () { + $overlay.css({width: $window.width(), height: $window.height(), top: $window.scrollTop(), left: $window.scrollLeft()}); + }).trigger('resize.' + event_ie6); + } + + trigger(event_open, settings.onOpen); + + $groupControls.add($title).hide(); + + $close.html(settings.close).show(); + } + + publicMethod.load(true); + } + } + + // ColorBox's markup needs to be added to the DOM prior to being called + // so that the browser will go ahead and load the CSS background images. + function appendHTML() { + if (!$box && document.body) { + init = false; + + $window = $(window); + $box = $tag(div).attr({id: colorbox, 'class': isIE ? prefix + (isIE6 ? 'IE6' : 'IE') : ''}).hide(); + $overlay = $tag(div, "Overlay", isIE6 ? 'position:absolute' : '').hide(); + $wrap = $tag(div, "Wrapper"); + $content = $tag(div, "Content").append( + $loaded = $tag(div, "LoadedContent", 'width:0; height:0; overflow:hidden'), + $loadingOverlay = $tag(div, "LoadingOverlay").add($tag(div, "LoadingGraphic")), + $title = $tag(div, "Title"), + $current = $tag(div, "Current"), + $next = $tag(div, "Next"), + $prev = $tag(div, "Previous"), + $slideshow = $tag(div, "Slideshow").bind(event_open, slideshow), + $close = $tag(div, "Close") + ); + + $wrap.append( // The 3x3 Grid that makes up ColorBox + $tag(div).append( + $tag(div, "TopLeft"), + $topBorder = $tag(div, "TopCenter"), + $tag(div, "TopRight") + ), + $tag(div, false, 'clear:left').append( + $leftBorder = $tag(div, "MiddleLeft"), + $content, + $rightBorder = $tag(div, "MiddleRight") + ), + $tag(div, false, 'clear:left').append( + $tag(div, "BottomLeft"), + $bottomBorder = $tag(div, "BottomCenter"), + $tag(div, "BottomRight") + ) + ).find('div div').css({'float': 'left'}); + + $loadingBay = $tag(div, false, 'position:absolute; width:9999px; visibility:hidden; display:none'); + + $groupControls = $next.add($prev).add($current).add($slideshow); + + $(document.body).append($overlay, $box.append($wrap, $loadingBay)); + } + } + + // Add ColorBox's event bindings + function addBindings() { + if ($box) { + if (!init) { + init = true; + + // Cache values needed for size calculations + interfaceHeight = $topBorder.height() + $bottomBorder.height() + $content.outerHeight(true) - $content.height();//Subtraction needed for IE6 + interfaceWidth = $leftBorder.width() + $rightBorder.width() + $content.outerWidth(true) - $content.width(); + loadedHeight = $loaded.outerHeight(true); + loadedWidth = $loaded.outerWidth(true); + + // Setting padding to remove the need to do size conversions during the animation step. + $box.css({"padding-bottom": interfaceHeight, "padding-right": interfaceWidth}); + + // Anonymous functions here keep the public method from being cached, thereby allowing them to be redefined on the fly. + $next.click(function () { + publicMethod.next(); + }); + $prev.click(function () { + publicMethod.prev(); + }); + $close.click(function () { + publicMethod.close(); + }); + $overlay.click(function () { + if (settings.overlayClose) { + publicMethod.close(); + } + }); + + // Key Bindings + $(document).bind('keydown.' + prefix, function (e) { + var key = e.keyCode; + if (open && settings.escKey && key === 27) { + e.preventDefault(); + publicMethod.close(); + } + if (open && settings.arrowKey && $related[1]) { + if (key === 37) { + e.preventDefault(); + $prev.click(); + } else if (key === 39) { + e.preventDefault(); + $next.click(); + } + } + }); + + $('.' + boxElement, document).live('click', function (e) { + // ignore non-left-mouse-clicks and clicks modified with ctrl / command, shift, or alt. + // See: http://jacklmoore.com/notes/click-events/ + if (!(e.which > 1 || e.shiftKey || e.altKey || e.metaKey)) { + e.preventDefault(); + launch(this); + } + }); + } + return true; + } + return false; + } + + // Don't do anything if ColorBox already exists. + if ($.colorbox) { + return; + } + + // Append the HTML when the DOM loads + $(appendHTML); + + + // **************** + // PUBLIC FUNCTIONS + // Usage format: $.fn.colorbox.close(); + // Usage from within an iframe: parent.$.fn.colorbox.close(); + // **************** + + publicMethod = $.fn[colorbox] = $[colorbox] = function (options, callback) { + var $this = this; + + options = options || {}; + + appendHTML(); + + if (addBindings()) { + if (!$this[0]) { + if ($this.selector) { // if a selector was given and it didn't match any elements, go ahead and exit. + return $this; + } + // if no selector was given (ie. $.colorbox()), create a temporary element to work with + $this = $(''); + options.open = true; // assume an immediate open + } + + if (callback) { + options.onComplete = callback; + } + + $this.each(function () { + $.data(this, colorbox, $.extend({}, $.data(this, colorbox) || defaults, options)); + }).addClass(boxElement); + + if (($.isFunction(options.open) && options.open.call($this)) || options.open) { + launch($this[0]); + } + } + + return $this; + }; + + publicMethod.position = function (speed, loadedCallback) { + var + top = 0, + left = 0, + offset = $box.offset(), + scrollTop = $window.scrollTop(), + scrollLeft = $window.scrollLeft(); + + $window.unbind('resize.' + prefix); + + // remove the modal so that it doesn't influence the document width/height + $box.css({top: -9e4, left: -9e4}); + + if (settings.fixed && !isIE6) { + offset.top -= scrollTop; + offset.left -= scrollLeft; + $box.css({position: 'fixed'}); + } else { + top = scrollTop; + left = scrollLeft; + $box.css({position: 'absolute'}); + } + + // keeps the top and left positions within the browser's viewport. + if (settings.right !== false) { + left += Math.max($window.width() - settings.w - loadedWidth - interfaceWidth - setSize(settings.right, 'x'), 0); + } else if (settings.left !== false) { + left += setSize(settings.left, 'x'); + } else { + left += Math.round(Math.max($window.width() - settings.w - loadedWidth - interfaceWidth, 0) / 2); + } + + if (settings.bottom !== false) { + top += Math.max($window.height() - settings.h - loadedHeight - interfaceHeight - setSize(settings.bottom, 'y'), 0); + } else if (settings.top !== false) { + top += setSize(settings.top, 'y'); + } else { + top += Math.round(Math.max($window.height() - settings.h - loadedHeight - interfaceHeight, 0) / 2); + } + + $box.css({top: offset.top, left: offset.left}); + + // setting the speed to 0 to reduce the delay between same-sized content. + speed = ($box.width() === settings.w + loadedWidth && $box.height() === settings.h + loadedHeight) ? 0 : speed || 0; + + // this gives the wrapper plenty of breathing room so it's floated contents can move around smoothly, + // but it has to be shrank down around the size of div#colorbox when it's done. If not, + // it can invoke an obscure IE bug when using iframes. + $wrap[0].style.width = $wrap[0].style.height = "9999px"; + + function modalDimensions(that) { + $topBorder[0].style.width = $bottomBorder[0].style.width = $content[0].style.width = that.style.width; + $content[0].style.height = $leftBorder[0].style.height = $rightBorder[0].style.height = that.style.height; + } + + $box.dequeue().animate({width: settings.w + loadedWidth, height: settings.h + loadedHeight, top: top, left: left}, { + duration: speed, + complete: function () { + modalDimensions(this); + + active = false; + + // shrink the wrapper down to exactly the size of colorbox to avoid a bug in IE's iframe implementation. + $wrap[0].style.width = (settings.w + loadedWidth + interfaceWidth) + "px"; + $wrap[0].style.height = (settings.h + loadedHeight + interfaceHeight) + "px"; + + if (settings.reposition) { + setTimeout(function () { // small delay before binding onresize due to an IE8 bug. + $window.bind('resize.' + prefix, publicMethod.position); + }, 1); + } + + if (loadedCallback) { + loadedCallback(); + } + }, + step: function () { + modalDimensions(this); + } + }); + }; + + publicMethod.resize = function (options) { + if (open) { + options = options || {}; + + if (options.width) { + settings.w = setSize(options.width, 'x') - loadedWidth - interfaceWidth; + } + if (options.innerWidth) { + settings.w = setSize(options.innerWidth, 'x'); + } + $loaded.css({width: settings.w}); + + if (options.height) { + settings.h = setSize(options.height, 'y') - loadedHeight - interfaceHeight; + } + if (options.innerHeight) { + settings.h = setSize(options.innerHeight, 'y'); + } + if (!options.innerHeight && !options.height) { + $loaded.css({height: "auto"}); + settings.h = $loaded.height(); + } + $loaded.css({height: settings.h}); + + publicMethod.position(settings.transition === "none" ? 0 : settings.speed); + } + }; + + publicMethod.prep = function (object) { + if (!open) { + return; + } + + var callback, speed = settings.transition === "none" ? 0 : settings.speed; + + $loaded.remove(); + $loaded = $tag(div, 'LoadedContent').append(object); + + function getWidth() { + settings.w = settings.w || $loaded.width(); + settings.w = settings.mw && settings.mw < settings.w ? settings.mw : settings.w; + return settings.w; + } + function getHeight() { + settings.h = settings.h || $loaded.height(); + settings.h = settings.mh && settings.mh < settings.h ? settings.mh : settings.h; + return settings.h; + } + + $loaded.hide() + .appendTo($loadingBay.show())// content has to be appended to the DOM for accurate size calculations. + .css({width: getWidth(), overflow: settings.scrolling ? 'auto' : 'hidden'}) + .css({height: getHeight()})// sets the height independently from the width in case the new width influences the value of height. + .prependTo($content); + + $loadingBay.hide(); + + // floating the IMG removes the bottom line-height and fixed a problem where IE miscalculates the width of the parent element as 100% of the document width. + //$(photo).css({'float': 'none', marginLeft: 'auto', marginRight: 'auto'}); + + $(photo).css({'float': 'none'}); + + // Hides SELECT elements in IE6 because they would otherwise sit on top of the overlay. + if (isIE6) { + $('select').not($box.find('select')).filter(function () { + return this.style.visibility !== 'hidden'; + }).css({'visibility': 'hidden'}).one(event_cleanup, function () { + this.style.visibility = 'inherit'; + }); + } + + callback = function () { + var preload, i, total = $related.length, iframe, frameBorder = 'frameBorder', allowTransparency = 'allowTransparency', complete, src, img; + + if (!open) { + return; + } + + function removeFilter() { + if (isIE) { + $box[0].style.removeAttribute('filter'); + } + } + + complete = function () { + clearTimeout(loadingTimer); + $loadingOverlay.hide(); + trigger(event_complete, settings.onComplete); + }; + + if (isIE) { + //This fadeIn helps the bicubic resampling to kick-in. + if (photo) { + $loaded.fadeIn(100); + } + } + + $title.html(settings.title).add($loaded).show(); + + if (total > 1) { // handle grouping + if (typeof settings.current === "string") { + $current.html(settings.current.replace('{current}', index + 1).replace('{total}', total)).show(); + } + + $next[(settings.loop || index < total - 1) ? "show" : "hide"]().html(settings.next); + $prev[(settings.loop || index) ? "show" : "hide"]().html(settings.previous); + + if (settings.slideshow) { + $slideshow.show(); + } + + // Preloads images within a rel group + if (settings.preloading) { + preload = [ + getIndex(-1), + getIndex(1) + ]; + while (i = $related[preload.pop()]) { + src = $.data(i, colorbox).href || i.href; + if ($.isFunction(src)) { + src = src.call(i); + } + if (isImage(src)) { + img = new Image(); + img.src = src; + } + } + } + } else { + $groupControls.hide(); + } + + if (settings.iframe) { + iframe = $tag('iframe')[0]; + + if (frameBorder in iframe) { + iframe[frameBorder] = 0; + } + if (allowTransparency in iframe) { + iframe[allowTransparency] = "true"; + } + // give the iframe a unique name to prevent caching + iframe.name = prefix + (+new Date()); + if (settings.fastIframe) { + complete(); + } else { + $(iframe).one('load', complete); + } + iframe.src = settings.href; + if (!settings.scrolling) { + iframe.scrolling = "no"; + } + $(iframe).addClass(prefix + 'Iframe').appendTo($loaded).one(event_purge, function () { + iframe.src = "//about:blank"; + }); + } else { + complete(); + } + + if (settings.transition === 'fade') { + $box.fadeTo(speed, 1, removeFilter); + } else { + removeFilter(); + } + }; + + if (settings.transition === 'fade') { + $box.fadeTo(speed, 0, function () { + publicMethod.position(0, callback); + }); + } else { + publicMethod.position(speed, callback); + } + }; + + publicMethod.load = function (launched) { + var href, setResize, prep = publicMethod.prep; + + active = true; + + photo = false; + + element = $related[index]; + + if (!launched) { + makeSettings(); + } + + trigger(event_purge); + + trigger(event_load, settings.onLoad); + + settings.h = settings.height ? + setSize(settings.height, 'y') - loadedHeight - interfaceHeight : + settings.innerHeight && setSize(settings.innerHeight, 'y'); + + settings.w = settings.width ? + setSize(settings.width, 'x') - loadedWidth - interfaceWidth : + settings.innerWidth && setSize(settings.innerWidth, 'x'); + + // Sets the minimum dimensions for use in image scaling + settings.mw = settings.w; + settings.mh = settings.h; + + // Re-evaluate the minimum width and height based on maxWidth and maxHeight values. + // If the width or height exceed the maxWidth or maxHeight, use the maximum values instead. + if (settings.maxWidth) { + settings.mw = setSize(settings.maxWidth, 'x') - loadedWidth - interfaceWidth; + settings.mw = settings.w && settings.w < settings.mw ? settings.w : settings.mw; + } + if (settings.maxHeight) { + settings.mh = setSize(settings.maxHeight, 'y') - loadedHeight - interfaceHeight; + settings.mh = settings.h && settings.h < settings.mh ? settings.h : settings.mh; + } + + href = settings.href; + + loadingTimer = setTimeout(function () { + $loadingOverlay.show(); + }, 100); + + if (settings.inline) { + // Inserts an empty placeholder where inline content is being pulled from. + // An event is bound to put inline content back when ColorBox closes or loads new content. + $tag(div).hide().insertBefore($(href)[0]).one(event_purge, function () { + $(this).replaceWith($loaded.children()); + }); + prep($(href)); + } else if (settings.iframe) { + // IFrame element won't be added to the DOM until it is ready to be displayed, + // to avoid problems with DOM-ready JS that might be trying to run in that iframe. + prep(" "); + } else if (settings.html) { + prep(settings.html); + } else if (isImage(href)) { + $(photo = new Image()) + .addClass(prefix + 'Photo') + .error(function () { + settings.title = false; + prep($tag(div, 'Error').text('This image could not be loaded')); + }) + .load(function () { + var percent; + photo.onload = null; //stops animated gifs from firing the onload repeatedly. + + if (settings.scalePhotos) { + setResize = function () { + photo.height -= photo.height * percent; + photo.width -= photo.width * percent; + }; + if (settings.mw && photo.width > settings.mw) { + percent = (photo.width - settings.mw) / photo.width; + setResize(); + } + if (settings.mh && photo.height > settings.mh) { + percent = (photo.height - settings.mh) / photo.height; + setResize(); + } + } + + if (settings.h) { + photo.style.marginTop = Math.max(settings.h - photo.height, 0) / 2 + 'px'; + } + + if ($related[1] && (settings.loop || $related[index + 1])) { + photo.style.cursor = 'pointer'; + photo.onclick = function () { + publicMethod.next(); + }; + } + + if (isIE) { + photo.style.msInterpolationMode = 'bicubic'; + } + + setTimeout(function () { // A pause because Chrome will sometimes report a 0 by 0 size otherwise. + prep(photo); + }, 1); + }); + + setTimeout(function () { // A pause because Opera 10.6+ will sometimes not run the onload function otherwise. + photo.src = href; + }, 1); + } else if (href) { + $loadingBay.load(href, settings.data, function (data, status, xhr) { + prep(status === 'error' ? $tag(div, 'Error').text('Request unsuccessful: ' + xhr.statusText) : $(this).contents()); + }); + } + }; + + // Navigates to the next page/image in a set. + publicMethod.next = function () { + if (!active && $related[1] && (settings.loop || $related[index + 1])) { + index = getIndex(1); + publicMethod.load(); + } + }; + + publicMethod.prev = function () { + if (!active && $related[1] && (settings.loop || index)) { + index = getIndex(-1); + publicMethod.load(); + } + }; + + // Note: to use this within an iframe use the following format: parent.$.fn.colorbox.close(); + publicMethod.close = function () { + if (open && !closing) { + + closing = true; + + open = false; + + trigger(event_cleanup, settings.onCleanup); + + $window.unbind('.' + prefix + ' .' + event_ie6); + + $overlay.fadeTo(200, 0); + + $box.stop().fadeTo(300, 0, function () { + + $box.add($overlay).css({'opacity': 1, cursor: 'auto'}).hide(); + + trigger(event_purge); + + $loaded.remove(); + + setTimeout(function () { + closing = false; + trigger(event_closed, settings.onClosed); + }, 1); + }); + } + }; + + // Removes changes ColorBox made to the document, but does not remove the plugin + // from jQuery. + publicMethod.remove = function () { + $([]).add($box).add($overlay).remove(); + $box = null; + $('.' + boxElement) + .removeData(colorbox) + .removeClass(boxElement) + .die(); + }; + + // A method for fetching the current element ColorBox is referencing. + // returns a jQuery object. + publicMethod.element = function () { + return $(element); + }; + + publicMethod.settings = defaults; + +}(jQuery, document, this)); \ No newline at end of file diff --git a/public/javascripts/jquery.cookie.js b/app/assets/javascripts/jquery.cookie.js similarity index 76% rename from public/javascripts/jquery.cookie.js rename to app/assets/javascripts/jquery.cookie.js index 6a3e394..999b855 100644 --- a/public/javascripts/jquery.cookie.js +++ b/app/assets/javascripts/jquery.cookie.js @@ -26,7 +26,7 @@ jQuery.cookie = function (key, value, options) { return (document.cookie = [ encodeURIComponent(key), '=', - options.raw ? value : encodeURIComponent(value), + options.raw ? value : cookie_encode(value), options.expires ? '; expires=' + options.expires.toUTCString() : '', // use expires attribute, max-age is not supported by IE options.path ? '; path=' + options.path : '', options.domain ? '; domain=' + options.domain : '', @@ -39,3 +39,11 @@ jQuery.cookie = function (key, value, options) { var result, decode = options.raw ? function (s) { return s; } : decodeURIComponent; return (result = new RegExp('(?:^|; )' + encodeURIComponent(key) + '=([^;]*)').exec(document.cookie)) ? decode(result[1]) : null; }; + +function cookie_encode(string){ + //full uri decode not only to encode ",; =" but to save uicode charaters + var decoded = encodeURIComponent(string); + //encod back common and allowed charaters {}:"#[] to save space and make the cookies more human readable + var ns = decoded.replace(/(%7B|%7D|%3A|%22|%23|%5B|%5D)/g,function(charater){return decodeURIComponent(charater);}); + return ns; +} diff --git a/public/javascripts/jquery.highlight-3.js b/app/assets/javascripts/jquery.highlight-3.js similarity index 100% rename from public/javascripts/jquery.highlight-3.js rename to app/assets/javascripts/jquery.highlight-3.js diff --git a/public/javascripts/jquery.hotkeys.js b/app/assets/javascripts/jquery.hotkeys.js similarity index 100% rename from public/javascripts/jquery.hotkeys.js rename to app/assets/javascripts/jquery.hotkeys.js diff --git a/public/javascripts/jquery.js b/app/assets/javascripts/jquery.js similarity index 96% rename from public/javascripts/jquery.js rename to app/assets/javascripts/jquery.js index f3201aa..11e6d06 100644 --- a/public/javascripts/jquery.js +++ b/app/assets/javascripts/jquery.js @@ -1,5 +1,5 @@ /*! - * jQuery JavaScript Library v1.6.2 + * jQuery JavaScript Library v1.6.4 * http://jquery.com/ * * Copyright 2011, John Resig @@ -11,7 +11,7 @@ * Copyright 2011, The Dojo Foundation * Released under the MIT, BSD, and GPL Licenses. * - * Date: Thu Jun 30 14:16:56 2011 -0400 + * Date: Mon Sep 12 18:54:48 2011 -0400 */ (function( window, undefined ) { @@ -37,8 +37,8 @@ var jQuery = function( selector, context ) { rootjQuery, // A simple way to check for HTML strings or ID strings - // (both of which we optimize for) - quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + // Prioritize #id over to avoid XSS via location.hash (#9521) + quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, // Check if a string has a non-whitespace character in it rnotwhite = /\S/, @@ -66,11 +66,12 @@ var jQuery = function( selector, context ) { rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, // Matches dashed string for camelizing - rdashAlpha = /-([a-z])/ig, + rdashAlpha = /-([a-z]|[0-9])/ig, + rmsPrefix = /^-ms-/, // Used by jQuery.camelCase as callback to replace() fcamelCase = function( all, letter ) { - return letter.toUpperCase(); + return ( letter + "" ).toUpperCase(); }, // Keep a UserAgent string for use with jQuery.browser @@ -212,7 +213,7 @@ jQuery.fn = jQuery.prototype = { selector: "", // The current version of jQuery being used - jquery: "1.6.2", + jquery: "1.6.4", // The default length of a jQuery object is 0 length: 0, @@ -521,10 +522,15 @@ jQuery.extend({ return false; } - // Not own constructor property must be Object - if ( obj.constructor && - !hasOwn.call(obj, "constructor") && - !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + try { + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 return false; } @@ -574,24 +580,23 @@ jQuery.extend({ }, // Cross-browser xml parsing - // (xml & tmp used internally) - parseXML: function( data , xml , tmp ) { - - if ( window.DOMParser ) { // Standard - tmp = new DOMParser(); - xml = tmp.parseFromString( data , "text/xml" ); - } else { // IE - xml = new ActiveXObject( "Microsoft.XMLDOM" ); - xml.async = "false"; - xml.loadXML( data ); - } - - tmp = xml.documentElement; - - if ( ! tmp || ! tmp.nodeName || tmp.nodeName === "parsererror" ) { + parseXML: function( data ) { + var xml, tmp; + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { jQuery.error( "Invalid XML: " + data ); } - return xml; }, @@ -611,10 +616,10 @@ jQuery.extend({ } }, - // Converts a dashed string to camelCased string; - // Used by both the css and data modules + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) camelCase: function( string ) { - return string.replace( rdashAlpha, fcamelCase ); + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); }, nodeName: function( elem, name ) { @@ -699,6 +704,9 @@ jQuery.extend({ }, inArray: function( elem, array ) { + if ( !array ) { + return -1; + } if ( indexOf ) { return indexOf.call( array, elem ); @@ -1071,7 +1079,7 @@ jQuery.extend({ if ( returned && jQuery.isFunction( returned.promise ) ) { returned.promise().then( newDefer.resolve, newDefer.reject ); } else { - newDefer[ action ]( returned ); + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); } }); } else { @@ -1173,6 +1181,7 @@ jQuery.support = (function() { div.setAttribute("className", "t"); div.innerHTML = "
    a"; + all = div.getElementsByTagName( "*" ); a = div.getElementsByTagName( "a" )[ 0 ]; @@ -1293,13 +1302,14 @@ jQuery.support = (function() { width: 0, height: 0, border: 0, - margin: 0 + margin: 0, + background: "none" }; if ( body ) { jQuery.extend( testElementStyle, { position: "absolute", - left: -1000, - top: -1000 + left: "-1000px", + top: "-1000px" }); } for ( i in testElementStyle ) { @@ -1404,7 +1414,7 @@ jQuery.boxModel = jQuery.support.boxModel; var rbrace = /^(?:\{.*\}|\[.*\])$/, - rmultiDash = /([a-z])([A-Z])/g; + rmultiDash = /([A-Z])/g; jQuery.extend({ cache: {}, @@ -1436,7 +1446,9 @@ jQuery.extend({ return; } - var internalKey = jQuery.expando, getByName = typeof name === "string", thisCache, + var thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", // We have to handle DOM nodes and JS objects differently because IE6-7 // can't GC object references properly across the DOM-JS boundary @@ -1452,7 +1464,7 @@ jQuery.extend({ // Avoid doing any more work than we need to when trying to get data on an // object that has no data at all - if ( (!id || (pvt && id && !cache[ id ][ internalKey ])) && getByName && data === undefined ) { + if ( (!id || (pvt && id && (cache[ id ] && !cache[ id ][ internalKey ]))) && getByName && data === undefined ) { return; } @@ -1511,10 +1523,24 @@ jQuery.extend({ return thisCache[ internalKey ] && thisCache[ internalKey ].events; } - return getByName ? - // Check for both converted-to-camel and non-converted data property names - thisCache[ jQuery.camelCase( name ) ] || thisCache[ name ] : - thisCache; + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; }, removeData: function( elem, name, pvt /* Internal Use Only */ ) { @@ -1522,7 +1548,12 @@ jQuery.extend({ return; } - var internalKey = jQuery.expando, isNode = elem.nodeType, + var thisCache, + + // Reference to internal data cache key + internalKey = jQuery.expando, + + isNode = elem.nodeType, // See jQuery.data for more information cache = isNode ? jQuery.cache : elem, @@ -1537,9 +1568,16 @@ jQuery.extend({ } if ( name ) { - var thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ]; + + thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ]; if ( thisCache ) { + + // Support interoperable removal of hyphenated or camelcased keys + if ( !thisCache[ name ] ) { + name = jQuery.camelCase( name ); + } + delete thisCache[ name ]; // If there is no data left in the cache, we want to continue @@ -1566,7 +1604,8 @@ jQuery.extend({ // Browsers that fail expando deletion also refuse to delete expandos on // the window, but it will allow it on all other JS objects; other browsers // don't care - if ( jQuery.support.deleteExpando || cache != window ) { + // Ensure that `cache` is not a window object #10080 + if ( jQuery.support.deleteExpando || !cache.setInterval ) { delete cache[ id ]; } else { cache[ id ] = null; @@ -1690,7 +1729,8 @@ function dataAttr( elem, key, data ) { // If nothing was found internally, try to fetch any // data from the HTML5 data-* attribute if ( data === undefined && elem.nodeType === 1 ) { - var name = "data-" + key.replace( rmultiDash, "$1-$2" ).toLowerCase(); + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); data = elem.getAttribute( name ); @@ -1910,8 +1950,7 @@ var rclass = /[\n\t\r]/g, rfocusable = /^(?:button|input|object|select|textarea)$/i, rclickable = /^a(?:rea)?$/i, rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, - rinvalidChar = /\:|^on/, - formHook, boolHook; + nodeHook, boolHook; jQuery.fn.extend({ attr: function( name, value ) { @@ -2049,7 +2088,7 @@ jQuery.fn.extend({ hasClass: function( selector ) { var className = " " + selector + " "; for ( var i = 0, l = this.length; i < l; i++ ) { - if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { return true; } } @@ -2229,14 +2268,11 @@ jQuery.extend({ if ( !hooks ) { // Use boolHook for boolean attributes if ( rboolean.test( name ) ) { - hooks = boolHook; - // Use formHook for forms and if the name contains certain characters - } else if ( formHook && name !== "className" && - (jQuery.nodeName( elem, "form" ) || rinvalidChar.test( name )) ) { - - hooks = formHook; + // Use nodeHook if available( IE6/7 ) + } else if ( nodeHook ) { + hooks = nodeHook; } } } @@ -2273,14 +2309,9 @@ jQuery.extend({ var propName; if ( elem.nodeType === 1 ) { name = jQuery.attrFix[ name ] || name; - - if ( jQuery.support.getSetAttribute ) { - // Use removeAttribute in browsers that support it - elem.removeAttribute( name ); - } else { - jQuery.attr( elem, name, "" ); - elem.removeAttributeNode( elem.getAttributeNode( name ) ); - } + + jQuery.attr( elem, name, "" ); + elem.removeAttribute( name ); // Set corresponding property to false for boolean attributes if ( rboolean.test( name ) && (propName = jQuery.propFix[ name ] || name) in elem ) { @@ -2308,33 +2339,20 @@ jQuery.extend({ } } }, - tabIndex: { - get: function( elem ) { - // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set - // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ - var attributeNode = elem.getAttributeNode("tabIndex"); - - return attributeNode && attributeNode.specified ? - parseInt( attributeNode.value, 10 ) : - rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? - 0 : - undefined; - } - }, // Use the value property for back compat - // Use the formHook for button elements in IE6/7 (#1954) + // Use the nodeHook for button elements in IE6/7 (#1954) value: { get: function( elem, name ) { - if ( formHook && jQuery.nodeName( elem, "button" ) ) { - return formHook.get( elem, name ); + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); } return name in elem ? elem.value : null; }, set: function( elem, value, name ) { - if ( formHook && jQuery.nodeName( elem, "button" ) ) { - return formHook.set( elem, value, name ); + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); } // Does not return so that setAttribute is also used elem.value = value; @@ -2383,7 +2401,7 @@ jQuery.extend({ } } else { - if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== undefined ) { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { return ret; } else { @@ -2392,14 +2410,33 @@ jQuery.extend({ } }, - propHooks: {} + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } }); +// Add the tabindex propHook to attrHooks for back-compat +jQuery.attrHooks.tabIndex = jQuery.propHooks.tabIndex; + // Hook for boolean attributes boolHook = { get: function( elem, name ) { // Align boolean attributes with corresponding properties - return jQuery.prop( elem, name ) ? + // Fall back to attribute presence where some booleans are not supported + var attrNode; + return jQuery.prop( elem, name ) === true || ( attrNode = elem.getAttributeNode( name ) ) && attrNode.nodeValue !== false ? name.toLowerCase() : undefined; }, @@ -2425,12 +2462,10 @@ boolHook = { // IE6/7 do not support getting/setting some attributes with get/setAttribute if ( !jQuery.support.getSetAttribute ) { - - // propFix is more comprehensive and contains all fixes - jQuery.attrFix = jQuery.propFix; - // Use this for any attribute on a form in IE6/7 - formHook = jQuery.attrHooks.name = jQuery.attrHooks.title = jQuery.valHooks.button = { + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { get: function( elem, name ) { var ret; ret = elem.getAttributeNode( name ); @@ -2440,13 +2475,13 @@ if ( !jQuery.support.getSetAttribute ) { undefined; }, set: function( elem, value, name ) { - // Check form objects in IE (multiple bugs related) - // Only use nodeValue if the attribute node exists on the form + // Set the existing or create a new attribute node var ret = elem.getAttributeNode( name ); - if ( ret ) { - ret.nodeValue = value; - return value; + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); } + return (ret.nodeValue = value + ""); } }; @@ -2505,6 +2540,7 @@ if ( !jQuery.support.optSelected ) { parent.parentNode.selectedIndex; } } + return null; } }); } @@ -3235,8 +3271,9 @@ if ( !jQuery.support.submitBubbles ) { setup: function( data, namespaces ) { if ( !jQuery.nodeName( this, "form" ) ) { jQuery.event.add(this, "click.specialSubmit", function( e ) { + // Avoid triggering error on non-existent type attribute in IE VML (#7071) var elem = e.target, - type = elem.type; + type = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.type : ""; if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { trigger( "submit", this, arguments ); @@ -3245,7 +3282,7 @@ if ( !jQuery.support.submitBubbles ) { jQuery.event.add(this, "keypress.specialSubmit", function( e ) { var elem = e.target, - type = elem.type; + type = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.type : ""; if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { trigger( "submit", this, arguments ); @@ -3270,7 +3307,8 @@ if ( !jQuery.support.changeBubbles ) { var changeFilters, getVal = function( elem ) { - var type = elem.type, val = elem.value; + var type = jQuery.nodeName( elem, "input" ) ? elem.type : "", + val = elem.value; if ( type === "radio" || type === "checkbox" ) { val = elem.checked; @@ -5295,12 +5333,17 @@ jQuery.fn.extend({ // Determine the position of an element within // the matched set of elements index: function( elem ) { - if ( !elem || typeof elem === "string" ) { - return jQuery.inArray( this[0], - // If it receives a string, the selector is used - // If it receives nothing, the siblings are used - elem ? jQuery( elem ) : this.parent().children() ); + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + // Locate the position of the desired element return jQuery.inArray( // If it receives a jQuery object, the first element is used @@ -6048,7 +6091,10 @@ jQuery.extend({ // with an element if you are cloning the body and one of the // elements on the page has a name or id of "length" for ( i = 0; srcElements[i]; ++i ) { - cloneFixAttributes( srcElements[i], destElements[i] ); + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[i] ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } } } @@ -6248,14 +6294,14 @@ function evalScript( i, elem ) { + var ralpha = /alpha\([^)]*\)/i, ropacity = /opacity=([^)]*)/, // fixed for IE9, see #8346 rupper = /([A-Z]|^ms)/g, rnumpx = /^-?\d+(?:px)?$/i, rnum = /^-?\d/, - rrelNum = /^[+\-]=/, - rrelNumFilter = /[^+\-\.\de]+/g, + rrelNum = /^([\-+])=([\-+.\de]+)/, cssShow = { position: "absolute", visibility: "hidden", display: "block" }, cssWidth = [ "Left", "Right" ], @@ -6332,18 +6378,18 @@ jQuery.extend({ if ( value !== undefined ) { type = typeof value; - // Make sure that NaN and null values aren't set. See: #7116 - if ( type === "number" && isNaN( value ) || value == null ) { - return; - } - // convert relative number strings (+= or -=) to relative numbers. #7345 - if ( type === "string" && rrelNum.test( value ) ) { - value = +value.replace( rrelNumFilter, "" ) + parseFloat( jQuery.css( elem, name ) ); + if ( type === "string" && (ret = rrelNum.exec( value )) ) { + value = ( +( ret[1] + 1) * +ret[2] ) + parseFloat( jQuery.css( elem, name ) ); // Fixes bug #9237 type = "number"; } + // Make sure that NaN and null values aren't set. See: #7116 + if ( value == null || type === "number" && isNaN( value ) ) { + return; + } + // If a number was passed in, add 'px' to the (except for certain CSS properties) if ( type === "number" && !jQuery.cssNumber[ origName ] ) { value += "px"; @@ -6459,18 +6505,29 @@ if ( !jQuery.support.opacity ) { set: function( elem, value ) { var style = elem.style, - currentStyle = elem.currentStyle; + currentStyle = elem.currentStyle, + opacity = jQuery.isNaN( value ) ? "" : "alpha(opacity=" + value * 100 + ")", + filter = currentStyle && currentStyle.filter || style.filter || ""; // IE has trouble with opacity if it does not have layout // Force it by setting the zoom level style.zoom = 1; - // Set the alpha filter to set the opacity - var opacity = jQuery.isNaN( value ) ? - "" : - "alpha(opacity=" + value * 100 + ")", - filter = currentStyle && currentStyle.filter || style.filter || ""; + // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 + if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" ) { + + // Setting style.filter to null, "" & " " still leave "filter:" in the cssText + // if "filter:" is present at all, clearType is disabled, we want to avoid this + // style.removeAttribute is IE Only, but so apparently is this code path... + style.removeAttribute( "filter" ); + // if there there is no filter style applied in a css rule, we are done + if ( currentStyle && !currentStyle.filter ) { + return; + } + } + + // otherwise, set new filter values style.filter = ralpha.test( filter ) ? filter.replace( ralpha, opacity ) : filter + " " + opacity; @@ -6625,9 +6682,9 @@ var r20 = /%20/g, rCRLF = /\r?\n/g, rhash = /#.*$/, rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL - rinput = /^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, // #7653, #8125, #8152: local protocol detection - rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|widget):$/, + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, rnoContent = /^(?:GET|HEAD)$/, rprotocol = /^\/\//, rquery = /\?/, @@ -6662,7 +6719,10 @@ var r20 = /%20/g, ajaxLocation, // Document location segments - ajaxLocParts; + ajaxLocParts, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = ["*/"] + ["*"]; // #8138, IE may throw an exception when accessing // a field from window.location if document.domain has been set @@ -6755,6 +6815,22 @@ function inspectPrefiltersOrTransports( structure, options, originalOptions, jqX return selection; } +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + for( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } +} + jQuery.fn.extend({ load: function( url, params, callback ) { if ( typeof url !== "string" && _load ) { @@ -6898,23 +6974,16 @@ jQuery.extend({ // Creates a full fledged settings object into target // with both ajaxSettings and settings fields. // If target is omitted, writes into ajaxSettings. - ajaxSetup: function ( target, settings ) { - if ( !settings ) { - // Only one parameter, we extend ajaxSettings - settings = target; - target = jQuery.extend( true, jQuery.ajaxSettings, settings ); + ajaxSetup: function( target, settings ) { + if ( settings ) { + // Building a settings object + ajaxExtend( target, jQuery.ajaxSettings ); } else { - // target was provided, we extend into it - jQuery.extend( true, target, jQuery.ajaxSettings, settings ); - } - // Flatten fields we don't want deep extended - for( var field in { context: 1, url: 1 } ) { - if ( field in settings ) { - target[ field ] = settings[ field ]; - } else if( field in jQuery.ajaxSettings ) { - target[ field ] = jQuery.ajaxSettings[ field ]; - } + // Extending ajaxSettings + settings = target; + target = jQuery.ajaxSettings; } + ajaxExtend( target, settings ); return target; }, @@ -6942,7 +7011,7 @@ jQuery.extend({ html: "text/html", text: "text/plain", json: "application/json, text/javascript", - "*": "*/*" + "*": allTypes }, contents: { @@ -6972,6 +7041,15 @@ jQuery.extend({ // Parse text as xml "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + context: true, + url: true } }, @@ -7082,7 +7160,7 @@ jQuery.extend({ // Callback for when everything is done // It is defined here because jslint complains if it is declared // at the end of the function (which would be more logical and readable) - function done( status, statusText, responses, headers ) { + function done( status, nativeStatusText, responses, headers ) { // Called once if ( state === 2 ) { @@ -7105,11 +7183,12 @@ jQuery.extend({ responseHeadersString = headers || ""; // Set readyState - jqXHR.readyState = status ? 4 : 0; + jqXHR.readyState = status > 0 ? 4 : 0; var isSuccess, success, error, + statusText = nativeStatusText, response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined, lastModified, etag; @@ -7161,7 +7240,7 @@ jQuery.extend({ // Set data for the fake xhr object jqXHR.status = status; - jqXHR.statusText = statusText; + jqXHR.statusText = "" + ( nativeStatusText || statusText ); // Success/Error if ( isSuccess ) { @@ -7183,7 +7262,7 @@ jQuery.extend({ completeDeferred.resolveWith( callbackContext, [ jqXHR, statusText ] ); if ( fireGlobals ) { - globalEventContext.trigger( "ajaxComplete", [ jqXHR, s] ); + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); // Handle the global AJAX counter if ( !( --jQuery.active ) ) { jQuery.event.trigger( "ajaxStop" ); @@ -7264,6 +7343,8 @@ jQuery.extend({ // If data is available, append data to url if ( s.data ) { s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + // #9682: remove data so that it's not used in an eventual retry + delete s.data; } // Get ifModifiedKey before adding the anti-cache parameter @@ -7301,7 +7382,7 @@ jQuery.extend({ jqXHR.setRequestHeader( "Accept", s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? - s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", */*; q=0.01" : "" ) : + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : s.accepts[ "*" ] ); @@ -7347,7 +7428,7 @@ jQuery.extend({ transport.send( requestHeaders, done ); } catch (e) { // Propagate exception as error if not done - if ( status < 2 ) { + if ( state < 2 ) { done( -1, e ); // Simply rethrow otherwise } else { @@ -7995,10 +8076,7 @@ var elemdisplay = {}, // opacity animations [ "opacity" ] ], - fxNow, - requestAnimationFrame = window.webkitRequestAnimationFrame || - window.mozRequestAnimationFrame || - window.oRequestAnimationFrame; + fxNow; jQuery.fn.extend({ show: function( speed, easing, callback ) { @@ -8374,8 +8452,7 @@ jQuery.fx.prototype = { // Start an animation from one number to another custom: function( from, to, unit ) { var self = this, - fx = jQuery.fx, - raf; + fx = jQuery.fx; this.startTime = fxNow || createFxNow(); this.start = from; @@ -8391,20 +8468,7 @@ jQuery.fx.prototype = { t.elem = this.elem; if ( t() && jQuery.timers.push(t) && !timerId ) { - // Use requestAnimationFrame instead of setInterval if available - if ( requestAnimationFrame ) { - timerId = true; - raf = function() { - // When timerId gets set to null at any point, this stops - if ( timerId ) { - requestAnimationFrame( raf ); - fx.tick(); - } - }; - requestAnimationFrame( raf ); - } else { - timerId = setInterval( fx.tick, fx.interval ); - } + timerId = setInterval( fx.tick, fx.interval ); } }, @@ -8947,9 +9011,10 @@ jQuery.each([ "Height", "Width" ], function( i, name ) { if ( jQuery.isWindow( elem ) ) { // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat - var docElemProp = elem.document.documentElement[ "client" + name ]; + var docElemProp = elem.document.documentElement[ "client" + name ], + body = elem.document.body; return elem.document.compatMode === "CSS1Compat" && docElemProp || - elem.document.body[ "client" + name ] || docElemProp; + body && body[ "client" + name ] || docElemProp; // Get document width or height } else if ( elem.nodeType === 9 ) { diff --git a/app/assets/javascripts/jquery.mobile-1.0.js b/app/assets/javascripts/jquery.mobile-1.0.js new file mode 100644 index 0000000..2f5d203 --- /dev/null +++ b/app/assets/javascripts/jquery.mobile-1.0.js @@ -0,0 +1,6907 @@ +/* +* jQuery Mobile Framework 1.0 +* http://jquerymobile.com +* +* Copyright 2011 (c) jQuery Project +* Dual licensed under the MIT or GPL Version 2 licenses. +* http://jquery.org/license +* +*/ +/*! + * jQuery UI Widget @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ + +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + $( elem ).triggerHandler( "remove" ); + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + $( this ).triggerHandler( "remove" ); + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ); + if ( !instance ) { + throw "cannot call methods on " + name + " prior to initialization; " + + "attempted to call method '" + options + "'"; + } + if ( !$.isFunction( instance[options] ) ) { + throw "no such method '" + options + "' for " + name + " widget instance"; + } + var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + var options = {}; + if ( $.metadata ) { + options = $.metadata.get( element )[ this.widgetName ]; + } + return options; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/* +* widget factory extentions for mobile +*/ + +(function( $, undefined ) { + +$.widget( "mobile.widget", { + // decorate the parent _createWidget to trigger `widgetinit` for users + // who wish to do post post `widgetcreate` alterations/additions + // + // TODO create a pull request for jquery ui to trigger this event + // in the original _createWidget + _createWidget: function() { + $.Widget.prototype._createWidget.apply( this, arguments ); + this._trigger( 'init' ); + }, + + _getCreateOptions: function() { + + var elem = this.element, + options = {}; + + $.each( this.options, function( option ) { + + var value = elem.jqmData( option.replace( /[A-Z]/g, function( c ) { + return "-" + c.toLowerCase(); + }) + ); + + if ( value !== undefined ) { + options[ option ] = value; + } + }); + + return options; + }, + + enhanceWithin: function( target ) { + // TODO remove dependency on the page widget for the keepNative. + // Currently the keepNative value is defined on the page prototype so + // the method is as well + var page = $(target).closest(":jqmData(role='page')").data( "page" ), + keepNative = (page && page.keepNativeSelector()) || ""; + + $( this.options.initSelector, target ).not( keepNative )[ this.widgetName ](); + } +}); + +})( jQuery ); +/* +* a workaround for window.matchMedia +*/ + +(function( $, undefined ) { + +var $window = $( window ), + $html = $( "html" ); + +/* $.mobile.media method: pass a CSS media type or query and get a bool return + note: this feature relies on actual media query support for media queries, though types will work most anywhere + examples: + $.mobile.media('screen') //>> tests for screen media type + $.mobile.media('screen and (min-width: 480px)') //>> tests for screen media type with window width > 480px + $.mobile.media('@media screen and (-webkit-min-device-pixel-ratio: 2)') //>> tests for webkit 2x pixel ratio (iPhone 4) +*/ +$.mobile.media = (function() { + // TODO: use window.matchMedia once at least one UA implements it + var cache = {}, + testDiv = $( "
    " ), + fakeBody = $( "" ).append( testDiv ); + + return function( query ) { + if ( !( query in cache ) ) { + var styleBlock = document.createElement( "style" ), + cssrule = "@media " + query + " { #jquery-mediatest { position:absolute; } }"; + + //must set type for IE! + styleBlock.type = "text/css"; + + if ( styleBlock.styleSheet ){ + styleBlock.styleSheet.cssText = cssrule; + } else { + styleBlock.appendChild( document.createTextNode(cssrule) ); + } + + $html.prepend( fakeBody ).prepend( styleBlock ); + cache[ query ] = testDiv.css( "position" ) === "absolute"; + fakeBody.add( styleBlock ).remove(); + } + return cache[ query ]; + }; +})(); + +})(jQuery); +/* +* support tests +*/ + +(function( $, undefined ) { + +var fakeBody = $( "" ).prependTo( "html" ), + fbCSS = fakeBody[ 0 ].style, + vendors = [ "Webkit", "Moz", "O" ], + webos = "palmGetResource" in window, //only used to rule out scrollTop + operamini = window.operamini && ({}).toString.call( window.operamini ) === "[object OperaMini]", + bb = window.blackberry; //only used to rule out box shadow, as it's filled opaque on BB + +// thx Modernizr +function propExists( prop ) { + var uc_prop = prop.charAt( 0 ).toUpperCase() + prop.substr( 1 ), + props = ( prop + " " + vendors.join( uc_prop + " " ) + uc_prop ).split( " " ); + + for ( var v in props ){ + if ( fbCSS[ props[ v ] ] !== undefined ) { + return true; + } + } +} + +// Test for dynamic-updating base tag support ( allows us to avoid href,src attr rewriting ) +function baseTagTest() { + var fauxBase = location.protocol + "//" + location.host + location.pathname + "ui-dir/", + base = $( "head base" ), + fauxEle = null, + href = "", + link, rebase; + + if ( !base.length ) { + base = fauxEle = $( "", { "href": fauxBase }).appendTo( "head" ); + } else { + href = base.attr( "href" ); + } + + link = $( "" ).prependTo( fakeBody ); + rebase = link[ 0 ].href; + base[ 0 ].href = href || location.pathname; + + if ( fauxEle ) { + fauxEle.remove(); + } + return rebase.indexOf( fauxBase ) === 0; +} + + +// non-UA-based IE version check by James Padolsey, modified by jdalton - from http://gist.github.com/527683 +// allows for inclusion of IE 6+, including Windows Mobile 7 +$.mobile.browser = {}; +$.mobile.browser.ie = (function() { + var v = 3, + div = document.createElement( "div" ), + a = div.all || []; + + while ( div.innerHTML = "", a[ 0 ] ); + + return v > 4 ? v : !v; +})(); + + +$.extend( $.support, { + orientation: "orientation" in window && "onorientationchange" in window, + touch: "ontouchend" in document, + cssTransitions: "WebKitTransitionEvent" in window, + pushState: "pushState" in history && "replaceState" in history, + mediaquery: $.mobile.media( "only all" ), + cssPseudoElement: !!propExists( "content" ), + touchOverflow: !!propExists( "overflowScrolling" ), + boxShadow: !!propExists( "boxShadow" ) && !bb, + scrollTop: ( "pageXOffset" in window || "scrollTop" in document.documentElement || "scrollTop" in fakeBody[ 0 ] ) && !webos && !operamini, + dynamicBaseTag: baseTagTest() +}); + +fakeBody.remove(); + + +// $.mobile.ajaxBlacklist is used to override ajaxEnabled on platforms that have known conflicts with hash history updates (BB5, Symbian) +// or that generally work better browsing in regular http for full page refreshes (Opera Mini) +// Note: This detection below is used as a last resort. +// We recommend only using these detection methods when all other more reliable/forward-looking approaches are not possible +var nokiaLTE7_3 = (function(){ + + var ua = window.navigator.userAgent; + + //The following is an attempt to match Nokia browsers that are running Symbian/s60, with webkit, version 7.3 or older + return ua.indexOf( "Nokia" ) > -1 && + ( ua.indexOf( "Symbian/3" ) > -1 || ua.indexOf( "Series60/5" ) > -1 ) && + ua.indexOf( "AppleWebKit" ) > -1 && + ua.match( /(BrowserNG|NokiaBrowser)\/7\.[0-3]/ ); +})(); + +$.mobile.ajaxBlacklist = + // BlackBerry browsers, pre-webkit + window.blackberry && !window.WebKitPoint || + // Opera Mini + operamini || + // Symbian webkits pre 7.3 + nokiaLTE7_3; + +// Lastly, this workaround is the only way we've found so far to get pre 7.3 Symbian webkit devices +// to render the stylesheets when they're referenced before this script, as we'd recommend doing. +// This simply reappends the CSS in place, which for some reason makes it apply +if ( nokiaLTE7_3 ) { + $(function() { + $( "head link[rel='stylesheet']" ).attr( "rel", "alternate stylesheet" ).attr( "rel", "stylesheet" ); + }); +} + +// For ruling out shadows via css +if ( !$.support.boxShadow ) { + $( "html" ).addClass( "ui-mobile-nosupport-boxshadow" ); +} + +})( jQuery ); +/* +* "mouse" plugin +*/ + +// This plugin is an experiment for abstracting away the touch and mouse +// events so that developers don't have to worry about which method of input +// the device their document is loaded on supports. +// +// The idea here is to allow the developer to register listeners for the +// basic mouse events, such as mousedown, mousemove, mouseup, and click, +// and the plugin will take care of registering the correct listeners +// behind the scenes to invoke the listener at the fastest possible time +// for that device, while still retaining the order of event firing in +// the traditional mouse environment, should multiple handlers be registered +// on the same element for different events. +// +// The current version exposes the following virtual events to jQuery bind methods: +// "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel" + +(function( $, window, document, undefined ) { + +var dataPropertyName = "virtualMouseBindings", + touchTargetPropertyName = "virtualTouchID", + virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split( " " ), + touchEventProps = "clientX clientY pageX pageY screenX screenY".split( " " ), + activeDocHandlers = {}, + resetTimerID = 0, + startX = 0, + startY = 0, + didScroll = false, + clickBlockList = [], + blockMouseTriggers = false, + blockTouchTriggers = false, + eventCaptureSupported = "addEventListener" in document, + $document = $( document ), + nextTouchID = 1, + lastTouchID = 0; + +$.vmouse = { + moveDistanceThreshold: 10, + clickDistanceThreshold: 10, + resetTimerDuration: 1500 +}; + +function getNativeEvent( event ) { + + while ( event && typeof event.originalEvent !== "undefined" ) { + event = event.originalEvent; + } + return event; +} + +function createVirtualEvent( event, eventType ) { + + var t = event.type, + oe, props, ne, prop, ct, touch, i, j; + + event = $.Event(event); + event.type = eventType; + + oe = event.originalEvent; + props = $.event.props; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( oe ) { + for ( i = props.length, prop; i; ) { + prop = props[ --i ]; + event[ prop ] = oe[ prop ]; + } + } + + // make sure that if the mouse and click virtual events are generated + // without a .which one is defined + if ( t.search(/mouse(down|up)|click/) > -1 && !event.which ){ + event.which = 1; + } + + if ( t.search(/^touch/) !== -1 ) { + ne = getNativeEvent( oe ); + t = ne.touches; + ct = ne.changedTouches; + touch = ( t && t.length ) ? t[0] : ( (ct && ct.length) ? ct[ 0 ] : undefined ); + + if ( touch ) { + for ( j = 0, len = touchEventProps.length; j < len; j++){ + prop = touchEventProps[ j ]; + event[ prop ] = touch[ prop ]; + } + } + } + + return event; +} + +function getVirtualBindingFlags( element ) { + + var flags = {}, + b, k; + + while ( element ) { + + b = $.data( element, dataPropertyName ); + + for ( k in b ) { + if ( b[ k ] ) { + flags[ k ] = flags.hasVirtualBinding = true; + } + } + element = element.parentNode; + } + return flags; +} + +function getClosestElementWithVirtualBinding( element, eventType ) { + var b; + while ( element ) { + + b = $.data( element, dataPropertyName ); + + if ( b && ( !eventType || b[ eventType ] ) ) { + return element; + } + element = element.parentNode; + } + return null; +} + +function enableTouchBindings() { + blockTouchTriggers = false; +} + +function disableTouchBindings() { + blockTouchTriggers = true; +} + +function enableMouseBindings() { + lastTouchID = 0; + clickBlockList.length = 0; + blockMouseTriggers = false; + + // When mouse bindings are enabled, our + // touch bindings are disabled. + disableTouchBindings(); +} + +function disableMouseBindings() { + // When mouse bindings are disabled, our + // touch bindings are enabled. + enableTouchBindings(); +} + +function startResetTimer() { + clearResetTimer(); + resetTimerID = setTimeout(function(){ + resetTimerID = 0; + enableMouseBindings(); + }, $.vmouse.resetTimerDuration ); +} + +function clearResetTimer() { + if ( resetTimerID ){ + clearTimeout( resetTimerID ); + resetTimerID = 0; + } +} + +function triggerVirtualEvent( eventType, event, flags ) { + var ve; + + if ( ( flags && flags[ eventType ] ) || + ( !flags && getClosestElementWithVirtualBinding( event.target, eventType ) ) ) { + + ve = createVirtualEvent( event, eventType ); + + $( event.target).trigger( ve ); + } + + return ve; +} + +function mouseEventCallback( event ) { + var touchID = $.data(event.target, touchTargetPropertyName); + + if ( !blockMouseTriggers && ( !lastTouchID || lastTouchID !== touchID ) ){ + var ve = triggerVirtualEvent( "v" + event.type, event ); + if ( ve ) { + if ( ve.isDefaultPrevented() ) { + event.preventDefault(); + } + if ( ve.isPropagationStopped() ) { + event.stopPropagation(); + } + if ( ve.isImmediatePropagationStopped() ) { + event.stopImmediatePropagation(); + } + } + } +} + +function handleTouchStart( event ) { + + var touches = getNativeEvent( event ).touches, + target, flags; + + if ( touches && touches.length === 1 ) { + + target = event.target; + flags = getVirtualBindingFlags( target ); + + if ( flags.hasVirtualBinding ) { + + lastTouchID = nextTouchID++; + $.data( target, touchTargetPropertyName, lastTouchID ); + + clearResetTimer(); + + disableMouseBindings(); + didScroll = false; + + var t = getNativeEvent( event ).touches[ 0 ]; + startX = t.pageX; + startY = t.pageY; + + triggerVirtualEvent( "vmouseover", event, flags ); + triggerVirtualEvent( "vmousedown", event, flags ); + } + } +} + +function handleScroll( event ) { + if ( blockTouchTriggers ) { + return; + } + + if ( !didScroll ) { + triggerVirtualEvent( "vmousecancel", event, getVirtualBindingFlags( event.target ) ); + } + + didScroll = true; + startResetTimer(); +} + +function handleTouchMove( event ) { + if ( blockTouchTriggers ) { + return; + } + + var t = getNativeEvent( event ).touches[ 0 ], + didCancel = didScroll, + moveThreshold = $.vmouse.moveDistanceThreshold; + didScroll = didScroll || + ( Math.abs(t.pageX - startX) > moveThreshold || + Math.abs(t.pageY - startY) > moveThreshold ), + flags = getVirtualBindingFlags( event.target ); + + if ( didScroll && !didCancel ) { + triggerVirtualEvent( "vmousecancel", event, flags ); + } + + triggerVirtualEvent( "vmousemove", event, flags ); + startResetTimer(); +} + +function handleTouchEnd( event ) { + if ( blockTouchTriggers ) { + return; + } + + disableTouchBindings(); + + var flags = getVirtualBindingFlags( event.target ), + t; + triggerVirtualEvent( "vmouseup", event, flags ); + + if ( !didScroll ) { + var ve = triggerVirtualEvent( "vclick", event, flags ); + if ( ve && ve.isDefaultPrevented() ) { + // The target of the mouse events that follow the touchend + // event don't necessarily match the target used during the + // touch. This means we need to rely on coordinates for blocking + // any click that is generated. + t = getNativeEvent( event ).changedTouches[ 0 ]; + clickBlockList.push({ + touchID: lastTouchID, + x: t.clientX, + y: t.clientY + }); + + // Prevent any mouse events that follow from triggering + // virtual event notifications. + blockMouseTriggers = true; + } + } + triggerVirtualEvent( "vmouseout", event, flags); + didScroll = false; + + startResetTimer(); +} + +function hasVirtualBindings( ele ) { + var bindings = $.data( ele, dataPropertyName ), + k; + + if ( bindings ) { + for ( k in bindings ) { + if ( bindings[ k ] ) { + return true; + } + } + } + return false; +} + +function dummyMouseHandler(){} + +function getSpecialEventObject( eventType ) { + var realType = eventType.substr( 1 ); + + return { + setup: function( data, namespace ) { + // If this is the first virtual mouse binding for this element, + // add a bindings object to its data. + + if ( !hasVirtualBindings( this ) ) { + $.data( this, dataPropertyName, {}); + } + + // If setup is called, we know it is the first binding for this + // eventType, so initialize the count for the eventType to zero. + var bindings = $.data( this, dataPropertyName ); + bindings[ eventType ] = true; + + // If this is the first virtual mouse event for this type, + // register a global handler on the document. + + activeDocHandlers[ eventType ] = ( activeDocHandlers[ eventType ] || 0 ) + 1; + + if ( activeDocHandlers[ eventType ] === 1 ) { + $document.bind( realType, mouseEventCallback ); + } + + // Some browsers, like Opera Mini, won't dispatch mouse/click events + // for elements unless they actually have handlers registered on them. + // To get around this, we register dummy handlers on the elements. + + $( this ).bind( realType, dummyMouseHandler ); + + // For now, if event capture is not supported, we rely on mouse handlers. + if ( eventCaptureSupported ) { + // If this is the first virtual mouse binding for the document, + // register our touchstart handler on the document. + + activeDocHandlers[ "touchstart" ] = ( activeDocHandlers[ "touchstart" ] || 0) + 1; + + if (activeDocHandlers[ "touchstart" ] === 1) { + $document.bind( "touchstart", handleTouchStart ) + .bind( "touchend", handleTouchEnd ) + + // On touch platforms, touching the screen and then dragging your finger + // causes the window content to scroll after some distance threshold is + // exceeded. On these platforms, a scroll prevents a click event from being + // dispatched, and on some platforms, even the touchend is suppressed. To + // mimic the suppression of the click event, we need to watch for a scroll + // event. Unfortunately, some platforms like iOS don't dispatch scroll + // events until *AFTER* the user lifts their finger (touchend). This means + // we need to watch both scroll and touchmove events to figure out whether + // or not a scroll happenens before the touchend event is fired. + + .bind( "touchmove", handleTouchMove ) + .bind( "scroll", handleScroll ); + } + } + }, + + teardown: function( data, namespace ) { + // If this is the last virtual binding for this eventType, + // remove its global handler from the document. + + --activeDocHandlers[ eventType ]; + + if ( !activeDocHandlers[ eventType ] ) { + $document.unbind( realType, mouseEventCallback ); + } + + if ( eventCaptureSupported ) { + // If this is the last virtual mouse binding in existence, + // remove our document touchstart listener. + + --activeDocHandlers[ "touchstart" ]; + + if ( !activeDocHandlers[ "touchstart" ] ) { + $document.unbind( "touchstart", handleTouchStart ) + .unbind( "touchmove", handleTouchMove ) + .unbind( "touchend", handleTouchEnd ) + .unbind( "scroll", handleScroll ); + } + } + + var $this = $( this ), + bindings = $.data( this, dataPropertyName ); + + // teardown may be called when an element was + // removed from the DOM. If this is the case, + // jQuery core may have already stripped the element + // of any data bindings so we need to check it before + // using it. + if ( bindings ) { + bindings[ eventType ] = false; + } + + // Unregister the dummy event handler. + + $this.unbind( realType, dummyMouseHandler ); + + // If this is the last virtual mouse binding on the + // element, remove the binding data from the element. + + if ( !hasVirtualBindings( this ) ) { + $this.removeData( dataPropertyName ); + } + } + }; +} + +// Expose our custom events to the jQuery bind/unbind mechanism. + +for ( var i = 0; i < virtualEventNames.length; i++ ){ + $.event.special[ virtualEventNames[ i ] ] = getSpecialEventObject( virtualEventNames[ i ] ); +} + +// Add a capture click handler to block clicks. +// Note that we require event capture support for this so if the device +// doesn't support it, we punt for now and rely solely on mouse events. +if ( eventCaptureSupported ) { + document.addEventListener( "click", function( e ){ + var cnt = clickBlockList.length, + target = e.target, + x, y, ele, i, o, touchID; + + if ( cnt ) { + x = e.clientX; + y = e.clientY; + threshold = $.vmouse.clickDistanceThreshold; + + // The idea here is to run through the clickBlockList to see if + // the current click event is in the proximity of one of our + // vclick events that had preventDefault() called on it. If we find + // one, then we block the click. + // + // Why do we have to rely on proximity? + // + // Because the target of the touch event that triggered the vclick + // can be different from the target of the click event synthesized + // by the browser. The target of a mouse/click event that is syntehsized + // from a touch event seems to be implementation specific. For example, + // some browsers will fire mouse/click events for a link that is near + // a touch event, even though the target of the touchstart/touchend event + // says the user touched outside the link. Also, it seems that with most + // browsers, the target of the mouse/click event is not calculated until the + // time it is dispatched, so if you replace an element that you touched + // with another element, the target of the mouse/click will be the new + // element underneath that point. + // + // Aside from proximity, we also check to see if the target and any + // of its ancestors were the ones that blocked a click. This is necessary + // because of the strange mouse/click target calculation done in the + // Android 2.1 browser, where if you click on an element, and there is a + // mouse/click handler on one of its ancestors, the target will be the + // innermost child of the touched element, even if that child is no where + // near the point of touch. + + ele = target; + + while ( ele ) { + for ( i = 0; i < cnt; i++ ) { + o = clickBlockList[ i ]; + touchID = 0; + + if ( ( ele === target && Math.abs( o.x - x ) < threshold && Math.abs( o.y - y ) < threshold ) || + $.data( ele, touchTargetPropertyName ) === o.touchID ) { + // XXX: We may want to consider removing matches from the block list + // instead of waiting for the reset timer to fire. + e.preventDefault(); + e.stopPropagation(); + return; + } + } + ele = ele.parentNode; + } + } + }, true); +} +})( jQuery, window, document ); +/* +* "events" plugin - Handles events +*/ + +(function( $, window, undefined ) { + +// add new event shortcuts +$.each( ( "touchstart touchmove touchend orientationchange throttledresize " + + "tap taphold swipe swipeleft swiperight scrollstart scrollstop" ).split( " " ), function( i, name ) { + + $.fn[ name ] = function( fn ) { + return fn ? this.bind( name, fn ) : this.trigger( name ); + }; + + $.attrFn[ name ] = true; +}); + +var supportTouch = $.support.touch, + scrollEvent = "touchmove scroll", + touchStartEvent = supportTouch ? "touchstart" : "mousedown", + touchStopEvent = supportTouch ? "touchend" : "mouseup", + touchMoveEvent = supportTouch ? "touchmove" : "mousemove"; + +function triggerCustomEvent( obj, eventType, event ) { + var originalType = event.type; + event.type = eventType; + $.event.handle.call( obj, event ); + event.type = originalType; +} + +// also handles scrollstop +$.event.special.scrollstart = { + + enabled: true, + + setup: function() { + + var thisObject = this, + $this = $( thisObject ), + scrolling, + timer; + + function trigger( event, state ) { + scrolling = state; + triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event ); + } + + // iPhone triggers scroll after a small delay; use touchmove instead + $this.bind( scrollEvent, function( event ) { + + if ( !$.event.special.scrollstart.enabled ) { + return; + } + + if ( !scrolling ) { + trigger( event, true ); + } + + clearTimeout( timer ); + timer = setTimeout(function() { + trigger( event, false ); + }, 50 ); + }); + } +}; + +// also handles taphold +$.event.special.tap = { + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( "vmousedown", function( event ) { + + if ( event.which && event.which !== 1 ) { + return false; + } + + var origTarget = event.target, + origEvent = event.originalEvent, + timer; + + function clearTapTimer() { + clearTimeout( timer ); + } + + function clearTapHandlers() { + clearTapTimer(); + + $this.unbind( "vclick", clickHandler ) + .unbind( "vmouseup", clearTapTimer ) + .unbind( "vmousecancel", clearTapHandlers ); + } + + function clickHandler(event) { + clearTapHandlers(); + + // ONLY trigger a 'tap' event if the start target is + // the same as the stop target. + if ( origTarget == event.target ) { + triggerCustomEvent( thisObject, "tap", event ); + } + } + + $this.bind( "vmousecancel", clearTapHandlers ) + .bind( "vmouseup", clearTapTimer ) + .bind( "vclick", clickHandler ); + + timer = setTimeout(function() { + triggerCustomEvent( thisObject, "taphold", $.Event( "taphold" ) ); + }, 750 ); + }); + } +}; + +// also handles swipeleft, swiperight +$.event.special.swipe = { + scrollSupressionThreshold: 10, // More than this horizontal displacement, and we will suppress scrolling. + + durationThreshold: 1000, // More time than this, and it isn't a swipe. + + horizontalDistanceThreshold: 30, // Swipe horizontal displacement must be more than this. + + verticalDistanceThreshold: 75, // Swipe vertical displacement must be less than this. + + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( touchStartEvent, function( event ) { + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event, + start = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ], + origin: $( event.target ) + }, + stop; + + function moveHandler( event ) { + + if ( !start ) { + return; + } + + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event; + + stop = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ] + }; + + // prevent scrolling + if ( Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.scrollSupressionThreshold ) { + event.preventDefault(); + } + } + + $this.bind( touchMoveEvent, moveHandler ) + .one( touchStopEvent, function( event ) { + $this.unbind( touchMoveEvent, moveHandler ); + + if ( start && stop ) { + if ( stop.time - start.time < $.event.special.swipe.durationThreshold && + Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.horizontalDistanceThreshold && + Math.abs( start.coords[ 1 ] - stop.coords[ 1 ] ) < $.event.special.swipe.verticalDistanceThreshold ) { + + start.origin.trigger( "swipe" ) + .trigger( start.coords[0] > stop.coords[ 0 ] ? "swipeleft" : "swiperight" ); + } + } + start = stop = undefined; + }); + }); + } +}; + +(function( $, window ) { + // "Cowboy" Ben Alman + + var win = $( window ), + special_event, + get_orientation, + last_orientation; + + $.event.special.orientationchange = special_event = { + setup: function() { + // If the event is supported natively, return false so that jQuery + // will bind to the event using DOM methods. + if ( $.support.orientation && $.mobile.orientationChangeEnabled ) { + return false; + } + + // Get the current orientation to avoid initial double-triggering. + last_orientation = get_orientation(); + + // Because the orientationchange event doesn't exist, simulate the + // event by testing window dimensions on resize. + win.bind( "throttledresize", handler ); + }, + teardown: function(){ + // If the event is not supported natively, return false so that + // jQuery will unbind the event using DOM methods. + if ( $.support.orientation && $.mobile.orientationChangeEnabled ) { + return false; + } + + // Because the orientationchange event doesn't exist, unbind the + // resize event handler. + win.unbind( "throttledresize", handler ); + }, + add: function( handleObj ) { + // Save a reference to the bound event handler. + var old_handler = handleObj.handler; + + + handleObj.handler = function( event ) { + // Modify event object, adding the .orientation property. + event.orientation = get_orientation(); + + // Call the originally-bound event handler and return its result. + return old_handler.apply( this, arguments ); + }; + } + }; + + // If the event is not supported natively, this handler will be bound to + // the window resize event to simulate the orientationchange event. + function handler() { + // Get the current orientation. + var orientation = get_orientation(); + + if ( orientation !== last_orientation ) { + // The orientation has changed, so trigger the orientationchange event. + last_orientation = orientation; + win.trigger( "orientationchange" ); + } + } + + // Get the current page orientation. This method is exposed publicly, should it + // be needed, as jQuery.event.special.orientationchange.orientation() + $.event.special.orientationchange.orientation = get_orientation = function() { + var isPortrait = true, elem = document.documentElement; + + // prefer window orientation to the calculation based on screensize as + // the actual screen resize takes place before or after the orientation change event + // has been fired depending on implementation (eg android 2.3 is before, iphone after). + // More testing is required to determine if a more reliable method of determining the new screensize + // is possible when orientationchange is fired. (eg, use media queries + element + opacity) + if ( $.support.orientation ) { + // if the window orientation registers as 0 or 180 degrees report + // portrait, otherwise landscape + isPortrait = window.orientation % 180 == 0; + } else { + isPortrait = elem && elem.clientWidth / elem.clientHeight < 1.1; + } + + return isPortrait ? "portrait" : "landscape"; + }; + +})( jQuery, window ); + + +// throttled resize event +(function() { + + $.event.special.throttledresize = { + setup: function() { + $( this ).bind( "resize", handler ); + }, + teardown: function(){ + $( this ).unbind( "resize", handler ); + } + }; + + var throttle = 250, + handler = function() { + curr = ( new Date() ).getTime(); + diff = curr - lastCall; + + if ( diff >= throttle ) { + + lastCall = curr; + $( this ).trigger( "throttledresize" ); + + } else { + + if ( heldCall ) { + clearTimeout( heldCall ); + } + + // Promise a held call will still execute + heldCall = setTimeout( handler, throttle - diff ); + } + }, + lastCall = 0, + heldCall, + curr, + diff; +})(); + + +$.each({ + scrollstop: "scrollstart", + taphold: "tap", + swipeleft: "swipe", + swiperight: "swipe" +}, function( event, sourceEvent ) { + + $.event.special[ event ] = { + setup: function() { + $( this ).bind( sourceEvent, $.noop ); + } + }; +}); + +})( jQuery, this ); +// Script: jQuery hashchange event +// +// *Version: 1.3, Last updated: 7/21/2010* +// +// Project Home - http://benalman.com/projects/jquery-hashchange-plugin/ +// GitHub - http://github.com/cowboy/jquery-hashchange/ +// Source - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.js +// (Minified) - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.min.js (0.8kb gzipped) +// +// About: License +// +// Copyright (c) 2010 "Cowboy" Ben Alman, +// Dual licensed under the MIT and GPL licenses. +// http://benalman.com/about/license/ +// +// About: Examples +// +// These working examples, complete with fully commented code, illustrate a few +// ways in which this plugin can be used. +// +// hashchange event - http://benalman.com/code/projects/jquery-hashchange/examples/hashchange/ +// document.domain - http://benalman.com/code/projects/jquery-hashchange/examples/document_domain/ +// +// About: Support and Testing +// +// Information about what version or versions of jQuery this plugin has been +// tested with, what browsers it has been tested in, and where the unit tests +// reside (so you can test it yourself). +// +// jQuery Versions - 1.2.6, 1.3.2, 1.4.1, 1.4.2 +// Browsers Tested - Internet Explorer 6-8, Firefox 2-4, Chrome 5-6, Safari 3.2-5, +// Opera 9.6-10.60, iPhone 3.1, Android 1.6-2.2, BlackBerry 4.6-5. +// Unit Tests - http://benalman.com/code/projects/jquery-hashchange/unit/ +// +// About: Known issues +// +// While this jQuery hashchange event implementation is quite stable and +// robust, there are a few unfortunate browser bugs surrounding expected +// hashchange event-based behaviors, independent of any JavaScript +// window.onhashchange abstraction. See the following examples for more +// information: +// +// Chrome: Back Button - http://benalman.com/code/projects/jquery-hashchange/examples/bug-chrome-back-button/ +// Firefox: Remote XMLHttpRequest - http://benalman.com/code/projects/jquery-hashchange/examples/bug-firefox-remote-xhr/ +// WebKit: Back Button in an Iframe - http://benalman.com/code/projects/jquery-hashchange/examples/bug-webkit-hash-iframe/ +// Safari: Back Button from a different domain - http://benalman.com/code/projects/jquery-hashchange/examples/bug-safari-back-from-diff-domain/ +// +// Also note that should a browser natively support the window.onhashchange +// event, but not report that it does, the fallback polling loop will be used. +// +// About: Release History +// +// 1.3 - (7/21/2010) Reorganized IE6/7 Iframe code to make it more +// "removable" for mobile-only development. Added IE6/7 document.title +// support. Attempted to make Iframe as hidden as possible by using +// techniques from http://www.paciellogroup.com/blog/?p=604. Added +// support for the "shortcut" format $(window).hashchange( fn ) and +// $(window).hashchange() like jQuery provides for built-in events. +// Renamed jQuery.hashchangeDelay to and +// lowered its default value to 50. Added +// and properties plus document-domain.html +// file to address access denied issues when setting document.domain in +// IE6/7. +// 1.2 - (2/11/2010) Fixed a bug where coming back to a page using this plugin +// from a page on another domain would cause an error in Safari 4. Also, +// IE6/7 Iframe is now inserted after the body (this actually works), +// which prevents the page from scrolling when the event is first bound. +// Event can also now be bound before DOM ready, but it won't be usable +// before then in IE6/7. +// 1.1 - (1/21/2010) Incorporated document.documentMode test to fix IE8 bug +// where browser version is incorrectly reported as 8.0, despite +// inclusion of the X-UA-Compatible IE=EmulateIE7 meta tag. +// 1.0 - (1/9/2010) Initial Release. Broke out the jQuery BBQ event.special +// window.onhashchange functionality into a separate plugin for users +// who want just the basic event & back button support, without all the +// extra awesomeness that BBQ provides. This plugin will be included as +// part of jQuery BBQ, but also be available separately. + +(function($,window,undefined){ + '$:nomunge'; // Used by YUI compressor. + + // Reused string. + var str_hashchange = 'hashchange', + + // Method / object references. + doc = document, + fake_onhashchange, + special = $.event.special, + + // Does the browser support window.onhashchange? Note that IE8 running in + // IE7 compatibility mode reports true for 'onhashchange' in window, even + // though the event isn't supported, so also test document.documentMode. + doc_mode = doc.documentMode, + supports_onhashchange = 'on' + str_hashchange in window && ( doc_mode === undefined || doc_mode > 7 ); + + // Get location.hash (or what you'd expect location.hash to be) sans any + // leading #. Thanks for making this necessary, Firefox! + function get_fragment( url ) { + url = url || location.href; + return '#' + url.replace( /^[^#]*#?(.*)$/, '$1' ); + }; + + // Method: jQuery.fn.hashchange + // + // Bind a handler to the window.onhashchange event or trigger all bound + // window.onhashchange event handlers. This behavior is consistent with + // jQuery's built-in event handlers. + // + // Usage: + // + // > jQuery(window).hashchange( [ handler ] ); + // + // Arguments: + // + // handler - (Function) Optional handler to be bound to the hashchange + // event. This is a "shortcut" for the more verbose form: + // jQuery(window).bind( 'hashchange', handler ). If handler is omitted, + // all bound window.onhashchange event handlers will be triggered. This + // is a shortcut for the more verbose + // jQuery(window).trigger( 'hashchange' ). These forms are described in + // the section. + // + // Returns: + // + // (jQuery) The initial jQuery collection of elements. + + // Allow the "shortcut" format $(elem).hashchange( fn ) for binding and + // $(elem).hashchange() for triggering, like jQuery does for built-in events. + $.fn[ str_hashchange ] = function( fn ) { + return fn ? this.bind( str_hashchange, fn ) : this.trigger( str_hashchange ); + }; + + // Property: jQuery.fn.hashchange.delay + // + // The numeric interval (in milliseconds) at which the + // polling loop executes. Defaults to 50. + + // Property: jQuery.fn.hashchange.domain + // + // If you're setting document.domain in your JavaScript, and you want hash + // history to work in IE6/7, not only must this property be set, but you must + // also set document.domain BEFORE jQuery is loaded into the page. This + // property is only applicable if you are supporting IE6/7 (or IE8 operating + // in "IE7 compatibility" mode). + // + // In addition, the property must be set to the + // path of the included "document-domain.html" file, which can be renamed or + // modified if necessary (note that the document.domain specified must be the + // same in both your main JavaScript as well as in this file). + // + // Usage: + // + // jQuery.fn.hashchange.domain = document.domain; + + // Property: jQuery.fn.hashchange.src + // + // If, for some reason, you need to specify an Iframe src file (for example, + // when setting document.domain as in ), you can + // do so using this property. Note that when using this property, history + // won't be recorded in IE6/7 until the Iframe src file loads. This property + // is only applicable if you are supporting IE6/7 (or IE8 operating in "IE7 + // compatibility" mode). + // + // Usage: + // + // jQuery.fn.hashchange.src = 'path/to/file.html'; + + $.fn[ str_hashchange ].delay = 50; + /* + $.fn[ str_hashchange ].domain = null; + $.fn[ str_hashchange ].src = null; + */ + + // Event: hashchange event + // + // Fired when location.hash changes. In browsers that support it, the native + // HTML5 window.onhashchange event is used, otherwise a polling loop is + // initialized, running every milliseconds to + // see if the hash has changed. In IE6/7 (and IE8 operating in "IE7 + // compatibility" mode), a hidden Iframe is created to allow the back button + // and hash-based history to work. + // + // Usage as described in : + // + // > // Bind an event handler. + // > jQuery(window).hashchange( function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).hashchange(); + // + // A more verbose usage that allows for event namespacing: + // + // > // Bind an event handler. + // > jQuery(window).bind( 'hashchange', function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).trigger( 'hashchange' ); + // + // Additional Notes: + // + // * The polling loop and Iframe are not created until at least one handler + // is actually bound to the 'hashchange' event. + // * If you need the bound handler(s) to execute immediately, in cases where + // a location.hash exists on page load, via bookmark or page refresh for + // example, use jQuery(window).hashchange() or the more verbose + // jQuery(window).trigger( 'hashchange' ). + // * The event can be bound before DOM ready, but since it won't be usable + // before then in IE6/7 (due to the necessary Iframe), recommended usage is + // to bind it inside a DOM ready handler. + + // Override existing $.event.special.hashchange methods (allowing this plugin + // to be defined after jQuery BBQ in BBQ's source code). + special[ str_hashchange ] = $.extend( special[ str_hashchange ], { + + // Called only when the first 'hashchange' event is bound to window. + setup: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to create our own. And we don't want to call this + // until the user binds to the event, just in case they never do, since it + // will create a polling loop and possibly even a hidden Iframe. + $( fake_onhashchange.start ); + }, + + // Called only when the last 'hashchange' event is unbound from window. + teardown: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to stop ours (if possible). + $( fake_onhashchange.stop ); + } + + }); + + // fake_onhashchange does all the work of triggering the window.onhashchange + // event for browsers that don't natively support it, including creating a + // polling loop to watch for hash changes and in IE 6/7 creating a hidden + // Iframe to enable back and forward. + fake_onhashchange = (function(){ + var self = {}, + timeout_id, + + // Remember the initial hash so it doesn't get triggered immediately. + last_hash = get_fragment(), + + fn_retval = function(val){ return val; }, + history_set = fn_retval, + history_get = fn_retval; + + // Start the polling loop. + self.start = function() { + timeout_id || poll(); + }; + + // Stop the polling loop. + self.stop = function() { + timeout_id && clearTimeout( timeout_id ); + timeout_id = undefined; + }; + + // This polling loop checks every $.fn.hashchange.delay milliseconds to see + // if location.hash has changed, and triggers the 'hashchange' event on + // window when necessary. + function poll() { + var hash = get_fragment(), + history_hash = history_get( last_hash ); + + if ( hash !== last_hash ) { + history_set( last_hash = hash, history_hash ); + + $(window).trigger( str_hashchange ); + + } else if ( history_hash !== last_hash ) { + location.href = location.href.replace( /#.*/, '' ) + history_hash; + } + + timeout_id = setTimeout( poll, $.fn[ str_hashchange ].delay ); + }; + + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvv REMOVE IF NOT SUPPORTING IE6/7/8 vvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + $.browser.msie && !supports_onhashchange && (function(){ + // Not only do IE6/7 need the "magical" Iframe treatment, but so does IE8 + // when running in "IE7 compatibility" mode. + + var iframe, + iframe_src; + + // When the event is bound and polling starts in IE 6/7, create a hidden + // Iframe for history handling. + self.start = function(){ + if ( !iframe ) { + iframe_src = $.fn[ str_hashchange ].src; + iframe_src = iframe_src && iframe_src + get_fragment(); + + // Create hidden Iframe. Attempt to make Iframe as hidden as possible + // by using techniques from http://www.paciellogroup.com/blog/?p=604. + iframe = $('':"");b._keyEvent=false;return D},_generateMonthYearHeader:function(b,f,j,l,o,n,k,m){var p=this._get(b,"changeMonth"), -q=this._get(b,"changeYear"),s=this._get(b,"showMonthAfterYear"),r='
    ',u="";if(n||!p)u+=''+k[f]+"";else{k=l&&l.getFullYear()==j;var v=o&&o.getFullYear()==j;u+='"}s||(r+=u+(n||!(p&&q)?" ":""));if(!b.yearshtml){b.yearshtml="";if(n||!q)r+=''+j+"";else{m=this._get(b,"yearRange").split(":");var x=(new Date).getFullYear();k=function(y){y=y.match(/c[+-].*/)?j+parseInt(y.substring(1),10):y.match(/[+-].*/)?x+parseInt(y,10):parseInt(y,10);return isNaN(y)?x:y};f=k(m[0]);m=Math.max(f,k(m[1]||""));f=l?Math.max(f,l.getFullYear()):f;m=o?Math.min(m,o.getFullYear()): -m;for(b.yearshtml+='";r+=b.yearshtml;b.yearshtml=null}}r+=this._get(b,"yearSuffix");if(s)r+=(n||!(p&&q)?" ":"")+u;r+="
    ";return r},_adjustInstDate:function(b,f,j){var l=b.drawYear+(j== -"Y"?f:0),o=b.drawMonth+(j=="M"?f:0);f=Math.min(b.selectedDay,this._getDaysInMonth(l,o))+(j=="D"?f:0);l=this._restrictMinMax(b,this._daylightSavingAdjust(new Date(l,o,f)));b.selectedDay=l.getDate();b.drawMonth=b.selectedMonth=l.getMonth();b.drawYear=b.selectedYear=l.getFullYear();if(j=="M"||j=="Y")this._notifyChange(b)},_restrictMinMax:function(b,f){var j=this._getMinMaxDate(b,"min");b=this._getMinMaxDate(b,"max");f=j&&fb?b:f},_notifyChange:function(b){var f=this._get(b,"onChangeMonthYear"); -if(f)f.apply(b.input?b.input[0]:null,[b.selectedYear,b.selectedMonth+1,b])},_getNumberOfMonths:function(b){b=this._get(b,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(b,f){return this._determineDate(b,this._get(b,f+"Date"),null)},_getDaysInMonth:function(b,f){return 32-this._daylightSavingAdjust(new Date(b,f,32)).getDate()},_getFirstDayOfMonth:function(b,f){return(new Date(b,f,1)).getDay()},_canAdjustMonth:function(b,f,j,l){var o=this._getNumberOfMonths(b); -j=this._daylightSavingAdjust(new Date(j,l+(f<0?f:o[0]*o[1]),1));f<0&&j.setDate(this._getDaysInMonth(j.getFullYear(),j.getMonth()));return this._isInRange(b,j)},_isInRange:function(b,f){var j=this._getMinMaxDate(b,"min");b=this._getMinMaxDate(b,"max");return(!j||f.getTime()>=j.getTime())&&(!b||f.getTime()<=b.getTime())},_getFormatConfig:function(b){var f=this._get(b,"shortYearCutoff");f=typeof f!="string"?f:(new Date).getFullYear()%100+parseInt(f,10);return{shortYearCutoff:f,dayNamesShort:this._get(b, -"dayNamesShort"),dayNames:this._get(b,"dayNames"),monthNamesShort:this._get(b,"monthNamesShort"),monthNames:this._get(b,"monthNames")}},_formatDate:function(b,f,j,l){if(!f){b.currentDay=b.selectedDay;b.currentMonth=b.selectedMonth;b.currentYear=b.selectedYear}f=f?typeof f=="object"?f:this._daylightSavingAdjust(new Date(l,j,f)):this._daylightSavingAdjust(new Date(b.currentYear,b.currentMonth,b.currentDay));return this.formatDate(this._get(b,"dateFormat"),f,this._getFormatConfig(b))}});a.fn.datepicker= -function(b){if(!this.length)return this;if(!a.datepicker.initialized){a(document).mousedown(a.datepicker._checkExternalClick).find("body").append(a.datepicker.dpDiv);a.datepicker.initialized=true}var f=Array.prototype.slice.call(arguments,1);if(typeof b=="string"&&(b=="isDisabled"||b=="getDate"||b=="widget"))return a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this[0]].concat(f));if(b=="option"&&arguments.length==2&&typeof arguments[1]=="string")return a.datepicker["_"+b+"Datepicker"].apply(a.datepicker, -[this[0]].concat(f));return this.each(function(){typeof b=="string"?a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this].concat(f)):a.datepicker._attachDatepicker(this,b)})};a.datepicker=new c;a.datepicker.initialized=false;a.datepicker.uuid=(new Date).getTime();a.datepicker.version="1.8.14";window["DP_jQuery_"+g]=a})(jQuery); -(function(a,d){var c={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},e={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},h=a.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};a.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, -position:{my:"center",at:"center",collision:"fit",using:function(g){var i=a(this).css(g).offset().top;i<0&&a(this).css("top",g.top-i)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var g=this,i=g.options,b=i.title||" ",f=a.ui.dialog.getTitleId(g.element),j=(g.uiDialog=a("
    ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ -i.dialogClass).css({zIndex:i.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(n){if(i.closeOnEscape&&n.keyCode&&n.keyCode===a.ui.keyCode.ESCAPE){g.close(n);n.preventDefault()}}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(n){g.moveToTop(false,n)});g.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(j);var l=(g.uiDialogTitlebar=a("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(j), -o=a('
    ').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){o.addClass("ui-state-hover")},function(){o.removeClass("ui-state-hover")}).focus(function(){o.addClass("ui-state-focus")}).blur(function(){o.removeClass("ui-state-focus")}).click(function(n){g.close(n);return false}).appendTo(l);(g.uiDialogTitlebarCloseText=a("")).addClass("ui-icon ui-icon-closethick").text(i.closeText).appendTo(o);a("").addClass("ui-dialog-title").attr("id", -f).html(b).prependTo(l);if(a.isFunction(i.beforeclose)&&!a.isFunction(i.beforeClose))i.beforeClose=i.beforeclose;l.find("*").add(l).disableSelection();i.draggable&&a.fn.draggable&&g._makeDraggable();i.resizable&&a.fn.resizable&&g._makeResizable();g._createButtons(i.buttons);g._isOpen=false;a.fn.bgiframe&&j.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var g=this;g.overlay&&g.overlay.destroy();g.uiDialog.hide();g.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); -g.uiDialog.remove();g.originalTitle&&g.element.attr("title",g.originalTitle);return g},widget:function(){return this.uiDialog},close:function(g){var i=this,b,f;if(false!==i._trigger("beforeClose",g)){i.overlay&&i.overlay.destroy();i.uiDialog.unbind("keypress.ui-dialog");i._isOpen=false;if(i.options.hide)i.uiDialog.hide(i.options.hide,function(){i._trigger("close",g)});else{i.uiDialog.hide();i._trigger("close",g)}a.ui.dialog.overlay.resize();if(i.options.modal){b=0;a(".ui-dialog").each(function(){if(this!== -i.uiDialog[0]){f=a(this).css("z-index");isNaN(f)||(b=Math.max(b,f))}});a.ui.dialog.maxZ=b}return i}},isOpen:function(){return this._isOpen},moveToTop:function(g,i){var b=this,f=b.options;if(f.modal&&!g||!f.stack&&!f.modal)return b._trigger("focus",i);if(f.zIndex>a.ui.dialog.maxZ)a.ui.dialog.maxZ=f.zIndex;if(b.overlay){a.ui.dialog.maxZ+=1;b.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)}g={scrollTop:b.element.attr("scrollTop"),scrollLeft:b.element.attr("scrollLeft")};a.ui.dialog.maxZ+= -1;b.uiDialog.css("z-index",a.ui.dialog.maxZ);b.element.attr(g);b._trigger("focus",i);return b},open:function(){if(!this._isOpen){var g=this,i=g.options,b=g.uiDialog;g.overlay=i.modal?new a.ui.dialog.overlay(g):null;g._size();g._position(i.position);b.show(i.show);g.moveToTop(true);i.modal&&b.bind("keypress.ui-dialog",function(f){if(f.keyCode===a.ui.keyCode.TAB){var j=a(":tabbable",this),l=j.filter(":first");j=j.filter(":last");if(f.target===j[0]&&!f.shiftKey){l.focus(1);return false}else if(f.target=== -l[0]&&f.shiftKey){j.focus(1);return false}}});a(g.element.find(":tabbable").get().concat(b.find(".ui-dialog-buttonpane :tabbable").get().concat(b.get()))).eq(0).focus();g._isOpen=true;g._trigger("open");return g}},_createButtons:function(g){var i=this,b=false,f=a("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),j=a("
    ").addClass("ui-dialog-buttonset").appendTo(f);i.uiDialog.find(".ui-dialog-buttonpane").remove();typeof g==="object"&&g!==null&&a.each(g, -function(){return!(b=true)});if(b){a.each(g,function(l,o){o=a.isFunction(o)?{click:o,text:l}:o;var n=a('').click(function(){o.click.apply(i.element[0],arguments)}).appendTo(j);a.each(o,function(k,m){if(k!=="click")k in h?n[k](m):n.attr(k,m)});a.fn.button&&n.button()});f.appendTo(i.uiDialog)}},_makeDraggable:function(){function g(l){return{position:l.position,offset:l.offset}}var i=this,b=i.options,f=a(document),j;i.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", -handle:".ui-dialog-titlebar",containment:"document",start:function(l,o){j=b.height==="auto"?"auto":a(this).height();a(this).height(a(this).height()).addClass("ui-dialog-dragging");i._trigger("dragStart",l,g(o))},drag:function(l,o){i._trigger("drag",l,g(o))},stop:function(l,o){b.position=[o.position.left-f.scrollLeft(),o.position.top-f.scrollTop()];a(this).removeClass("ui-dialog-dragging").height(j);i._trigger("dragStop",l,g(o));a.ui.dialog.overlay.resize()}})},_makeResizable:function(g){function i(l){return{originalPosition:l.originalPosition, -originalSize:l.originalSize,position:l.position,size:l.size}}g=g===d?this.options.resizable:g;var b=this,f=b.options,j=b.uiDialog.css("position");g=typeof g==="string"?g:"n,e,s,w,se,sw,ne,nw";b.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:b.element,maxWidth:f.maxWidth,maxHeight:f.maxHeight,minWidth:f.minWidth,minHeight:b._minHeight(),handles:g,start:function(l,o){a(this).addClass("ui-dialog-resizing");b._trigger("resizeStart",l,i(o))},resize:function(l,o){b._trigger("resize", -l,i(o))},stop:function(l,o){a(this).removeClass("ui-dialog-resizing");f.height=a(this).height();f.width=a(this).width();b._trigger("resizeStop",l,i(o));a.ui.dialog.overlay.resize()}}).css("position",j).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var g=this.options;return g.height==="auto"?g.minHeight:Math.min(g.minHeight,g.height)},_position:function(g){var i=[],b=[0,0],f;if(g){if(typeof g==="string"||typeof g==="object"&&"0"in g){i=g.split?g.split(" "): -[g[0],g[1]];if(i.length===1)i[1]=i[0];a.each(["left","top"],function(j,l){if(+i[j]===i[j]){b[j]=i[j];i[j]=l}});g={my:i.join(" "),at:i.join(" "),offset:b.join(" ")}}g=a.extend({},a.ui.dialog.prototype.options.position,g)}else g=a.ui.dialog.prototype.options.position;(f=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},g));f||this.uiDialog.hide()},_setOptions:function(g){var i=this,b={},f=false;a.each(g,function(j,l){i._setOption(j,l); -if(j in c)f=true;if(j in e)b[j]=l});f&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",b)},_setOption:function(g,i){var b=this,f=b.uiDialog;switch(g){case "beforeclose":g="beforeClose";break;case "buttons":b._createButtons(i);break;case "closeText":b.uiDialogTitlebarCloseText.text(""+i);break;case "dialogClass":f.removeClass(b.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+i);break;case "disabled":i?f.addClass("ui-dialog-disabled"): -f.removeClass("ui-dialog-disabled");break;case "draggable":var j=f.is(":data(draggable)");j&&!i&&f.draggable("destroy");!j&&i&&b._makeDraggable();break;case "position":b._position(i);break;case "resizable":(j=f.is(":data(resizable)"))&&!i&&f.resizable("destroy");j&&typeof i==="string"&&f.resizable("option","handles",i);!j&&i!==false&&b._makeResizable(i);break;case "title":a(".ui-dialog-title",b.uiDialogTitlebar).html(""+(i||" "));break}a.Widget.prototype._setOption.apply(b,arguments)},_size:function(){var g= -this.options,i,b,f=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(g.minWidth>g.width)g.width=g.minWidth;i=this.uiDialog.css({height:"auto",width:g.width}).height();b=Math.max(0,g.minHeight-i);if(g.height==="auto")if(a.support.minHeight)this.element.css({minHeight:b,height:"auto"});else{this.uiDialog.show();g=this.element.css("height","auto").height();f||this.uiDialog.hide();this.element.height(Math.max(g,b))}else this.element.height(Math.max(g.height- -i,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});a.extend(a.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(g){g=g.attr("id");if(!g){this.uuid+=1;g=this.uuid}return"ui-dialog-title-"+g},overlay:function(g){this.$el=a.ui.dialog.overlay.create(g)}});a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(g){return g+".dialog-overlay"}).join(" "), -create:function(g){if(this.instances.length===0){setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()
    ").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), -height:this.height()});a.fn.bgiframe&&i.bgiframe();this.instances.push(i);return i},destroy:function(g){var i=a.inArray(g,this.instances);i!=-1&&this.oldInstances.push(this.instances.splice(i,1)[0]);this.instances.length===0&&a([document,window]).unbind(".dialog-overlay");g.remove();var b=0;a.each(this.instances,function(){b=Math.max(b,this.css("z-index"))});this.maxZ=b},height:function(){var g,i;if(a.browser.msie&&a.browser.version<7){g=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); -i=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return g0?g.left-b:Math.max(g.left-i.collisionPosition.left,g.left)},top:function(g,i){var b=a(window);b=i.collisionPosition.top+i.collisionHeight-b.height()-b.scrollTop();g.top=b>0?g.top-b:Math.max(g.top-i.collisionPosition.top,g.top)}},flip:{left:function(g,i){if(i.at[0]!=="center"){var b=a(window);b=i.collisionPosition.left+i.collisionWidth-b.width()-b.scrollLeft();var f=i.my[0]==="left"?-i.elemWidth:i.my[0]==="right"?i.elemWidth:0,j=i.at[0]==="left"?i.targetWidth:-i.targetWidth,l=-2*i.offset[0];g.left+= -i.collisionPosition.left<0?f+j+l:b>0?f+j+l:0}},top:function(g,i){if(i.at[1]!=="center"){var b=a(window);b=i.collisionPosition.top+i.collisionHeight-b.height()-b.scrollTop();var f=i.my[1]==="top"?-i.elemHeight:i.my[1]==="bottom"?i.elemHeight:0,j=i.at[1]==="top"?i.targetHeight:-i.targetHeight,l=-2*i.offset[1];g.top+=i.collisionPosition.top<0?f+j+l:b>0?f+j+l:0}}}};if(!a.offset.setOffset){a.offset.setOffset=function(g,i){if(/static/.test(a.curCSS(g,"position")))g.style.position="relative";var b=a(g), -f=b.offset(),j=parseInt(a.curCSS(g,"top",true),10)||0,l=parseInt(a.curCSS(g,"left",true),10)||0;f={top:i.top-f.top+j,left:i.left-f.left+l};"using"in i?i.using.call(g,f):b.css(f)};a.fn.offset=function(g){var i=this[0];if(!i||!i.ownerDocument)return null;if(g)return this.each(function(){a.offset.setOffset(this,g)});return h.call(this)}}})(jQuery); -(function(a,d){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=a("
    ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); -this.valueDiv.remove();a.Widget.prototype.destroy.apply(this,arguments)},value:function(c){if(c===d)return this._value();this._setOption("value",c);return this},_setOption:function(c,e){if(c==="value"){this.options.value=e;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var c=this.options.value;if(typeof c!=="number")c=0;return Math.min(this.options.max,Math.max(this.min,c))},_percentage:function(){return 100* -this._value()/this.options.max},_refreshValue:function(){var c=this.value(),e=this._percentage();if(this.oldValue!==c){this.oldValue=c;this._trigger("change")}this.valueDiv.toggle(c>this.min).toggleClass("ui-corner-right",c===this.options.max).width(e.toFixed(0)+"%");this.element.attr("aria-valuenow",c)}});a.extend(a.ui.progressbar,{version:"1.8.14"})})(jQuery); -(function(a){a.widget("ui.slider",a.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var d=this,c=this.options,e=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),h=c.values&&c.values.length||1,g=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+ -this.orientation+" ui-widget ui-widget-content ui-corner-all"+(c.disabled?" ui-slider-disabled ui-disabled":""));this.range=a([]);if(c.range){if(c.range===true){if(!c.values)c.values=[this._valueMin(),this._valueMin()];if(c.values.length&&c.values.length!==2)c.values=[c.values[0],c.values[0]]}this.range=a("
    ").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(c.range==="min"||c.range==="max"?" ui-slider-range-"+c.range:""))}for(var i=e.length;i"); -this.handles=e.add(a(g.join("")).appendTo(d.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(b){b.preventDefault()}).hover(function(){c.disabled||a(this).addClass("ui-state-hover")},function(){a(this).removeClass("ui-state-hover")}).focus(function(){if(c.disabled)a(this).blur();else{a(".ui-slider .ui-state-focus").removeClass("ui-state-focus");a(this).addClass("ui-state-focus")}}).blur(function(){a(this).removeClass("ui-state-focus")});this.handles.each(function(b){a(this).data("index.ui-slider-handle", -b)});this.handles.keydown(function(b){var f=true,j=a(this).data("index.ui-slider-handle"),l,o,n;if(!d.options.disabled){switch(b.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.PAGE_UP:case a.ui.keyCode.PAGE_DOWN:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:f=false;if(!d._keySliding){d._keySliding=true;a(this).addClass("ui-state-active");l=d._start(b,j);if(l===false)return}break}n=d.options.step;l=d.options.values&&d.options.values.length? -(o=d.values(j)):(o=d.value());switch(b.keyCode){case a.ui.keyCode.HOME:o=d._valueMin();break;case a.ui.keyCode.END:o=d._valueMax();break;case a.ui.keyCode.PAGE_UP:o=d._trimAlignValue(l+(d._valueMax()-d._valueMin())/5);break;case a.ui.keyCode.PAGE_DOWN:o=d._trimAlignValue(l-(d._valueMax()-d._valueMin())/5);break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(l===d._valueMax())return;o=d._trimAlignValue(l+n);break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(l===d._valueMin())return;o=d._trimAlignValue(l- -n);break}d._slide(b,j,o);return f}}).keyup(function(b){var f=a(this).data("index.ui-slider-handle");if(d._keySliding){d._keySliding=false;d._stop(b,f);d._change(b,f);a(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); -return this},_mouseCapture:function(d){var c=this.options,e,h,g,i,b;if(c.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();e=this._normValueFromMouse({x:d.pageX,y:d.pageY});h=this._valueMax()-this._valueMin()+1;i=this;this.handles.each(function(f){var j=Math.abs(e-i.values(f));if(h>j){h=j;g=a(this);b=f}});if(c.range===true&&this.values(1)===c.min){b+=1;g=a(this.handles[b])}if(this._start(d,b)===false)return false; -this._mouseSliding=true;i._handleIndex=b;g.addClass("ui-state-active").focus();c=g.offset();this._clickOffset=!a(d.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:d.pageX-c.left-g.width()/2,top:d.pageY-c.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(d,b,e);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(d){var c= -this._normValueFromMouse({x:d.pageX,y:d.pageY});this._slide(d,this._handleIndex,c);return false},_mouseStop:function(d){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(d,this._handleIndex);this._change(d,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(d){var c;if(this.orientation==="horizontal"){c= -this.elementSize.width;d=d.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{c=this.elementSize.height;d=d.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}c=d/c;if(c>1)c=1;if(c<0)c=0;if(this.orientation==="vertical")c=1-c;d=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+c*d)},_start:function(d,c){var e={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){e.value=this.values(c); -e.values=this.values()}return this._trigger("start",d,e)},_slide:function(d,c,e){var h;if(this.options.values&&this.options.values.length){h=this.values(c?0:1);if(this.options.values.length===2&&this.options.range===true&&(c===0&&e>h||c===1&&e1){this.options.values[d]=this._trimAlignValue(c);this._refreshValue();this._change(null,d)}else if(arguments.length)if(a.isArray(arguments[0])){e=this.options.values;h=arguments[0];for(g=0;g=this._valueMax())return this._valueMax();var c=this.options.step>0?this.options.step:1,e=(d-this._valueMin())%c;alignValue=d-e;if(Math.abs(e)*2>=c)alignValue+=e>0?c:-c;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, -_refreshValue:function(){var d=this.options.range,c=this.options,e=this,h=!this._animateOff?c.animate:false,g,i={},b,f,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(o){g=(e.values(o)-e._valueMin())/(e._valueMax()-e._valueMin())*100;i[e.orientation==="horizontal"?"left":"bottom"]=g+"%";a(this).stop(1,1)[h?"animate":"css"](i,c.animate);if(e.options.range===true)if(e.orientation==="horizontal"){if(o===0)e.range.stop(1,1)[h?"animate":"css"]({left:g+"%"},c.animate); -if(o===1)e.range[h?"animate":"css"]({width:g-b+"%"},{queue:false,duration:c.animate})}else{if(o===0)e.range.stop(1,1)[h?"animate":"css"]({bottom:g+"%"},c.animate);if(o===1)e.range[h?"animate":"css"]({height:g-b+"%"},{queue:false,duration:c.animate})}b=g});else{f=this.value();j=this._valueMin();l=this._valueMax();g=l!==j?(f-j)/(l-j)*100:0;i[e.orientation==="horizontal"?"left":"bottom"]=g+"%";this.handle.stop(1,1)[h?"animate":"css"](i,c.animate);if(d==="min"&&this.orientation==="horizontal")this.range.stop(1, -1)[h?"animate":"css"]({width:g+"%"},c.animate);if(d==="max"&&this.orientation==="horizontal")this.range[h?"animate":"css"]({width:100-g+"%"},{queue:false,duration:c.animate});if(d==="min"&&this.orientation==="vertical")this.range.stop(1,1)[h?"animate":"css"]({height:g+"%"},c.animate);if(d==="max"&&this.orientation==="vertical")this.range[h?"animate":"css"]({height:100-g+"%"},{queue:false,duration:c.animate})}}});a.extend(a.ui.slider,{version:"1.8.14"})})(jQuery); -(function(a,d){function c(){return++h}function e(){return++g}var h=0,g=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
    ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
  • #{label}
  • "},_create:function(){this._tabify(true)},_setOption:function(i,b){if(i=="selected")this.options.collapsible&& -b==this.options.selected||this.select(b);else{this.options[i]=b;this._tabify()}},_tabId:function(i){return i.title&&i.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+c()},_sanitizeSelector:function(i){return i.replace(/:/g,"\\:")},_cookie:function(){var i=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+e());return a.cookie.apply(null,[i].concat(a.makeArray(arguments)))},_ui:function(i,b){return{tab:i,panel:b,index:this.anchors.index(i)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var i= -a(this);i.html(i.data("label.tabs")).removeData("label.tabs")})},_tabify:function(i){function b(r,u){r.css("display","");!a.support.opacity&&u.opacity&&r[0].style.removeAttribute("filter")}var f=this,j=this.options,l=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=a(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return a("a",this)[0]});this.panels=a([]);this.anchors.each(function(r,u){var v=a(u).attr("href"),w=v.split("#")[0],x;if(w&&(w===location.toString().split("#")[0]|| -(x=a("base")[0])&&w===x.href)){v=u.hash;u.href=v}if(l.test(v))f.panels=f.panels.add(f.element.find(f._sanitizeSelector(v)));else if(v&&v!=="#"){a.data(u,"href.tabs",v);a.data(u,"load.tabs",v.replace(/#.*$/,""));v=f._tabId(u);u.href="#"+v;u=f.element.find("#"+v);if(!u.length){u=a(j.panelTemplate).attr("id",v).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(f.panels[r-1]||f.list);u.data("destroy.tabs",true)}f.panels=f.panels.add(u)}else j.disabled.push(r)});if(i){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); -this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===d){location.hash&&this.anchors.each(function(r,u){if(u.hash==location.hash){j.selected=r;return false}});if(typeof j.selected!=="number"&&j.cookie)j.selected=parseInt(f._cookie(),10);if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)j.selected= -this.lis.index(this.lis.filter(".ui-tabs-selected"));j.selected=j.selected||(this.lis.length?0:-1)}else if(j.selected===null)j.selected=-1;j.selected=j.selected>=0&&this.anchors[j.selected]||j.selected<0?j.selected:0;j.disabled=a.unique(j.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(r){return f.lis.index(r)}))).sort();a.inArray(j.selected,j.disabled)!=-1&&j.disabled.splice(a.inArray(j.selected,j.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); -if(j.selected>=0&&this.anchors.length){f.element.find(f._sanitizeSelector(f.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");f.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[j.selected],f.element.find(f._sanitizeSelector(f.anchors[j.selected].hash))[0]))});this.load(j.selected)}a(window).bind("unload",function(){f.lis.add(f.anchors).unbind(".tabs");f.lis=f.anchors=f.panels=null})}else j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); -this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");j.cookie&&this._cookie(j.selected,j.cookie);i=0;for(var o;o=this.lis[i];i++)a(o)[a.inArray(i,j.disabled)!=-1&&!a(o).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");j.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var n=function(r,u){u.is(":not(.ui-state-disabled)")&&u.addClass("ui-state-"+r)},k=function(r,u){u.removeClass("ui-state-"+ -r)};this.lis.bind("mouseover.tabs",function(){n("hover",a(this))});this.lis.bind("mouseout.tabs",function(){k("hover",a(this))});this.anchors.bind("focus.tabs",function(){n("focus",a(this).closest("li"))});this.anchors.bind("blur.tabs",function(){k("focus",a(this).closest("li"))})}var m,p;if(j.fx)if(a.isArray(j.fx)){m=j.fx[0];p=j.fx[1]}else m=p=j.fx;var q=p?function(r,u){a(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.hide().removeClass("ui-tabs-hide").animate(p,p.duration||"normal", -function(){b(u,p);f._trigger("show",null,f._ui(r,u[0]))})}:function(r,u){a(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.removeClass("ui-tabs-hide");f._trigger("show",null,f._ui(r,u[0]))},s=m?function(r,u){u.animate(m,m.duration||"normal",function(){f.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");b(u,m);f.element.dequeue("tabs")})}:function(r,u){f.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");f.element.dequeue("tabs")}; -this.anchors.bind(j.event+".tabs",function(){var r=this,u=a(r).closest("li"),v=f.panels.filter(":not(.ui-tabs-hide)"),w=f.element.find(f._sanitizeSelector(r.hash));if(u.hasClass("ui-tabs-selected")&&!j.collapsible||u.hasClass("ui-state-disabled")||u.hasClass("ui-state-processing")||f.panels.filter(":animated").length||f._trigger("select",null,f._ui(this,w[0]))===false){this.blur();return false}j.selected=f.anchors.index(this);f.abort();if(j.collapsible)if(u.hasClass("ui-tabs-selected")){j.selected= --1;j.cookie&&f._cookie(j.selected,j.cookie);f.element.queue("tabs",function(){s(r,v)}).dequeue("tabs");this.blur();return false}else if(!v.length){j.cookie&&f._cookie(j.selected,j.cookie);f.element.queue("tabs",function(){q(r,w)});f.load(f.anchors.index(this));this.blur();return false}j.cookie&&f._cookie(j.selected,j.cookie);if(w.length){v.length&&f.element.queue("tabs",function(){s(r,v)});f.element.queue("tabs",function(){q(r,w)});f.load(f.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; -a.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(i){if(typeof i=="string")i=this.anchors.index(this.anchors.filter("[href$="+i+"]"));return i},destroy:function(){var i=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var b= -a.data(this,"href.tabs");if(b)this.href=b;var f=a(this).unbind(".tabs");a.each(["href","load","cache"],function(j,l){f.removeData(l+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});i.cookie&&this._cookie(null,i.cookie);return this},add:function(i, -b,f){if(f===d)f=this.anchors.length;var j=this,l=this.options;b=a(l.tabTemplate.replace(/#\{href\}/g,i).replace(/#\{label\}/g,b));i=!i.indexOf("#")?i.replace("#",""):this._tabId(a("a",b)[0]);b.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var o=j.element.find("#"+i);o.length||(o=a(l.panelTemplate).attr("id",i).data("destroy.tabs",true));o.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(f>=this.lis.length){b.appendTo(this.list);o.appendTo(this.list[0].parentNode)}else{b.insertBefore(this.lis[f]); -o.insertBefore(this.panels[f])}l.disabled=a.map(l.disabled,function(n){return n>=f?++n:n});this._tabify();if(this.anchors.length==1){l.selected=0;b.addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){j._trigger("show",null,j._ui(j.anchors[0],j.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[f],this.panels[f]));return this},remove:function(i){i=this._getIndex(i);var b=this.options,f=this.lis.eq(i).remove(),j=this.panels.eq(i).remove(); -if(f.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(i+(i+1=i?--l:l});this._tabify();this._trigger("remove",null,this._ui(f.find("a")[0],j[0]));return this},enable:function(i){i=this._getIndex(i);var b=this.options;if(a.inArray(i,b.disabled)!=-1){this.lis.eq(i).removeClass("ui-state-disabled");b.disabled=a.grep(b.disabled,function(f){return f!=i});this._trigger("enable",null, -this._ui(this.anchors[i],this.panels[i]));return this}},disable:function(i){i=this._getIndex(i);var b=this.options;if(i!=b.selected){this.lis.eq(i).addClass("ui-state-disabled");b.disabled.push(i);b.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[i],this.panels[i]))}return this},select:function(i){i=this._getIndex(i);if(i==-1)if(this.options.collapsible&&this.options.selected!=-1)i=this.options.selected;else return this;this.anchors.eq(i).trigger(this.options.event+".tabs");return this}, -load:function(i){i=this._getIndex(i);var b=this,f=this.options,j=this.anchors.eq(i)[0],l=a.data(j,"load.tabs");this.abort();if(!l||this.element.queue("tabs").length!==0&&a.data(j,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(i).addClass("ui-state-processing");if(f.spinner){var o=a("span",j);o.data("label.tabs",o.html()).html(f.spinner)}this.xhr=a.ajax(a.extend({},f.ajaxOptions,{url:l,success:function(n,k){b.element.find(b._sanitizeSelector(j.hash)).html(n);b._cleanup();f.cache&&a.data(j, -"cache.tabs",true);b._trigger("load",null,b._ui(b.anchors[i],b.panels[i]));try{f.ajaxOptions.success(n,k)}catch(m){}},error:function(n,k){b._cleanup();b._trigger("load",null,b._ui(b.anchors[i],b.panels[i]));try{f.ajaxOptions.error(n,k,i,j)}catch(m){}}}));b.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, -url:function(i,b){this.anchors.eq(i).removeData("cache.tabs").data("load.tabs",b);return this},length:function(){return this.anchors.length}});a.extend(a.ui.tabs,{version:"1.8.14"});a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(i,b){var f=this,j=this.options,l=f._rotate||(f._rotate=function(o){clearTimeout(f.rotation);f.rotation=setTimeout(function(){var n=j.selected;f.select(++n"),b.open=!0;f.each(function(){a.data(this,e,a.extend({},a.data(this,e)||d,b)),a(this).addClass(X)}),g=b.open,a.isFunction(g)&&(g=g.call(f)),g&&bc(f[0]);return f},W.init=function(){y=a(c),q=Y().attr({id:e,"class":m?f+(n?"IE6":"IE"):""}),p=Y("Overlay",n?"position:absolute":"").hide(),r=Y("Wrapper"),s=Y("Content").append(z=Y("LoadedContent","width:0; height:0; overflow:hidden"),B=Y("LoadingOverlay").add(Y("LoadingGraphic")),C=Y("Title"),D=Y("Current"),F=Y("Next"),G=Y("Previous"),E=Y("Slideshow").bind(g,bb),H=Y("Close")),r.append(Y().append(Y("TopLeft"),t=Y("TopCenter"),Y("TopRight")),Y(!1,"clear:left").append(u=Y("MiddleLeft"),s,v=Y("MiddleRight")),Y(!1,"clear:left").append(Y("BottomLeft"),w=Y("BottomCenter"),Y("BottomRight"))).children().children().css({"float":"left"}),A=Y(!1,"position:absolute; width:9999px; visibility:hidden; display:none"),a("body").prepend(p,q.append(r,A)),s.children().hover(function(){a(this).addClass("hover")},function(){a(this).removeClass("hover")}).addClass("hover"),K=t.height()+w.height()+s.outerHeight(!0)-s.height(),L=u.width()+v.width()+s.outerWidth(!0)-s.width(),M=z.outerHeight(!0),N=z.outerWidth(!0),q.css({"padding-bottom":K,"padding-right":L}).hide(),F.click(function(){W.next()}),G.click(function(){W.prev()}),H.click(function(){W.close()}),I=F.add(G).add(D).add(E),s.children().removeClass("hover"),p.click(function(){J.overlayClose&&W.close()}),a(b).bind("keydown."+f,function(a){var b=a.keyCode;R&&J.escKey&&b===27&&(a.preventDefault(),W.close()),R&&J.arrowKey&&x[1]&&(b===37?(a.preventDefault(),G.click()):b===39&&(a.preventDefault(),F.click()))})},W.remove=function(){q.add(p).remove(),a("."+X).removeData(e).removeClass(X)},W.position=function(a,c){function g(a){t[0].style.width=w[0].style.width=s[0].style.width=a.style.width,B[0].style.height=B[1].style.height=s[0].style.height=u[0].style.height=v[0].style.height=a.style.height}var d,e=0,f=0;q.hide(),J.fixed&&!n?q.css({position:"fixed"}):(e=y.scrollTop(),f=y.scrollLeft(),q.css({position:"absolute"})),J.right!==!1?f+=Math.max(y.width()-J.w-N-L-Z(J.right,"x"),0):J.left!==!1?f+=Z(J.left,"x"):f+=Math.max(y.width()-J.w-N-L,0)/2,J.bottom!==!1?e+=Math.max(b.documentElement.clientHeight-J.h-M-K-Z(J.bottom,"y"),0):J.top!==!1?e+=Z(J.top,"y"):e+=Math.max(b.documentElement.clientHeight-J.h-M-K,0)/2,q.show(),d=q.width()===J.w+N&&q.height()===J.h+M?0:a,r[0].style.width=r[0].style.height="9999px",q.dequeue().animate({width:J.w+N,height:J.h+M,top:e,left:f},{duration:d,complete:function(){g(this),S=!1,r[0].style.width=J.w+N+L+"px",r[0].style.height=J.h+M+K+"px",c&&c()},step:function(){g(this)}})},W.resize=function(a){if(R){a=a||{},a.width&&(J.w=Z(a.width,"x")-N-L),a.innerWidth&&(J.w=Z(a.innerWidth,"x")),z.css({width:J.w}),a.height&&(J.h=Z(a.height,"y")-M-K),a.innerHeight&&(J.h=Z(a.innerHeight,"y"));if(!a.innerHeight&&!a.height){var b=z.wrapInner("
    ").children();J.h=b.height(),b.replaceWith(b.children())}z.css({height:J.h}),W.position(J.transition==="none"?0:J.speed)}},W.prep=function(b){function h(b){W.position(b,function(){function o(){m&&q[0].style.removeAttribute("filter")}var b,d,g,h,j=x.length,k,n;!R||(n=function(){clearTimeout(V),B.hide(),ba(i,J.onComplete)},m&&Q&&z.fadeIn(100),C.html(J.title).add(z).show(),j>1?(typeof J.current=="string"&&D.html(J.current.replace(/\{current\}/,P+1).replace(/\{total\}/,j)).show(),F[J.loop||P")[0].src=h),$(d)&&(a("")[0].src=d))):I.hide(),J.iframe?(k=a("